| Term: | topiramate |
|
| Accession: | CHEBI:63631
|
 browse the term
 view annotations
|
| Definition: | A hexose derivative that is 2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose in which the hydroxy group has been converted to the corresponding sulfamate ester. It blocks voltage-dependent sodium channels and is used as an antiepileptic and for the prevention of migraine. |
| Synonyms: | related_synonym: | 2,3:4,5-bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate; 2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose sulfamate; C12H21NO8S; CC1(C)O[C@@H]2CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@H]3[C@@H]2O1; InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7-,8-,9+,12+/m1/s1; InChIKey=KJADKKWYZYXHBB-XBWDGYHZSA-N; McN-4853; RWJ-17021; TPM; Topamax; tipiramate; tipiramato; topiramato; topiramatum |
| | alt_id: | CHEBI:9633 |
| | xref_casrn: | 97240-79-4 |
| | xref: | ChEMBL:466279 "ChEMBL COMPOUND"; ChemIDplus:97240-79-4 "CAS Registry Number"; CiteXplore:22233396 "PubMed citation"; CiteXplore:22249827 "PubMed citation"; DrugBank:DB00273 "DrugBank"; KEGG COMPOUND:97240-79-4 "CAS Registry Number"; KEGG COMPOUND:C07502 "KEGG COMPOUND"; KEGG DRUG:D00537 "KEGG DRUG" |
| | xref_mesh: | MESH:C052342 |
| | xref: | Patent:US4513006 "Patent"; Reaxys:5988957 "Reaxys Registry Number"; Wikipedia:Topiramate "Wikipedia" |
|
|
