| Term: | 2,4-dinitrotoluene |
|
| Accession: | CHEBI:920
|
 browse the term
 view annotations
|
| Definition: | A dinitrotoluene in which the methyl group is ortho to one of the nitro groups and para to the other. It is the most common isomer of dinitrotoluene. |
| Synonyms: | exact_synonym: | 1-methyl-2,4-dinitrobenzene |
| | related_synonym: | 2,4-DNT; 2,4-dinitro-1-methylbenzene; 2,4-dinitromethylbenzene; 2,4-dinitrotoluol; C7H6N2O4; Cc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O; DNT; InChI=1S/C7H6N2O4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3; InChIKey=RMBFBMJGBANMMK-UHFFFAOYSA-N |
| | xref_casrn: | 121-14-2 |
| | xref: | ChEMBL:530957 "ChEMBL COMPOUND"; ChemIDplus:121-14-2 "CAS Registry Number"; KEGG COMPOUND:121-14-2 "CAS Registry Number"; KEGG COMPOUND:C11006 "KEGG COMPOUND" |
| | xref_mesh: | MESH:C016403 |
| | xref: | NIST Chemistry WebBook:121-14-2 "CAS Registry Number"; Wikipedia:2\,4-Dinitrotoluene "Wikipedia" |
