acene - Ontology Browser - Rat Genome Database

Keyword

ONTOLOGY BROWSER

Term:	acene	go back to main search page
Accession:	CHEBI:35297	browse the term view annotations
Definition:	A polycyclic aromatic hydrocarbon consisting of fused benzene rings in a rectilinear arrangement.
Synonyms:	exact_synonym:	acenes
	related_synonym:	Acen; Azen; InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H; InChIKey=MWPLVEDNUUSJAV-UHFFFAOYSA-N; polyacenes
	xref:	ChEMBL:304484 "ChEMBL COMPOUND"

Parent Terms	Term With Siblings	Child Terms
acenes + ortho-fused polycyclic arene +	7,12-dimethyltetraphene acene + A polycyclic aromatic hydrocarbon consisting of fused benzene rings in a rectilinear arrangement. acene aldehyde + acene ester + acene nitrile + acenoquinone + anthracenes + biphenylene chrysene cyclopenta[l]phenanthrene + dibenz[a,h]anthracene dibenzannulene + fluorene + fluorenes + helicene + heptacenes + heptaphene hexacenes + hexaphene hexaphenylene nonacenes + nonaphene octacenes + octaphene octaphenylene ortho-fused bicyclic arene + pentacenes + pentaphene phenanthrene + picene tetracenes + tetranaphthylene tetraphene + tetraphenylene trinaphthylene triphenylene	anthracene + heptacene hexacene nonacene octacene pentacene tetracene +