Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:methscopolamine
go back to main search page
Accession:CHEBI:135361 term browser browse the term
Synonyms:related_synonym: Formula=C18H24NO4;   InChI=1S/C18H24NO4/c1-19(2)14-8-12(9-15(19)17-16(14)23-17)22-18(21)13(10-20)11-6-4-3-5-7-11/h3-7,12-17,20H,8-10H2,1-2H3/q+1/t12-,13-,14-,15+,16-,17+/m1/s1;   InChIKey=LZCOQTDXKCNBEE-IKIFYQGPSA-N;   N-Methylhyoscine;   N-Methylscopolamine;   SMILES=C[N+]1(C)[C@@H]2[C@H]3[C@@H]([C@H]1C[C@H](C2)OC([C@H](CO)C4=CC=CC=C4)=O)O3;   methscopolamine bromide;   methscopolamine nitrate;   methylscopolamine;   methylscopolamine bromide
 xref: CAS:13265-10-6;   Drug_Central:1757;   HMDB:HMDB0014605
 xref_mesh: MESH:D019832


show annotations for term's descendants           Sort by:
 
methscopolamine term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Chrm1 cholinergic receptor, muscarinic 1 multiple interactions
affects binding
ISO
EXP
brucine analog affects the reaction [N-Methylscopolamine binds to CHRM1 protein]; brucine N-oxide promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]; Crotalid Venoms inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; Gallamine Triethiodide inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; KT 5720 promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]; KT 5823 promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]; N-Methylscopolamine affects the reaction [muscarinic toxin 7 binds to CHRM1 protein]; Pancuronium inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; Pipecuronium inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; Pirenzepine inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; rocuronium inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; Staurosporine affects the reaction [KT 5720 promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]]; staurosporine aglycone promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]; Staurosporine promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]; Vecuronium Bromide inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; WIN 51708 inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; WIN 62577 inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]
CHRM1 protein binds to N-Methylscopolamine; N-Methylscopolamine binds to CHRM1 protein
Pilocarpine inhibits the reaction [N-Methylscopolamine binds to CHRM1 protein]; Pilocarpine promotes the reaction [N-Methylscopolamine binds to CHRM1 protein]
CTD PMID:9224827 PMID:9495826 PMID:9846649 PMID:10069518 PMID:10845706 PMID:10860942 PMID:14559291 PMID:16137708 PMID:16439611 PMID:16709648 NCBI chr 1:224,869,087...224,885,101
Ensembl chr 1:224,882,439...224,884,205
JBrowse link
G Chrm2 cholinergic receptor, muscarinic 2 multiple interactions
affects binding
ISO
EXP
[CHRM2 protein binds to dimethyl-W84] affects the reaction [CHRM2 protein binds to N-Methylscopolamine]; [CHRM2 protein binds to Gallamine Triethiodide] affects the reaction [CHRM2 protein binds to N-Methylscopolamine]; [CHRM2 protein binds to Gallamine Triethiodide] promotes the reaction [CHRM2 protein binds to N-Methylscopolamine]; brucine analog affects the reaction [N-Methylscopolamine binds to CHRM2 protein]; brucine N-oxide promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; brucine promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; Crotalid Venoms inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; Gallamine Triethiodide inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; KT 5720 promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; KT 5823 promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; methoctramine inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; N-chloromethylbrucine promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; Pancuronium inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; Pipecuronium inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; rocuronium inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]; Staurosporine promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; Strychnine promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]; Vecuronium Bromide inhibits the reaction [N-Methylscopolamine binds to CHRM2 protein]
CHRM2 protein binds to N-Methylscopolamine; N-Methylscopolamine binds to CHRM2 protein
Pilocarpine promotes the reaction [N-Methylscopolamine binds to CHRM2 protein]
CTD PMID:9224827 PMID:9495826 PMID:9846649 PMID:10069518 PMID:10845706 PMID:10860942 PMID:14559291 PMID:15647330 PMID:15937215 PMID:16641315 NCBI chr 4:64,089,028...64,091,090
Ensembl chr 4:64,088,900...64,091,090
JBrowse link
G Chrm3 cholinergic receptor, muscarinic 3 multiple interactions
affects binding
ISO
EXP
4-diphenylacetoxy-1,1-dimethylpiperidinium inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; brucine analog affects the reaction [N-Methylscopolamine binds to CHRM3 protein]; Carbachol inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; Gallamine Triethiodide inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; Guanylyl Imidodiphosphate inhibits the reaction [Carbachol inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]]; Pancuronium inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; Pipecuronium inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; rocuronium inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; Vecuronium Bromide inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]; Zinc Oxide promotes the reaction [Carbachol inhibits the reaction [N-Methylscopolamine binds to CHRM3 protein]]
CHRM3 protein binds to N-Methylscopolamine; N-Methylscopolamine binds to CHRM3 protein
CTD PMID:9224827 PMID:9846649 PMID:10069518 PMID:12435818 PMID:15647330 PMID:20708676 NCBI chr17:63,990,599...64,463,222
Ensembl chr17:63,990,599...63,994,169
JBrowse link
G Chrm4 cholinergic receptor, muscarinic 4 affects binding
multiple interactions
ISO CHRM4 protein binds to N-Methylscopolamine; N-Methylscopolamine binds to CHRM4 protein
brucine analog affects the reaction [N-Methylscopolamine binds to CHRM4 protein]; Gallamine Triethiodide inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; Pancuronium inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; Pipecuronium inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; rocuronium inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; Strychnine promotes the reaction [N-Methylscopolamine binds to CHRM4 protein]; Tropicamide inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; Vecuronium Bromide inhibits the reaction [N-Methylscopolamine binds to CHRM4 protein]; WIN 51708 promotes the reaction [N-Methylscopolamine binds to CHRM4 protein]
CTD PMID:9224827 PMID:9495826 PMID:9846649 PMID:10069518 PMID:16709648 NCBI chr 3:80,833,272...80,841,165
Ensembl chr 3:80,833,272...80,841,006
JBrowse link
G Chrm5 cholinergic receptor, muscarinic 5 multiple interactions
affects binding
ISO 4-diphenylacetoxy-1,1-dimethylpiperidinium inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; [CHRM5 protein binds to dimethyl-W84] affects the reaction [CHRM5 protein binds to N-Methylscopolamine]; [CHRM5 protein binds to Gallamine Triethiodide] affects the reaction [CHRM5 protein binds to N-Methylscopolamine]; [CHRM5 protein binds to Gallamine Triethiodide] promotes the reaction [CHRM5 protein binds to N-Methylscopolamine]; brucine N-oxide promotes the reaction [N-Methylscopolamine binds to CHRM5 protein]; Crotalid Venoms inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Gallamine Triethiodide inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; methoctramine inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Pancuronium inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Pipecuronium inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Pirenzepine inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Rocuronium inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Tropicamide inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]; Vecuronium Bromide inhibits the reaction [N-Methylscopolamine binds to CHRM5 protein]
CHRM5 protein binds to N-Methylscopolamine; N-Methylscopolamine binds to CHRM5 protein
CTD PMID:9495826 PMID:9846649 PMID:10845706 PMID:15937215 PMID:16641315 NCBI chr 3:103,966,451...104,018,815
Ensembl chr 3:103,966,451...104,018,861
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19771
    chemical entity 19771
      molecular entity 19770
        polyatomic entity 19688
          heteroatomic molecular entity 19619
            hydroxides 19076
              organic hydroxy compound 18659
                hydroxy carboxylic acid 3617
                  3-hydroxy carboxylic acid 489
                    methscopolamine 5
Path 2
Term Annotations click to browse term
  CHEBI ontology 19771
    subatomic particle 19770
      composite particle 19770
        hadron 19770
          baryon 19770
            nucleon 19770
              atomic nucleus 19770
                atom 19770
                  main group element atom 19658
                    p-block element atom 19658
                      carbon group element atom 19574
                        carbon atom 19564
                          organic molecular entity 19564
                            organic group 18599
                              organic divalent group 18590
                                organodiyl group 18590
                                  carbonyl group 18505
                                    carbonyl compound 18505
                                      carboxylic acid 18157
                                        hydroxy carboxylic acid 3617
                                          3-hydroxy carboxylic acid 489
                                            methscopolamine 5
paths to the root