Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   

ONTOLOGY REPORT - ANNOTATIONS


Term:N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-pyrazinecarboxamide
go back to main search page
Accession:CHEBI:120477 term browser browse the term
Definition:A pyrazine that has formula C14H14N4O2S.
Synonyms:related_synonym: Formula=C14H14N4O2S;   InChI=1S/C14H14N4O2S/c15-12(19)11-8-3-1-2-4-10(8)21-14(11)18-13(20)9-7-16-5-6-17-9/h5-7H,1-4H2,(H2,15,19)(H,18,20);   InChIKey=QLVGBOYXFQCZTK-UHFFFAOYSA-N;   SMILES=C1CCC2=C(C1)C(=C(S2)NC(=O)C3=NC=CN=C3)C(=O)N
 xref: LINCS:LSM-31920


show annotations for term's descendants       view all columns           Sort by:
 

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 23805
    chemical entity 23768
      atom 23756
        nonmetal atom 23408
          nitrogen atom 20391
            nitrogen molecular entity 20391
              organonitrogen compound 20098
                carboxamide 18370
                  primary carboxamide 3582
                    N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-pyrazinecarboxamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 23805
    subatomic particle 23756
      composite particle 23756
        hadron 23756
          baryon 23756
            nucleon 23756
              atomic nucleus 23756
                atom 23756
                  main group element atom 23575
                    p-block element atom 23575
                      carbon group element atom 23289
                        carbon atom 23243
                          organic molecular entity 23243
                            organic group 21924
                              organic divalent group 21896
                                organodiyl group 21896
                                  carbonyl group 21868
                                    carbonyl compound 21868
                                      carboxylic acid 20917
                                        carboacyl group 19023
                                          univalent carboacyl group 19023
                                            carbamoyl group 18370
                                              carboxamide 18370
                                                primary carboxamide 3582
                                                  N-(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-pyrazinecarboxamide 0
paths to the root

NHLBI Logo

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.