| Term: | 6-aminopenicillanic acid |
|
| Accession: | CHEBI:16705
|
 browse the term
 view annotations
|
| Definition: | A penicillanic acid compound having a (6R)-amino substituent. The active nucleus common to all penicillins; it may be substituted at the 6-amino position to form the semisynthetic penicillins, resulting in a variety of antibacterial and pharmacologic characteristics. |
| Synonyms: | exact_synonym: | 6-amino-2,2-dimethylpenam-3alpha-carboxylic acid |
| | related_synonym: | (2S,5R,6R)-6-amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid; 6-APA; 6-Aminopenicillamine acid; 6-Aminopenicillanate; 6-Apa; 6-Aps; Aminopenicillanic acid; C8H12N2O3S; InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1; InChIKey=NGHVIOIJCVXTGV-ALEPSDHESA-N; Penicin; Penin; Phenacyl 6-aminopenicillinate; [H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2N)C(O)=O |
| | alt_id: | CHEBI:20705; CHEBI:2172 |
| | xref_casrn: | 551-16-6 |
| | xref: | Beilstein:15080 "Beilstein Registry Number"; Beilstein:959078 "Beilstein Registry Number"; ChemIDplus:551-16-6 "CAS Registry Number"; CiteXplore:12569987 "PubMed citation"; CiteXplore:1384868 "PubMed citation"; CiteXplore:14687482 "PubMed citation"; CiteXplore:1701026 "PubMed citation"; CiteXplore:6166603 "PubMed citation"; Gmelin:1876702 "Gmelin Registry Number"; KEGG COMPOUND:551-16-6 "CAS Registry Number"; KEGG COMPOUND:C02954 "KEGG COMPOUND" |
| | cyclic_relationship: | is_conjugate_base_of CHEBI:30938; is_tautomer_of CHEBI:57869 |
