| Term: | dimethyl sulfoxide |
|
| Accession: | CHEBI:28262
|
browse the term
view annotations
|
| Definition: | A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
| Synonyms: | exact_synonym: | (methanesulfinyl)methane |
| | related_synonym: | (CH3)2SO; C2H6OS; CS(C)=O; DMSO; Dimethylsulfoxid; InChI=1S/C2H6OS/c1-4(2)3/h1-2H3; InChIKey=IAZDPXIOMUYVGZ-UHFFFAOYSA-N; S(O)Me2; dimethyl sulfur oxide; dimethyl sulphoxide; dimethyli sulfoxidum; dimethylsulfoxyde; dimetil sulfoxido; dmso; methylsulfinylmethane; sulfinylbis(methane) |
| | alt_id: | CHEBI:23801; CHEBI:42138; CHEBI:4612 |
| | xref_casrn: | 67-68-5 |
| | xref: | Beilstein:506008 "Beilstein Registry Number"; ChEMBL:110009 "ChEMBL COMPOUND"; ChemIDplus:67-68-5 "CAS Registry Number"; CiteXplore:11162043 "PubMed citation"; CiteXplore:11350866 "PubMed citation"; CiteXplore:15237653 "PubMed citation"; CiteXplore:15588915 "PubMed citation"; CiteXplore:15868171 "PubMed citation"; CiteXplore:16434015 "PubMed citation"; CiteXplore:19096138 "PubMed citation"; CiteXplore:19382398 "PubMed citation"; CiteXplore:21426213 "PubMed citation"; CiteXplore:22030943 "PubMed citation"; CiteXplore:22722716 "PubMed citation"; CiteXplore:22768202 "PubMed citation"; CiteXplore:22814967 "PubMed citation"; DrugBank:DB01093 "DrugBank"; Gmelin:1556 "Gmelin Registry Number"; KEGG COMPOUND:67-68-5 "CAS Registry Number"; KEGG COMPOUND:C11143 "KEGG COMPOUND"; KEGG DRUG:D01043 "KEGG DRUG" |
| | xref_mesh: | MESH:D004121 |
| | xref: | NIST Chemistry WebBook:67-68-5 "CAS Registry Number"; PDBeChem:DMS "PDBeChem"; Reaxys:506008 "Reaxys Registry Number"; UM-BBD:c0236 "UM-BBD compID"; Wikipedia:Dimethyl_Sulfoxide "Wikipedia" |