| Term: | 2,4,6-trinitrotoluene |
|
| Accession: | CHEBI:46053
|
 browse the term
 view annotations
|
| Definition: | A trinitrotoluene having the nitro groups at positions 2, 4 and 6. |
| Synonyms: | exact_synonym: | 2-methyl-1,3,5-trinitrobenzene |
| | related_synonym: | 1-methyl-2,4,6-trinitrobenzene; 2,4,6-TNT; 2,4,6-Trinitrotoluol; C7H5N3O6; Cc1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O; InChI=1S/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3; InChIKey=SPSSULHKWOKEEL-UHFFFAOYSA-N; TNT; Trinitrotoluen; Trinitrotoluol; Tritol; Trotyl; alpha-TNT; s-Trinitrotoluol; s-trinitrotoluene; sym-Trinitrotoluol; trinitrotoluene |
| | alt_id: | CHEBI:19337; CHEBI:46051 |
| | xref_casrn: | 118-96-7 |
| | xref: | Beilstein:1887900 "Beilstein Registry Number"; ChEMBL:798695 "ChEMBL COMPOUND"; ChemIDplus:118-96-7 "CAS Registry Number"; CiteXplore:19427119 "PubMed citation"; CiteXplore:20219247 "PubMed citation"; DrugBank:DB01676 "DrugBank" |
| | xref_mesh: | MESH:D014303 |
| | xref: | NIST Chemistry WebBook:118-96-7 "CAS Registry Number"; PDBeChem:TNL "PDBeChem"; Reaxys:1887900 "Reaxys Registry Number"; Wikipedia:Trinitrotoluene "Wikipedia" |
|
|
