Submit Data |  Help |  Video Tutorials |  News |  Publications |  FTP Download |  REST API |  Citing RGD |  Contact   


go back to main search page
Accession:CHEBI:114336 term browser browse the term
Definition:A pyrazine that has formula C14H14N6O2.
Synonyms:related_synonym: Formula=C14H14N6O2;   InChI=1S/C14H14N6O2/c1-10(8-13(21)18-12-4-2-3-5-17-12)19-20-14(22)11-9-15-6-7-16-11/h2-7,9H,8H2,1H3,(H,20,22)(H,17,18,21);   InChIKey=SHJJUTOOKVCRCT-UHFFFAOYSA-N;   SMILES=CC(=NNC(=O)C1=NC=CN=C1)CC(=O)NC2=CC=CC=N2
 xref: LINCS:LSM-25796

show annotations for term's descendants       view all columns           Sort by:

Term paths to the root
Path 1
Term Annotations click to browse term
  CHEBI ontology 21025
    chemical entity 21023
      atom 21019
        nonmetal atom 20834
          nitrogen atom 18721
            nitrogen molecular entity 18721
              organonitrogen compound 18657
                carboxamide 17153
                  secondary carboxamide 209
                    N-[[4-oxo-4-(2-pyridinylamino)butan-2-ylidene]amino]-2-pyrazinecarboxamide 0
Path 2
Term Annotations click to browse term
  CHEBI ontology 21025
    subatomic particle 21019
      composite particle 21019
        hadron 21019
          baryon 21019
            nucleon 21019
              atomic nucleus 21019
                atom 21019
                  main group element atom 20860
                    p-block element atom 20860
                      carbon group element atom 20601
                        carbon atom 20578
                          organic molecular entity 20578
                            organic group 19174
                              organic divalent group 19164
                                organodiyl group 19164
                                  carbonyl group 19134
                                    carbonyl compound 19134
                                      carboxylic acid 18814
                                        carboacyl group 17452
                                          univalent carboacyl group 17452
                                            carbamoyl group 17153
                                              carboxamide 17153
                                                secondary carboxamide 209
                                                  N-[[4-oxo-4-(2-pyridinylamino)butan-2-ylidene]amino]-2-pyrazinecarboxamide 0
paths to the root


RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.