Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:114864 term browser browse the term
Definition:An organonitrogen compound that has formula C23H28N6O3S2.
Synonyms:related_synonym: Formula=C23H28N6O3S2;   InChI=1S/C23H28N6O3S2/c30-20(15-28-26-22(25-27-28)19-10-5-13-34-19)29(16-6-1-2-7-16)21(18-9-4-12-33-18)23(31)24-14-17-8-3-11-32-17/h4-5,9-10,12-13,16-17,21H,1-3,6-8,11,14-15H2,(H,24,31);   InChIKey=IXVNMHKBGZUMBO-UHFFFAOYSA-N;   SMILES=C1CCC(C1)N(C(C2=CC=CS2)C(=O)NCC3CCCO3)C(=O)CN4N=C(N=N4)C5=CC=CS5
 xref: LINCS:LSM-26326

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 23754
    chemical entity 23717
      atom 23703
        nonmetal atom 23352
          nitrogen atom 20395
            nitrogen molecular entity 20395
              organonitrogen compound 20101
                2-[cyclopentyl-[1-oxo-2-(5-thiophen-2-yl-2-tetrazolyl)ethyl]amino]-N-(2-oxolanylmethyl)-2-thiophen-2-ylacetamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 23754
    subatomic particle 23703
      composite particle 23703
        hadron 23703
          baryon 23703
            nucleon 23703
              atomic nucleus 23703
                atom 23703
                  main group element atom 23522
                    p-block element atom 23522
                      carbon group element atom 23232
                        carbon atom 23208
                          organic molecular entity 23208
                            organic group 21897
                              organic divalent group 21869
                                organodiyl group 21869
                                  carbonyl group 21840
                                    carbonyl compound 21840
                                      carboxylic acid 20885
                                        amino acid 13051
                                          alpha-amino acid 7874
                                            2-[cyclopentyl-[1-oxo-2-(5-thiophen-2-yl-2-tetrazolyl)ethyl]amino]-N-(2-oxolanylmethyl)-2-thiophen-2-ylacetamide 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.