wortmannin - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	wortmannin	go back to main search page
Accession:	CHEBI:52289	browse the term
Definition:	A delta-lactone that has formula C23H24O8.
Synonyms:	exact_synonym:	(1S,6bR,9aS,11R,11bR)-9a,11b-dimethyl-1-[(methyloxy)methyl]-3,6,9-trioxo-1,6,6b,7,8,9,9a,10,11,11b-decahydro-3H-furo[4,3,2-de]indeno[4,5-h]isochromen-11-yl acetate
	related_synonym:	C23H24O8; InChI=1S/C23H24O8/c1-10(24)30-13-7-22(2)12(5-6-14(22)25)16-18(13)23(3)15(9-28-4)31-21(27)11-8-29-20(17(11)23)19(16)26/h8,12-13,15H,5-7,9H2,1-4H3/t12-,13+,15+,22-,23-/m0/s1; InChIKey=QDLHCMPXEPAAMD-QAIWCSMKSA-N; Wartmannin; [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)c2occ3C(=O)O[C@H](COC)[C@@]1(C)c23
	xref_casrn:	19545-26-7
	xref:	Beilstein:67676 "Beilstein Registry Number"; ChemIDplus:19545-26-7 "CAS Registry Number"; CiteXplore:22003059 "PubMed citation"; CiteXplore:22056625 "PubMed citation"; CiteXplore:22524784 "PubMed citation"; KEGG COMPOUND:C15181 "KEGG COMPOUND"
	xref_mesh:	MESH:C009687
	xref:	Reaxys:67676 "Reaxys Registry Number"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

wortmannin
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		decreases activity	ISO				RGD:6480464	CTD
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		affects localization	EXP				RGD:6480464	CTD
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		multiple interactions	EXP				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		affects localization	EXP				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		multiple interactions	EXP				RGD:6480464	CTD
G	Acox1	acyl-CoA oxidase 1, palmitoyl		multiple interactions	EXP	10	106,281,977	106,319,382	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Aifm1	apoptosis-inducing factor, mitochondrion-associated 1		decreases localization	EXP	X	134,868,878	134,908,166	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases activity	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases expression	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases expression	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1s1	AKT1 substrate 1 (proline-rich)		multiple interactions	ISO	1	95,325,272	95,328,510	RGD:6480464	CTD
G	Akt1s1	AKT1 substrate 1 (proline-rich)		decreases phosphorylation	ISO	1	95,325,272	95,328,510	RGD:6480464	CTD
G	Alpi	alkaline phosphatase, intestinal		multiple interactions	ISO	9	85,892,887	85,896,353	RGD:6480464	CTD
G	Alpi	alkaline phosphatase, intestinal		increases activity	ISO	9	85,892,887	85,896,353	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Areg	amphiregulin		decreases activity	EXP	14	18,466,313	18,475,571	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	EXP	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		decreases phosphorylation	EXP	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	EXP	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bcar1	breast cancer anti-estrogen resistance 1		multiple interactions	ISO	19	41,646,190	41,669,234	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		multiple interactions	ISO				RGD:6480464	CTD
G	Becn1	beclin 1, autophagy related		multiple interactions	ISO	10	90,317,957	90,333,329	RGD:6480464	CTD
G	Birc2	baculoviral IAP repeat-containing 2		multiple interactions	ISO	8	4,649,559	4,667,733	RGD:6480464	CTD
G	Birc2	baculoviral IAP repeat-containing 2		decreases expression	ISO	8	4,649,559	4,667,733	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		multiple interactions	ISO	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		decreases expression	ISO				RGD:6480464	CTD
G	C5	complement component 5		multiple interactions	ISO	3	14,011,115	14,102,744	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		decreases activity	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	ISO	4	42,956,102	42,989,057	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl9	chemokine (C-C motif) ligand 9		multiple interactions	ISO	10	71,645,931	71,650,814	RGD:6480464	CTD
G	Ccna2	cyclin A2		multiple interactions	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd2	cyclin D2		decreases methylation	ISO	4	163,523,817	163,546,501	RGD:6480464	CTD
G	Ccnd2	cyclin D2		increases expression	ISO	4	163,523,817	163,546,501	RGD:6480464	CTD
G	Ccnd3	cyclin D3		affects localization	ISO				RGD:6480464	CTD
G	Ccnd3	cyclin D3		multiple interactions	ISO				RGD:6480464	CTD
G	Ccnd3	cyclin D3		multiple interactions	ISO				RGD:6480464	CTD
G	Ccne1	cyclin E1		multiple interactions	ISO	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Ccr3	chemokine (C-C motif) receptor 3		multiple interactions	ISO	8	128,759,943	128,769,341	RGD:6480464	CTD
G	Ccr5	chemokine (C-C motif) receptor 5		multiple interactions	ISO	8	128,907,157	128,912,272	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cdc25a	cell division cycle 25A		multiple interactions	ISO	8	114,237,704	114,255,971	RGD:6480464	CTD
G	Cdc25a	cell division cycle 25A		decreases expression	ISO	8	114,237,704	114,255,971	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		decreases activity	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		decreases expression	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		decreases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		increases expression	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cftr	cystic fibrosis transmembrane conductance regulator		multiple interactions	ISO	4	43,874,852	44,041,870	RGD:6480464	CTD
G	Chek1	checkpoint kinase 1		multiple interactions	ISO	8	37,954,322	37,974,748	RGD:6480464	CTD
G	Chek1	checkpoint kinase 1		decreases expression	ISO	8	37,954,322	37,974,748	RGD:6480464	CTD
G	Chek1	checkpoint kinase 1		multiple interactions	ISO	8	37,954,322	37,974,748	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		multiple interactions	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		multiple interactions	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		decreases phosphorylation	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	ISO	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Col18a1	collagen, type XVIII, alpha 1		multiple interactions	ISO	20	11,920,816	11,982,468	RGD:6480464	CTD
G	Col1a2	collagen, type I, alpha 2		multiple interactions	ISO	4	29,393,645	29,428,572	RGD:6480464	CTD
G	Cpt1a	carnitine palmitoyltransferase 1a, liver		multiple interactions	EXP	1	205,852,800	205,912,972	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	ISO	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	ISO	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases expression	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcr2	chemokine (C-X-C motif) receptor 2		multiple interactions	ISO	9	73,470,943	73,477,315	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		decreases secretion	EXP	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		multiple interactions	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	E2f1	E2F transcription factor 1		multiple interactions	ISO	3	145,032,489	145,043,729	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	ISO	16	69,110,522	69,123,895	RGD:6480464	CTD
G	Epor	erythropoietin receptor		multiple interactions	ISO	8	21,061,310	21,065,886	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	2	218,371,050	218,382,645	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fgf1	fibroblast growth factor 1 (acidic)		decreases activity	ISO	18	31,785,480	31,806,452	RGD:6480464	CTD
G	Fgf1	fibroblast growth factor 1 (acidic)		multiple interactions	EXP	18	31,785,480	31,806,452	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		multiple interactions	ISO	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Foxo1	forkhead box O1		multiple interactions	ISO	2	141,127,345	141,203,446	RGD:6480464	CTD
G	Foxo1	forkhead box O1		multiple interactions	ISO	2	141,127,345	141,203,446	RGD:6480464	CTD
G	Foxo3	forkhead box O3		multiple interactions	ISO	20	46,171,784	46,262,818	RGD:6480464	CTD
G	Foxo4	forkhead box O4		multiple interactions	ISO	X	89,332,278	89,338,835	RGD:6480464	CTD
G	Gast	gastrin		decreases secretion	EXP	10	89,273,628	89,276,192	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		increases expression	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Glp1r	glucagon-like peptide 1 receptor		multiple interactions	EXP	20	9,225,881	9,264,184	RGD:6480464	CTD
G	Grn	granulin		multiple interactions	EXP	10	91,536,135	91,542,239	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		decreases expression	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	EXP	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		decreases phosphorylation	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	EXP	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		decreases phosphorylation	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	H2afx	H2A histone family, member X		multiple interactions	ISO	8	47,312,609	47,313,938	RGD:6480464	CTD
G	H2afx	H2A histone family, member X		multiple interactions	ISO	8	47,312,609	47,313,938	RGD:6480464	CTD
G	H2afx	H2A histone family, member X		multiple interactions	ISO	8	47,312,609	47,313,938	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		decreases expression	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	EXP	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	EXP	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hsf1	heat shock transcription factor 1		multiple interactions	ISO	7	114,524,211	114,551,166	RGD:6480464	CTD
G	Hsf1	heat shock transcription factor 1		affects localization	ISO	7	114,524,211	114,551,166	RGD:6480464	CTD
G	Hspa1a	heat shock protein 1A		decreases expression	ISO	20	3,945,716	3,959,552	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Il12a	interleukin 12A		multiple interactions	ISO	2	158,710,261	158,717,689	RGD:6480464	CTD
G	Il12b	interleukin 12B		multiple interactions	ISO	10	29,558,955	29,568,331	RGD:6480464	CTD
G	Il17a	interleukin 17A		multiple interactions	ISO	9	19,454,979	19,458,467	RGD:6480464	CTD
G	Il17a	interleukin 17A		multiple interactions	ISO	9	19,454,979	19,458,467	RGD:6480464	CTD
G	Il18	interleukin 18		multiple interactions	ISO	8	53,936,584	53,943,228	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	ISO	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il23a	Interleukin 23, alpha subunit p19		multiple interactions	ISO	7	1,584,112	1,586,226	RGD:6480464	CTD
G	Il3	interleukin 3		multiple interactions	ISO	10	39,684,691	39,687,041	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	ISO	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	ISO	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	EXP	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Itgav	integrin, alpha V		multiple interactions	ISO	3	66,953,403	67,029,774	RGD:6480464	CTD
G	Itgb2	integrin, beta 2		multiple interactions	ISO	20	11,446,521	11,485,009	RGD:6480464	CTD
G	Itgb3	integrin, beta 3		multiple interactions	ISO				RGD:6480464	CTD
G	Kcnh1	potassium voltage-gated channel, subfamily H (eag-related), member 1		multiple interactions	ISO	13	108,129,617	108,407,815	RGD:6480464	CTD
G	Kitlg	KIT ligand		multiple interactions	ISO	7	37,714,157	37,795,722	RGD:6480464	CTD
G	Klf4	Kruppel-like factor 4 (gut)		multiple interactions	EXP	5	73,446,928	73,451,286	RGD:6480464	CTD
G	Kng1	kininogen 1		multiple interactions	EXP	11	80,109,499	80,131,887	RGD:6480464	CTD
G	Lep	leptin		decreases expression	ISO	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		decreases secretion	ISO	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		multiple interactions	ISO	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lig1	ligase I, DNA, ATP-dependent		multiple interactions	ISO	1	73,728,892	73,767,429	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		decreases phosphorylation	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapt	microtubule-associated protein tau		increases phosphorylation	ISO	10	93,411,098	93,508,762	RGD:6480464	CTD
G	Mapt	microtubule-associated protein tau		multiple interactions	ISO	10	93,411,098	93,508,762	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		multiple interactions	ISO				RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		multiple interactions	ISO				RGD:6480464	CTD
G	Mdm2	p53 E3 ubiquitin protein ligase		multiple interactions	ISO	7	56,996,694	57,020,926	RGD:6480464	CTD
G	Mmp12	matrix metallopeptidase 12		multiple interactions	ISO	8	4,249,938	4,259,675	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	EXP	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		decreases activity	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mpo	myeloperoxidase		multiple interactions	ISO	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mt1a	metallothionein 1a		multiple interactions	ISO	19	11,261,631	11,262,647	RGD:6480464	CTD
G	Mt3	metallothionein 3		decreases response to substance	ISO	19	11,284,554	11,286,402	RGD:6480464	CTD
G	Mtor	mechanistic target of rapamycin (serine/threonine kinase)		multiple interactions	ISO	5	165,531,402	165,640,899	RGD:6480464	CTD
G	Mtr	5-methyltetrahydrofolate-homocysteine methyltransferase		multiple interactions	ISO	17	68,782,708	68,867,101	RGD:6480464	CTD
G	Mycn	v-myc myelocytomatosis viral related oncogene, neuroblastoma derived (avian)		multiple interactions	ISO	6	36,508,262	36,514,071	RGD:6480464	CTD
G	Myh4	myosin, heavy chain 4, skeletal muscle		multiple interactions	ISO	10	53,931,880	53,955,029	RGD:6480464	CTD
G	Myl7	myosin, light chain 7, regulatory		multiple interactions	ISO	14	86,568,142	86,570,122	RGD:6480464	CTD
G	Myl7	myosin, light chain 7, regulatory		decreases phosphorylation	ISO	14	86,568,142	86,570,122	RGD:6480464	CTD
G	Ncs1	neuronal calcium sensor 1		multiple interactions	EXP	3	10,305,202	10,354,149	RGD:6480464	CTD
G	Ndrg1	N-myc downstream regulated 1		decreases phosphorylation	ISO	7	104,302,038	104,344,842	RGD:6480464	CTD
G	Ndrg1	N-myc downstream regulated 1		multiple interactions	ISO	7	104,302,038	104,344,842	RGD:6480464	CTD
G	Nedd4	neural precursor cell expressed, developmentally down-regulated 4, E3 ubiquitin protein ligase		multiple interactions	EXP	8	77,252,500	77,337,402	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		decreases activity	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		decreases phosphorylation	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	EXP	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Notch1	notch 1		multiple interactions	ISO	3	4,631,797	4,677,640	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nr5a1	nuclear receptor subfamily 5, group A, member 1		multiple interactions	ISO	3	18,498,913	18,519,738	RGD:6480464	CTD
G	Ntf3	neurotrophin 3		decreases transport	ISO	4	162,435,781	162,506,961	RGD:6480464	CTD
G	Ntf4	neurotrophin 4		decreases transport	ISO	1	95,885,577	95,888,408	RGD:6480464	CTD
G	Nts	neurotensin		multiple interactions	ISO	7	40,474,654	40,484,058	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Pck1	phosphoenolpyruvate carboxykinase 1 (soluble)		multiple interactions	EXP	3	164,012,410	164,018,359	RGD:6480464	CTD
G	Pdcd4	programmed cell death 4		increases expression	ISO	1	260,183,648	260,202,032	RGD:6480464	CTD
G	Pdk1	pyruvate dehydrogenase kinase, isozyme 1		multiple interactions	ISO	3	54,292,076	54,319,242	RGD:6480464	CTD
G	Pdx1	pancreatic and duodenal homeobox 1		multiple interactions	ISO				RGD:6480464	CTD
G	Pdx1	pancreatic and duodenal homeobox 1		multiple interactions	ISO				RGD:6480464	CTD
G	Pik3ca	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit alpha		multiple interactions	ISO	2	118,640,277	118,672,440	RGD:6480464	CTD
G	Pik3ca	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit alpha		decreases activity	ISO	2	118,640,277	118,672,440	RGD:6480464	CTD
G	Pik3cb	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit beta		decreases activity	ISO	8	103,886,682	103,957,112	RGD:6480464	CTD
G	Pik3cd	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit delta		decreases activity	ISO	5	166,735,274	166,761,189	RGD:6480464	CTD
G	Pik3cg	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit gamma		multiple interactions	ISO	6	50,441,892	50,476,931	RGD:6480464	CTD
G	Pik3cg	phosphatidylinositol-4,5-bisphosphate 3-kinase, catalytic subunit gamma		decreases activity	ISO	6	50,441,892	50,476,931	RGD:6480464	CTD
G	Pik3r1	phosphoinositide-3-kinase, regulatory subunit 1 (alpha)		decreases activity	ISO	2	32,602,673	32,675,350	RGD:6480464	CTD
G	Plac1	placenta-specific 1		multiple interactions	ISO	X	140,014,910	140,055,813	RGD:6480464	CTD
G	Postn	periostin, osteoblast specific factor		multiple interactions	EXP	2	143,537,099	143,568,341	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		multiple interactions	EXP	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		multiple interactions	EXP	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppm1d	protein phosphatase, Mg2+/Mn2+ dependent, 1D		multiple interactions	ISO	10	73,575,506	73,612,063	RGD:6480464	CTD
G	Ppp1r1b	protein phosphatase 1, regulatory (inhibitor) subunit 1B		multiple interactions	ISO	10	87,121,889	87,131,587	RGD:6480464	CTD
G	Prkcd	protein kinase C, delta		multiple interactions	ISO	16	5,954,218	5,975,743	RGD:6480464	CTD
G	Prkcd	protein kinase C, delta		multiple interactions	ISO	16	5,954,218	5,975,743	RGD:6480464	CTD
G	Prkdc	protein kinase, DNA activated, catalytic polypeptide		multiple interactions	ISO	11	86,951,420	87,169,229	RGD:6480464	CTD
G	Pten	phosphatase and tensin homolog		multiple interactions	ISO	1	236,771,027	236,837,261	RGD:6480464	CTD
G	Pten	phosphatase and tensin homolog		multiple interactions	EXP	1	236,771,027	236,837,261	RGD:6480464	CTD
G	Ptger1	prostaglandin E receptor 1 (subtype EP1)		multiple interactions	ISO	19	26,160,729	26,163,156	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptk2	protein tyrosine kinase 2		multiple interactions	ISO	7	110,933,298	111,084,554	RGD:6480464	CTD
G	Ptk2	protein tyrosine kinase 2		multiple interactions	ISO	7	110,933,298	111,084,554	RGD:6480464	CTD
G	Ptk2	protein tyrosine kinase 2		multiple interactions	EXP	7	110,933,298	111,084,554	RGD:6480464	CTD
G	Pxn	paxillin		multiple interactions	ISO	12	42,322,193	42,370,507	RGD:6480464	CTD
G	Rad23b	RAD23 homolog B (S. cerevisiae)		multiple interactions	ISO	5	73,256,542	73,294,296	RGD:6480464	CTD
G	Rad50	RAD50 homolog (S. cerevisiae)		multiple interactions	ISO	10	39,112,733	39,164,694	RGD:6480464	CTD
G	Rap1a	RAP1A, member of RAS oncogene family		multiple interactions	ISO	2	200,980,324	201,001,561	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		multiple interactions	ISO	15	53,828,881	53,962,099	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		multiple interactions	ISO	15	53,828,881	53,962,099	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rps6	ribosomal protein S6		multiple interactions	ISO	5	106,165,612	106,168,472	RGD:6480464	CTD
G	Rps6kb1	ribosomal protein S6 kinase, polypeptide 1		multiple interactions	EXP	10	76,657,024	76,698,088	RGD:6480464	CTD
G	Rps6kb1	ribosomal protein S6 kinase, polypeptide 1		multiple interactions	ISO	10	76,657,024	76,698,088	RGD:6480464	CTD
G	Rps6kb2	ribosomal protein S6 kinase, polypeptide 2		multiple interactions	ISO	1	206,740,966	206,747,653	RGD:6480464	CTD
G	Scg2	secretogranin II		decreases activity	ISO	9	78,762,661	78,767,970	RGD:6480464	CTD
G	Sct	secretin		multiple interactions	EXP	1	201,472,250	201,472,944	RGD:6480464	CTD
G	Serpinh1	serpin peptidase inhibitor, clade H (heat shock protein 47), member 1, (collagen binding protein 1)		multiple interactions	ISO	1	156,666,914	156,674,210	RGD:6480464	CTD
G	Sftpc	surfactant protein C		decreases expression	ISO	15	50,923,105	50,926,047	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		multiple interactions	ISO	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Sirpa	signal-regulatory protein alpha		multiple interactions	ISO	3	117,210,116	117,247,840	RGD:6480464	CTD
G	Sirt1	sirtuin 1		multiple interactions	ISO	20	25,675,302	25,686,494	RGD:6480464	CTD
G	Sirt1	sirtuin 1		multiple interactions	ISO	20	25,675,302	25,686,494	RGD:6480464	CTD
G	Sirt1	sirtuin 1		multiple interactions	ISO	20	25,675,302	25,686,494	RGD:6480464	CTD
G	Slc1a1	solute carrier family 1 (neuronal/epithelial high affinity glutamate transporter, system Xag), member 1		multiple interactions	EXP	1	232,469,746	232,549,584	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	EXP	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a5	solute carrier family 2 (facilitated glucose/fructose transporter), member 5		multiple interactions	EXP	5	167,240,442	167,285,761	RGD:6480464	CTD
G	Slc5a5	solute carrier family 5 (sodium iodide symporter), member 5		multiple interactions	ISO	16	19,046,200	19,056,281	RGD:6480464	CTD
G	Slc6a3	solute carrier family 6 (neurotransmitter transporter, dopamine), member 3		multiple interactions	ISO	1	30,516,568	30,557,540	RGD:6480464	CTD
G	Socs3	suppressor of cytokine signaling 3		multiple interactions	ISO	10	107,958,468	107,959,330	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		increases expression	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sp1	Sp1 transcription factor		multiple interactions	ISO	7	141,164,180	141,194,509	RGD:6480464	CTD
G	Sqstm1	sequestosome 1		multiple interactions	ISO	10	35,751,300	35,762,630	RGD:6480464	CTD
G	Sqstm1	sequestosome 1		decreases expression	ISO	10	35,751,300	35,762,630	RGD:6480464	CTD
G	Sqstm1	sequestosome 1		increases expression	ISO	10	35,751,300	35,762,630	RGD:6480464	CTD
G	Sts	steroid sulfatase (microsomal), isozyme S		multiple interactions	ISO	X	63,915,803	63,923,834	RGD:6480464	CTD
G	Th	tyrosine hydroxylase		multiple interactions	ISO	1	203,164,253	203,171,506	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	ISO	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Tjp1	tight junction protein 1		multiple interactions	ISO	1	119,684,774	119,750,532	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	EXP	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		decreases phosphorylation	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp73	tumor protein p73		multiple interactions	ISO	5	170,848,979	171,078,739	RGD:6480464	CTD
G	Tpp2	tripeptidyl peptidase II		multiple interactions	ISO	9	42,984,834	43,066,195	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Xrcc5	X-ray repair complementing defective repair in Chinese hamster cells 5		multiple interactions	ISO	9	71,472,459	71,581,936	RGD:6480464	CTD
G	Xrcc6	X-ray repair complementing defective repair in Chinese hamster cells 6		multiple interactions	ISO	7	120,401,944	120,422,923	RGD:6480464	CTD
G	Zfp143	zinc finger protein 143		multiple interactions	ISO	1	167,704,313	167,740,073	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
role	482262
application	245197
food additive	24034
acidity regulator	17484
acetic acid	17384
acetate ester	1935
wortmannin	398
PX-866	0
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
p-block element atom	458699
carbon group element atom	410677
carbon atom	407233
organic molecular entity	407226
organic group	167766
organic divalent group	166601
organodiyl group	166601
carbonyl group	166291
carbonyl compound	166291
carboxylic acid	121484
monocarboxylic acid	70508
acetic acid	17384
acetate ester	1935
wortmannin	398
PX-866	0