phenacetin - Ontology Browser - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY BROWSER

Term:	phenacetin	go back to main search page
Accession:	CHEBI:8050	browse the term view annotations
Definition:	A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group.
Synonyms:	exact_synonym:	N-(4-ethoxyphenyl)acetamide
	related_synonym:	1-Acetamido-4-ethoxybenzene; 4-Ethoxyacetanilide; Acetophenetidin; Acetophenetidine; Acetophenetin; Acetphenetidin; Achrocidin; C10H13NO2; CCOc1ccc(NC(C)=O)cc1; Codempiral; Commotional; Contradol; Contradouleur; Fenacetina; InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12); InChIKey=CPJSUEIXXCENMM-UHFFFAOYSA-N; Phenacetine; Phenacetinum
	xref_casrn:	62-44-2
	xref:	ChEMBL:116498 "ChEMBL COMPOUND"; ChemIDplus:62-44-2 "CAS Registry Number"; DrugBank:DB03783 "DrugBank"; KEGG COMPOUND:62-44-2 "CAS Registry Number"; KEGG COMPOUND:C07591 "KEGG COMPOUND"; KEGG DRUG:D00569 "KEGG DRUG"
	xref_mesh:	MESH:D010615
	xref:	NIST Chemistry WebBook:62-44-2 "CAS Registry Number"; Patent:US2887513 "Patent"; Reaxys:1869238 "Reaxys Registry Number"; Wikipedia:Phenacetin "Wikipedia"

Parent Terms	Term With Siblings	Child Terms
acetamides + aromatic ether + cyclooxygenase 3 inhibitor + N-phenylacetamide + non-narcotic analgesic + peripheral nervous system drug +	(+)-lariciresinol (+)-N-(methoxycarbonyl)-N-norboldine (+)-pisatin (2-nitrophenoxy)acetic acid (2R,3S,2'R)-nadolol + (2R,3S,2'S)-nadolol + (2S,3R)-2,3-dihydro-7-methoxy-2,3-dimethyl-2-[4-methyl-5-(4-methyl-2-furyl)-3(E)-pentenyl]-furo[3,2-c]coumarin (2S,3R,2'R)-nadolol + (2S,3R,2'S)-nadolol + (3R,4R)-(-)-6-methoxy-1-oxo-3-n-pentyl-3,4-dihydro-1H-isochromen-4-yl-acetate (S)-6-O-methylnorlaudanosoline (S)-etodolac 1-iodo-2-methoxybenzene 1-methoxycanthinone 10-deoxygerfelin 12,13-dihydroxyfumitremorgin C 18-oxotryprostatin A 2'-O-methyllicodione 2,2',3-trihydroxydiphenyl ether 2,2',4,4',5-pentachlorodiphenyl ether 2,4-DB 2,4-dinitrophenetole 2-(4-ethoxyphenyl)-2-methylpropan-1-ol + 2-amino-5-[(1-methoxy-2-methylindolizin-3-yl)carbonyl]benzoic acid 2-chloro-N-isopropylacetamide 2-fluoroacetamides + 2-hydroxyacetamide 2-isopropoxyphenol + 2-O-methylcytosine 2-phenoxyethanol 2-phenylacetamide 3-O-ethylentacapone 3-O-methylentacapone 4',5'-dihydro-11,5'-dihydroxy-4'-methoxytephrosin 4-(methylamino)antipyrine 4-aminoantipyrine 4-chloroacetanilide 4849F 5'-hydroxyomeprazole 5-bromo-8-methoxy-1-methyl-beta-carboline 5-hydroxy-6-methoxy-2-methylchromone-7-O-rutinoside 5-methoxy-8-(2'-hydroxy-3'-buthoxy-3'-methylbutyloxy)psoralen 5-nonyloxytryptamine 5-O-methylcelebixanthone 6,6'-bieckol 6-[1'-oxo-3'(R)-hydroxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran 6-[4-(5,5-dimethyltetrahydrofuran-3-yl)phenoxy]hexanoic acid 6-bromoharmine 6-methoxyquinoline 6-methoxyspirotryprostatin B 6-O-methyl-2-deprenylrheediaxanthone B 7'-O-demethylisocephaeline 7,2'-dihydroxy-4'-methoxyisoflavan quinonemethide 7,2'-dihydroxy-4'-methoxyisoflavanol + 7-oxohernangerine 7-phloroeckol 8'-epi-cleomiscosin A 9-methoxycanthin-6-one abyssinone D acamprosate ACES + acetamide + acetochlor acetosyringone acetylsalicylic acid acetylspermidine + acifluorfen aclidinium + aiphanol alachlor alclofenac alfentanil alpha-methyl-L-dopa amantadine aminophenazone aminopotentidine ancistrotanzanine A ancistrotanzanine B ansamitocin P3 antipyrine + apixaban apocynin aprepitant ardimerin digallate arisugacin A arisugacin B arisugacin C arisugacin D artoindonesianin E1 AS-186a + AS-186b AS-186c AS-186d AS-186g atomoxetine + azilsartan + azilsartan medoxomil bauhinoxepin B bauhinoxepin F bauhinoxepin I bauhinoxepin J bedaquiline BGT226 free base bidebiline C bidebiline D bidenlignaside A bidenlignaside B bosutinib + brasiliquinone C bromfenac bromfenac sodium salt bromfenac sodium salt sesquihydrate bufexamac cabozantinib + capsaicin carbachol carbamazepine caulophine celebixanthone + celecoxib ceratamine A CGP 12177 chlorophenoxyacetic acid + chloroprocaine + chloroprocaine hydrochloride chlorprothixene + ciglitazone circumdatin H citrifolinoside cleomiscosin A clonidine + colpol coniferin cordyol C cratoxyarborenone C cratoxyarborenone E cratoxyarborenone F crizotinib cyathusal A cyathusal B cyathusal C cyclazosin + cycloprothrin cyfluthrin + cyhalothrin + cylindol A cypermethrin + deglymidodrine + Delta(9)-tetrahydrocannabinol deltamethrin deracoxib dexibuprofen dexmedetomidine + diclofenac + dieckol diflunisal dihydroergotamine + dihydroergotamine mesylate dihydroergotamine tartrate dimethyl sulfoxide dioncophylline C diorcinol diphenoxybenzene + drummondin E E-3810 free base ecgonine methyl ester + elvitegravir emericellin ergotamine ethacrynic acid ethyl vanillin etodolac + etofenprox etravirine fenoprofen fenoprofen calcium fenoxycarb fenpropathrin fenvalerate + feruloylacetic acid florbetapir F-18 flufenamate flufenamic acid flurbiprofen + friedelin + fucodiphloroethol G fukanefuromarin E fukanefuromarin F fukanefuromarin G fukanemarin B fumitremorgin A fumitremorgin C + garciniaxanthone H gemfibrozil gerfelin gilvusmycin glafenine guattegaumerine halfenprox hinokiflavone homovanillic acid + hypocrellin D ibuprofen + ICI 118551 iloperidone isohomovanillic acid jerantinine A + jerantinine B jerantinine C + jerantinine D jerantinine E jerantinine F JMV 390-1 juglanin A laccaridione A laccaridione B lamotrigine laurolistine + lespeflorin G2 lespeflorin G3 lespeflorin G8 lespeflorin H2 levobunolol + lindechunine A linezolid linkable vandetanib analogue littorachalcone longipedumin A loxtidine lycoperine A marsupsin mefenacet melatonin metachromin T metamizole metamizole sodium methotrimeprazine methoxybenzene + methoxyflavanone + methoxyisoflavanone + methoxyisoflavone + metipranolol metoprolol mexiletine + michellamine A michellamine B midodrine monodictysin C moxifloxacin multicaulin multiorthoquinone N(2)-methylharmine N(3')-acetyl-2-deoxystreptamine antibiotic N(4)-acetyl-L-2,4-diaminobutyric acid N(4)-acetylcytidine N,N-Diethylphenylacetamide N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-2-(2,6-dimethoxyphenoxy)ethanamine N-acetyl-2-arylethylamine + N-acetylarylamine N-acetylhistamine N-acetylphosphinothricin N-acetylprocainamide N-acetylserotonin N-acetyltryptamine N-benzylacetamides N-butylharmine N-ethylharmine N-isopropylacetanilide N-monoacetylalkane-alpha,omega-diamine + N-phenylacetamide + naproxen naproxen sodium naproxol nicotine + nimesulide nothramicin NP-101A O-propanoyl-L-carnitine O-propanoylcarnitine + obtusafuran omeprazole + ospemifene oxypeucedanin hydrate acetonide paracetamol + parecoxib paroxetine parthenolide paxanthonin + PF 1163A PF 1163B phenacetin A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group. phenazopyridine phenazopyridine hydrochloride phenetole phenoxybenzoic acid + phenylbutazone posaconazole practolol procaine propyphenazone pyriproxyfen quinine + regorafenib + roflumilast rosmarinic acid + RS 39604 rubraxanthone salicin + salicylamide + sandwicensin SDZ 35-682 silafluofen silandrin silibinin silychristin spiramide sulindac + suprofen suxibuzone swertianolin + swertipunicoside tamoxifen N-oxide tephrosin + tetrahydropalmatine tetrahydroswertianolin thiosalicylic acid toremifene tralomethrin trans-anethole triclosan tryprostatin A UK-2A UK-2B valdecoxib + vandetanib + vanillylmandelic acid verruculogen + vieillardixanthone violaceol I violaceol II wedelolactone XL765 zardaverine

Contact Us | About Us | Jobs at RGD

© Bioinformatics Program, HMGC at the Medical College of Wisconsin

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.
NHLBI Logo