| Term: | prednisone |
|
| Accession: | CHEBI:8382
|
browse the term
view annotations
|
| Definition: | A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a beta-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid. |
| Synonyms: | related_synonym: | 1,2-Dehydrocortisone; 1,4-Pregnadiene-17alpha,21-diol-3,11,20-trione; 17,21-Dihydroxypregna-1,4-diene-3,11,20-trione; C21H26O5; Dehydrocortisone; InChI=1S/C21H26O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1; InChIKey=XOFYZVNMUHMLCC-ZPOLXVRWSA-N; [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])C(=O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO; prednisona; prednisonum |
| | xref_casrn: | 53-03-2 |
| | xref: | Beilstein:2065301 "Beilstein Registry Number"; ChEMBL:127229 "ChEMBL COMPOUND"; ChemIDplus:53-03-2 "CAS Registry Number"; CiteXplore:10438974 "PubMed citation"; CiteXplore:15859934 "PubMed citation"; CiteXplore:18971570 "PubMed citation"; CiteXplore:23093541 "PubMed citation"; CiteXplore:23395281 "PubMed citation"; DrugBank:DB00635 "DrugBank"; KEGG COMPOUND:C07370 "KEGG COMPOUND" |
| | xref_mesh: | MESH:D011241 |
| | xref: | Patent:US2579479 "Patent"; Patent:US2837464 "Patent"; Patent:US2897216 "Patent"; Patent:US3134718 "Patent"; Wikipedia:Prednisone "Wikipedia" |
|
|