Send us a Message



Submit Data |  Help |  Video Tutorials |  News |  Publications |  Download |  REST API |  Citing RGD |  Contact   

CHEBI ONTOLOGY - ANNOTATIONS

The Chemical Entities of Biological Interest (ChEBI) ontology is downloaded weekly from EMBL-EBI at http://www.ebi.ac.uk/chebi/. The data is made available under the Creative Commons License (CC BY 3.0, http://creativecommons.org/licenses/by/3.0/). For more information see: Degtyarenko et al. (2008) ChEBI: a database and ontology for chemical entities of biological interest. Nucleic Acids Res. 36, D344–D350.

Term:3,3',5,5'-tetraiodothyroacetic acid
go back to main search page
Accession:CHEBI:131194 term browser browse the term
Definition:A monocarboxylic acid that is thyroacetic acid carrying four iodo substituents at positions 3, 3', 5 and 5'.
Synonyms:related_synonym: 3,5-Diiodo-4-(4-hydroxy-3,5-diiodophenoxy)benzeneacetic acid;   Acide 3,5,3',5'-tetraiodothyroacetique;   Formula=C14H8I4O4;   InChI=1S/C14H8I4O4/c15-8-4-7(5-9(16)13(8)21)22-14-10(17)1-6(2-11(14)18)3-12(19)20/h1-2,4-5,21H,3H2,(H,19,20);   InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-N;   SMILES=O(C1=CC(=C(C(=C1)I)O)I)C=2C(=CC(=CC2I)CC(O)=O)I;   Tetrac;   Tetraiodothyroacetic acid
 alt_id: CHEBI:45954
 xref: CAS:67-30-1;   DrugBank:DB01751;   LINCS:LSM-25628
 xref_mesh: MESH:C011126
 xref: MetaCyc:CPD-11403;   PDBeChem:T4A;   PMID:23103412;   PMID:24214887;   PMID:25258542;   PMID:25628605;   PMID:25866761;   PMID:26041883;   PMID:26307023;   PMID:26384643;   PMID:26756636;   Reaxys:2173215



show annotations for term's descendants           Sort by:
 
3,3',5,5'-tetraiodothyroacetic acid term browser
Symbol Object Name Qualifiers Evidence Notes Source PubMed Reference(s) RGD Reference(s) Position
G Mapk1 mitogen activated protein kinase 1 multiple interactions ISO
EXP
tetraiodothyroacetic acid inhibits the reaction [Thyroxine results in increased phosphorylation of and results in increased activity of MAPK1 protein]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine results in increased phosphorylation of and results in increased activity of MAPK1 protein]
tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of MAPK1 protein]
CTD PMID:17174366 PMID:17984113 NCBI chr11:83,957,813...84,023,629
Ensembl chr11:83,957,813...84,023,616
JBrowse link
G Mapk3 mitogen activated protein kinase 3 multiple interactions ISO
EXP
tetraiodothyroacetic acid inhibits the reaction [Thyroxine results in increased phosphorylation of and results in increased activity of MAPK3 protein]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine results in increased phosphorylation of and results in increased activity of MAPK3 protein]
tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of MAPK3 protein]
CTD PMID:17174366 PMID:17984113 NCBI chr 1:181,366,646...181,372,863
Ensembl chr 1:181,366,637...181,372,863
JBrowse link
G Ncoa2 nuclear receptor coactivator 2 multiple interactions ISO tetraiodothyroacetic acid promotes the reaction [THRA protein binds to NCOA2 protein]; tetraiodothyroacetic acid promotes the reaction [THRB protein binds to NCOA2 protein] CTD PMID:31566444 NCBI chr 5:5,835,642...6,069,693
Ensembl chr 5:5,835,706...6,067,451
JBrowse link
G Ncor1 nuclear receptor co-repressor 1 multiple interactions ISO tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR1 protein]] CTD PMID:22227104 NCBI chr10:46,999,536...47,142,294
Ensembl chr10:46,999,536...47,141,032
JBrowse link
G Ncor2 nuclear receptor co-repressor 2 multiple interactions ISO tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR2 protein]] CTD PMID:22227104 NCBI chr12:31,466,418...31,628,319
Ensembl chr12:31,466,412...31,628,319
JBrowse link
G Nr1i2 nuclear receptor subfamily 1, group I, member 2 multiple interactions ISO tetraiodothyroacetic acid binds to and results in increased activity of NR1I2 protein CTD PMID:33049310 NCBI chr11:62,460,213...62,496,665
Ensembl chr11:62,460,213...62,496,658
JBrowse link
G Pparg peroxisome proliferator-activated receptor gamma multiple interactions ISO tetraiodothyroacetic acid binds to and results in increased activity of PPARG protein CTD PMID:33049310 NCBI chr 4:148,423,102...148,548,471
Ensembl chr 4:148,423,194...148,548,468
JBrowse link
G Rxra retinoid X receptor alpha affects binding ISO tetraiodothyroacetic acid binds to RXRA protein CTD PMID:31566444 NCBI chr 3:10,989,832...11,076,366
Ensembl chr 3:10,989,832...11,073,712
JBrowse link
G Thra thyroid hormone receptor alpha multiple interactions ISO tetraiodothyroacetic acid binds to and results in increased activity of THRA protein; tetraiodothyroacetic acid promotes the reaction [THRA protein binds to NCOA2 protein] CTD PMID:31566444 PMID:33049310 NCBI chr10:83,701,885...83,729,408
Ensembl chr10:83,700,755...83,729,936
JBrowse link
G Thrb thyroid hormone receptor beta multiple interactions
affects binding
increases activity
ISO tetraiodothyroacetic acid binds to and results in increased activity of THRB protein; tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Thyroxine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR1 protein]]; tetraiodothyroacetic acid inhibits the reaction [Triiodothyronine inhibits the reaction [THRB protein binds to NCOR2 protein]]; tetraiodothyroacetic acid promotes the reaction [THRB protein binds to NCOA2 protein]
tetraiodothyroacetic acid binds to THRB protein
tetraiodothyroacetic acid results in increased activity of THRB protein
CTD PMID:22227104 PMID:31077750 PMID:31566444 PMID:33049310 NCBI chr15:7,685,180...8,031,920
Ensembl chr15:7,685,180...7,882,916
JBrowse link
G Tp53 tumor protein p53 multiple interactions EXP tetraiodothyroacetic acid inhibits the reaction [Thyroxine affects the localization of TP53 protein modified form] CTD PMID:17984113 NCBI chr10:54,300,070...54,311,525
Ensembl chr10:54,300,048...54,311,524
JBrowse link

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 20089
    role 20042
      biological role 20011
        biochemical role 19671
          apoptosis inducer 13408
            3,3',5,5'-tetraiodothyroacetic acid 11
Path 2
Term Annotations click to browse term
  CHEBI ontology 20089
    subatomic particle 20058
      composite particle 20058
        hadron 20088
          baryon 20088
            nucleon 20088
              atomic nucleus 20088
                atom 20058
                  main group element atom 19960
                    p-block element atom 19990
                      carbon group element atom 19916
                        carbon atom 19909
                          organic molecular entity 19909
                            organic group 18988
                              organic divalent group 18950
                                organodiyl group 18974
                                  carbonyl group 18903
                                    carbonyl compound 18925
                                      carboxylic acid 18597
                                        monocarboxylic acid 17843
                                          3,3',5,5'-tetraiodothyroacetic acid 11
paths to the root