| Term: | zidovudine |
|
| Accession: | CHEBI:10110
|
 browse the term
 view annotations
|
| Definition: | A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
| Synonyms: | exact_synonym: | 3'-azido-3'-deoxythymidine |
| | related_synonym: | AZT; Azidothymidine; C10H13N5O4; Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O; InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1; InChIKey=HBOMLICNUCNMMY-XLPZGREQSA-N; Zidovudin; Zidovudinum |
| | alt_id: | CHEBI:619601 |
| | xref_casrn: | 30516-87-1 |
| | xref: | Beilstein:763034 "Beilstein Registry Number"; ChEMBL:127307 "ChEMBL COMPOUND"; ChEMBL:19112024 "PubMed citation"; ChEMBL:619601 "ChEMBL COMPOUND"; ChemIDplus:30516-87-1 "CAS Registry Number"; DrugBank:30516-87-1 "CAS Registry Number"; DrugBank:DB00495 "DrugBank"; KEGG COMPOUND:30516-87-1 "CAS Registry Number"; KEGG COMPOUND:C07210 "KEGG COMPOUND"; KEGG DRUG:30516-87-1 "CAS Registry Number"; KEGG DRUG:D00413 "KEGG DRUG" |
| | xref_mesh: | MESH:D015215 |
| | xref: | Patent:US4724232 "Patent"; Wikipedia:Zidovudine "Wikipedia" |
