| Term: | oxybenzone |
|
| Accession: | CHEBI:34283
|
 browse the term
 view annotations
|
| Definition: | A hydroxybenzophenone that is benzophenone which is substituted at the 2- and 4-positions of one of the benzene rings by hydroxy and methoxy groups respectively. |
| Synonyms: | exact_synonym: | (2-hydroxy-4-methoxyphenyl)(phenyl)methanone |
| | related_synonym: | 2-Benzoyl-5-methoxyphenol; 2-Hydroxy-4-methoxybenzophenone; 4-Methoxy-2-hydroxybenzophenone; Benzophenone-3; C14H12O3; COc1ccc(C(=O)c2ccccc2)c(O)c1; InChI=1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3; InChIKey=DXGLGDHPHMLXJC-UHFFFAOYSA-N; oxibenzona; oxybenzonum |
| | alt_id: | CHEBI:569732 |
| | xref_casrn: | 131-57-7 |
| | xref: | Beilstein:1913145 "Beilstein Registry Number"; ChEMBL:569732 "ChEMBL COMPOUND"; CiteXplore:11169173 "PubMed citation"; DrugBank:DB01428 "DrugBank"; KEGG COMPOUND:131-57-7 "CAS Registry Number"; KEGG COMPOUND:C14285 "KEGG COMPOUND"; KEGG DRUG:D05309 "KEGG DRUG" |
| | xref_mesh: | MESH:C005290 |
| | xref: | NIST Chemistry WebBook:131-57-7 "CAS Registry Number"; Patent:US2773903 "Patent"; Patent:US2861104 "Patent"; Patent:US2861105 "Patent"; Patent:US3073866 "Patent"; Wikipedia:Oxybenzone "Wikipedia" |
