2-amino-2-deoxy-D-glucopyranose - Ontology Report

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	2-amino-2-deoxy-D-glucopyranose	go back to main search page
Accession:	CHEBI:47977	browse the term
Definition:	A D-glucosamine whose structure comprises D-glucopyranose having an amino substituent at position 2.
Synonyms:	related_synonym:	2-Amino-2-deoxy-D-glucose; C6H13NO5; Chitosamine; D-Glucosamine; InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6?/m1/s1; InChIKey=MSWZFWKMSRAUBD-IVMDWMLBSA-N; N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O
	alt_id:	CHEBI:4162; CHEBI:47972
	xref_casrn:	3416-24-8
	xref:	Beilstein:1423209 "Beilstein Registry Number"; ChEMBL:570033 "ChEMBL COMPOUND"; CiteXplore:59831 "PubMed citation"; Gmelin:397125 "Gmelin Registry Number"; KEGG COMPOUND:3416-24-8 "CAS Registry Number"; KEGG COMPOUND:C00329 "KEGG COMPOUND"
	xref_mesh:	MESH:D005944
	xref:	Reaxys:1423209 "Reaxys Registry Number"
	cyclic_relationship:	is_conjugate_base_of CHEBI:58723

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

2-amino-2-deoxy-D-glucopyranose
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Aacs	acetoacetyl-CoA synthetase		increases expression	ISO	12	32,206,863	32,250,583	RGD:6480464	CTD
G	Abcg1	ATP-binding cassette, subfamily G (WHITE), member 1		increases expression	EXP	20	9,390,485	9,459,574	RGD:6480464	CTD
G	Acaca	acetyl-CoA carboxylase alpha		increases expression	ISO	10	72,483,772	72,677,134	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	EXP	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		affects expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		decreases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acot3	acyl-CoA thioesterase 3		increases expression	ISO	6	108,089,349	108,095,288	RGD:6480464	CTD
G	Acox2	acyl-CoA oxidase 2, branched chain		decreases expression	ISO	15	18,645,349	18,677,855	RGD:6480464	CTD
G	Acss2	acyl-CoA synthetase short-chain family member 2		increases expression	ISO	3	146,013,995	146,057,119	RGD:6480464	CTD
G	Adam15	ADAM metallopeptidase domain 15		multiple interactions	EXP	2	181,527,175	181,537,640	RGD:6480464	CTD
G	Adam15	ADAM metallopeptidase domain 15		decreases expression	EXP	2	181,527,175	181,537,640	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		multiple interactions	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		increases expression	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		decreases expression	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	EXP	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		decreases expression	EXP	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts4	ADAM metallopeptidase with thrombospondin type 1 motif, 4		increases expression	EXP	13	87,142,442	87,151,783	RGD:6480464	CTD
G	Adamts5	ADAM metallopeptidase with thrombospondin type 1 motif, 5		decreases expression	ISO	11	25,503,380	25,548,851	RGD:6480464	CTD
G	Adamts5	ADAM metallopeptidase with thrombospondin type 1 motif, 5		multiple interactions	ISO	11	25,503,380	25,548,851	RGD:6480464	CTD
G	Adamts9	ADAM metallopeptidase with thrombospondin type 1 motif, 9		decreases cleavage	ISO	4	126,996,604	127,198,909	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	EXP	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Afp	alpha-fetoprotein		increases expression	ISO	14	19,092,563	19,110,728	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases expression	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Ahi1	Abelson helper integration site 1		decreases expression	ISO	1	16,332,801	16,454,055	RGD:6480464	CTD
G	Akr1b8	aldo-keto reductase family 1, member B8		increases expression	EXP	4	61,714,282	61,726,856	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		affects phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Alg12	asparagine-linked glycosylation 12, alpha-1,6-mannosyltransferase		decreases expression	ISO	7	127,109,296	127,123,482	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		multiple interactions	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		increases activity	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		increases expression	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		increases secretion	ISO				RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		increases stability	ISO				RGD:6480464	CTD
G	Apob	apolipoprotein B		increases degradation	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases expression	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases localization	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases secretion	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		increases ubiquitination	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apoe	apolipoprotein E		multiple interactions	ISO	1	79,003,634	79,006,387	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		multiple interactions	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		decreases expression	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		multiple interactions	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		increases expression	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		decreases expression	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		multiple interactions	EXP	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		increases expression	EXP	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		increases expression	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf7ip	activating transcription factor 7 interacting protein		increases expression	ISO	4	173,566,920	173,586,494	RGD:6480464	CTD
G	Atp2a2	ATPase, Ca++ transporting, cardiac muscle, slow twitch 2		decreases expression	ISO	12	35,266,600	35,316,237	RGD:6480464	CTD
G	Azin1	antizyme inhibitor 1		decreases expression	EXP	7	74,159,130	74,189,447	RGD:6480464	CTD
G	Azin1	antizyme inhibitor 1		multiple interactions	EXP	7	74,159,130	74,189,447	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		multiple interactions	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		increases expression	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		multiple interactions	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		decreases expression	ISO				RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		increases expression	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bgn	biglycan		multiple interactions	EXP	X	159,380,557	159,393,409	RGD:6480464	CTD
G	Bgn	biglycan		decreases expression	EXP	X	159,380,557	159,393,409	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	EXP	3	121,372,692	121,381,236	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		decreases expression	EXP	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	EXP	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		multiple interactions	EXP	17	32,380,199	32,689,295	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		decreases expression	EXP	17	32,380,199	32,689,295	RGD:6480464	CTD
G	Bmp7	bone morphogenetic protein 7		multiple interactions	EXP	3	163,723,429	163,799,567	RGD:6480464	CTD
G	Bmp7	bone morphogenetic protein 7		increases expression	EXP	3	163,723,429	163,799,567	RGD:6480464	CTD
G	Calr	calreticulin		decreases expression	ISO	19	24,964,775	24,969,670	RGD:6480464	CTD
G	Car3	carbonic anhydrase 3		decreases expression	EXP	2	88,106,727	88,114,686	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		decreases expression	ISO	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Cbr3	carbonyl reductase 3		increases expression	ISO	11	33,913,961	33,922,221	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		multiple interactions	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		increases expression	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl22	chemokine (C-C motif) ligand 22		multiple interactions	EXP	19	10,697,324	10,704,129	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	EXP	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		multiple interactions	EXP	10	70,267,281	70,269,131	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		increases expression	EXP	10	70,267,281	70,269,131	RGD:6480464	CTD
G	Ccnb1	cyclin B1		decreases expression	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Cd24	CD24 molecule		increases expression	ISO	20	47,502,354	47,507,663	RGD:6480464	CTD
G	Cd28	Cd28 molecule		increases expression	EXP	9	59,342,273	59,367,743	RGD:6480464	CTD
G	Cdc20	cell division cycle 20		decreases expression	EXP	5	138,913,180	138,916,744	RGD:6480464	CTD
G	Cdc23	cell division cycle 23		decreases expression	EXP	18	27,108,516	27,128,285	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		decreases expression	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		decreases expression	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		decreases expression	EXP	15	22,617,409	22,624,922	RGD:6480464	CTD
G	Cenpf	centromere protein F		decreases expression	EXP	13	105,920,242	105,965,655	RGD:6480464	CTD
G	Chi3l1	chitinase 3-like 1 (cartilage glycoprotein-39)		decreases expression	ISO	13	47,139,658	47,147,591	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		multiple interactions	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		decreases activity	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Ckap2	cytoskeleton associated protein 2		decreases expression	EXP	16	74,492,221	74,518,743	RGD:6480464	CTD
G	Clta	clathrin, light chain A		decreases expression	EXP	5	60,484,437	60,502,432	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		multiple interactions	EXP	2	209,996,467	210,193,379	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		decreases expression	EXP	2	209,996,467	210,193,379	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		decreases expression	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		increases expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		affects expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		increases expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	EXP	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col8a1	collagen, type VIII, alpha 1		multiple interactions	EXP	11	43,604,994	43,733,870	RGD:6480464	CTD
G	Col8a1	collagen, type VIII, alpha 1		decreases expression	EXP	11	43,604,994	43,733,870	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		multiple interactions	EXP	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		decreases expression	EXP	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		increases expression	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		multiple interactions	EXP	10	87,473,990	87,476,365	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		increases expression	EXP	10	87,473,990	87,476,365	RGD:6480464	CTD
G	Ctgf	connective tissue growth factor		increases expression	EXP	1	21,327,099	21,330,215	RGD:6480464	CTD
G	Ctsd	cathepsin D		affects localization	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		increases activity	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		multiple interactions	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		decreases expression	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Cul2	cullin 2		multiple interactions	ISO	17	62,701,289	62,741,344	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		decreases expression	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		multiple interactions	ISO	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		multiple interactions	EXP	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl11	chemokine (C-X-C motif) ligand 11		multiple interactions	EXP	14	17,250,648	17,253,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases expression	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		increases expression	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl3	chemokine (C-X-C motif) ligand 3		increases expression	EXP	14	18,767,306	18,787,340	RGD:6480464	CTD
G	Cxcl3	chemokine (C-X-C motif) ligand 3		multiple interactions	EXP	14	18,767,306	18,787,340	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		multiple interactions	EXP	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		decreases expression	ISO	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		affects localization	ISO	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		affects localization	ISO	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Cyp51	cytochrome P450, family 51		increases expression	ISO	4	26,752,677	26,771,131	RGD:6480464	CTD
G	Dbi	diazepam binding inhibitor (GABA receptor modulator, acyl-CoA binding protein)		increases expression	ISO				RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		decreases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit4l	DNA-damage-inducible transcript 4-like		increases expression	EXP	2	51,881,101	51,881,461	RGD:6480464	CTD
G	Dhcr7	7-dehydrocholesterol reductase		increases expression	ISO	1	204,245,562	204,258,913	RGD:6480464	CTD
G	Dnajb11	DnaJ (Hsp40) homolog, subfamily B, member 11		decreases expression	ISO	11	80,360,406	80,376,870	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		decreases expression	ISO	6	63,583,033	63,587,247	RGD:6480464	CTD
G	Dnajc3	DnaJ (Hsp40) homolog, subfamily C, member 3		decreases expression	ISO	15	103,881,634	103,921,295	RGD:6480464	CTD
G	Dspp	dentin sialophosphoprotein		decreases expression	ISO	14	6,674,662	6,680,769	RGD:6480464	CTD
G	Dusp5	dual specificity phosphatase 5		multiple interactions	EXP	1	259,754,234	259,767,645	RGD:6480464	CTD
G	Dusp5	dual specificity phosphatase 5		increases expression	EXP	1	259,754,234	259,767,645	RGD:6480464	CTD
G	Dusp7	dual specificity phosphatase 7		multiple interactions	EXP	8	111,510,358	111,515,989	RGD:6480464	CTD
G	Dusp7	dual specificity phosphatase 7		decreases expression	EXP	8	111,510,358	111,515,989	RGD:6480464	CTD
G	Dync1i1	dynein cytoplasmic 1 intermediate chain 1		decreases expression	EXP	4	30,496,410	30,809,622	RGD:6480464	CTD
G	Edem1	ER degradation enhancer, mannosidase alpha-like 1		decreases expression	ISO	4	144,349,966	144,379,501	RGD:6480464	CTD
G	Eif2ak3	eukaryotic translation initiation factor 2 alpha kinase 3		multiple interactions	EXP	4	104,016,940	104,078,261	RGD:6480464	CTD
G	Eif2ak3	eukaryotic translation initiation factor 2 alpha kinase 3		increases phosphorylation	ISO	4	104,016,940	104,078,261	RGD:6480464	CTD
G	Eif2s1	eukaryotic translation initiation factor 2, subunit 1 alpha		increases phosphorylation	ISO	6	101,495,444	101,520,113	RGD:6480464	CTD
G	Eif2s1	eukaryotic translation initiation factor 2, subunit 1 alpha		multiple interactions	EXP	6	101,495,444	101,520,113	RGD:6480464	CTD
G	Eif2s1	eukaryotic translation initiation factor 2, subunit 1 alpha		increases phosphorylation	EXP	6	101,495,444	101,520,113	RGD:6480464	CTD
G	Elovl6	ELOVL fatty acid elongase 6		increases expression	ISO	2	226,946,573	227,054,321	RGD:6480464	CTD
G	Epas1	endothelial PAS domain protein 1		decreases expression	EXP	6	10,203,108	10,297,215	RGD:6480464	CTD
G	Epas1	endothelial PAS domain protein 1		multiple interactions	EXP	6	10,203,108	10,297,215	RGD:6480464	CTD
G	Eprs	glutamyl-prolyl-tRNA synthetase		decreases expression	ISO	13	101,375,656	101,448,175	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		increases expression	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		increases expression	EXP	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fasn	fatty acid synthase		increases expression	ISO				RGD:6480464	CTD
G	Fbp2	fructose-1,6-bisphosphatase 2		increases expression	ISO	17	7,824,298	7,841,661	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		multiple interactions	EXP	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		decreases expression	EXP	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		multiple interactions	EXP	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fgf9	fibroblast growth factor 9		multiple interactions	EXP	15	37,115,068	37,155,652	RGD:6480464	CTD
G	Fgf9	fibroblast growth factor 9		increases expression	EXP	15	37,115,068	37,155,652	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		multiple interactions	EXP	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		increases expression	EXP	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		increases expression	ISO	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		decreases expression	EXP	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Fkbp11	FK506 binding protein 11		decreases expression	ISO	7	137,490,985	137,494,418	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	ISO	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Furin	furin (paired basic amino acid cleaving enzyme)		decreases cleavage	ISO	1	136,209,969	136,222,057	RGD:6480464	CTD
G	Furin	furin (paired basic amino acid cleaving enzyme)		multiple interactions	ISO	1	136,209,969	136,222,057	RGD:6480464	CTD
G	Fxyd2	FXYD domain-containing ion transport regulator 2		increases expression	EXP	8	48,379,075	48,385,553	RGD:6480464	CTD
G	Gatm	glycine amidinotransferase (L-arginine:glycine amidinotransferase)		decreases expression	EXP	3	109,558,043	109,565,432	RGD:6480464	CTD
G	Gck	glucokinase		decreases expression	EXP	14	86,572,518	86,587,723	RGD:6480464	CTD
G	Gclc	glutamate-cysteine ligase, catalytic subunit		increases expression	ISO	8	82,724,429	82,762,848	RGD:6480464	CTD
G	Gfpt1	glutamine fructose-6-phosphate transaminase 1		multiple interactions	EXP	4	121,204,274	121,250,160	RGD:6480464	CTD
G	Glrx	glutaredoxin (thioltransferase)		increases expression	ISO	2	2,888,605	2,899,216	RGD:6480464	CTD
G	Gnpnat1	glucosamine-phosphate N-acetyltransferase 1		decreases expression	ISO	15	21,272,165	21,284,459	RGD:6480464	CTD
G	Gnptab	N-acetylglucosamine-1-phosphate transferase, alpha and beta subunits		increases expression	ISO	7	25,084,137	25,149,880	RGD:6480464	CTD
G	Gpd1l	glycerol-3-phosphate dehydrogenase 1-like		increases expression	ISO	8	119,317,528	119,347,194	RGD:6480464	CTD
G	Grem1	gremlin 1		multiple interactions	EXP	3	99,597,201	99,608,935	RGD:6480464	CTD
G	Grem1	gremlin 1		decreases expression	EXP	3	99,597,201	99,608,935	RGD:6480464	CTD
G	Gspt1	G1 to S phase transition 1		multiple interactions	ISO	10	4,249,196	4,283,833	RGD:6480464	CTD
G	Gstt1	glutathione S-transferase theta 1		increases expression	ISO	20	13,604,355	13,621,456	RGD:6480464	CTD
G	Hapln1	hyaluronan and proteoglycan link protein 1		decreases expression	EXP	2	19,576,064	19,638,106	RGD:6480464	CTD
G	Hapln1	hyaluronan and proteoglycan link protein 1		multiple interactions	EXP	2	19,576,064	19,638,106	RGD:6480464	CTD
G	Herpud1	homocysteine-inducible, endoplasmic reticulum stress-inducible, ubiquitin-like domain member 1		decreases expression	ISO	19	11,036,567	11,046,914	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		decreases expression	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		decreases expression	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		decreases expression	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hk1	hexokinase 1		increases expression	ISO				RGD:6480464	CTD
G	Hk1	hexokinase 1		increases expression	EXP				RGD:6480464	CTD
G	Hmga1	high mobility group AT-hook 1		increases expression	EXP	20	5,769,052	5,772,269	RGD:6480464	CTD
G	Hmgcs1	3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble)		increases expression	ISO	2	51,737,090	51,754,583	RGD:6480464	CTD
G	Hmmr	hyaluronan mediated motility receptor (RHAMM)		decreases expression	EXP	10	25,733,375	25,762,825	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		increases expression	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hoxa1	homeo box A1		decreases expression	ISO	4	80,456,728	80,458,388	RGD:6480464	CTD
G	Hpgd	hydroxyprostaglandin dehydrogenase 15 (NAD)		decreases expression	EXP	16	37,419,901	37,457,896	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		decreases expression	ISO	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		increases expression	ISO	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		decreases expression	EXP	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		decreases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hyou1	hypoxia up-regulated 1		decreases expression	ISO	8	47,346,753	47,358,869	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	EXP	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		decreases activity	EXP	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Id1	inhibitor of DNA binding 1		increases expression	ISO	3	143,086,162	143,087,289	RGD:6480464	CTD
G	Id2	inhibitor of DNA binding 2		increases expression	ISO	6	42,781,476	42,783,307	RGD:6480464	CTD
G	Id3	inhibitor of DNA binding 3		increases expression	ISO	5	154,934,138	154,935,707	RGD:6480464	CTD
G	Idh1	isocitrate dehydrogenase 1 (NADP+), soluble		increases expression	ISO	9	63,769,401	63,790,622	RGD:6480464	CTD
G	Ifi204	interferon activated gene 204		increases expression	ISO	13	89,752,997	89,770,167	RGD:6480464	CTD
G	Ifit1	interferon-induced protein with tetratricopeptide repeats 1		increases expression	ISO	1	238,609,171	238,611,236	RGD:6480464	CTD
G	Ifit3	interferon-induced protein with tetratricopeptide repeats 3		increases expression	ISO	1	238,571,300	238,576,443	RGD:6480464	CTD
G	Ifng	interferon gamma		decreases secretion	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		multiple interactions	EXP	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		decreases expression	EXP	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp4	insulin-like growth factor binding protein 4		decreases expression	ISO	10	87,822,429	87,834,315	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		multiple interactions	EXP	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		increases expression	EXP	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Ikbkb	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase beta		multiple interactions	ISO	16	73,804,730	73,858,510	RGD:6480464	CTD
G	Ikbkg	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase gamma		multiple interactions	EXP	X	160,386,558	160,420,190	RGD:6480464	CTD
G	Ikbkg	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase gamma		decreases expression	EXP	X	160,386,558	160,420,190	RGD:6480464	CTD
G	Il11	interleukin 11		multiple interactions	EXP	1	67,784,584	67,795,141	RGD:6480464	CTD
G	Il13ra1	interleukin 13 receptor, alpha 1		multiple interactions	EXP	X	8,758,662	8,820,545	RGD:6480464	CTD
G	Il13ra1	interleukin 13 receptor, alpha 1		decreases expression	EXP	X	8,758,662	8,820,545	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		increases expression	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		decreases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1r2	interleukin 1 receptor, type II		multiple interactions	EXP	9	39,279,397	39,319,672	RGD:6480464	CTD
G	Il2	interleukin 2		decreases secretion	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il23r	interleukin 23 receptor		multiple interactions	EXP	4	97,087,580	97,768,978	RGD:6480464	CTD
G	Il33	interleukin 33		decreases expression	EXP	1	233,670,801	233,685,798	RGD:6480464	CTD
G	Il4	interleukin 4		decreases secretion	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il4	interleukin 4		decreases expression	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il5	interleukin 5		decreases secretion	ISO	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il5	interleukin 5		decreases expression	ISO	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	ISO	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Irf1	interferon regulatory factor 1		multiple interactions	ISO	10	39,220,600	39,227,602	RGD:6480464	CTD
G	Isyna1	inositol-3-phosphate synthase 1		increases expression	EXP	16	19,345,305	19,348,141	RGD:6480464	CTD
G	Jak2	Janus kinase 2		multiple interactions	EXP	1	232,915,995	232,974,763	RGD:6480464	CTD
G	Jak2	Janus kinase 2		increases expression	EXP	1	232,915,995	232,974,763	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		multiple interactions	EXP	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		decreases expression	EXP	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Jund	jun D proto-oncogene		multiple interactions	ISO	16	19,239,694	19,241,529	RGD:6480464	CTD
G	Kcnj16	potassium inwardly-rectifying channel, subfamily J, member 16		increases expression	ISO	10	100,514,180	100,515,949	RGD:6480464	CTD
G	Kif11	kinesin family member 11		decreases expression	EXP	1	241,668,938	241,722,847	RGD:6480464	CTD
G	Kif4a	kinesin family member 4A		decreases expression	EXP	X	88,624,683	88,742,447	RGD:6480464	CTD
G	Klf10	Kruppel-like factor 10		increases expression	ISO	7	73,821,190	73,826,866	RGD:6480464	CTD
G	Lama4	laminin, alpha 4		multiple interactions	EXP	20	43,077,612	43,203,519	RGD:6480464	CTD
G	Lama4	laminin, alpha 4		increases expression	EXP	20	43,077,612	43,203,519	RGD:6480464	CTD
G	Lamb1	laminin, beta 1		multiple interactions	ISO	6	49,115,671	49,183,374	RGD:6480464	CTD
G	Lamc1	laminin, gamma 1		multiple interactions	ISO	13	68,241,453	68,369,419	RGD:6480464	CTD
G	Lcn2	lipocalin 2		decreases expression	ISO	3	11,511,402	11,514,747	RGD:6480464	CTD
G	LOC100360218	interleukin 13 receptor, alpha 1-like		multiple interactions	EXP	11	73,147,318	73,148,958	RGD:6480464	CTD
G	LOC100360218	interleukin 13 receptor, alpha 1-like		decreases expression	EXP	11	73,147,318	73,148,958	RGD:6480464	CTD
G	Lpin1	lipin 1		increases expression	ISO	6	40,253,664	40,297,195	RGD:6480464	CTD
G	Mafb	v-maf musculoaponeurotic fibrosarcoma oncogene homolog B (avian)		increases expression	EXP	3	151,116,831	151,118,751	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases phosphorylation	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		decreases expression	ISO				RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		multiple interactions	ISO				RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		multiple interactions	EXP				RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		decreases expression	ISO				RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		decreases expression	EXP				RGD:6480464	CTD
G	Mfap3l	microfibrillar-associated protein 3-like		increases expression	ISO	16	32,751,464	32,766,478	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		decreases expression	EXP	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp10	matrix metallopeptidase 10 (stromelysin 2)		increases expression	EXP	8	4,367,842	4,375,737	RGD:6480464	CTD
G	Mmp10	matrix metallopeptidase 10 (stromelysin 2)		multiple interactions	EXP	8	4,367,842	4,375,737	RGD:6480464	CTD
G	Mmp12	matrix metallopeptidase 12		multiple interactions	EXP	8	4,249,938	4,259,675	RGD:6480464	CTD
G	Mmp12	matrix metallopeptidase 12		increases expression	EXP	8	4,249,938	4,259,675	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		affects expression	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		increases expression	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	ISO	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	ISO	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		increases expression	EXP	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	EXP	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		decreases expression	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	EXP	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	ISO	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		multiple interactions	EXP	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp3	matrix metallopeptidase 3		increases expression	EXP	8	4,315,601	4,329,146	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	EXP	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		increases expression	EXP	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mpo	myeloperoxidase		decreases activity	EXP	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mvd	mevalonate (diphospho) decarboxylase		increases expression	ISO	19	52,722,306	52,732,312	RGD:6480464	CTD
G	Ndufa4	NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 4		increases expression	EXP	4	37,125,782	37,133,055	RGD:6480464	CTD
G	Nedd4	neural precursor cell expressed, developmentally down-regulated 4, E3 ubiquitin protein ligase		decreases expression	EXP	8	77,252,500	77,337,402	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		decreases activity	EXP	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		decreases expression	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		decreases phosphorylation	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbib	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, beta		multiple interactions	EXP	1	83,865,440	83,873,010	RGD:6480464	CTD
G	Nfkbib	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, beta		increases expression	EXP	1	83,865,440	83,873,010	RGD:6480464	CTD
G	Ngef	neuronal guanine nucleotide exchange factor		increases expression	ISO	9	86,294,206	86,327,765	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		increases expression	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nr1h4	nuclear receptor subfamily 1, group H, member 4		affects expression	EXP	7	26,189,759	26,307,061	RGD:6480464	CTD
G	Nsdhl	NAD(P) dependent steroid dehydrogenase-like		increases expression	ISO	X	158,923,025	158,954,914	RGD:6480464	CTD
G	Nucb2	nucleobindin 2		decreases expression	ISO	1	174,605,677	174,642,111	RGD:6480464	CTD
G	Nuf2	NUF2, NDC80 kinetochore complex component, homolog (S. cerevisiae)		decreases expression	EXP	13	85,286,634	85,315,366	RGD:6480464	CTD
G	Oasl2	2'-5' oligoadenylate synthetase-like 2		increases expression	ISO	12	42,996,518	43,009,338	RGD:6480464	CTD
G	Oat	ornithine aminotransferase		multiple interactions	EXP	1	192,026,623	192,046,404	RGD:6480464	CTD
G	Ogt	O-linked N-acetylglucosamine (GlcNAc) transferase		decreases expression	ISO	X	89,721,369	89,766,218	RGD:6480464	CTD
G	Orc2	origin recognition complex, subunit 2		decreases expression	ISO	9	57,125,684	57,155,508	RGD:6480464	CTD
G	Oxr1	oxidation resistance 1		decreases expression	ISO	7	77,427,877	77,501,800	RGD:6480464	CTD
G	Pank1	pantothenate kinase 1		increases expression	ISO	1	238,797,912	238,857,586	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases cleavage	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		affects expression	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		multiple interactions	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdia4	protein disulfide isomerase family A, member 4		decreases expression	ISO	4	75,929,398	75,948,299	RGD:6480464	CTD
G	Pdia6	protein disulfide isomerase family A, member 6		decreases expression	ISO				RGD:6480464	CTD
G	Pdk4	pyruvate dehydrogenase kinase, isozyme 4		increases expression	ISO	4	30,235,296	30,245,298	RGD:6480464	CTD
G	Pfkp	phosphofructokinase, platelet		increases expression	ISO	17	74,760,912	74,823,046	RGD:6480464	CTD
G	Piga	phosphatidylinositol glycan anchor biosynthesis, class A		decreases expression	ISO	X	50,797,413	50,812,217	RGD:6480464	CTD
G	Pla2g2a	phospholipase A2, group IIA (platelets, synovial fluid)		multiple interactions	EXP	5	157,654,786	157,657,360	RGD:6480464	CTD
G	Pla2g2a	phospholipase A2, group IIA (platelets, synovial fluid)		decreases expression	EXP	5	157,654,786	157,657,360	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		affects expression	EXP	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		multiple interactions	EXP	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Pla2g5	phospholipase A2, group V		multiple interactions	EXP	5	157,619,703	157,640,971	RGD:6480464	CTD
G	Pla2g5	phospholipase A2, group V		decreases expression	EXP	5	157,619,703	157,640,971	RGD:6480464	CTD
G	Plat	plasminogen activator, tissue		increases expression	ISO	16	73,711,323	73,736,328	RGD:6480464	CTD
G	Plk1	polo-like kinase 1		increases expression	ISO	1	181,002,811	181,012,741	RGD:6480464	CTD
G	Plk1	polo-like kinase 1		decreases expression	EXP	1	181,002,811	181,012,741	RGD:6480464	CTD
G	Ppap2b	phosphatidic acid phosphatase type 2B		decreases expression	EXP	5	126,121,416	126,197,099	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	ISO	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		decreases expression	ISO	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		decreases expression	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppm1a	protein phosphatase, Mg2+/Mn2+ dependent, 1A		decreases expression	ISO	6	95,162,067	95,198,936	RGD:6480464	CTD
G	Ppp1r15a	protein phosphatase 1, regulatory subunit 15A		decreases expression	ISO	1	95,994,023	95,997,080	RGD:6480464	CTD
G	Prc1	protein regulator of cytokinesis 1		decreases expression	EXP	1	136,112,674	136,133,720	RGD:6480464	CTD
G	Psme3	proteasome (prosome, macropain) activator subunit 3		decreases expression	ISO	10	90,343,493	90,351,335	RGD:6480464	CTD
G	Ptges	prostaglandin E synthase		multiple interactions	ISO	3	9,946,194	9,957,538	RGD:6480464	CTD
G	Ptges	prostaglandin E synthase		multiple interactions	ISO	3	9,946,194	9,957,538	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		decreases expression	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		increases expression	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		decreases glycosylation	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Pttg1	pituitary tumor-transforming 1		decreases expression	EXP	10	28,527,409	28,532,831	RGD:6480464	CTD
G	Rab32	RAB32, member RAS oncogene family		increases expression	ISO	1	5,203,908	5,218,416	RGD:6480464	CTD
G	Racgap1	Rac GTPase-activating protein 1		decreases expression	EXP	7	138,366,356	138,395,716	RGD:6480464	CTD
G	Rbm39	RNA binding motif protein 39		decreases expression	ISO	3	146,555,202	146,587,650	RGD:6480464	CTD
G	Recql4	RecQ protein-like 4		increases expression	ISO	7	114,752,863	114,760,027	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		increases localization	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		decreases activity	EXP	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Relb	v-rel reticuloendotheliosis viral oncogene homolog B		multiple interactions	EXP				RGD:6480464	CTD
G	Rhob	ras homolog family member B		increases expression	ISO	6	32,052,333	32,054,507	RGD:6480464	CTD
G	Rhoc	ras homolog family member C		decreases expression	ISO	2	200,048,056	200,054,107	RGD:6480464	CTD
G	Rnd1	Rho family GTPase 1		multiple interactions	ISO	7	137,418,519	137,425,590	RGD:6480464	CTD
G	Rnd1	Rho family GTPase 1		decreases expression	ISO	7	137,418,519	137,425,590	RGD:6480464	CTD
G	Rps6	ribosomal protein S6		decreases phosphorylation	ISO	5	106,165,612	106,168,472	RGD:6480464	CTD
G	Rps6kb1	ribosomal protein S6 kinase, polypeptide 1		decreases phosphorylation	ISO	10	76,657,024	76,698,088	RGD:6480464	CTD
G	Runx2	runt-related transcription factor 2		increases phosphorylation	ISO	9	11,869,234	12,025,219	RGD:6480464	CTD
G	Runx2	runt-related transcription factor 2		multiple interactions	ISO	9	11,869,234	12,025,219	RGD:6480464	CTD
G	Runx2	runt-related transcription factor 2		increases expression	ISO	9	11,869,234	12,025,219	RGD:6480464	CTD
G	Scd	stearoyl-CoA desaturase (delta-9-desaturase)		increases expression	ISO	1	249,358,105	249,371,164	RGD:6480464	CTD
G	Sdc2	syndecan 2		multiple interactions	EXP	7	68,290,558	68,405,183	RGD:6480464	CTD
G	Sdc2	syndecan 2		decreases expression	EXP	7	68,290,558	68,405,183	RGD:6480464	CTD
G	Sdc4	syndecan 4		multiple interactions	EXP	3	155,446,138	155,464,825	RGD:6480464	CTD
G	Sdc4	syndecan 4		decreases expression	EXP	3	155,446,138	155,464,825	RGD:6480464	CTD
G	Selenbp1	selenium binding protein 1		decreases expression	EXP	2	189,840,450	189,881,332	RGD:6480464	CTD
G	Serpinb2	serpin peptidase inhibitor, clade B (ovalbumin), member 2		increases expression	EXP	13	13,632,596	13,641,605	RGD:6480464	CTD
G	Serpinh1	serpin peptidase inhibitor, clade H (heat shock protein 47), member 1, (collagen binding protein 1)		increases expression	ISO	1	156,666,914	156,674,210	RGD:6480464	CTD
G	Sfrp2	secreted frizzled-related protein 2		decreases expression	EXP	2	175,479,320	175,486,865	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		decreases expression	ISO	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Shcbp1	Shc SH2-domain binding protein 1		decreases expression	EXP	16	90,002,645	90,022,167	RGD:6480464	CTD
G	Slc23a2	solute carrier family 23 (nucleobase transporters), member 2		increases expression	EXP	3	119,796,376	119,886,011	RGD:6480464	CTD
G	Slc2a2	solute carrier family 2 (facilitated glucose transporter), member 2		decreases expression	EXP	2	116,036,501	116,065,834	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		decreases expression	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		increases uptake	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	EXP	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		decreases expression	EXP	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a6	solute carrier family 2 (facilitated glucose transporter), member 6		decreases expression	ISO	3	5,917,992	5,924,807	RGD:6480464	CTD
G	Slc37a4	solute carrier family 37 (glucose-6-phosphate transporter), member 4		increases expression	ISO	8	47,363,896	47,369,981	RGD:6480464	CTD
G	Slc4a4	solute carrier family 4, sodium bicarbonate cotransporter, member 4		decreases expression	EXP	14	20,381,545	20,739,216	RGD:6480464	CTD
G	Slc7a8	solute carrier family 7 (amino acid transporter light chain, L system), member 8		increases expression	EXP	15	32,800,927	32,860,797	RGD:6480464	CTD
G	Slc7a8	solute carrier family 7 (amino acid transporter light chain, L system), member 8		multiple interactions	EXP	15	32,800,927	32,860,797	RGD:6480464	CTD
G	Smad2	SMAD family member 2		multiple interactions	ISO	18	73,180,520	73,241,707	RGD:6480464	CTD
G	Smad2	SMAD family member 2		increases phosphorylation	ISO	18	73,180,520	73,241,707	RGD:6480464	CTD
G	Smpd3	sphingomyelin phosphodiesterase 3, neutral membrane		decreases expression	EXP	19	36,112,166	36,195,564	RGD:6480464	CTD
G	Sox4	SRY (sex determining region Y)-box 4		multiple interactions	EXP	17	42,172,863	42,177,590	RGD:6480464	CTD
G	Sox4	SRY (sex determining region Y)-box 4		decreases expression	EXP	17	42,172,863	42,177,590	RGD:6480464	CTD
G	Srsf3	serine/arginine-rich splicing factor 3		decreases expression	ISO	20	7,316,649	7,326,580	RGD:6480464	CTD
G	St6gal1	ST6 beta-galactosamide alpha-2,6-sialyltranferase 1		increases expression	ISO	11	79,723,269	79,765,645	RGD:6480464	CTD
G	Stat1	signal transducer and activator of transcription 1		multiple interactions	ISO	9	46,455,635	46,497,560	RGD:6480464	CTD
G	Stat1	signal transducer and activator of transcription 1		multiple interactions	ISO	9	46,455,635	46,497,560	RGD:6480464	CTD
G	Tacc3	transforming, acidic coiled-coil containing protein 3		decreases expression	EXP	14	82,746,460	82,760,864	RGD:6480464	CTD
G	Testin	testin gene		decreases expression	EXP	17	9,532,437	9,544,923	RGD:6480464	CTD
G	Tgfa	transforming growth factor alpha		multiple interactions	EXP	4	120,355,649	120,437,772	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		increases expression	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Thbs4	thrombospondin 4		multiple interactions	EXP	2	23,010,823	23,053,527	RGD:6480464	CTD
G	Thbs4	thrombospondin 4		decreases expression	EXP	2	23,010,823	23,053,527	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		multiple interactions	EXP	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		increases expression	EXP	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		affects expression	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		multiple interactions	ISO	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		multiple interactions	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		increases expression	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Tinag	tubulointerstitial nephritis antigen		increases expression	ISO	8	81,947,234	82,032,994	RGD:6480464	CTD
G	Tk1	thymidine kinase 1, soluble		decreases expression	EXP				RGD:6480464	CTD
G	Tlr1	toll-like receptor 1		increases expression	ISO				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases secretion	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf11b	tumor necrosis factor receptor superfamily, member 11b		multiple interactions	ISO	7	90,606,424	90,634,431	RGD:6480464	CTD
G	Tnfrsf1a	tumor necrosis factor receptor superfamily, member 1a		multiple interactions	ISO	4	162,172,563	162,185,252	RGD:6480464	CTD
G	Tnfrsf1b	tumor necrosis factor receptor superfamily, member 1b		multiple interactions	ISO	5	163,666,541	163,697,484	RGD:6480464	CTD
G	Tnfsf11	tumor necrosis factor (ligand) superfamily, member 11		multiple interactions	ISO	15	59,397,837	59,428,014	RGD:6480464	CTD
G	Tnfsf11	tumor necrosis factor (ligand) superfamily, member 11		increases expression	ISO	15	59,397,837	59,428,014	RGD:6480464	CTD
G	Tnk2	tyrosine kinase, non-receptor, 2		multiple interactions	EXP	11	69,927,509	69,966,854	RGD:6480464	CTD
G	Top2a	topoisomerase (DNA) II alpha		decreases expression	EXP	10	87,771,337	87,800,960	RGD:6480464	CTD
G	Traf6	TNF receptor-associated factor 6, E3 ubiquitin protein ligase		multiple interactions	ISO	3	86,827,582	86,847,408	RGD:6480464	CTD
G	Trpv4	transient receptor potential cation channel, subfamily V, member 4		increases expression	ISO	12	43,226,933	43,265,889	RGD:6480464	CTD
G	Txn1	thioredoxin 1		decreases expression	EXP	5	75,921,365	75,933,595	RGD:6480464	CTD
G	Txn1	thioredoxin 1		decreases expression	ISO	5	75,921,365	75,933,595	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		multiple interactions	ISO	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		increases expression	ISO	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		increases expression	EXP	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Ucp2	uncoupling protein 2 (mitochondrial, proton carrier)		decreases expression	EXP	1	157,925,514	157,928,222	RGD:6480464	CTD
G	Uqcrh	ubiquinol-cytochrome c reductase hinge protein		increases expression	ISO	5	136,255,481	136,263,676	RGD:6480464	CTD
G	Vamp1	vesicle-associated membrane protein 1		increases expression	EXP	4	161,333,661	161,340,447	RGD:6480464	CTD
G	Vcan	versican		multiple interactions	EXP	2	19,712,629	19,801,443	RGD:6480464	CTD
G	Vcan	versican		decreases expression	EXP	2	19,712,629	19,801,443	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		increases expression	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vnn1	vanin 1		increases expression	ISO	1	22,087,290	22,097,592	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		multiple interactions	ISO	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		decreases splicing	ISO	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		increases expression	ISO	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		increases expression	EXP	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		multiple interactions	EXP	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xdh	xanthine dehydrogenase		multiple interactions	EXP	6	21,417,685	21,590,015	RGD:6480464	CTD
G	Zfp467	zinc finger protein 467		increases expression	ISO	4	76,522,000	76,528,470	RGD:6480464	CTD
beta-D-glucosamine
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Aacs	acetoacetyl-CoA synthetase		increases expression	ISO	12	32,206,863	32,250,583	RGD:6480464	CTD
G	Abcg1	ATP-binding cassette, subfamily G (WHITE), member 1		increases expression	EXP	20	9,390,485	9,459,574	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	EXP	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		affects expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		decreases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acot3	acyl-CoA thioesterase 3		increases expression	ISO	6	108,089,349	108,095,288	RGD:6480464	CTD
G	Acox2	acyl-CoA oxidase 2, branched chain		decreases expression	ISO	15	18,645,349	18,677,855	RGD:6480464	CTD
G	Acss2	acyl-CoA synthetase short-chain family member 2		increases expression	ISO	3	146,013,995	146,057,119	RGD:6480464	CTD
G	Adam15	ADAM metallopeptidase domain 15		multiple interactions	EXP	2	181,527,175	181,537,640	RGD:6480464	CTD
G	Adam15	ADAM metallopeptidase domain 15		decreases expression	EXP	2	181,527,175	181,537,640	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		multiple interactions	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		increases expression	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		decreases expression	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	EXP	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		decreases expression	EXP	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts4	ADAM metallopeptidase with thrombospondin type 1 motif, 4		increases expression	EXP	13	87,142,442	87,151,783	RGD:6480464	CTD
G	Adamts5	ADAM metallopeptidase with thrombospondin type 1 motif, 5		decreases expression	ISO	11	25,503,380	25,548,851	RGD:6480464	CTD
G	Adamts5	ADAM metallopeptidase with thrombospondin type 1 motif, 5		multiple interactions	ISO	11	25,503,380	25,548,851	RGD:6480464	CTD
G	Adamts9	ADAM metallopeptidase with thrombospondin type 1 motif, 9		decreases cleavage	ISO	4	126,996,604	127,198,909	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	EXP	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Afp	alpha-fetoprotein		increases expression	ISO	14	19,092,563	19,110,728	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases expression	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Ahi1	Abelson helper integration site 1		decreases expression	ISO	1	16,332,801	16,454,055	RGD:6480464	CTD
G	Akr1b8	aldo-keto reductase family 1, member B8		increases expression	EXP	4	61,714,282	61,726,856	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		affects phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Alg12	asparagine-linked glycosylation 12, alpha-1,6-mannosyltransferase		decreases expression	ISO	7	127,109,296	127,123,482	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		multiple interactions	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		increases activity	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		increases expression	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		increases secretion	ISO				RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		increases stability	ISO				RGD:6480464	CTD
G	Apob	apolipoprotein B		increases degradation	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases expression	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases localization	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		decreases secretion	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		increases ubiquitination	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apob	apolipoprotein B		multiple interactions	ISO	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apoe	apolipoprotein E		multiple interactions	ISO	1	79,003,634	79,006,387	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		multiple interactions	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		decreases expression	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		multiple interactions	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		increases expression	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		decreases expression	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		multiple interactions	EXP	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		increases expression	EXP	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Atf7ip	activating transcription factor 7 interacting protein		increases expression	ISO	4	173,566,920	173,586,494	RGD:6480464	CTD
G	Atp2a2	ATPase, Ca++ transporting, cardiac muscle, slow twitch 2		decreases expression	ISO	12	35,266,600	35,316,237	RGD:6480464	CTD
G	Azin1	antizyme inhibitor 1		decreases expression	EXP	7	74,159,130	74,189,447	RGD:6480464	CTD
G	Azin1	antizyme inhibitor 1		multiple interactions	EXP	7	74,159,130	74,189,447	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		multiple interactions	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		increases expression	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	B3gat3	beta-1,3-glucuronyltransferase 3 (glucuronosyltransferase I)		multiple interactions	EXP	1	211,597,624	211,604,142	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		decreases expression	ISO				RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		increases expression	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bgn	biglycan		multiple interactions	EXP	X	159,380,557	159,393,409	RGD:6480464	CTD
G	Bgn	biglycan		decreases expression	EXP	X	159,380,557	159,393,409	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	EXP	3	121,372,692	121,381,236	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		decreases expression	EXP	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	EXP	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		multiple interactions	EXP	17	32,380,199	32,689,295	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		decreases expression	EXP	17	32,380,199	32,689,295	RGD:6480464	CTD
G	Bmp7	bone morphogenetic protein 7		multiple interactions	EXP	3	163,723,429	163,799,567	RGD:6480464	CTD
G	Bmp7	bone morphogenetic protein 7		increases expression	EXP	3	163,723,429	163,799,567	RGD:6480464	CTD
G	Calr	calreticulin		decreases expression	ISO	19	24,964,775	24,969,670	RGD:6480464	CTD
G	Car3	carbonic anhydrase 3		decreases expression	EXP	2	88,106,727	88,114,686	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		decreases expression	ISO	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Cbr3	carbonyl reductase 3		increases expression	ISO	11	33,913,961	33,922,221	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		multiple interactions	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		increases expression	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl22	chemokine (C-C motif) ligand 22		multiple interactions	EXP	19	10,697,324	10,704,129	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	EXP	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		multiple interactions	EXP	10	70,267,281	70,269,131	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		increases expression	EXP	10	70,267,281	70,269,131	RGD:6480464	CTD
G	Ccnb1	cyclin B1		decreases expression	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Cd24	CD24 molecule		increases expression	ISO	20	47,502,354	47,507,663	RGD:6480464	CTD
G	Cd28	Cd28 molecule		increases expression	EXP	9	59,342,273	59,367,743	RGD:6480464	CTD
G	Cdc20	cell division cycle 20		decreases expression	EXP	5	138,913,180	138,916,744	RGD:6480464	CTD
G	Cdc23	cell division cycle 23		decreases expression	EXP	18	27,108,516	27,128,285	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		decreases expression	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		decreases expression	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		decreases expression	EXP	15	22,617,409	22,624,922	RGD:6480464	CTD
G	Cenpf	centromere protein F		decreases expression	EXP	13	105,920,242	105,965,655	RGD:6480464	CTD
G	Chi3l1	chitinase 3-like 1 (cartilage glycoprotein-39)		decreases expression	ISO	13	47,139,658	47,147,591	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		multiple interactions	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		decreases activity	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Ckap2	cytoskeleton associated protein 2		decreases expression	EXP	16	74,492,221	74,518,743	RGD:6480464	CTD
G	Clta	clathrin, light chain A		decreases expression	EXP	5	60,484,437	60,502,432	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		multiple interactions	EXP	2	209,996,467	210,193,379	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		decreases expression	EXP	2	209,996,467	210,193,379	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		decreases expression	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		increases expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		affects expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		increases expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	EXP	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col8a1	collagen, type VIII, alpha 1		multiple interactions	EXP	11	43,604,994	43,733,870	RGD:6480464	CTD
G	Col8a1	collagen, type VIII, alpha 1		decreases expression	EXP	11	43,604,994	43,733,870	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		multiple interactions	EXP	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		decreases expression	EXP	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		increases expression	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		multiple interactions	EXP	10	87,473,990	87,476,365	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		increases expression	EXP	10	87,473,990	87,476,365	RGD:6480464	CTD
G	Ctgf	connective tissue growth factor		increases expression	EXP	1	21,327,099	21,330,215	RGD:6480464	CTD
G	Ctsd	cathepsin D		affects localization	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		increases activity	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		multiple interactions	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Ctsd	cathepsin D		decreases expression	ISO	1	202,619,669	202,631,545	RGD:6480464	CTD
G	Cul2	cullin 2		multiple interactions	ISO	17	62,701,289	62,741,344	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		decreases expression	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		multiple interactions	ISO	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		multiple interactions	EXP	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl11	chemokine (C-X-C motif) ligand 11		multiple interactions	EXP	14	17,250,648	17,253,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases expression	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		increases expression	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl3	chemokine (C-X-C motif) ligand 3		increases expression	EXP	14	18,767,306	18,787,340	RGD:6480464	CTD
G	Cxcl3	chemokine (C-X-C motif) ligand 3		multiple interactions	EXP	14	18,767,306	18,787,340	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		affects localization	ISO	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Eprs	glutamyl-prolyl-tRNA synthetase		decreases expression	ISO	13	101,375,656	101,448,175	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		increases expression	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		increases expression	EXP	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fbp2	fructose-1,6-bisphosphatase 2		increases expression	ISO	17	7,824,298	7,841,661	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		multiple interactions	EXP	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		decreases expression	EXP	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		multiple interactions	EXP	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fgf9	fibroblast growth factor 9		multiple interactions	EXP	15	37,115,068	37,155,652	RGD:6480464	CTD
G	Fgf9	fibroblast growth factor 9		increases expression	EXP	15	37,115,068	37,155,652	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		multiple interactions	EXP	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		increases expression	EXP	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		increases expression	ISO	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		decreases expression	EXP	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Fkbp11	FK506 binding protein 11		decreases expression	ISO	7	137,490,985	137,494,418	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	ISO	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Hmmr	hyaluronan mediated motility receptor (RHAMM)		decreases expression	EXP	10	25,733,375	25,762,825	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		increases expression	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hoxa1	homeo box A1		decreases expression	ISO	4	80,456,728	80,458,388	RGD:6480464	CTD
G	Hpgd	hydroxyprostaglandin dehydrogenase 15 (NAD)		decreases expression	EXP	16	37,419,901	37,457,896	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		decreases expression	ISO	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		increases expression	ISO	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		decreases expression	EXP	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		decreases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hyou1	hypoxia up-regulated 1		decreases expression	ISO	8	47,346,753	47,358,869	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Ifng	interferon gamma		decreases secretion	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		multiple interactions	EXP	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		increases expression	EXP	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Ikbkb	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase beta		multiple interactions	ISO	16	73,804,730	73,858,510	RGD:6480464	CTD
G	Ikbkg	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase gamma		multiple interactions	EXP	X	160,386,558	160,420,190	RGD:6480464	CTD
G	Ikbkg	inhibitor of kappa light polypeptide gene enhancer in B-cells, kinase gamma		decreases expression	EXP	X	160,386,558	160,420,190	RGD:6480464	CTD
G	Il11	interleukin 11		multiple interactions	EXP	1	67,784,584	67,795,141	RGD:6480464	CTD
G	Il13ra1	interleukin 13 receptor, alpha 1		multiple interactions	EXP	X	8,758,662	8,820,545	RGD:6480464	CTD
G	Il13ra1	interleukin 13 receptor, alpha 1		decreases expression	EXP	X	8,758,662	8,820,545	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		increases expression	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		decreases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1r2	interleukin 1 receptor, type II		multiple interactions	EXP	9	39,279,397	39,319,672	RGD:6480464	CTD
G	Il2	interleukin 2		decreases secretion	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il4	interleukin 4		decreases secretion	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il5	interleukin 5		decreases secretion	ISO	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		multiple interactions	EXP	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		decreases expression	EXP	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Jund	jun D proto-oncogene		multiple interactions	ISO	16	19,239,694	19,241,529	RGD:6480464	CTD
G	Kcnj16	potassium inwardly-rectifying channel, subfamily J, member 16		increases expression	ISO	10	100,514,180	100,515,949	RGD:6480464	CTD
G	Kif11	kinesin family member 11		decreases expression	EXP	1	241,668,938	241,722,847	RGD:6480464	CTD
G	Kif4a	kinesin family member 4A		decreases expression	EXP	X	88,624,683	88,742,447	RGD:6480464	CTD
G	Klf10	Kruppel-like factor 10		increases expression	ISO	7	73,821,190	73,826,866	RGD:6480464	CTD
G	Lama4	laminin, alpha 4		multiple interactions	EXP	20	43,077,612	43,203,519	RGD:6480464	CTD
G	Lama4	laminin, alpha 4		increases expression	EXP	20	43,077,612	43,203,519	RGD:6480464	CTD
G	Lamb1	laminin, beta 1		multiple interactions	ISO	6	49,115,671	49,183,374	RGD:6480464	CTD
G	Lamc1	laminin, gamma 1		multiple interactions	ISO	13	68,241,453	68,369,419	RGD:6480464	CTD
G	Lcn2	lipocalin 2		decreases expression	ISO	3	11,511,402	11,514,747	RGD:6480464	CTD
G	LOC100360218	interleukin 13 receptor, alpha 1-like		multiple interactions	EXP	11	73,147,318	73,148,958	RGD:6480464	CTD
G	LOC100360218	interleukin 13 receptor, alpha 1-like		decreases expression	EXP	11	73,147,318	73,148,958	RGD:6480464	CTD
G	Lpin1	lipin 1		increases expression	ISO	6	40,253,664	40,297,195	RGD:6480464	CTD
G	Mafb	v-maf musculoaponeurotic fibrosarcoma oncogene homolog B (avian)		increases expression	EXP	3	151,116,831	151,118,751	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp10	matrix metallopeptidase 10 (stromelysin 2)		increases expression	EXP	8	4,367,842	4,375,737	RGD:6480464	CTD
G	Mmp10	matrix metallopeptidase 10 (stromelysin 2)		multiple interactions	EXP	8	4,367,842	4,375,737	RGD:6480464	CTD
G	Mmp12	matrix metallopeptidase 12		multiple interactions	EXP	8	4,249,938	4,259,675	RGD:6480464	CTD
G	Mmp12	matrix metallopeptidase 12		increases expression	EXP	8	4,249,938	4,259,675	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		affects expression	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	ISO	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		increases expression	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	ISO	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		decreases activity	EXP	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		decreases expression	EXP	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		affects expression	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		multiple interactions	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdia4	protein disulfide isomerase family A, member 4		decreases expression	ISO	4	75,929,398	75,948,299	RGD:6480464	CTD
G	Pdia6	protein disulfide isomerase family A, member 6		decreases expression	ISO				RGD:6480464	CTD
G	Pdk4	pyruvate dehydrogenase kinase, isozyme 4		increases expression	ISO	4	30,235,296	30,245,298	RGD:6480464	CTD
G	Pfkp	phosphofructokinase, platelet		increases expression	ISO	17	74,760,912	74,823,046	RGD:6480464	CTD
G	Piga	phosphatidylinositol glycan anchor biosynthesis, class A		decreases expression	ISO	X	50,797,413	50,812,217	RGD:6480464	CTD
G	Pla2g2a	phospholipase A2, group IIA (platelets, synovial fluid)		multiple interactions	EXP	5	157,654,786	157,657,360	RGD:6480464	CTD
G	Pla2g2a	phospholipase A2, group IIA (platelets, synovial fluid)		decreases expression	EXP	5	157,654,786	157,657,360	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		affects expression	EXP	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		multiple interactions	EXP	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Pla2g5	phospholipase A2, group V		multiple interactions	EXP	5	157,619,703	157,640,971	RGD:6480464	CTD
G	Pla2g5	phospholipase A2, group V		decreases expression	EXP	5	157,619,703	157,640,971	RGD:6480464	CTD
G	Plat	plasminogen activator, tissue		increases expression	ISO	16	73,711,323	73,736,328	RGD:6480464	CTD
G	Plk1	polo-like kinase 1		increases expression	ISO	1	181,002,811	181,012,741	RGD:6480464	CTD
G	Plk1	polo-like kinase 1		decreases expression	EXP	1	181,002,811	181,012,741	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		decreases expression	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Pttg1	pituitary tumor-transforming 1		decreases expression	EXP	10	28,527,409	28,532,831	RGD:6480464	CTD
G	Rab32	RAB32, member RAS oncogene family		increases expression	ISO	1	5,203,908	5,218,416	RGD:6480464	CTD
G	Racgap1	Rac GTPase-activating protein 1		decreases expression	EXP	7	138,366,356	138,395,716	RGD:6480464	CTD
G	Rbm39	RNA binding motif protein 39		decreases expression	ISO	3	146,555,202	146,587,650	RGD:6480464	CTD
G	Recql4	RecQ protein-like 4		increases expression	ISO	7	114,752,863	114,760,027	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Relb	v-rel reticuloendotheliosis viral oncogene homolog B		multiple interactions	EXP				RGD:6480464	CTD
G	Serpinh1	serpin peptidase inhibitor, clade H (heat shock protein 47), member 1, (collagen binding protein 1)		increases expression	ISO	1	156,666,914	156,674,210	RGD:6480464	CTD
G	Sfrp2	secreted frizzled-related protein 2		decreases expression	EXP	2	175,479,320	175,486,865	RGD:6480464	CTD
G	Sgk1	serum/glucocorticoid regulated kinase 1		decreases expression	ISO	1	23,501,257	23,506,651	RGD:6480464	CTD
G	Shcbp1	Shc SH2-domain binding protein 1		decreases expression	EXP	16	90,002,645	90,022,167	RGD:6480464	CTD
G	Slc23a2	solute carrier family 23 (nucleobase transporters), member 2		increases expression	EXP	3	119,796,376	119,886,011	RGD:6480464	CTD
G	Slc2a2	solute carrier family 2 (facilitated glucose transporter), member 2		decreases expression	EXP	2	116,036,501	116,065,834	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		decreases expression	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		increases uptake	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		multiple interactions	EXP	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		affects expression	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		multiple interactions	ISO	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		multiple interactions	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		increases expression	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Tinag	tubulointerstitial nephritis antigen		increases expression	ISO	8	81,947,234	82,032,994	RGD:6480464	CTD
G	Tk1	thymidine kinase 1, soluble		decreases expression	EXP				RGD:6480464	CTD
G	Tlr1	toll-like receptor 1		increases expression	ISO				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases secretion	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Traf6	TNF receptor-associated factor 6, E3 ubiquitin protein ligase		multiple interactions	ISO	3	86,827,582	86,847,408	RGD:6480464	CTD
G	Trpv4	transient receptor potential cation channel, subfamily V, member 4		increases expression	ISO	12	43,226,933	43,265,889	RGD:6480464	CTD
G	Txn1	thioredoxin 1		decreases expression	EXP	5	75,921,365	75,933,595	RGD:6480464	CTD
G	Txn1	thioredoxin 1		decreases expression	ISO	5	75,921,365	75,933,595	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		multiple interactions	ISO	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		increases expression	ISO	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		increases expression	EXP	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Ucp2	uncoupling protein 2 (mitochondrial, proton carrier)		decreases expression	EXP	1	157,925,514	157,928,222	RGD:6480464	CTD
G	Uqcrh	ubiquinol-cytochrome c reductase hinge protein		increases expression	ISO	5	136,255,481	136,263,676	RGD:6480464	CTD
G	Vamp1	vesicle-associated membrane protein 1		increases expression	EXP	4	161,333,661	161,340,447	RGD:6480464	CTD
G	Vcan	versican		multiple interactions	EXP	2	19,712,629	19,801,443	RGD:6480464	CTD
G	Vcan	versican		decreases expression	EXP	2	19,712,629	19,801,443	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		increases expression	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vnn1	vanin 1		increases expression	ISO	1	22,087,290	22,097,592	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		multiple interactions	ISO	14	86,151,910	86,156,975	RGD:6480464	CTD
G	Xbp1	X-box binding protein 1		decreases splicing	ISO	14	86,151,910	86,156,975	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
role	482262
biological role	480454
biochemical role	193861
metabolite	175191
secondary metabolite	170532
D-glucopyranose	1427
2-amino-2-deoxy-D-glucopyranose	1334
(1->4)-D-glucosaminyl residue	0
2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose +	0
alpha-D-glucosamine +	0
beta-D-glucosamine +	667
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
p-block element atom	458699
carbon group element atom	410677
carbon atom	407233
organic molecular entity	407226
heteroorganic entity	324767
organochalcogen compound	226950
organooxygen compound	213735
carbohydrate	20809
carbohydrate derivative	16368
amino sugar	3699
amino monosaccharide	3698
hexosamine	3698
glucosamines	3548
glucosamine	2011
D-glucosamine	2011
2-amino-2-deoxy-D-glucopyranose	1334
(1->4)-D-glucosaminyl residue	0
2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose +	0
alpha-D-glucosamine +	0
beta-D-glucosamine +	667