| Term: | estriol |
|
| Accession: | CHEBI:27974
|
 browse the term
 view annotations
|
| Definition: | One of the three main estrogens produced by the human body, having a 3,16alpha,17beta-trihydroxy substitution pattern. |
| Synonyms: | exact_synonym: | estra-1,3,5(10)-triene-3,16alpha,17beta-triol |
| | related_synonym: | (16alpha,17beta)-estra-1,3,5(10)-triene-3,16,17-triol; 1,3,5(10)-Estratriene-3,16-alpha,17beta-triol; 16alpha-hydroxyestradiol; 3,16alpha,17beta-trihydroxy-Delta(1,3,5)-estratriene; C18H24O3; Estriel; InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1; InChIKey=PROQIPRRNZUXQM-ZXXIGWHRSA-N; [H][C@]12CC[C@]3(C)[C@@H](O)[C@H](O)C[C@@]3([H])[C@]1([H])CCc1cc(O)ccc21; oestriol; trihydroxyestrin |
| | alt_id: | CHEBI:23969; CHEBI:42467; CHEBI:4869 |
| | xref_casrn: | 50-27-1 |
| | xref: | Beilstein:2508172 "Beilstein Registry Number"; ChEMBL:428137 "ChEMBL COMPOUND"; ChemIDplus:50-27-1 "CAS Registry Number"; CiteXplore:9373313 "PubMed citation"; DrugBank:DB04573 "DrugBank"; KEGG COMPOUND:50-27-1 "CAS Registry Number"; KEGG COMPOUND:C05141 "KEGG COMPOUND"; KEGG DRUG:D00185 "KEGG DRUG"; LIPID MAPS:LMST02010003 "LIPID MAPS instance" |
| | xref_mesh: | MESH:D004964 |
| | xref: | NIST Chemistry WebBook:50-27-1 "CAS Registry Number"; PDBeChem:ESL "PDBeChem"; Wikipedia:Estriol "Wikipedia" |
|
|
