| Term: | folic acid |
|
| Accession: | CHEBI:27470
|
 browse the term
 view annotations
|
| Definition: | Folic acid is a form of the water-soluble vitamine B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
| Synonyms: | exact_synonym: | N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| | related_synonym: | C19H19N7O6; Folate; Folsaeure; InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1; InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N; N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid; N-pteroyl-L-glutamic acid; Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1; PGA; PteGlu; Pteroylglutamic acid; pteroyl-L-glutamic acid; pteroyl-L-monoglutamic acid; vitamin Bc; vitamin M |
| | alt_id: | CHEBI:24075; CHEBI:42610; CHEBI:5140; CHEBI:569217 |
| | xref_casrn: | 59-30-3 |
| | xref: | Beilstein:100781 "Beilstein Registry Number"; ChEMBL:18788725 "PubMed citation"; ChEMBL:569217 "ChEMBL COMPOUND"; ChemIDplus:59-30-3 "CAS Registry Number"; CiteXplore:17784727 "PubMed citation"; DrugBank:DB00158 "DrugBank"; KEGG COMPOUND:59-30-3 "CAS Registry Number"; KEGG COMPOUND:C00504 "KEGG COMPOUND" |
| | xref_mesh: | MESH:D005492 |
| | xref: | MetaCyc:CPD-12826 "MetaCyc"; NIST Chemistry WebBook:59-30-3 "CAS Registry Number"; PDBeChem:FOL "PDBeChem"; Wikipedia:Folic_Acid "Wikipedia" |
| | cyclic_relationship: | is_conjugate_acid_of CHEBI:62501 |
