| Term: | didanosine |
|
| Accession: | CHEBI:490877
|
 browse the term
 view annotations
|
| Definition: | A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. |
| Synonyms: | related_synonym: | 2,3-dideoxyinosine; 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one; 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one; 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol; 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one; C10H12N4O3; DDI; InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1; InChIKey=BXZVVICBKDXVGW-NKWVEPMBSA-N; OC[C@@H]1CC[C@@H](O1)n1cnc2c1nc[nH]c2=O; ddIno; didanosina; didanosinum; dideoxyinosine |
| | alt_id: | CHEBI:158219; CHEBI:39738; CHEBI:4516; CHEBI:475381; CHEBI:668806 |
| | xref_casrn: | 69655-05-6 |
| | xref: | Beilstein:3619529 "Beilstein Registry Number"; ChEMBL:10386939 "PubMed citation"; ChEMBL:158219 "ChEMBL COMPOUND"; ChEMBL:1619614 "PubMed citation"; ChEMBL:17046264 "PubMed citation"; ChEMBL:475381 "ChEMBL COMPOUND"; ChEMBL:490877 "ChEMBL COMPOUND"; ChEMBL:668806 "ChEMBL COMPOUND"; ChemIDplus:69655-05-6 "CAS Registry Number"; CiteXplore:18549801 "PubMed citation"; DrugBank:DB00900 "DrugBank"; KEGG COMPOUND:69655-05-6 "CAS Registry Number"; KEGG COMPOUND:C06953 "KEGG COMPOUND"; KEGG DRUG:D00296 "KEGG DRUG" |
| | xref_mesh: | MESH:D016049 |
| | xref: | PDBeChem:2DI "PDBeChem"; Patent:EP206497 "Patent"; Wikipedia:Didanosine "Wikipedia" |
|
|
