| Term: | methylphenidate |
|
| Accession: | CHEBI:6887
|
browse the term
view annotations
|
| Definition: | A carboxylic ester that has formula C14H19NO2. |
| Synonyms: | exact_synonym: | methyl phenyl(piperidin-2-yl)acetate |
| | related_synonym: | C14H19NO2; COC(=O)C(C1CCCCN1)c1ccccc1; Daytrana; InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3; InChIKey=DUGOZIWVEXMGBE-UHFFFAOYSA-N; alpha-phenyl-2-piperidineacetic acid methyl ester; methyl alpha-phenyl-alpha-(2-piperidyl)acetate; methyl alpha-phenyl-alpha-2-piperidinylacetate; methyl phenidylacetate; methylphenidan; methylphenidatum; metilfenidato |
| | xref_casrn: | 113-45-1 |
| | xref: | Beilstein:200061 "Beilstein Registry Number"; ChEMBL:149842 "ChEMBL COMPOUND"; ChemIDplus:113-45-1 "CAS Registry Number"; DrugBank:DB00422 "DrugBank"; KEGG COMPOUND:113-45-1 "CAS Registry Number"; KEGG COMPOUND:C07196 "KEGG COMPOUND"; KEGG DRUG:D04999 "KEGG DRUG" |
| | xref_mesh: | MESH:D008774 |
| | xref: | NIST Chemistry WebBook:113-45-1 "CAS Registry Number"; Patent:US2507631 "Patent"; Patent:US2957880 "Patent"; Wikipedia:Methylphenidate "Wikipedia" |
| | cyclic_relationship: | is_conjugate_base_of CHEBI:51856 |