| Term: | phenylephrine |
|
| Accession: | CHEBI:8093
|
 browse the term
 view annotations
|
| Definition: | A phenylethanolamine that has formula C9H13NO2. |
| Synonyms: | exact_synonym: | 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol |
| | related_synonym: | (-)-m-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol; Benzenemethanol, 3-hydroxy-alpha-((methylamino)methyl)-, (R)-; Benzyl alcohol, m-hydroxy-alpha-((methylamino)methyl)-, (-)-; C9H13NO2; CNC[C@H](O)c1cccc(O)c1; InChI=1S/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1; InChIKey=SONNWYBIRXJNDC-VIFPVBQESA-N; R(-)-Phenylephrine; fenilefrina; l-(3-Hydroxyphenyl)-N-methylethanolamine; phenylephrinum |
| | xref_casrn: | 59-42-7 |
| | xref: | ChEMBL:319334 "ChEMBL COMPOUND"; ChemIDplus:59-42-7 "CAS Registry Number"; DrugBank:DB00388 "DrugBank"; KEGG COMPOUND:59-42-7 "CAS Registry Number"; KEGG COMPOUND:C07441 "KEGG COMPOUND" |
| | xref_mesh: | MESH:D010656 |
| | xref: | NIST Chemistry WebBook:59-42-7 "CAS Registry Number"; Patent:US1932347 "Patent"; Patent:US1954389 "Patent"; Wikipedia:Phenylephrine "Wikipedia" |
