telmisartan - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	telmisartan	go back to main search page
Accession:	CHEBI:9434	browse the term
Definition:	A biphenylyltetrazole that has formula C33H30N4O2.
Synonyms:	related_synonym:	4'-((4-methyl-6-(1-methyl-2-benzimidazolyl)-2-propyl-1-benzimidazolyl)methyl)-2-biphenylcarboxylic acid; 4'-[(1,4'-dimethyl-2'propyl[2,6'-bi-1H-benzimidazol]-1'-yl)methyl]-[1,1'-biphenyl]-2-carboxylic acid; 4'-[(1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]biphenyl-2-carboxylic acid; BIBR 277; C33H30N4O2; CCCc1nc2c(C)cc(cc2n1Cc1ccc(cc1)-c1ccccc1C(O)=O)-c1nc2ccccc2n1C; InChI=1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39); InChIKey=RMMXLENWKUUMAY-UHFFFAOYSA-N; Micardis
	xref_casrn:	144701-48-4
	xref:	Beilstein:6624054 "Beilstein Registry Number"; ChEMBL:216949 "ChEMBL COMPOUND"; ChemIDplus:144701-48-4 "CAS Registry Number"; DrugBank:DB00966 "DrugBank"; KEGG COMPOUND:144701-48-4 "CAS Registry Number"; KEGG COMPOUND:C07710 "KEGG COMPOUND"; KEGG DRUG:D00627 "KEGG DRUG"
	xref_mesh:	MESH:C084178
	xref:	Patent:EP502314 "Patent"; Wikipedia:Telmisartan "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

telmisartan
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		decreases activity	ISO				RGD:6480464	CTD
G	Abcg1	ATP-binding cassette, subfamily G (WHITE), member 1		multiple interactions	ISO	20	9,390,485	9,459,574	RGD:6480464	CTD
G	Abcg1	ATP-binding cassette, subfamily G (WHITE), member 1		increases expression	ISO	20	9,390,485	9,459,574	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		decreases expression	EXP	10	95,361,338	95,381,455	RGD:6480464	CTD
G	Ace2	angiotensin I converting enzyme (peptidyl-dipeptidase A) 2		multiple interactions	ISO	X	51,051,758	51,096,036	RGD:6480464	CTD
G	Ache	acetylcholinesterase		multiple interactions	ISO				RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		decreases expression	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		decreases expression	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		affects binding	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		increases expression	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		multiple interactions	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		multiple interactions	ISO	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		multiple interactions	ISO	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		multiple interactions	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		decreases expression	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		multiple interactions	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agtr1b	angiotensin II receptor, type 1b		multiple interactions	ISO	2	105,503,269	105,602,591	RGD:6480464	CTD
G	Agtr1b	angiotensin II receptor, type 1b		affects binding	EXP	2	105,503,269	105,602,591	RGD:6480464	CTD
G	Agtr1b	angiotensin II receptor, type 1b		multiple interactions	EXP	2	105,503,269	105,602,591	RGD:6480464	CTD
G	Agtr1b	angiotensin II receptor, type 1b		increases expression	EXP	2	105,503,269	105,602,591	RGD:6480464	CTD
G	Alb	albumin		affects expression	ISO	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Cacna1g	calcium channel, voltage-dependent, T type, alpha 1G subunit		multiple interactions	EXP	10	83,043,636	83,112,886	RGD:6480464	CTD
G	Cacna1g	calcium channel, voltage-dependent, T type, alpha 1G subunit		decreases expression	EXP	10	83,043,636	83,112,886	RGD:6480464	CTD
G	Cacna1h	calcium channel, voltage-dependent, T type, alpha 1H subunit		multiple interactions	EXP	10	14,621,372	14,679,051	RGD:6480464	CTD
G	Cacna1h	calcium channel, voltage-dependent, T type, alpha 1H subunit		decreases expression	EXP	10	14,621,372	14,679,051	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		decreases response to substance	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccr2	chemokine (C-C motif) receptor 2		decreases expression	EXP	8	128,892,784	128,893,905	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		increases expression	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Crp	C-reactive protein, pentraxin-related		decreases expression	ISO	13	88,702,243	88,703,153	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases response to substance	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		decreases expression	ISO	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		multiple interactions	EXP	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		decreases expression	EXP	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		multiple interactions	ISO	X	25,514,572	25,547,181	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		decreases expression	EXP	X	25,514,572	25,547,181	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		decreases expression	EXP	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	EXP	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Ednra	endothelin receptor type A		multiple interactions	EXP	19	32,042,366	32,108,153	RGD:6480464	CTD
G	Ednrb	endothelin receptor type B		multiple interactions	EXP	15	87,893,141	87,898,700	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	EXP	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fn1	fibronectin 1		multiple interactions	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		increases expression	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		decreases expression	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	EXP	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Ins1	insulin 1		increases expression	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins2	insulin 2		decreases expression	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Irak1	interleukin-1 receptor-associated kinase 1		multiple interactions	ISO	X	159,960,184	159,969,180	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		multiple interactions	ISO	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		increases expression	ISO	1	80,663,791	80,682,480	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		decreases phosphorylation	EXP	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapkapk2	mitogen-activated protein kinase-activated protein kinase 2		multiple interactions	ISO	13	43,994,943	44,041,504	RGD:6480464	CTD
G	Mas1	MAS1 oncogene		multiple interactions	ISO	1	42,154,786	42,185,750	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		decreases expression	EXP	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mpo	myeloperoxidase		multiple interactions	ISO	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Ncf2	neutrophil cytosolic factor 2		multiple interactions	ISO	13	67,806,516	67,834,105	RGD:6480464	CTD
G	Ncf2	neutrophil cytosolic factor 2		decreases expression	ISO	13	67,806,516	67,834,105	RGD:6480464	CTD
G	Ncf2	neutrophil cytosolic factor 2		multiple interactions	EXP	13	67,806,516	67,834,105	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		increases expression	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		increases phosphorylation	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nox4	NADPH oxidase 4		multiple interactions	EXP	1	143,415,816	143,603,554	RGD:6480464	CTD
G	Nphs1	nephrosis 1, congenital, Finnish type (nephrin)		multiple interactions	EXP	1	85,414,492	85,444,233	RGD:6480464	CTD
G	Nppb	natriuretic peptide B		affects expression	ISO	5	165,062,348	165,063,650	RGD:6480464	CTD
G	Nppb	natriuretic peptide B		decreases expression	ISO	5	165,062,348	165,063,650	RGD:6480464	CTD
G	Olr1	oxidized low density lipoprotein (lectin-like) receptor 1		multiple interactions	ISO	4	166,747,228	166,769,340	RGD:6480464	CTD
G	Plau	plasminogen activator, urokinase		multiple interactions	EXP	15	3,680,072	3,686,232	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		multiple interactions	ISO	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		increases expression	ISO	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		increases expression	EXP	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases activity	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	ISO	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	EXP	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Ren	renin		increases expression	EXP	13	46,262,936	46,275,213	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		multiple interactions	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		multiple interactions	EXP	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Syp	synaptophysin		multiple interactions	ISO	X	26,890,307	26,905,319	RGD:6480464	CTD
G	Syp	synaptophysin		multiple interactions	EXP	X	26,890,307	26,905,319	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		decreases expression	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tjp1	tight junction protein 1		multiple interactions	ISO	1	119,684,774	119,750,532	RGD:6480464	CTD
G	Tjp1	tight junction protein 1		affects localization	ISO	1	119,684,774	119,750,532	RGD:6480464	CTD
G	Tjp1	tight junction protein 1		decreases expression	ISO	1	119,684,774	119,750,532	RGD:6480464	CTD
G	Tlr4	toll-like receptor 4		multiple interactions	ISO	5	83,564,100	83,577,735	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Traf6	TNF receptor-associated factor 6, E3 ubiquitin protein ligase		multiple interactions	ISO	3	86,827,582	86,847,408	RGD:6480464	CTD
G	Ucp1	uncoupling protein 1 (mitochondrial, proton carrier)		multiple interactions	ISO	19	26,527,548	26,535,621	RGD:6480464	CTD
G	Ucp1	uncoupling protein 1 (mitochondrial, proton carrier)		increases expression	ISO	19	26,527,548	26,535,621	RGD:6480464	CTD
G	Ucp2	uncoupling protein 2 (mitochondrial, proton carrier)		multiple interactions	ISO	1	157,925,514	157,928,222	RGD:6480464	CTD
G	Ucp2	uncoupling protein 2 (mitochondrial, proton carrier)		increases expression	ISO	1	157,925,514	157,928,222	RGD:6480464	CTD
G	Ucp3	uncoupling protein 3 (mitochondrial, proton carrier)		multiple interactions	ISO	1	157,896,001	157,909,608	RGD:6480464	CTD
G	Ucp3	uncoupling protein 3 (mitochondrial, proton carrier)		increases expression	ISO	1	157,896,001	157,909,608	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	EXP	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	501881
role	491510
chemical role	210371
inhibitor	73699
enzyme inhibitor	69443
angiotensin-converting enzyme inhibitor	684
telmisartan	147
Path 2
Term	Annotations
CHEBI ontology	501881
subatomic particle	500845
composite particle	500845
hadron	500845
baryon	500845
nucleon	500845
atomic nucleus	500845
atom	500845
main group element atom	470301
p-block element atom	467779
carbon group element atom	419149
carbon atom	415667
organic molecular entity	415660
organic molecule	365810
organic cyclic compound	304492
organic heterocyclic compound	158510
organic heteromonocyclic compound	61261
mancude organic heteromonocyclic parent	8948
azole	7464
tetrazoles	902
biphenylyltetrazole	825
telmisartan	147