protoporphyrin - Ontology Browser - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY BROWSER

Term:	protoporphyrin	go back to main search page
Accession:	CHEBI:15430	browse the term view annotations
Definition:	A cyclic tetrapyrrole that consists of porphyrin bearing four methyl substituents at positions 3, 8, 13 and 17, two vinyl substituents at positions 7 and 12 and two 2-carboxyethyl substituents at positions 2 and 18. The parent of the class of protoporphyrins.
Synonyms:	exact_synonym:	7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoic acid
	related_synonym:	3,3'-(3,7,12,17-tetramethyl-8,13-divinyl-21H,23H-porphine-2,18-diyl)-bis-propionic acid; 3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-dipropanoic acid; C34H34N4O4; Cc1c(CCC(O)=O)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5C=C)c(C)c4C=C)c(C)c3CCC(O)=O; H2ppIX; InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35,38H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-N; Kammerer's prophyrin; Porphyrinogen IX; Protoporphyrin IX; ooporphyrin
	alt_id:	CHEBI:14959; CHEBI:14960; CHEBI:14961; CHEBI:26358; CHEBI:8592
	xref_casrn:	553-12-8
	xref:	Beilstein:635160 "Beilstein Registry Number"; Beilstein:635161 "Beilstein Registry Number"; ChEMBL:849476 "ChEMBL COMPOUND"; ChemIDplus:553-12-8 "CAS Registry Number"; CiteXplore:18625294 "PubMed citation"; CiteXplore:19005892 "PubMed citation"; CiteXplore:20961864 "PubMed citation"; CiteXplore:21146529 "PubMed citation"; CiteXplore:21167148 "PubMed citation"; CiteXplore:21668870 "PubMed citation"; CiteXplore:21760730 "PubMed citation"; CiteXplore:21913427 "PubMed citation"; CiteXplore:23533060 "PubMed citation"; DrugBank:DB02285 "DrugBank"; Gmelin:251232 "Gmelin Registry Number"; HMDB:HMDB00241 "HMDB"; KEGG COMPOUND:553-12-8 "CAS Registry Number"; KEGG COMPOUND:C02191 "KEGG COMPOUND"
	xref_mesh:	MESH:C028025
	xref:	MetaCyc:PROTOPORPHYRIN_IX "MetaCyc"; NIST Chemistry WebBook:553-12-8 "CAS Registry Number"; PDBeChem:PP9 "PDBeChem"; Reaxys:380795 "Reaxys Registry Number"; Wikipedia:Protoporphyrin_IX "Wikipedia"
	cyclic_relationship:	is_conjugate_acid_of CHEBI:36159; is_conjugate_acid_of CHEBI:57306

Parent Terms	Term With Siblings	Child Terms
metabolite + photosensitizing agent + protoporphyrins +	(6-methoxy-2-naphthyl)acetic acid (6S)-5-formyltetrahydrofolic acid (E)-hexadec-2-enoic acid + (R)-carnitine + (S)-nicotinium N-alpha-D-glucosiduronate 1,7-dimethylxanthine 10-HDoHE 11-HDoHE 11-HETE 11-trans-LTE4 12-epi-leukotriene B4 12-HEPE 13,14-dihydro-15-keto-PGF2alpha 13,14-dihydro-15-ketoprostaglandin D2 13-HDoHE 13-HODE + 13-HOTrE 13-hydroxy-6Z,9Z,11E-octadecatrienoic acid 13-oxo-9E,11E-ODE 14-HDoHE 15-deoxy-Delta(12,14)-prostaglandin J2 15-epi-lipoxin A4 15-HEDE + 15-HEPE 15-HETrE 15-ketoprostaglandin F1alpha 15-oxoEDE 16(17)-EpDPE 16-HDoHE 17(18)-EpETE 17-HDoHE 17alpha-hydroxyprogesterone 18-HEPE 18-hydroxy-18-oxo-dinorleukotriene B4 19(20)-EpDPE 19,20-DiHDPA 2,2-dimethylbutyric acid 2-amino-3-methylpentanoic acid + 2-furoic acid + 2-hydroxy-17beta-estradiol 2-methoxy-17beta-estradiol + 2-methoxyestrone + 20-HDoHE 20-oxoleukotriene B4 3'-hydroxy-4'-methoxydiclofenac 3'-hydroxydiclofenac 3'-hydroxyflavanone + 3,4-dihydroxybenzoic acid 3,4-dihydroxymandelaldehyde 3,4-dihydroxyphenylethyleneglycol 3,4-dihydroxyphenylpyruvic acid 3-(2,3-dihydroxyphenyl)propanoic acid 3-(4-tert-butylamino-6-methylthiol-s-triazin-2-ylamino)propionaldehyde 3-methyl-7H-xanthine 3-methyl-9H-xanthine 3-methyleneindolenine 3-oxooctadecanoyl-CoA 3alpha,7alpha,12alpha-trihydroxy-5beta-cholestan-26-oyl-CoA + 4',5-dihydroxydiclofenac 4'-hydroxydiclofenac 4'-hydroxydiclofenac quinone imine 4-chlorophenylacetic acid 4-fumarylacetoacetate(2-) 4-HDoHE 4-hydroperoxycyclophosphamide 4-hydroxy-17beta-estradiol 4-hydroxycyclophosphamide 4-hydroxydebrisoquin 4-hydroxyphenytoin 4-hydroxytolbutamide 4E,15Z-bilirubin IXa 5,10,15,20-tetrakis(1-methylpyridinium-4-yl)porphyrin 5,15-DiHETE 5,6-dihydrothymine 5,6-Ep-15S-HETE 5-aminolevulinic acid + 5-HEPE 5-HETE + 5-HETrE 5-hydroxydiclofenac 5-hydroxydiclofenac quinone imine 6,15-diketo,13,14-dihydroprostaglandin F1alpha 6-epi-lipoxin A4 6-oxo-prostaglandin E1 6-oxo-prostaglandin F1alpha 7,8-didehydro-17beta-estradiol 7-HDoHE 8-HDoHE 8-HETE 8-HETrE 9,10-diphenylanthracene 9-cis-retinoic acid + 9-HODE + 9-HOTrE 9-hydroxy-5E,7Z,11Z,14Z-eicosatetraenoic acid 9-hydroxy-5Z,7E,11Z,14Z-eicosatetraenoic acid 9-oxo-10E,12E-ODE 9-oxo-10E,12Z-ODE acetophenone + afimoxifene Ala-Ala-Ala Ala-Ala-Asp Ala-Ala-Asp-Asp Ala-Ala-Gly Ala-Ala-Pro Ala-Ala-Pro-Pro Ala-Ala-Ser Ala-Asn Ala-Asn-Asn-Pro Ala-Asn-Asp-Pro Ala-Asn-Gln-Ser Ala-Asp-Gly Ala-Asp-Pro Ala-Asp-Ser Ala-Cys-Gly Ala-Gln-Pro Ala-Gly-His Ala-Gly-Pro Ala-Gly-Ser Ala-Gly-Tyr Ala-Leu-Ala-Pro Ala-Leu-Asp-Asp Ala-Leu-Asp-Gly Ala-Leu-Leu-Asp Ala-Leu-Leu-His Ala-Leu-Leu-Ser Ala-Leu-Leu-Thr Ala-Leu-Thr-Gln Ala-Leu-Thr-Pro Ala-Leu-Val-Ser Ala-Met-Ser-Arg Ala-Phe-Thr-Ser Ala-Phe-Trp-Asn Ala-Thr-Ala-Pro Ala-Trp-Asn-Asp Ala-Val-Asp-His Ala-Val-Asp-Pro Ala-Val-Asp-Ser alanine + all-trans-4-hydroxyretinoic acid arginine + Asp-Gly-Pro asparagine + aspartic acid + benzophenone + benzoylacetyl-CoA benzyl alcohol + biotin sulfoxide carprofen + chlorohydroquinone chlorpromazine N-oxide choline + cidofovir anhydrous + cisplatin clothianidin + crocetin + cyclosporin A cysteine + decarboxytiaprofenic acid DHET + diclofenac beta-D-glucosiduronic acid digoxigenin monodigitoxoside DiHDPE + DiHOME + dihydrochelirubine dihydrophaseic acid dihydrosanguinarine + diphenylcyclopropenone docetaxel anhydrous + drug metabolite + ecgonine + ecgonine benzoate ecgonine methyl ester + EET + eoxin A4 eoxin C4 eoxin D4 eoxin E4 EpDPE + EpETE + EpOME + ergothioneine formic acid + fumonisin B1 gemcitabine + glutamic acid + glutamine + glutathioselenol + glycerone + glycine + glycine betaine GS26575 HDoHE + HEDE + hematoporphyrin HEPE + HETrE + histidine + HOTrE + isoleucine + Leu-Gln-Pro leucine + leucodopachrome lipoxin A4 lombricine + lomefloxacin + lomefloxacin hydrochloride lucanthone + lysine + M3 malonyl-CoA metalloprotoporphyrin + methionine + methoxsalen + methyl 5-aminolevulinate + methyl 5-aminolevulinate hydrochloride methylselenol metronidazole + N'-acetylisoniazid N-acetyl-beta-D-glucosamine + N-acetylsulfamethoxazole N-dodecanoylsphingosine 1-phosphate norfentanyl nornicotine octadecadienal oleamide oleandrigenin OxoEDE + OxoODE + pantetheine phaseic acid + phenol + phenylacetyl-CoA + phenylalanine + phenylbutazone pimeloyl-CoA + porfimer porfimer sodium primary metabolite proline + propionyl-CoA + protoporphyrin + A cyclic tetrapyrrole that consists of porphyrin bearing four methyl substituents at positions 3, 8, 13 and 17, two vinyl substituents at positions 7 and 12 and two 2-carboxyethyl substituents at positions 2 and 18. The parent of the class of protoporphyrins. protoporphyrin monomethyl ester protoporphyrinate pyrrolidin-2-one quinoxalin-2-ol + riboflavin + secondary metabolite + selenodiglutathione serine + sphingosine 1-phosphate spinosad SQ 26,992 streptidine + sulfamethoxazole hydroxylamine sulochrin tamoxifen N-oxide temoporfin tetrachloro-1,4-benzoquinone tetracosahexaenoic acid tetranor-12R-HETE threonine + trans-4-hydroxy-L-proline + trichloroacetic acid trimethylamine N-oxide trioxsalen tryptophan + tyrosine + ubiquinol-10 valine + vernolic acid + verteporfin vinorelbine +	hematoporphyrin protoporphyrin monomethyl ester

Contact Us | About Us | Jobs at RGD

© Bioinformatics Program, HMGC at the Medical College of Wisconsin

RGD is funded by grant HL64541 from the National Heart, Lung, and Blood Institute on behalf of the NIH.
NHLBI Logo