Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:3,3',5,5'-tetraiodothyroacetic acid
go back to main search page
Accession:CHEBI:131194 term browser browse the term
Definition:A monocarboxylic acid that is thyroacetic acid carrying four iodo substituents at positions 3, 3', 5 and 5'.
Synonyms:related_synonym: 3,5-Diiodo-4-(4-hydroxy-3,5-diiodophenoxy)benzeneacetic acid;   Acide 3,5,3',5'-tetraiodothyroacetique;   Formula=C14H8I4O4;   InChI=1S/C14H8I4O4/c15-8-4-7(5-9(16)13(8)21)22-14-10(17)1-6(2-11(14)18)3-12(19)20/h1-2,4-5,21H,3H2,(H,19,20);   InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-N;   SMILES=O(C1=CC(=C(C(=C1)I)O)I)C=2C(=CC(=CC2I)CC(O)=O)I;   Tetrac;   Tetraiodothyroacetic acid
 alt_id: CHEBI:45954
 xref: CAS:67-30-1;   DrugBank:DB01751;   LINCS:LSM-25628
 xref_mesh: MESH:C011126
 xref: MetaCyc:CPD-11403;   PDBeChem:T4A;   PMID:23103412;   PMID:24214887;   PMID:25258542;   PMID:25628605;   PMID:25866761;   PMID:26041883;   PMID:26307023;   PMID:26384643;   PMID:26756636;   Reaxys:2173215


show annotations for term's descendants           Sort by:
 
3,3',5,5'-tetraiodothyroacetic acid term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO
EXP
tetraiodothyroacetic acid inhibits the reaction [Thyroxine results in increased phosphorylation of and results in increased activity of MAPK1 protein]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine results in increased phosphorylation of and results in increased activity of MAPK1 protein]
tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of MAPK1 protein]
CTD PMID:17174366, PMID:17984113 NCBI chr11:88,203,863...88,273,301
Ensembl chr11:88,211,599...88,273,254
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO
EXP
tetraiodothyroacetic acid inhibits the reaction [Thyroxine results in increased phosphorylation of and results in increased activity of MAPK3 protein]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine results in increased phosphorylation of and results in increased activity of MAPK3 protein]
tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of MAPK3 protein]
CTD PMID:17174366, PMID:17984113 NCBI chr 1:198,192,773...198,198,975
Ensembl chr 1:198,192,773...198,198,975
JBrowse link
G Ncoa2 nuclear receptor coactivator 2 multiple interactions ISO tetraiodothyroacetic acid promotes the reaction [THRA protein binds to NCOA2 protein]; tetraiodothyroacetic acid promotes the reaction [THRB protein binds to NCOA2 protein] CTD PMID:31566444 NCBI chr 5:5,466,544...5,696,540
Ensembl chr 5:5,616,483...5,694,598
JBrowse link
G Ncor1 nuclear receptor co-repressor 1 multiple interactions ISO tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR1 protein]] CTD PMID:22227104 NCBI chr10:48,629,121...48,772,890
Ensembl chr10:48,629,121...48,772,890
JBrowse link
G Ncor2 nuclear receptor co-repressor 2 multiple interactions ISO tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR2 protein]] CTD PMID:22227104 NCBI chr12:36,871,917...37,033,701
Ensembl chr12:36,871,999...37,033,701
JBrowse link
G Rxra retinoid X receptor alpha affects binding ISO tetraiodothyroacetic acid binds to RXRA protein CTD PMID:31566444 NCBI chr 3:6,272,560...6,295,354
Ensembl chr 3:6,211,789...6,295,908
JBrowse link
G Thra thyroid hormone receptor alpha multiple interactions ISO tetraiodothyroacetic acid promotes the reaction [THRA protein binds to NCOA2 protein] CTD PMID:31566444 NCBI chr10:86,657,285...86,684,935
Ensembl chr10:86,657,285...86,684,933
JBrowse link
G Thrb thyroid hormone receptor beta multiple interactions
affects binding
increases activity
ISO tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid promotes the reaction [THRB protein binds to NCOA2 protein]
tetraiodothyroacetic acid binds to THRB protein
tetraiodothyroacetic acid results in increased activity of THRB protein
CTD PMID:22227104, PMID:31077750, PMID:31566444 NCBI chr15:8,890,578...9,239,815
Ensembl chr15:8,890,578...9,086,282
JBrowse link
G Tp53 tumor protein p53 multiple interactions EXP tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of TP53 protein modified form] CTD PMID:17984113 NCBI chr10:56,186,299...56,198,449
Ensembl chr10:56,187,020...56,198,449
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 19787
    role 19734
      biological role 19734
        biochemical role 19282
          apoptosis inducer 10895
            3,3',5,5'-tetraiodothyroacetic acid 9
Path 2
Term Annotations click to browse term
  CHEBI ontology 19787
    subatomic particle 19784
      composite particle 19784
        hadron 19784
          baryon 19784
            nucleon 19784
              atomic nucleus 19784
                atom 19784
                  main group element atom 19672
                    p-block element atom 19672
                      carbon group element atom 19574
                        carbon atom 19563
                          organic molecular entity 19563
                            organic group 18495
                              organic divalent group 18488
                                organodiyl group 18488
                                  carbonyl group 18391
                                    carbonyl compound 18391
                                      carboxylic acid 18061
                                        monocarboxylic acid 17407
                                          3,3',5,5'-tetraiodothyroacetic acid 9
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.