Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:126345 term browser browse the term
Definition:An indole that has formula C33H39N5O4.
Synonyms:related_synonym: Formula=C33H39N5O4;   InChI=1S/C33H39N5O4/c1-22-17-38(23(2)21-39)33(41)28-16-26(35-32(40)15-25-19-37(4)29-8-6-5-7-27(25)29)9-10-30(28)42-31(22)20-36(3)18-24-11-13-34-14-12-24/h5-14,16,19,22-23,31,39H,15,17-18,20-21H2,1-4H3,(H,35,40)/t22-,23-,31+/m1/s1;   InChIKey=NHCHRXXZNQAEEO-PKIAKLFDSA-N;   SMILES=C[C@@H]1CN(C(=O)C2=C(C=CC(=C2)NC(=O)CC3=CN(C4=CC=CC=C43)C)O[C@H]1CN(C)CC5=CC=NC=C5)[C@H](C)CO
 xref: LINCS:LSM-37911

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 0
    chemical entity 0
      atom 0
        nonmetal atom 0
          nitrogen atom 0
            nitrogen molecular entity 0
              organonitrogen compound 0
                organonitrogen heterocyclic compound 0
                  benzopyrrole 0
                    indoles 0
                      N-[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(pyridin-4-ylmethyl)amino]methyl]-6-oxo-3,4-dihydro-2H-1,5-benzoxazocin-8-yl]-2-(1-methyl-3-indolyl)acetamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 0
    subatomic particle 0
      composite particle 0
        hadron 0
          baryon 0
            nucleon 0
              atomic nucleus 0
                atom 0
                  main group element atom 0
                    p-block element atom 0
                      carbon group element atom 0
                        carbon atom 0
                          organic molecular entity 0
                            organic molecule 0
                              organic cyclic compound 0
                                organic heterocyclic compound 0
                                  organic heteropolycyclic compound 0
                                    organic heterobicyclic compound 0
                                      benzopyrrole 0
                                        indoles 0
                                          N-[(2R,3R)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-2-[[methyl(pyridin-4-ylmethyl)amino]methyl]-6-oxo-3,4-dihydro-2H-1,5-benzoxazocin-8-yl]-2-(1-methyl-3-indolyl)acetamide 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.