5-acetamido-3,5-dideoxy-L-arabino-hept-2-ulopyranosonic acid - Ontology Report

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	5-acetamido-3,5-dideoxy-L-arabino-hept-2-ulopyranosonic acid	go back to main search page
Accession:	CHEBI:62322	browse the term
Definition:	The ketoaldonic acid derivative that is N-acetylneuraminic acid after formal dehydroxylation and subsequent removal of C-8 and C-9.
Synonyms:	related_synonym:	C9H15NO7; InChI=1S/C9H15NO7/c1-4(12)10-7-5(13)2-9(16,8(14)15)17-6(7)3-11/h5-7,11,13,16H,2-3H2,1H3,(H,10,12)(H,14,15)/t5-,6-,7+,9?/m0/s1; InChIKey=VOYHUNWCVBZVQT-CRNPJGAVSA-N; N-acetyl-8,9-deoxy-8,9-dinorneuraminic acid; N-acetyl-8,9-dinorneuraminic acid; [H][C@@]1(CO)OC(O)(C[C@H](O)[C@H]1NC(C)=O)C(O)=O
	xref:	CiteXplore:18487279 "PubMed citation"; Reaxys:2288512 "Reaxys Registry Number"

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	501881
role	491510
chemical role	210371
antioxidant	26278
N-acetylneuraminic acid	1
5-acetamido-3,5-dideoxy-L-arabino-hept-2-ulopyranosonic acid	0
Path 2
Term	Annotations
CHEBI ontology	501881
subatomic particle	500845
composite particle	500845
hadron	500845
baryon	500845
nucleon	500845
atomic nucleus	500845
atom	500845
main group element atom	470301
p-block element atom	467779
carbon group element atom	419149
carbon atom	415667
organic molecular entity	415660
organic group	171184
organic divalent group	169999
organodiyl group	169999
carbonyl group	169689
carbonyl compound	169689
carboxylic acid	122651
carbohydrate acid	972
ketoaldonic acid	742
ketoaldonic acid derivative	1
neuraminic acids	1
sialic acid	1
N-acylneuraminic acid	1
N-acetylneuraminic acids	1
N-acetylneuraminic acid	1
5-acetamido-3,5-dideoxy-L-arabino-hept-2-ulopyranosonic acid	0