Ontology Browser

<<< Return to Ontology Search
caprylic acid (CHEBI:28837)
7004 annotations. (View Annotations)
Parent Terms Term With Siblings Child Terms
medium-chain fatty acid  +
straight-chain saturated fatty acid  +
(2E,4E)-deca-2,4-dienoic acid  
(2E,4Z)-8-hydroxydeca-2,4-dienoic acid  
(3S,4S)-3-hydroxy-4-methyldecanoic acid  
(3S,4S)-3-hydroxy-4-methyloctanoic acid  
10-hydroxy-(2E,8E)-decadien-4-ynoic acid
10-hydroxycapric acid
10-oxocapric acid
12-hydroxylauric acid  
12-oxo-trans-10-dodecenoic acid
2-bromodecanoic acid
2-oxohexanoic acid
3-hydroxylauric acid  
3-hydroxyoctanoic acid  
4,8-dimethylnonanoic acid  
4-hydroxylauric acid  
5-oxohexanoic acid
6-hydroxy-3-isopropenylheptanoic acid  
6-hydroxyhex-3-enoic acid  
6-hydroxyhexanoic acid
6-oxohexanoic acid
7-methyl-3-oxooct-6-enoic acid
7-methyloctanoic acid  
arachidic acid  
behenic acid  
butyric acid    
capric acid    
caproic acid    
caprylic acid    
A C8, straight-chain saturated fatty acid.
cerotic acid  
decenoic acid  
dodecatrienoic acid    
dodecenoic acid  
henicosanoic acid
heptanoic acid    
heptatrienoic acid  
heptenoic acid    
hexadienoic acid    
hexenoic acid    
lauric acid    
lignoceric acid    
margaric acid  
melissic acid  
montanic acid
myristic acid    
nonadecanoic acid
nonanoic acid    
octadienoic acid
octatrienoic acid
palmitic acid    
pentacosanoic acid
pentadecanoic acid  
sorbic acid    
stearic acid    
tricosanoic acid
tridecanoic acid
undecanoic acid    
undecenoic acid  
valeric acid    
(3S,4S)-3-hydroxy-4-methyloctanoic acid  +
(R)-lipoic acid  +  
(S)-lipoic acid  +
2-(pentylsulfanyl)acetic acid  +
3-hydroxyoctanoic acid  +
3-oxooctanoic acid  +
6-hydroxy-3,7-dimethyloctanoic acid  +
8-(5-hexylfuran-2-yl)octanoic acid
8-[(1R,2R)-3-oxo-2-\{(Z)-pent-2-en-1-yl\}cyclopentyl]octanoic acid
beta-D-fructofuranosyl 6-O-octanoyl-alpha-D-glucopyranoside
ciliatamide B
dihydrolipoic acid  +  
lipoic acid  +  
lipoyl group  +
lipoyl-AMP
octanoyl group  +
octanoyl-beta-D-glucuronide
octanoyl-CoA  +
perfluorooctanoic acid  

Synonyms
related_synonym: 1-heptanecarboxylic acid ;   8:0 ;   Acide octanoique ;   Acido octanoico ;   Acidum octanocium ;   C8:0 ;   C8H16O2 ;   CCCCCCCC(O)=O ;   CH3-[CH2]6-COOH ;   InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) ;   InChIKey=WWZKQHOCKIZLMA-UHFFFAOYSA-N ;   Kaprylsaeure ;   OCTANOIC ACID (CAPRYLIC ACID) ;   Octanoic acid ;   Octansaeure ;   Octylic acid ;   n-caprylic acid ;   n-octanoic acid ;   n-octoic acid ;   n-octylic acid ;   octoic acid
alt_id: CHEBI:25648 ;   CHEBI:3373 ;   CHEBI:44501
xref_casrn: 124-07-2
xref: Beilstein:1747180 "Beilstein Registry Number" ;   ChEMBL:278620 "ChEMBL COMPOUND" ;   ChemIDplus:124-07-2 "CAS Registry Number" ;   CiteXplore:16162522 "PubMed citation" ;   CiteXplore:16872526 "PubMed citation" ;   CiteXplore:19096058 "PubMed citation" ;   DrugBank:DB04519 "DrugBank" ;   Gmelin:142966 "Gmelin Registry Number" ;   KEGG COMPOUND:124-07-2 "CAS Registry Number" ;   KEGG COMPOUND:C06423 "KEGG COMPOUND" ;   LIPID MAPS:LMFA01010008 "LIPID MAPS instance"
xref_mesh: MESH:C031492
xref: NIST Chemistry WebBook:124-07-2 "CAS Registry Number" ;   PDBeChem:OCA "PDBeChem"
cyclic_relationship: is_conjugate_acid_of CHEBI:25646

paths to the root