Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   
Pathways

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:salvianolic acid B
go back to main search page
Accession:CHEBI:134301 term browser browse the term
Definition:A member of the class of 1-benzofurans that is an antioxidant and free radical scavenging compound extracted from S. miltiorrhiza
Synonyms:exact_synonym: (2R)-2-({(2E)-3-[(2S,3S)-3-{[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl}-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl}oxy)-3-(3,4-dihydroxyphenyl)propanoic acid
 related_synonym: Dan Shen Suan B;   Danfensuan B;   Formula=C36H30O16;   InChI=1S/C36H30O16/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48)/b10-5+/t27-,28?,31-,32+/m1/s1;   InChIKey=SNKFFCBZYFGCQN-VWUOOIFGSA-N;   Lithospermate B;   Lithospermic acid B;   SMILES=OC(=O)[C@@H](CC1=CC(O)=C(O)C=C1)OC(=O)\\C=C\\C1=C2[C@@H]([C@H](OC2=C(O)C=C1)C1=CC(O)=C(O)C=C1)C(=O)O[C@H](CC1=CC(O)=C(O)C=C1)C(O)=O
 xref: CAS:121521-90-2;   FooDB:FDB030001;   KNApSAcK:C00031982
 xref_mesh: MESH:C076944
 xref: PMID:1414377;   PMID:16933885;   PMID:27278104;   PMID:27424655;   PMID:27442887;   PMID:27484287;   PMID:27490455;   PMID:27497919;   PMID:27507327;   PMID:27513569;   PMID:27557491;   PMID:27569393;   PMID:27586425;   PMID:27592492;   PMID:27614127;   PMID:27670752;   PMID:27716647;   PMID:27779641;   PMID:27827892;   PMID:27843313;   PMID:27852325;   PMID:27893819;   PMID:27941340;   PMID:27973422;   PMID:27989594;   PMID:28000873;   PMID:28072989;   PMID:28116660;   PMID:28178753;   PMID:28211114;   PMID:28214521;   PMID:28244648;   PMID:28251987;   PMID:28254683;   Pubchem:6441188;   Reaxys:8182741



show annotations for term's descendants           Sort by:
salvianolic acid B term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Acta2 actin alpha 2, smooth muscle multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of ACTA2 protein]; salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of ACTA2 protein]
salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of ACTA2 protein]]; salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased expression of ACTA2 protein]
CTD PMID:19822164 PMID:33290806 NCBI chr 1:231,746,527...231,759,307
Ensembl chr 1:231,746,548...231,759,554
JBrowse link
G Akt1 AKT serine/threonine kinase 1 multiple interactions
increases phosphorylation
EXP 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [salvianolic acid B results in increased phosphorylation of AKT1 protein] CTD PMID:22545124 NCBI chr 6:131,713,716...131,735,319
Ensembl chr 6:131,713,720...131,733,921
JBrowse link
G Bax BCL2 associated X, apoptosis regulator multiple interactions EXP
ISO
2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [salvianolic acid B inhibits the reaction [Arsenic Trioxide results in increased expression of BAX protein]]; salvianolic acid B inhibits the reaction [Arsenic Trioxide results in increased expression of BAX protein]; salvianolic acid B inhibits the reaction [Cisplatin results in increased expression of BAX protein]; salvianolic acid B inhibits the reaction [Doxorubicin results in increased expression of BAX protein] CTD PMID:23201927 PMID:28495616 PMID:33952797 NCBI chr 1:95,940,001...95,945,407
Ensembl chr 1:95,938,808...95,945,368
JBrowse link
G Bcl2 BCL2, apoptosis regulator multiple interactions
increases expression
EXP 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [salvianolic acid B inhibits the reaction [arsenic trioxide results in decreased expression of BCL2 protein]]; salvianolic acid B inhibits the reaction [arsenic trioxide results in decreased expression of BCL2 protein]; salvianolic acid B inhibits the reaction [Doxorubicin results in decreased expression of BCL2 protein]
salvianolic acid B results in increased expression of BCL2 protein
CTD PMID:23201927 PMID:28495616 NCBI chr13:22,689,783...22,853,920
Ensembl chr13:22,684,989...22,853,743
Ensembl chr13:22,684,989...22,853,743
JBrowse link
G Bcl2l1 Bcl2-like 1 multiple interactions
increases expression
EXP 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [salvianolic acid B inhibits the reaction [arsenic trioxide results in decreased expression of BCL2L1 protein]]; salvianolic acid B inhibits the reaction [arsenic trioxide results in decreased expression of BCL2L1 protein]; salvianolic acid B inhibits the reaction [Ethanol results in decreased expression of BCL2L1 protein]
salvianolic acid B results in increased expression of BCL2L1 protein
CTD PMID:23201927 PMID:24769256 NCBI chr 3:141,253,508...141,304,582
Ensembl chr 3:141,253,523...141,303,479
JBrowse link
G Bdnf brain-derived neurotrophic factor increases expression
multiple interactions
ISO salvianolic acid B results in increased expression of BDNF protein
salvianolic acid B inhibits the reaction [1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine results in decreased expression of BDNF protein]
CTD PMID:24991814 NCBI chr 3:96,165,042...96,215,621
Ensembl chr 3:96,165,042...96,215,615
JBrowse link
G Casp3 caspase 3 multiple interactions EXP 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one inhibits the reaction [salvianolic acid B inhibits the reaction [arsenic trioxide results in increased activity of CASP3 protein]]; salvianolic acid B inhibits the reaction [arsenic trioxide results in increased activity of CASP3 protein]; salvianolic acid B inhibits the reaction [Doxorubicin results in increased cleavage of CASP3 protein]; salvianolic acid B inhibits the reaction [Ethanol results in increased cleavage of CASP3 protein] CTD PMID:23201927 PMID:24769256 PMID:28495616 NCBI chr16:45,662,910...45,681,171
Ensembl chr16:45,662,910...45,684,648
JBrowse link
G Cdkn1a cyclin-dependent kinase inhibitor 1A multiple interactions ISO salvianolic acid B inhibits the reaction [Diethylnitrosamine results in decreased expression of CDKN1A protein]; salvianolic acid B inhibits the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in decreased expression of CDKN1A protein]]
salvianolic acid B affects the reaction [TGFB1 protein affects the reaction [SMAD3 protein mutant form affects the expression of CDKN1A protein]]
CTD PMID:33290806 NCBI chr20:7,149,177...7,159,727
Ensembl chr20:7,149,217...7,159,585
JBrowse link
G Col1a2 collagen type I alpha 2 chain multiple interactions EXP salvianolic acid B inhibits the reaction [TGFB1 protein results in increased expression of COL1A2 mRNA] CTD PMID:19474275 NCBI chr 4:32,563,938...32,598,868
Ensembl chr 4:32,563,381...32,598,867
JBrowse link
G Crp C-reactive protein multiple interactions
decreases expression
EXP
ISO
salvianolic acid B inhibits the reaction [Ethanol results in increased expression of CRP mRNA]; salvianolic acid B inhibits the reaction [Ethanol results in increased expression of CRP protein]
salvianolic acid B results in decreased expression of CRP protein
salvianolic acid B inhibits the reaction [Ethanol results in increased expression of CRP protein]; SIRT1 protein affects the reaction [salvianolic acid B results in decreased expression of CRP protein]
CTD PMID:27989594 NCBI chr13:85,135,384...85,175,178
Ensembl chr13:85,124,977...85,175,178
JBrowse link
G Cybb cytochrome b-245 beta chain multiple interactions EXP salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of CYBB protein]; salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of CYBB protein] CTD PMID:19822164 NCBI chr  X:13,358,101...13,392,570
Ensembl chr  X:13,359,430...13,392,586
JBrowse link
G Cyp2e1 cytochrome P450, family 2, subfamily e, polypeptide 1 multiple interactions EXP salvianolic acid B inhibits the reaction [Ethanol results in increased expression of CYP2E1 protein] CTD PMID:27989594 NCBI chr 1:195,840,330...195,850,728
Ensembl chr 1:195,840,058...195,864,023
JBrowse link
G Ddit3 DNA-damage inducible transcript 3 multiple interactions EXP salvianolic acid B inhibits the reaction [Doxorubicin results in increased expression of DDIT3 protein] CTD PMID:28495616 NCBI chr 7:63,115,645...63,121,203
Ensembl chr 7:63,116,380...63,121,201
JBrowse link
G Gdnf glial cell derived neurotrophic factor increases expression
increases secretion
multiple interactions
ISO salvianolic acid B results in increased expression of GDNF mRNA
salvianolic acid B results in increased secretion of GDNF protein
NFE2L2 protein affects the reaction [salvianolic acid B results in increased expression of GDNF mRNA]; NFE2L2 protein affects the reaction [salvianolic acid B results in increased secretion of GDNF protein]
CTD PMID:24991814 NCBI chr 2:56,894,022...56,919,935
Ensembl chr 2:56,895,010...56,917,209
JBrowse link
G Gpt glutamic--pyruvic transaminase multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [Ethanol results in increased activity of GPT protein]; salvianolic acid B inhibits the reaction [Ethanol results in increased expression of GPT protein]
salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of GPT protein]]; salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased expression of GPT protein]
CTD PMID:24769256 PMID:27989594 PMID:33290806 NCBI chr 7:108,416,646...108,419,495
Ensembl chr 7:108,416,642...108,419,494
JBrowse link
G Gstp1 glutathione S-transferase pi 1 multiple interactions ISO salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of GSTP1 protein]] CTD PMID:33290806 NCBI chr 1:201,337,762...201,340,230
Ensembl chr 1:201,321,672...201,340,226
JBrowse link
G Hmox1 heme oxygenase 1 multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [Cisplatin results in decreased expression of HMOX1 mRNA] CTD PMID:33952797 NCBI chr19:13,466,287...13,474,082
Ensembl chr19:13,467,244...13,474,079
JBrowse link
G Hnf1a HNF1 homeobox A multiple interactions ISO salvianolic acid B inhibits the reaction [Ethanol results in decreased expression of HNF1A protein] CTD PMID:27989594 NCBI chr12:41,638,536...41,672,806
Ensembl chr12:41,645,587...41,672,104
JBrowse link
G Hspa5 heat shock protein family A (Hsp70) member 5 multiple interactions EXP salvianolic acid B inhibits the reaction [Doxorubicin results in increased expression of HSPA5 protein] CTD PMID:28495616 NCBI chr 3:18,055,507...18,059,969
Ensembl chr 3:18,055,405...18,059,891
JBrowse link
G Il1b interleukin 1 beta multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of IL1B protein]
NFE2L2 protein affects the reaction [salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of IL1B protein]]; salvianolic acid B inhibits the reaction [1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine results in increased expression of IL1B protein]; salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of IL1B protein]
CTD PMID:19822164 PMID:24991814 NCBI chr 3:116,577,005...116,583,386
Ensembl chr 3:116,577,010...116,583,415
JBrowse link
G Il6 interleukin 6 multiple interactions EXP salvianolic acid B inhibits the reaction [Ethanol results in increased expression of IL6 protein]; salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of IL6 protein] CTD PMID:19822164 PMID:24769256 PMID:27989594 NCBI chr 4:5,214,602...5,219,178
Ensembl chr 4:5,213,394...5,219,178
JBrowse link
G Mlxipl MLX interacting protein-like multiple interactions EXP salvianolic acid B inhibits the reaction [Ethanol results in increased expression of MLXIPL mRNA]; salvianolic acid B inhibits the reaction [Ethanol results in increased expression of MLXIPL protein]; SIRT1 protein affects the reaction [salvianolic acid B inhibits the reaction [Ethanol results in increased expression of MLXIPL protein]] CTD PMID:27989594 NCBI chr12:21,541,608...21,577,120
Ensembl chr12:21,543,576...21,577,112
JBrowse link
G Myc MYC proto-oncogene, bHLH transcription factor multiple interactions ISO salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased expression of MYC protein]; salvianolic acid B inhibits the reaction [SMAD3 protein mutant form affects the reaction [Diethylnitrosamine results in increased expression of MYC protein]]; SMAD3 protein modified form affects the reaction [salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased expression of MYC protein]] CTD PMID:33290806 NCBI chr 7:93,593,705...93,598,633
Ensembl chr 7:93,593,705...93,598,630
JBrowse link
G Ncf1 neutrophil cytosolic factor 1 multiple interactions EXP salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of NCF1 protein] CTD PMID:19822164 NCBI chr12:22,485,382...22,494,647
Ensembl chr12:22,485,451...22,494,646
JBrowse link
G Nfe2l2 NFE2 like bZIP transcription factor 2 multiple interactions
increases expression
ISO
EXP
NFE2L2 protein affects the reaction [salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of IL1B protein]]; NFE2L2 protein affects the reaction [salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of TNF protein]]; NFE2L2 protein affects the reaction [salvianolic acid B results in increased expression of GDNF mRNA]; NFE2L2 protein affects the reaction [salvianolic acid B results in increased secretion of GDNF protein]; salvianolic acid B inhibits the reaction [1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine results in decreased expression of NFE2L2 protein]; salvianolic acid B inhibits the reaction [Cisplatin results in decreased expression of NFE2L2 protein]; salvianolic acid B results in increased secretion of and affects the localization of NFE2L2 protein
salvianolic acid B results in increased expression of NFE2L2 protein
CTD PMID:24991814 PMID:33952797 NCBI chr 3:60,594,239...60,621,712
Ensembl chr 3:60,594,242...60,621,737
JBrowse link
G Nos2 nitric oxide synthase 2 multiple interactions EXP salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of NOS2 protein] CTD PMID:19822164 NCBI chr10:63,815,308...63,851,208
Ensembl chr10:63,815,308...63,851,210
JBrowse link
G Nqo1 NAD(P)H quinone dehydrogenase 1 multiple interactions ISO
EXP
salvianolic acid B inhibits the reaction [Cisplatin results in decreased expression of NQO1 mRNA] CTD PMID:33952797 NCBI chr19:35,295,633...35,310,528
Ensembl chr19:35,295,573...35,310,557
JBrowse link
G Pdgfb platelet derived growth factor subunit B multiple interactions EXP salvianolic acid B inhibits the reaction [PDGFB protein results in increased abundance of Hydrogen Peroxide]; salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of ACTA2 protein]; salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of CYBB protein]; salvianolic acid B inhibits the reaction [PDGFB protein results in increased expression of NCF1 protein] CTD PMID:19822164 NCBI chr 7:111,539,444...111,557,984
Ensembl chr 7:111,540,345...111,557,984
JBrowse link
G Ppargc1a PPARG coactivator 1 alpha multiple interactions EXP salvianolic acid B inhibits the reaction [Ethanol results in increased acetylation of PPARGC1A protein] CTD PMID:24769256 NCBI chr14:58,860,752...59,516,525
Ensembl chr14:58,861,144...59,512,656
JBrowse link
G Serpine1 serpin family E member 1 multiple interactions ISO salvianolic acid B affects the reaction [Diethylnitrosamine affects the expression of SERPINE1 protein]; salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine affects the expression of SERPINE1 protein]]; salvianolic acid B affects the reaction [SMAD3 protein mutant form affects the reaction [Diethylnitrosamine affects the expression of SERPINE1 protein]] CTD PMID:33290806 NCBI chr12:19,601,272...19,611,657
Ensembl chr12:19,601,272...19,611,657
JBrowse link
G Sirt1 sirtuin 1 increases expression
multiple interactions
ISO
EXP
salvianolic acid B results in increased expression of SIRT1 protein
salvianolic acid B inhibits the reaction [Ethanol results in decreased expression of SIRT1 mRNA]; salvianolic acid B inhibits the reaction [Ethanol results in decreased expression of SIRT1 protein]; SIRT1 protein affects the reaction [salvianolic acid B inhibits the reaction [Ethanol results in increased expression of MLXIPL protein]]
salvianolic acid B inhibits the reaction [Ethanol results in decreased expression of SIRT1 protein]; SIRT1 protein affects the reaction [salvianolic acid B results in decreased expression of CRP protein]
CTD PMID:24769256 PMID:27989594 NCBI chr20:25,307,225...25,329,273
Ensembl chr20:25,306,917...25,329,260
JBrowse link
G Smad3 SMAD family member 3 multiple interactions
affects response to substance
ISO salvianolic acid B affects the reaction [Diethylnitrosamine results in decreased expression of SMAD3 protein modified form]; salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine affects the expression of SERPINE1 protein]]; salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of ACTA2 protein]]; salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of GPT protein]]; salvianolic acid B affects the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased expression of GSTP1 protein]]; salvianolic acid B affects the reaction [SMAD3 protein mutant form affects the reaction [Diethylnitrosamine affects the expression of SERPINE1 protein]]; salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased phosphorylation of SMAD3 protein]; salvianolic acid B inhibits the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in decreased expression of CDKN1A protein]]; salvianolic acid B inhibits the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in decreased expression of SMAD3 protein modified form]]; salvianolic acid B inhibits the reaction [SMAD3 protein modified form affects the reaction [Diethylnitrosamine results in increased phosphorylation of SMAD3 protein]]; salvianolic acid B inhibits the reaction [SMAD3 protein mutant form affects the reaction [Diethylnitrosamine results in increased expression of MYC protein]]; SMAD3 protein modified form affects the reaction [salvianolic acid B inhibits the reaction [Diethylnitrosamine results in increased expression of MYC protein]]
SMAD3 protein modified form affects the susceptibility to salvianolic acid B
salvianolic acid B affects the reaction [TGFB1 protein affects the reaction [SMAD3 protein mutant form affects the expression of CDKN1A protein]]
CTD PMID:33290806 NCBI chr 8:64,126,829...64,236,960
Ensembl chr 8:64,110,039...64,236,960
JBrowse link
G Sod2 superoxide dismutase 2 multiple interactions EXP salvianolic acid B inhibits the reaction [Ethanol results in increased expression of SOD2 protein] CTD PMID:24769256 NCBI chr 1:47,638,318...47,645,163
Ensembl chr 1:47,636,528...47,645,189
JBrowse link
G Tgfb1 transforming growth factor, beta 1 multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [Dimethylnitrosamine results in increased expression of TGFB1 protein]; salvianolic acid B inhibits the reaction [TGFB1 protein results in increased expression of COL1A2 mRNA]
salvianolic acid B affects the reaction [TGFB1 protein affects the reaction [SMAD3 protein mutant form affects the expression of CDKN1A protein]]
CTD PMID:16009107 PMID:19474275 PMID:33290806 NCBI chr 1:81,196,532...81,212,848
Ensembl chr 1:81,196,532...81,212,847
JBrowse link
G Tgfbr1 transforming growth factor, beta receptor 1 multiple interactions EXP salvianolic acid B inhibits the reaction [Dimethylnitrosamine results in increased expression of TGFBR1 protein] CTD PMID:16009107 NCBI chr 5:61,653,773...61,710,777
Ensembl chr 5:61,653,233...61,710,777
JBrowse link
G Tgfbr2 transforming growth factor, beta receptor 2 multiple interactions EXP salvianolic acid B inhibits the reaction [Dimethylnitrosamine results in increased expression of TGFBR2 protein] CTD PMID:16009107 NCBI chr 8:115,794,537...115,883,615
Ensembl chr 8:115,794,537...115,883,228
JBrowse link
G Tlr4 toll-like receptor 4 multiple interactions EXP salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased expression of TLR4 mRNA]; salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased expression of TLR4 protein] CTD PMID:22101700 NCBI chr 5:80,145,867...80,159,501
Ensembl chr 5:80,145,826...80,159,628
JBrowse link
G Tnf tumor necrosis factor multiple interactions EXP
ISO
salvianolic acid B inhibits the reaction [Ethanol results in increased expression of TNF protein]; salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased expression of TNF protein]; salvianolic acid B inhibits the reaction [Thioacetamide results in increased expression of TNF protein]
NFE2L2 protein affects the reaction [salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of TNF protein]]; salvianolic acid B inhibits the reaction [1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine results in increased expression of TNF protein]; salvianolic acid B inhibits the reaction [Lipopolysaccharides results in increased secretion of TNF protein]
CTD PMID:19822164 PMID:22101700 PMID:24769256 PMID:24991814 PMID:27989594 NCBI chr20:3,622,011...3,624,629
Ensembl chr20:3,622,011...3,624,629
JBrowse link
G Tp53 tumor protein p53 decreases acetylation
multiple interactions
ISO
EXP
salvianolic acid B results in decreased acetylation of TP53 protein
salvianolic acid B inhibits the reaction [Ethanol results in increased acetylation of TP53 protein]
CTD PMID:24769256 NCBI chr10:54,300,070...54,311,525
Ensembl chr10:54,300,048...54,311,524
JBrowse link
G Trpc3 transient receptor potential cation channel, subfamily C, member 3 multiple interactions EXP salvianolic acid B inhibits the reaction [Doxorubicin results in increased expression of TRPC3 protein] CTD PMID:28495616 NCBI chr 2:119,481,313...119,619,333
Ensembl chr 2:119,481,400...119,558,855
JBrowse link
G Trpc6 transient receptor potential cation channel, subfamily C, member 6 multiple interactions EXP salvianolic acid B inhibits the reaction [Doxorubicin results in increased expression of TRPC6 protein] CTD PMID:28495616 NCBI chr 8:5,759,387...5,864,000
Ensembl chr 8:5,758,935...5,828,092
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19900
    role 19875
      chemical role 19497
        antioxidant 16054
          salvianolic acid B 41
Path 2
Term Annotations click to browse term
  CHEBI ontology 19900
    subatomic particle 19898
      composite particle 19898
        hadron 19898
          baryon 19898
            nucleon 19898
              atomic nucleus 19898
                atom 19898
                  main group element atom 19845
                    p-block element atom 19845
                      carbon group element atom 19792
                        carbon atom 19787
                          organic molecular entity 19787
                            organic group 18957
                              organic divalent group 18938
                                organodiyl group 18938
                                  carbonyl group 18890
                                    carbonyl compound 18890
                                      carboxylic ester 16140
                                        alpha,beta-unsaturated carboxylic ester 2158
                                          enoate ester 2158
                                            salvianolic acid B 41
paths to the root