Ontology Browser |
<<< Return to Ontology Search |
| alpha-hexachlorocyclohexane (CHEBI:39096) | |
| 435 annotations. (View Annotations) |
| Parent Terms | Term With Siblings | Child Terms |
|
|
| Synonyms | |
| exact_synonym: | (1R,2R,3R,4R,5S,6S)-1,2,3,4,5,6-hexachlorocyclohexane |
| related_synonym: | (1alpha,2alpha,3beta,4beta,5alpha,6beta)-1,2,3,4,5,6-hexachlorocyclohexane ; (1r,2c,3t,4t,5c,6t)-1,2,3,4,5,6-hexachlorocyclohexane ; C6H6Cl6 ; Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H](Cl)[C@H]1Cl ; InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4-,5+,6+/m1/s1 ; InChIKey=JLYXXMFPNIAWKQ-SHFUYGGZSA-N ; alpha-BHC ; alpha-HCH ; alpha-benzene hexachloride ; alpha-hexachlorane ; alpha-lindane |
| xref_casrn: | 319-84-6 |
| xref: | Beilstein:1907336 "Beilstein Registry Number" ; ChEMBL:1195259 "ChEMBL COMPOUND" ; ChemIDplus:319-84-6 "CAS Registry Number" ; Gmelin:794031 "Gmelin Registry Number" |
| xref_mesh: | MESH:C040534 |
| xref: | NIST Chemistry WebBook:319-84-6 "CAS Registry Number" |
|
