mifepristone - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	mifepristone	go back to main search page
Accession:	CHEBI:50692	browse the term
Definition:	A 3-oxo steroid that has formula C29H35NO2.
Synonyms:	exact_synonym:	11beta-[4-(dimethylamino)phenyl]-17beta-hydroxy-17alpha-(prop-1-yn-1-yl)estra-4,9-dien-3-one
	related_synonym:	11-(4-DIMETHYLAMINO-PHENYL)-17-HYDROXY-13-METHYL-17-PROP-1-YNYL-1,2,6,7,8,11,12,13,14,15,16,17-DODEC AHYDRO-CYCLOPENTA[A]PHENANTHREN-3-ONE; C29H35NO2; InChI=1S/C29H35NO2/c1-5-15-29(32)16-14-26-24-12-8-20-17-22(31)11-13-23(20)27(24)25(18-28(26,29)2)19-6-9-21(10-7-19)30(3)4/h6-7,9-10,17,24-26,32H,8,11-14,16,18H2,1-4H3/t24-,25+,26-,28-,29-/m0/s1; InChIKey=VKHAHZOOUSRJNA-GCNJZUOMSA-N; Mifegyne; Mifeprex; RU-486; RU486; [H][C@@]12CCC3=CC(=O)CCC3=C1[C@H](C[C@@]1(C)[C@@]2([H])CC[C@@]1(O)C#CC)c1ccc(cc1)N(C)C; mifepristona; mifepristonum
	alt_id:	CHEBI:40057; CHEBI:6934
	xref_casrn:	84371-65-3
	xref:	ChEMBL:812273 "ChEMBL COMPOUND"; ChemIDplus:84371-65-3 "CAS Registry Number"; DrugBank:DB00834 "DrugBank"; KEGG COMPOUND:84371-65-3 "CAS Registry Number"; KEGG COMPOUND:C07652 "KEGG COMPOUND"; KEGG DRUG:D00585 "KEGG DRUG"
	xref_mesh:	MESH:D015735
	xref:	PDBeChem:486 "PDBeChem"; Patent:EP57115 "Patent"; Patent:US4386085 "Patent"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

mifepristone
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		increases expression	ISO				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		increases expression	ISO				RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		increases expression	ISO	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc8	ATP-binding cassette, subfamily C (CFTR/MRP), member 8		decreases expression	ISO	1	96,622,574	96,703,723	RGD:6480464	CTD
G	Ablim1	actin-binding LIM protein 1		increases expression	ISO	1	263,380,818	263,465,905	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		multiple interactions	EXP	10	95,361,338	95,381,455	RGD:6480464	CTD
G	Acly	ATP citrate lyase		increases expression	ISO	10	89,420,934	89,471,398	RGD:6480464	CTD
G	Actb	actin, beta		decreases expression	ISO	12	12,047,070	12,050,040	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		multiple interactions	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipor2	adiponectin receptor 2		multiple interactions	ISO	4	155,664,035	155,677,627	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	EXP	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Aimp1	aminoacyl tRNA synthetase complex-interacting multifunctional protein 1		increases expression	ISO	2	230,142,679	230,166,226	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Aldh3b2	aldehyde dehydrogenase 3 family, member B2		decreases expression	ISO	1	206,549,529	206,553,424	RGD:6480464	CTD
G	Aldoc	aldolase C, fructose-bisphosphate		decreases expression	ISO	10	64,308,826	64,312,415	RGD:6480464	CTD
G	Ankrd10	ankyrin repeat domain 10		increases expression	ISO	16	82,719,075	82,742,218	RGD:6480464	CTD
G	Anpep	alanyl (membrane) aminopeptidase		decreases expression	ISO	1	135,600,751	135,619,208	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		increases expression	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Apoc1	apolipoprotein C-I		decreases expression	ISO	1	78,996,677	78,999,960	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Araf	v-raf murine sarcoma 3611 viral oncogene homolog		multiple interactions	ISO	X	12,556,904	12,568,583	RGD:6480464	CTD
G	Arhgap28	Rho GTPase activating protein 28		increases expression	ISO	9	106,996,258	107,162,388	RGD:6480464	CTD
G	Arl4d	ADP-ribosylation factor-like 4D		decreases expression	ISO	10	90,700,469	90,702,625	RGD:6480464	CTD
G	Arl6ip1	ADP-ribosylation factor-like 6 interacting protein 1		increases expression	ISO	1	176,332,729	176,342,244	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		multiple interactions	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Axin2	axin 2		increases expression	ISO	10	98,294,466	98,321,830	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		decreases expression	ISO	1	211,597,624	211,604,142	RGD:6480464	CTD
G	B3gnt6	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 6 (core 3 synthase)		decreases expression	ISO	1	155,435,459	155,440,490	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	EXP	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		affects localization	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bcat2	branched chain amino acid transaminase 2, mitochondrial		decreases expression	ISO	1	96,038,287	96,055,622	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		decreases expression	ISO				RGD:6480464	CTD
G	Bid	BH3 interacting domain death agonist		increases expression	ISO	4	157,296,383	157,318,481	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO				RGD:6480464	CTD
G	Bnip2	BCL2/adenovirus E1B interacting protein 2		increases expression	ISO	8	74,421,904	74,435,300	RGD:6480464	CTD
G	Bscl2	Berardinelli-Seip congenital lipodystrophy 2 (seipin)		decreases expression	ISO	1	211,509,675	211,518,963	RGD:6480464	CTD
G	Btk	Bruton agammaglobulinemia tyrosine kinase		increases expression	ISO	X	121,998,935	122,030,289	RGD:6480464	CTD
G	C1qtnf6	C1q and tumor necrosis factor related protein 6		increases expression	ISO	7	116,479,791	116,486,309	RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	EXP				RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	EXP				RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	EXP				RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	EXP				RGD:6480464	CTD
G	Cabin1	calcineurin binding protein 1		increases expression	ISO	20	13,444,801	13,569,453	RGD:6480464	CTD
G	Camp	cathelicidin antimicrobial peptide		decreases expression	ISO	8	114,214,914	114,216,728	RGD:6480464	CTD
G	Capn5	calpain 5		decreases expression	ISO	1	155,366,678	155,421,183	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		decreases expression	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	ISO	4	42,956,102	42,989,057	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		decreases expression	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccna2	cyclin A2		decreases expression	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccne1	cyclin E1		multiple interactions	ISO	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Cd28	Cd28 molecule		multiple interactions	ISO	9	59,342,273	59,367,743	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		decreases expression	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd4	Cd4 molecule		multiple interactions	ISO	4	160,988,512	161,014,038	RGD:6480464	CTD
G	Cd4	Cd4 molecule		decreases expression	ISO	4	160,988,512	161,014,038	RGD:6480464	CTD
G	Cd69	Cd69 molecule		increases expression	ISO	4	166,527,683	166,535,601	RGD:6480464	CTD
G	Cdc25c	cell division cycle 25C		multiple interactions	ISO	18	27,206,537	27,225,811	RGD:6480464	CTD
G	Cdh1	cadherin 1		increases expression	ISO	19	36,442,693	36,512,091	RGD:6480464	CTD
G	Cdh11	cadherin 11		increases expression	ISO	19	2,225,209	2,382,805	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		increases expression	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		decreases expression	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		multiple interactions	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		multiple interactions	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		multiple interactions	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		multiple interactions	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		decreases expression	ISO	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Cmtm6	CKLF-like MARVEL transmembrane domain containing 6		increases expression	ISO	8	119,149,810	119,165,515	RGD:6480464	CTD
G	Cntnap1	contactin associated protein 1		decreases expression	ISO	10	90,185,756	90,210,837	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		decreases expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col4a5	collagen, type IV, alpha 5		decreases expression	ISO	X	36,918,697	37,130,659	RGD:6480464	CTD
G	Cp	ceruloplasmin (ferroxidase)		multiple interactions	ISO	2	105,086,278	105,135,367	RGD:6480464	CTD
G	Cpz	carboxypeptidase Z		increases expression	ISO	14	80,857,371	80,880,592	RGD:6480464	CTD
G	Crebbp	CREB binding protein		multiple interactions	ISO	10	11,598,680	11,724,122	RGD:6480464	CTD
G	Crh	corticotropin releasing hormone		multiple interactions	EXP	2	104,764,023	104,765,887	RGD:6480464	CTD
G	Crispld2	cysteine-rich secretory protein LCCL domain containing 2		decreases expression	ISO	19	50,313,710	50,378,031	RGD:6480464	CTD
G	Cst7	cystatin F (leukocystatin)		decreases expression	ISO	3	141,188,442	141,199,756	RGD:6480464	CTD
G	Ctnnal1	catenin (cadherin associated protein), alpha-like 1		increases expression	ISO	5	74,716,087	74,771,424	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		increases expression	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		increases expression	ISO	19	10,666,940	10,676,424	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		decreases expression	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		increases expression	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl13	chemokine (C-X-C motif) ligand 13		decreases expression	ISO	14	15,126,332	15,131,368	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		increases expression	ISO	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cxcr7	chemokine (C-X-C motif) receptor 7		decreases expression	ISO	9	89,343,528	89,355,053	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	EXP	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	EXP	6	2,548,224	2,553,767	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	EXP	6	2,548,224	2,553,767	RGD:6480464	CTD
G	Cyp2a3	cytochrome P450, family 2, subfamily a, polypeptide 3		multiple interactions	ISO	1	81,944,896	81,953,007	RGD:6480464	CTD
G	Cyp2b1	cytochrome P450, family 2, subfamily b, polypeptide 1		increases expression	EXP	1	81,266,828	81,290,471	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		increases expression	EXP	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		multiple interactions	ISO	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		decreases activity	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		decreases activity	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		increases expression	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp4b1	cytochrome P450, family 4, subfamily b, polypeptide 1		decreases expression	ISO	5	135,917,327	135,934,636	RGD:6480464	CTD
G	Dcn	decorin		increases expression	ISO	7	35,004,234	35,045,191	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		decreases expression	ISO	20	27,252,273	27,254,371	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		multiple interactions	EXP	20	27,252,273	27,254,371	RGD:6480464	CTD
G	Dhrs3	dehydrogenase/reductase (SDR family) member 3		multiple interactions	ISO	5	163,341,856	163,375,604	RGD:6480464	CTD
G	Dio2	deiodinase, iodothyronine, type II		increases expression	ISO	6	114,307,758	114,317,563	RGD:6480464	CTD
G	Dio2	deiodinase, iodothyronine, type II		multiple interactions	EXP	6	114,307,758	114,317,563	RGD:6480464	CTD
G	Dkk1	dickkopf 1 homolog (Xenopus laevis)		multiple interactions	ISO	1	234,392,743	234,396,426	RGD:6480464	CTD
G	Dkk1	dickkopf 1 homolog (Xenopus laevis)		multiple interactions	ISO	1	234,392,743	234,396,426	RGD:6480464	CTD
G	Dkk1	dickkopf 1 homolog (Xenopus laevis)		multiple interactions	ISO	1	234,392,743	234,396,426	RGD:6480464	CTD
G	Dlc1	deleted in liver cancer 1		multiple interactions	ISO	16	59,312,930	59,355,129	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		increases expression	ISO	6	63,583,033	63,587,247	RGD:6480464	CTD
G	E2f1	E2F transcription factor 1		decreases expression	ISO	3	145,032,489	145,043,729	RGD:6480464	CTD
G	Ednrb	endothelin receptor type B		increases expression	ISO	15	87,893,141	87,898,700	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Enc1	ectodermal-neural cortex 1		increases expression	ISO	2	27,720,805	27,733,168	RGD:6480464	CTD
G	Epb41l3	erythrocyte membrane protein band 4.1-like 3		increases expression	ISO	9	108,303,607	108,426,942	RGD:6480464	CTD
G	Esm1	endothelial cell-specific molecule 1		increases expression	ISO	2	44,626,010	44,634,748	RGD:6480464	CTD
G	Exosc5	exosome component 5		decreases expression	ISO	1	80,871,353	80,876,329	RGD:6480464	CTD
G	F13a1	coagulation factor XIII, A1 polypeptide		increases expression	ISO	17	34,093,525	34,270,498	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		multiple interactions	EXP	2	25,985,800	25,989,072	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	2	218,371,050	218,382,645	RGD:6480464	CTD
G	Fah	fumarylacetoacetate hydrolase		decreases expression	ISO	1	140,851,975	140,876,187	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		increases expression	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fasn	fatty acid synthase		multiple interactions	ISO				RGD:6480464	CTD
G	Fbln1	fibulin 1		multiple interactions	ISO	7	123,208,154	123,287,289	RGD:6480464	CTD
G	Fbln1	fibulin 1		decreases expression	ISO	7	123,208,154	123,287,289	RGD:6480464	CTD
G	Fbxo46	F-box protein 46		decreases expression	ISO	1	78,480,914	78,497,104	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Flrt2	fibronectin leucine rich transmembrane protein 2		decreases expression	ISO	6	119,569,366	119,658,949	RGD:6480464	CTD
G	Foxn3	forkhead box N3		increases expression	ISO	6	123,385,156	123,762,322	RGD:6480464	CTD
G	Foxo3	forkhead box O3		multiple interactions	ISO	20	46,171,784	46,262,818	RGD:6480464	CTD
G	Foxq1	forkhead box Q1		multiple interactions	EXP	17	39,332,906	39,334,655	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		multiple interactions	EXP	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fstl3	follistatin-like 3 (secreted glycoprotein)		decreases expression	ISO	7	11,438,360	11,442,885	RGD:6480464	CTD
G	Fzd10	frizzled family receptor 10		increases expression	ISO	12	29,164,632	29,166,832	RGD:6480464	CTD
G	Fzd4	frizzled family receptor 4		increases expression	ISO	1	145,953,743	145,957,666	RGD:6480464	CTD
G	Fzd6	frizzled family receptor 6		increases expression	ISO	7	74,562,307	74,594,014	RGD:6480464	CTD
G	Fzd9	frizzled family receptor 9		increases expression	ISO	12	22,581,510	22,583,824	RGD:6480464	CTD
G	Gclc	glutamate-cysteine ligase, catalytic subunit		multiple interactions	ISO	8	82,724,429	82,762,848	RGD:6480464	CTD
G	Gclc	glutamate-cysteine ligase, catalytic subunit		increases expression	ISO	8	82,724,429	82,762,848	RGD:6480464	CTD
G	Gclm	glutamate cysteine ligase, modifier subunit		increases expression	ISO	2	218,895,434	218,915,491	RGD:6480464	CTD
G	Gclm	glutamate cysteine ligase, modifier subunit		multiple interactions	ISO	2	218,895,434	218,915,491	RGD:6480464	CTD
G	Ggta1	glycoprotein, alpha-galactosyltransferase 1		multiple interactions	ISO	3	14,485,028	14,559,484	RGD:6480464	CTD
G	Gja1	gap junction protein, alpha 1		increases expression	ISO	20	35,409,815	35,422,262	RGD:6480464	CTD
G	Gmppa	GDP-mannose pyrophosphorylase A		decreases expression	ISO	9	74,713,604	74,721,031	RGD:6480464	CTD
G	Gpr56	G protein-coupled receptor 56		decreases expression	ISO	19	10,438,332	10,475,607	RGD:6480464	CTD
G	Grb2	growth factor receptor bound protein 2		multiple interactions	ISO	10	105,722,014	105,818,649	RGD:6480464	CTD
G	Gria1	glutamate receptor, ionotropic, AMPA 1		decreases expression	ISO	10	42,613,359	42,616,610	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsta1	glutathione S-transferase alpha 1		increases expression	ISO	9	20,051,501	20,068,146	RGD:6480464	CTD
G	Gsta2	glutathione S-transferase alpha 2		multiple interactions	EXP	8	83,299,249	83,312,958	RGD:6480464	CTD
G	Gsta2	glutathione S-transferase alpha 2		increases expression	EXP	8	83,299,249	83,312,958	RGD:6480464	CTD
G	Gstt2	glutathione S-transferase, theta 2		decreases expression	ISO	20	13,221,696	13,225,367	RGD:6480464	CTD
G	Hdac2	histone deacetylase 2		increases expression	ISO	20	41,162,093	41,186,492	RGD:6480464	CTD
G	Hnf4a	hepatocyte nuclear factor 4, alpha		multiple interactions	ISO	3	154,459,863	154,482,825	RGD:6480464	CTD
G	Hpgd	hydroxyprostaglandin dehydrogenase 15 (NAD)		multiple interactions	ISO	16	37,419,901	37,457,896	RGD:6480464	CTD
G	Hpgd	hydroxyprostaglandin dehydrogenase 15 (NAD)		decreases expression	ISO	16	37,419,901	37,457,896	RGD:6480464	CTD
G	Hras	Harvey rat sarcoma virus oncogene		multiple interactions	ISO	1	201,385,705	201,388,987	RGD:6480464	CTD
G	Hsd11b1	hydroxysteroid 11-beta dehydrogenase 1		multiple interactions	ISO	13	109,063,491	109,089,468	RGD:6480464	CTD
G	Hsd11b2	hydroxysteroid 11-beta dehydrogenase 2		multiple interactions	ISO	19	35,336,342	35,341,585	RGD:6480464	CTD
G	Hsd11b2	hydroxysteroid 11-beta dehydrogenase 2		increases expression	ISO	19	35,336,342	35,341,585	RGD:6480464	CTD
G	Hsd17b6	hydroxysteroid (17-beta) dehydrogenase 6		decreases expression	ISO	7	1,118,183	1,137,670	RGD:6480464	CTD
G	Hsd17b8	hydroxysteroid (17-beta) dehydrogenase 8		decreases expression	ISO	20	4,964,860	4,966,855	RGD:6480464	CTD
G	Htr2b	5-hydroxytryptamine (serotonin) receptor 2B, G protein-coupled		increases expression	ISO	9	84,840,026	84,852,984	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		increases expression	ISO	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		decreases expression	ISO	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Il10	interleukin 10		multiple interactions	ISO	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il12b	interleukin 12B		multiple interactions	ISO	10	29,558,955	29,568,331	RGD:6480464	CTD
G	Il13ra2	interleukin 13 receptor, alpha 2		increases expression	ISO	X	30,505,850	30,533,002	RGD:6480464	CTD
G	Il17a	interleukin 17A		multiple interactions	ISO	9	19,454,979	19,458,467	RGD:6480464	CTD
G	Il17a	interleukin 17A		multiple interactions	ISO	9	19,454,979	19,458,467	RGD:6480464	CTD
G	Il18	interleukin 18		multiple interactions	ISO	8	53,936,584	53,943,228	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il2	interleukin 2		multiple interactions	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il2	interleukin 2		multiple interactions	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il4	interleukin 4		multiple interactions	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il4	interleukin 4		multiple interactions	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il5	interleukin 5		multiple interactions	ISO	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases secretion	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Inhba	inhibin beta-A		increases expression	ISO	17	57,244,466	57,257,531	RGD:6480464	CTD
G	Irak2	interleukin-1 receptor-associated kinase 2		decreases expression	ISO	4	149,543,029	149,599,463	RGD:6480464	CTD
G	Irak4	interleukin-1 receptor-associated kinase 4		decreases expression	ISO	7	133,055,185	133,081,614	RGD:6480464	CTD
G	Itga6	integrin, alpha 6		increases expression	ISO	3	54,202,931	54,272,803	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		increases expression	ISO	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Kdelr2	KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 2		increases expression	ISO				RGD:6480464	CTD
G	Kdr	kinase insert domain receptor		multiple interactions	ISO				RGD:6480464	CTD
G	Kif27	kinesin family member 27		increases expression	ISO	17	12,230,381	12,301,010	RGD:6480464	CTD
G	Klhl6	kelch-like family member 6		increases expression	ISO	11	83,221,776	83,260,528	RGD:6480464	CTD
G	Kmt2d	lysine (K)-specific methyltransferase 2D		decreases expression	ISO	7	137,601,739	137,639,556	RGD:6480464	CTD
G	Lama2	laminin, alpha 2		decreases expression	ISO	1	18,203,466	18,885,462	RGD:6480464	CTD
G	Lama3	laminin, alpha 3		decreases expression	ISO	18	4,030,463	4,121,355	RGD:6480464	CTD
G	Lamc2	laminin, gamma 2		increases expression	ISO	13	68,151,074	68,211,117	RGD:6480464	CTD
G	Ldoc1	leucine zipper, down-regulated in cancer 1		decreases expression	ISO	X	147,294,439	147,294,882	RGD:6480464	CTD
G	Lhb	luteinizing hormone beta		multiple interactions	EXP	1	95,892,999	95,893,988	RGD:6480464	CTD
G	Lhb	luteinizing hormone beta		increases secretion	EXP	1	95,892,999	95,893,988	RGD:6480464	CTD
G	Lmcd1	LIM and cysteine-rich domains 1		decreases expression	ISO	4	148,071,431	148,130,313	RGD:6480464	CTD
G	LOC100360920	KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 2		increases expression	ISO	12	11,498,420	11,513,595	RGD:6480464	CTD
G	LOC500300	similar to hypothetical protein MGC6835		multiple interactions	ISO	4	153,000,782	153,002,562	RGD:6480464	CTD
G	Lpar3	lysophosphatidic acid receptor 3		multiple interactions	ISO	2	244,431,789	244,510,815	RGD:6480464	CTD
G	Lpar3	lysophosphatidic acid receptor 3		decreases expression	ISO	2	244,431,789	244,510,815	RGD:6480464	CTD
G	Lum	lumican		increases expression	ISO	7	35,083,480	35,090,284	RGD:6480464	CTD
G	Lxn	latexin		increases expression	ISO	2	157,310,036	157,315,905	RGD:6480464	CTD
G	Maml3	mastermind like 3 (Drosophila)		increases expression	ISO	2	140,574,982	140,740,461	RGD:6480464	CTD
G	Maoa	monoamine oxidase A		multiple interactions	ISO	X	17,678,960	17,745,908	RGD:6480464	CTD
G	Map1b	microtubule-associated protein 1B		increases expression	ISO	2	30,415,235	30,508,354	RGD:6480464	CTD
G	Map2k1	mitogen activated protein kinase kinase 1		multiple interactions	ISO	8	68,379,074	68,451,554	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk6	mitogen-activated protein kinase 6		increases expression	ISO	8	80,212,726	80,236,362	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Marcksl1	MARCKS-like 1		increases expression	ISO	5	148,669,499	148,672,337	RGD:6480464	CTD
G	Mdm2	p53 E3 ubiquitin protein ligase		increases expression	ISO	7	56,996,694	57,020,926	RGD:6480464	CTD
G	Mgmt	O-6-methylguanine-DNA methyltransferase		multiple interactions	ISO	1	196,629,366	196,866,937	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		decreases expression	ISO	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mmd	monocyte to macrophage differentiation-associated		increases expression	ISO	10	78,664,115	78,692,402	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp10	matrix metallopeptidase 10 (stromelysin 2)		increases expression	ISO	8	4,367,842	4,375,737	RGD:6480464	CTD
G	Mmp14	matrix metallopeptidase 14 (membrane-inserted)		increases expression	ISO	15	32,493,852	32,503,077	RGD:6480464	CTD
G	Mmp16	matrix metallopeptidase 16		increases expression	ISO	5	32,352,311	32,586,469	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		increases expression	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp7	matrix metallopeptidase 7		increases expression	ISO	8	4,526,018	4,533,730	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	EXP	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mpzl1	myelin protein zero-like 1		decreases expression	ISO	13	81,321,155	81,357,929	RGD:6480464	CTD
G	Mstn	myostatin		multiple interactions	EXP	9	45,426,831	45,431,658	RGD:6480464	CTD
G	Mta1	metastasis associated 1		decreases expression	ISO	6	138,118,468	138,143,983	RGD:6480464	CTD
G	Mtor	mechanistic target of rapamycin (serine/threonine kinase)		multiple interactions	ISO	5	165,531,402	165,640,899	RGD:6480464	CTD
G	Muc1	mucin 1, cell surface associated		multiple interactions	ISO	2	181,399,482	181,403,640	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myh7	myosin, heavy chain 7, cardiac muscle, beta		multiple interactions	ISO	15	33,072,928	33,094,595	RGD:6480464	CTD
G	Myl2	myosin, light chain 2, regulatory, cardiac, slow		multiple interactions	ISO	12	35,653,745	35,664,700	RGD:6480464	CTD
G	Ncmap	noncompact myelin associated protein		multiple interactions	ISO	5	154,163,766	154,167,138	RGD:6480464	CTD
G	Ncoa2	nuclear receptor coactivator 2		multiple interactions	ISO	5	5,197,891	5,275,776	RGD:6480464	CTD
G	Ncor1	nuclear receptor co-repressor 1		multiple interactions	ISO	10	48,481,110	48,628,538	RGD:6480464	CTD
G	Ndp	Norrie disease (pseudoglioma)		decreases expression	ISO	X	17,416,946	17,441,393	RGD:6480464	CTD
G	Neurl1a	neuralized homolog 1A (Drosophila)		increases expression	ISO	1	252,502,664	252,573,249	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nme2	NME/NM23 nucleoside diphosphate kinase 2		multiple interactions	ISO	10	82,582,766	82,588,269	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nova1	neuro-oncological ventral antigen 1		increases expression	ISO	6	66,193,472	66,320,240	RGD:6480464	CTD
G	Nphs1	nephrosis 1, congenital, Finnish type (nephrin)		multiple interactions	ISO	1	85,414,492	85,444,233	RGD:6480464	CTD
G	Nppa	natriuretic peptide A		multiple interactions	EXP	5	165,074,518	165,075,827	RGD:6480464	CTD
G	Nppa	natriuretic peptide A		multiple interactions	ISO	5	165,074,518	165,075,827	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		decreases expression	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	EXP	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	EXP	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	ISO	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	ISO	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	ISO	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		increases activity	ISO	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	EXP	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr1i3	nuclear receptor subfamily 1, group I, member 3		multiple interactions	ISO	13	87,104,241	87,108,563	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		affects binding	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Ntn4	netrin 4		increases expression	ISO	7	30,717,988	30,832,378	RGD:6480464	CTD
G	Nubp2	nucleotide binding protein 2		increases expression	ISO	10	14,131,309	14,134,994	RGD:6480464	CTD
G	Ostm1	osteopetrosis associated transmembrane protein 1		increases expression	ISO				RGD:6480464	CTD
G	P2rx3	purinergic receptor P2X, ligand-gated ion channel, 3		multiple interactions	EXP	3	68,228,045	68,270,751	RGD:6480464	CTD
G	P2ry14	purinergic receptor P2Y, G-protein coupled, 14		increases expression	ISO	2	148,501,968	148,503,616	RGD:6480464	CTD
G	Paqr7	progestin and adipoQ receptor family member VII		decreases expression	ISO	5	153,263,432	153,264,469	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases cleavage	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Pc	pyruvate carboxylase		decreases expression	ISO	1	207,112,853	207,212,737	RGD:6480464	CTD
G	Pck1	phosphoenolpyruvate carboxykinase 1 (soluble)		multiple interactions	ISO	3	164,012,410	164,018,359	RGD:6480464	CTD
G	Pemt	phosphatidylethanolamine N-methyltransferase		decreases expression	ISO				RGD:6480464	CTD
G	Per1	period circadian clock 1		multiple interactions	EXP	10	55,859,851	55,868,747	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		affects activity	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		decreases activity	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	EXP	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	EXP	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	EXP	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		multiple interactions	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pgr	progesterone receptor		decreases expression	ISO	8	5,784,717	5,845,901	RGD:6480464	CTD
G	Pibf1	progesterone immunomodulatory binding factor 1		decreases expression	ISO	15	82,881,953	83,056,944	RGD:6480464	CTD
G	Pim1	pim-1 oncogene		multiple interactions	ISO	20	7,817,403	7,821,800	RGD:6480464	CTD
G	Plat	plasminogen activator, tissue		increases expression	ISO	16	73,711,323	73,736,328	RGD:6480464	CTD
G	Plat	plasminogen activator, tissue		multiple interactions	EXP	16	73,711,323	73,736,328	RGD:6480464	CTD
G	Pld1	phospholipase D1		increases expression	ISO	2	115,306,940	115,460,518	RGD:6480464	CTD
G	Plk1s1	polo-like kinase 1 substrate 1		increases expression	ISO	3	135,488,158	135,598,982	RGD:6480464	CTD
G	Plod2	procollagen lysine, 2-oxoglutarate 5-dioxygenase 2		increases expression	ISO	8	97,525,279	97,623,152	RGD:6480464	CTD
G	Plxdc2	plexin domain containing 2		increases expression	ISO	17	90,572,391	90,982,074	RGD:6480464	CTD
G	Pold2	polymerase (DNA directed), delta 2, accessory subunit		decreases expression	ISO	14	86,535,757	86,541,920	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppp1r1c	protein phosphatase 1, regulatory (inhibitor) subunit 1C		increases expression	ISO	3	62,519,426	62,622,517	RGD:6480464	CTD
G	Ppp2r3a	protein phosphatase 2, regulatory subunit B'', alpha		increases expression	ISO	8	106,061,334	106,155,090	RGD:6480464	CTD
G	Ppt2	palmitoyl-protein thioesterase 2		increases expression	ISO	20	4,225,630	4,234,653	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		multiple interactions	ISO	10	97,367,196	97,638,910	RGD:6480464	CTD
G	Prl	prolactin		multiple interactions	ISO	17	44,699,101	44,709,162	RGD:6480464	CTD
G	Prl	prolactin		increases expression	ISO	17	44,699,101	44,709,162	RGD:6480464	CTD
G	Prl	prolactin		multiple interactions	EXP	17	44,699,101	44,709,162	RGD:6480464	CTD
G	Prodh	proline dehydrogenase (oxidase) 1		decreases expression	ISO	11	84,905,060	84,922,229	RGD:6480464	CTD
G	Prpsap1	phosphoribosyl pyrophosphate synthetase-associated protein 1		multiple interactions	EXP	10	106,582,381	106,604,072	RGD:6480464	CTD
G	Psmc6	proteasome (prosome, macropain) 26S subunit, ATPase, 6		increases expression	ISO	15	21,217,367	21,239,320	RGD:6480464	CTD
G	Ptbp2	polypyrimidine tract binding protein 2		increases expression	ISO	2	216,188,745	216,249,176	RGD:6480464	CTD
G	Ptgds	prostaglandin D2 synthase (brain)		decreases expression	ISO	3	3,632,683	3,635,617	RGD:6480464	CTD
G	Ptgir	prostaglandin I2 (prostacyclin) receptor (IP)		increases expression	ISO	1	77,234,538	77,236,921	RGD:6480464	CTD
G	Ptgs1	prostaglandin-endoperoxide synthase 1		decreases expression	ISO	3	15,343,832	15,365,412	RGD:6480464	CTD
G	Ptprk	protein tyrosine phosphatase, receptor type, K		increases expression	ISO	1	17,328,563	17,752,200	RGD:6480464	CTD
G	Rap1b	RAP1B, member of RAS oncogene family		increases expression	ISO	7	57,132,750	57,139,811	RGD:6480464	CTD
G	Rap1b	RAP1B, member of RAS oncogene family		multiple interactions	EXP	7	57,132,750	57,139,811	RGD:6480464	CTD
G	Rarg	retinoic acid receptor, gamma		decreases expression	ISO	7	140,991,447	141,014,108	RGD:6480464	CTD
G	Rasgrp1	RAS guanyl releasing protein 1 (calcium and DAG-regulated)		multiple interactions	ISO	3	103,371,879	103,433,010	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		increases activity	ISO	15	53,828,881	53,962,099	RGD:6480464	CTD
G	Rb1cc1	RB1-inducible coiled-coil 1		increases expression	ISO	5	13,301,486	13,365,398	RGD:6480464	CTD
G	Reep6	receptor accessory protein 6		decreases expression	ISO	7	10,885,266	10,891,936	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rhog	ras homolog family member G		decreases expression	ISO	1	159,724,016	159,735,532	RGD:6480464	CTD
G	Rnf146	ring finger protein 146		increases expression	ISO	1	29,255,138	29,265,731	RGD:6480464	CTD
G	Rpl39	ribosomal protein L39		increases expression	ISO	X	7,825,919	7,827,935	RGD:6480464	CTD
G	Rprm	reprimo, TP53 dependent G2 arrest mediator candidate		decreases expression	ISO	3	35,590,166	35,591,583	RGD:6480464	CTD
G	Rps10	ribosomal protein S10		increases expression	ISO	20	5,849,327	5,853,893	RGD:6480464	CTD
G	Rps10l1	ribosomal protein S10-like 1		increases expression	ISO	6	74,838,974	74,839,471	RGD:6480464	CTD
G	RT1-DOb	RT1 class II, locus DOb		decreases expression	ISO	20	4,753,940	4,759,648	RGD:6480464	CTD
G	RT1-M3-1	RT1 class Ib, locus M3, gene 1		multiple interactions	ISO	20	1,412,553	1,416,692	RGD:6480464	CTD
G	S100a6	S100 calcium binding protein A6		decreases expression	ISO	2	182,895,080	182,896,305	RGD:6480464	CTD
G	S100g	S100 calcium binding protein G		multiple interactions	ISO	X	52,446,817	52,449,342	RGD:6480464	CTD
G	S100g	S100 calcium binding protein G		multiple interactions	EXP	X	52,446,817	52,449,342	RGD:6480464	CTD
G	Sec23ip	SEC23 interacting protein		increases expression	ISO	1	187,999,550	188,042,408	RGD:6480464	CTD
G	Sec62	SEC62 homolog (S. cerevisiae)		increases expression	ISO	2	116,990,256	117,025,688	RGD:6480464	CTD
G	Senp1	SUMO1/sentrin specific peptidase 1		increases expression	ISO	7	136,746,791	136,808,933	RGD:6480464	CTD
G	Sept4	septin 4		decreases expression	ISO	10	75,871,422	75,880,878	RGD:6480464	CTD
G	Serf2	small EDRK-rich factor 2		increases expression	ISO	3	108,255,260	108,258,848	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		decreases expression	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		multiple interactions	EXP	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Serpinf1	serpin peptidase inhibitor, clade F (alpha-2 antiplasmin, pigment epithelium derived factor), member 1		decreases expression	ISO	10	62,713,441	62,739,444	RGD:6480464	CTD
G	Sesn3	sestrin 3		increases expression	ISO	8	11,076,055	11,125,523	RGD:6480464	CTD
G	Sfrp1	secreted frizzled-related protein 1		increases expression	ISO	16	73,030,458	73,067,304	RGD:6480464	CTD
G	Sgip1	SH3-domain GRB2-like (endophilin) interacting protein 1		increases expression	ISO	5	123,696,703	123,897,989	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		multiple interactions	ISO	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		multiple interactions	EXP	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		multiple interactions	EXP	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Slc22a3	solute carrier family 22 (extraneuronal monoamine transporter), member 3		decreases expression	ISO	1	42,690,158	42,781,895	RGD:6480464	CTD
G	Slc27a5	solute carrier family 27 (fatty acid transporter), member 5		decreases expression	ISO	1	72,924,630	72,935,223	RGD:6480464	CTD
G	Slc2a5	solute carrier family 2 (facilitated glucose/fructose transporter), member 5		multiple interactions	EXP	5	167,240,442	167,285,761	RGD:6480464	CTD
G	Slc30a2	solute carrier family 30 (zinc transporter), member 2		multiple interactions	EXP	5	153,086,346	153,098,569	RGD:6480464	CTD
G	Slc43a1	solute carrier family 43, member 1		decreases expression	ISO	3	68,049,296	68,090,034	RGD:6480464	CTD
G	Slc7a4	solute carrier family 7 (orphan transporter), member 4		decreases expression	ISO	11	85,426,546	85,430,217	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		increases expression	ISO				RGD:6480464	CTD
G	Slco2a1	solute carrier organic anion transporter family, member 2a1		multiple interactions	ISO	8	108,012,829	108,098,561	RGD:6480464	CTD
G	Slit3	slit homolog 3 (Drosophila)		decreases expression	ISO	10	19,983,166	20,576,689	RGD:6480464	CTD
G	Smurf2	SMAD specific E3 ubiquitin protein ligase 2		increases expression	ISO	10	96,170,590	96,269,365	RGD:6480464	CTD
G	Snx12	sorting nexin 12		decreases expression	ISO	X	89,180,623	89,302,886	RGD:6480464	CTD
G	Snx2	sorting nexin 2		increases expression	ISO	18	48,642,904	48,684,466	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod3	superoxide dismutase 3, extracellular		multiple interactions	EXP	14	63,381,447	63,387,180	RGD:6480464	CTD
G	Sox9	SRY (sex determining region Y)-box 9		increases expression	ISO	10	102,392,187	102,394,256	RGD:6480464	CTD
G	Spag1	sperm associated antigen 1		increases expression	ISO	7	71,699,341	71,759,373	RGD:6480464	CTD
G	Sphk1	sphingosine kinase 1		multiple interactions	EXP	10	106,641,509	106,645,579	RGD:6480464	CTD
G	Srpx	sushi-repeat-containing protein, X-linked		decreases expression	ISO	X	24,833,279	24,904,349	RGD:6480464	CTD
G	Srpx2	sushi-repeat-containing protein, X-linked 2		increases expression	ISO	X	121,446,756	121,468,691	RGD:6480464	CTD
G	St6galnac2	ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2		increases expression	ISO	10	106,793,126	106,811,346	RGD:6480464	CTD
G	Star	steroidogenic acute regulatory protein		decreases expression	ISO	16	70,642,580	70,647,203	RGD:6480464	CTD
G	Stmn2	stathmin-like 2		increases expression	ISO	2	95,284,903	95,332,686	RGD:6480464	CTD
G	Sult1a1	sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1		multiple interactions	EXP	1	185,829,205	185,832,725	RGD:6480464	CTD
G	Sult1e1	sulfotransferase family 1E, estrogen-preferring, member 1		multiple interactions	ISO	14	21,948,475	21,965,541	RGD:6480464	CTD
G	Sumo1	SMT3 suppressor of mif two 3 homolog 1 (S. cerevisiae)		increases expression	ISO	9	58,212,538	58,242,760	RGD:6480464	CTD
G	Svil	supervillin		increases expression	ISO	17	60,897,631	60,898,874	RGD:6480464	CTD
G	Syngr1	synaptogyrin 1		decreases expression	ISO	7	118,328,188	118,351,610	RGD:6480464	CTD
G	Tat	tyrosine aminotransferase		multiple interactions	ISO	19	39,854,163	39,865,060	RGD:6480464	CTD
G	Tat	tyrosine aminotransferase		multiple interactions	EXP	19	39,854,163	39,865,060	RGD:6480464	CTD
G	Tat	tyrosine aminotransferase		multiple interactions	EXP	19	39,854,163	39,865,060	RGD:6480464	CTD
G	Tat	tyrosine aminotransferase		multiple interactions	EXP	19	39,854,163	39,865,060	RGD:6480464	CTD
G	Tek	TEK tyrosine kinase, endothelial		increases expression	ISO	5	115,047,195	115,196,172	RGD:6480464	CTD
G	Th	tyrosine hydroxylase		decreases expression	ISO	1	203,164,253	203,171,506	RGD:6480464	CTD
G	Th	tyrosine hydroxylase		multiple interactions	EXP	1	203,164,253	203,171,506	RGD:6480464	CTD
G	Thbs1	thrombospondin 1		increases expression	ISO				RGD:6480464	CTD
G	Thra	thyroid hormone receptor alpha		decreases expression	ISO	10	87,514,443	87,542,306	RGD:6480464	CTD
G	Thrb	thyroid hormone receptor beta		increases expression	ISO	15	9,282,845	9,345,506	RGD:6480464	CTD
G	Timm17a	translocase of inner mitochondrial membrane 17 homolog A (yeast)		increases expression	ISO	13	48,297,516	48,309,303	RGD:6480464	CTD
G	Tiparp	TCDD-inducible poly(ADP-ribose) polymerase		decreases expression	ISO	2	155,312,341	155,339,357	RGD:6480464	CTD
G	Tjp1	tight junction protein 1		increases expression	ISO	1	119,684,774	119,750,532	RGD:6480464	CTD
G	Tlr7	toll-like receptor 7		decreases expression	ISO	X	47,330,737	47,356,841	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		affects response to substance	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf1a	tumor necrosis factor receptor superfamily, member 1a		increases expression	ISO	4	162,172,563	162,185,252	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		multiple interactions	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tp53	tumor protein p53		decreases expression	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Trex1	three prime repair exonuclease 1		multiple interactions	EXP	8	114,071,508	114,072,509	RGD:6480464	CTD
G	Trib2	tribbles homolog 2 (Drosophila)		increases expression	ISO	6	39,474,243	39,496,718	RGD:6480464	CTD
G	Uqcrb	ubiquinol-cytochrome c reductase binding protein		increases expression	ISO	7	67,958,363	67,963,730	RGD:6480464	CTD
G	Uqcrb-ps1	ubiquinol-cytochrome c reductase binding protein, pseudogene 1		increases expression	ISO	1	90,807,565	90,807,900	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Wnt5a	wingless-type MMTV integration site family, member 5A		increases expression	ISO	16	3,782,025	3,799,625	RGD:6480464	CTD
G	Zfp36	zinc finger protein 36		multiple interactions	ISO	1	83,486,643	83,489,123	RGD:6480464	CTD
G	Zfp422	zinc finger protein 422		increases expression	ISO	4	152,975,181	152,979,366	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
role	482262
biological role	480454
pharmacological role	126923
antagonist	28686
hormone antagonist	10711
mifepristone	490
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
p-block element atom	458699
carbon group element atom	410677
carbon atom	407233
organic molecular entity	407226
organic group	167766
organic divalent group	166601
organodiyl group	166601
carbonyl group	166291
carbonyl compound	166291
ketone	31433
oxo steroid	13480
3-oxo steroid	11985
mifepristone	490