| Term: | 3,3',4,4',5-pentachlorobiphenyl |
|
| Accession: | CHEBI:34317
|
browse the term
view annotations
|
| Definition: | A pentachlorobiphenyl that has formula C12H5Cl5. |
| Synonyms: | exact_synonym: | 3,3',4,4',5-pentachloro-1,1'-biphenyl |
| | related_synonym: | 3,4,5,3',4'-Penta coplanar polychlorinated biphenyl; C12H5Cl5; Clc1ccc(cc1Cl)-c1cc(Cl)c(Cl)c(Cl)c1; InChI=1S/C12H5Cl5/c13-8-2-1-6(3-9(8)14)7-4-10(15)12(17)11(16)5-7/h1-5H; InChIKey=REHONNLQRWTIFF-UHFFFAOYSA-N; PCB 126 |
| | xref_casrn: | 57465-28-8 |
| | xref: | ChEMBL:327468 "ChEMBL COMPOUND"; ChemIDplus:57465-28-8 "CAS Registry Number"; KEGG COMPOUND:57465-28-8 "CAS Registry Number"; KEGG COMPOUND:C14573 "KEGG COMPOUND" |
| | xref_mesh: | MESH:C023035 |
| | xref: | NIST Chemistry WebBook:57465-28-8 "CAS Registry Number" |
|
|