| Term: | dibutyl phthalate |
|
| Accession: | CHEBI:34687
|
 browse the term
 view annotations
|
| Definition: | The dibutyl ester of benzene-1,2-dicarboxylic acid. |
| Synonyms: | exact_synonym: | dibutyl benzene-1,2-dicarboxylate |
| | related_synonym: | 1,2-Benzenedicarboxylic acid dibutyl ester; Benzene-o-dicarboxylic acid di-n-butyl ester; Benzenedicarboxylic acid dibutyl ester; Butyl phthalate; C16H22O4; CCCCOC(=O)c1ccccc1C(=O)OCCCC; DBP; Di-n-butyl phthalate; Dibutyl 1,2-benzenedicarboxylate; Dibutyl-o-phthalate; InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3; InChIKey=DOIRQSBPFJWKBE-UHFFFAOYSA-N; Phthalic acid di-n-butyl ester; Phthalic acid dibutyl ester; n-Butyl phthalate; o-Benzenedicarboxylic acid dibutyl ester |
| | alt_id: | CHEBI:535597 |
| | xref_casrn: | 84-74-2 |
| | xref: | Beilstein:1914064 "Beilstein Registry Number"; ChEMBL:535597 "ChEMBL COMPOUND"; ChemIDplus:84-74-2 "CAS Registry Number"; CiteXplore:19840837 "PubMed citation"; Gmelin:262569 "Gmelin Registry Number"; KEGG COMPOUND:84-74-2 "CAS Registry Number"; KEGG COMPOUND:C14214 "KEGG COMPOUND" |
| | xref_mesh: | MESH:D003993 |
| | xref: | NIST Chemistry WebBook:84-74-2 "CAS Registry Number" |
