| Term: | corticosterone |
|
| Accession: | CHEBI:16827
|
 browse the term
 view annotations
|
| Definition: | Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands. |
| Synonyms: | exact_synonym: | 11beta,21-dihydroxypregn-4-ene-3,20-dione |
| | related_synonym: | (11beta)-11,21-dihydroxypregn-4-ene-3,20-dione; 11beta,21-Dihydroxy-4-pregnene-3,20-dione; 11beta,21-dihydroxyprogesterone; 17-deoxycortisol; C21H30O4; InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1; InChIKey=OMFXVFTZEKFJBZ-HJTSIMOOSA-N; Kendall's compound B; Reichstein's substance H; [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C)C(=O)CO |
| | alt_id: | CHEBI:14022; CHEBI:19131; CHEBI:3891; CHEBI:41361; CHEBI:57911 |
| | xref_casrn: | 50-22-6 |
| | xref: | ChEMBL:282165 "ChEMBL COMPOUND"; ChemIDplus:2339601 "Beilstein Registry Number"; ChemIDplus:50-22-6 "CAS Registry Number"; CiteXplore:10438974 "PubMed citation"; KEGG COMPOUND:50-22-6 "CAS Registry Number"; KEGG COMPOUND:C02140 "KEGG COMPOUND" |
| | xref_mesh: | MESH:D003345 |
| | xref: | NIST Chemistry WebBook:50-22-6 "CAS Registry Number"; PDBeChem:C0R "PDBeChem"; Wikipedia:Corticosterone "Wikipedia" |
|
|
