| Term: | (-)-selegiline |
|
| Accession: | CHEBI:9086
|
 browse the term
 view annotations
|
| Definition: | A selegiline that has formula C13H17N. |
| Synonyms: | exact_synonym: | N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine |
| | related_synonym: | C13H17N; C[C@H](Cc1ccccc1)N(C)CC#C; EmSam; InChI=1S/C13H17N/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13/h1,5-9,12H,10-11H2,2-3H3/t12-/m1/s1; InChIKey=MEZLKOACVSPNER-GFCCVEGCSA-N; L-Deprenalin; selegilina; selegilinum |
| | xref_casrn: | 14611-51-9 |
| | xref: | Beilstein:5863318 "Beilstein Registry Number"; ChEMBL:196021 "ChEMBL COMPOUND"; ChemIDplus:14611-51-9 "CAS Registry Number"; DrugBank:DB01037 "DrugBank"; KEGG COMPOUND:14611-51-9 "CAS Registry Number"; KEGG COMPOUND:C07245 "KEGG COMPOUND"; KEGG DRUG:D03731 "KEGG DRUG" |
| | xref_mesh: | MESH:D012642 |
| | xref: | Patent:NL6605956 "Patent"; Patent:US4564706 "Patent"; Wikipedia:Selegiline "Wikipedia" |
| | cyclic_relationship: | is_conjugate_base_of CHEBI:50350 |
