| Term: | valproic acid |
|
| Accession: | CHEBI:39867
|
 browse the term
 view annotations
|
| Definition: | A branched-chain saturated fatty acid that comprises of a propyl substituent on a pentanoic acid stem. |
| Synonyms: | related_synonym: | 2-PROPYL-PENTANOIC ACID; 2-n-propyl-n-valeric acid; 2-propylpentanoic acid; 2-propylvaleric acid; 4-heptanecarboxylic acid; C8H16O2; CCCC(CCC)C(O)=O; DPA; Depakene; Di-n-propylessigsaeure; InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10); InChIKey=NIJJYAXOARWZEE-UHFFFAOYSA-N; VPA; Valproinsaeure; acide valproique; acido valproico; acidum valproicum; di-n-propylacetic acid; dipropylacetic acid; n-DPA |
| | alt_id: | CHEBI:115217; CHEBI:39858; CHEBI:9926 |
| | xref_casrn: | 99-66-1 |
| | xref: | ChEMBL:115217 "ChEMBL COMPOUND"; ChemIDplus:1750447 "Beilstein Registry Number"; ChemIDplus:99-66-1 "CAS Registry Number"; CiteXplore:12475192 "PubMed citation"; CiteXplore:17156483 "PubMed citation"; CiteXplore:19280426 "PubMed citation"; CiteXplore:8681902 "PubMed citation"; DrugBank:DB00313 "DrugBank"; KEGG COMPOUND:C07185 "KEGG COMPOUND"; KEGG DRUG:D00399 "KEGG DRUG" |
| | xref_mesh: | MESH:D014635 |
| | xref: | NIST Chemistry WebBook:99-66-1 "CAS Registry Number"; PDBeChem:2PP "PDBeChem"; Wikipedia:Valproic_Acid "Wikipedia" |
| | cyclic_relationship: | is_conjugate_acid_of CHEBI:60654 |
