paracetamol - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	paracetamol	go back to main search page
Accession:	CHEBI:46195	browse the term
Definition:	A derivative of phenol which has an acetamido substituent located para to the phenolic -OH group.
Synonyms:	exact_synonym:	N-(4-hydroxyphenyl)acetamide
	related_synonym:	4'-hydroxyacetanilide; 4-(Acetylamino)phenol; 4-acetamidophenol; APAP; Acenol; Acetaminofen; Acetaminophen; C8H9NO2; CC(=O)Nc1ccc(O)cc1; InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10); InChIKey=RZVAJINKPMORJF-UHFFFAOYSA-N; N-acetyl-p-aminophenol; Panadol; Tylenol; acetaminophene; p-Acetylaminophenol; p-acetamidophenol; p-acetaminophenol; p-hydroxyacetanilide; p-hydroxyphenolacetamide; paracetamolum
	alt_id:	CHEBI:2386; CHEBI:46191
	xref_casrn:	103-90-2
	xref:	Beilstein:2208089 "Beilstein Registry Number"; ChEMBL:116450 "ChEMBL COMPOUND"; ChemIDplus:103-90-2 "CAS Registry Number"; CiteXplore:11304127 "PubMed citation"; CiteXplore:16716555 "PubMed citation"; CiteXplore:21108564 "PubMed citation"; CiteXplore:22770225 "PubMed citation"; CiteXplore:7602118 "PubMed citation"; DrugBank:DB00316 "DrugBank"; HMDB:HMDB01859 "HMDB"; KEGG COMPOUND:103-90-2 "CAS Registry Number"; KEGG COMPOUND:C06804 "KEGG COMPOUND"; KEGG DRUG:D00217 "KEGG DRUG"
	xref_mesh:	MESH:D000082
	xref:	MetaCyc:CPD-7669 "MetaCyc"; NIST Chemistry WebBook:103-90-2 "CAS Registry Number"; PDBeChem:TYL "PDBeChem"; Reaxys:2208089 "Reaxys Registry Number"; Wikipedia:Acetaminophen "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

paracetamol
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	AAK1	AP2 associated kinase 1		multiple interactions	ISO	2	69,685,127	69,870,977	RGD:6480464	CTD
G	ABCB4	ATP-binding cassette, sub-family B (MDR/TAP), member 4		multiple interactions	ISO	7	87,031,361	87,105,019	RGD:6480464	CTD
G	ABCB7	ATP-binding cassette, sub-family B (MDR/TAP), member 7		multiple interactions	ISO	X	74,273,105	74,376,132	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases expression	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		multiple interactions	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC4	ATP-binding cassette, sub-family C (CFTR/MRP), member 4		increases expression	ISO	13	95,672,083	95,953,687	RGD:6480464	CTD
G	ABCD3	ATP-binding cassette, sub-family D (ALD), member 3		multiple interactions	ISO	1	94,883,933	94,984,219	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		multiple interactions	ISO	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ABHD14A	abhydrolase domain containing 14A		multiple interactions	ISO	3	52,009,042	52,015,216	RGD:6480464	CTD
G	ABHD14A	abhydrolase domain containing 14A		decreases expression	ISO	3	52,009,042	52,015,216	RGD:6480464	CTD
G	ABP1	amiloride binding protein 1 (amine oxidase (copper-containing))		increases expression	ISO	7	150,549,573	150,558,379	RGD:6480464	CTD
G	ACAA1	acetyl-CoA acyltransferase 1		multiple interactions	ISO	3	38,164,201	38,178,733	RGD:6480464	CTD
G	ACAA2	acetyl-CoA acyltransferase 2		multiple interactions	ISO	18	47,309,874	47,340,251	RGD:6480464	CTD
G	ACADL	acyl-CoA dehydrogenase, long chain		multiple interactions	ISO	2	211,052,714	211,090,215	RGD:6480464	CTD
G	ACADM	acyl-CoA dehydrogenase, C-4 to C-12 straight chain		multiple interactions	ISO	1	76,190,043	76,229,355	RGD:6480464	CTD
G	ACADS	acyl-CoA dehydrogenase, C-2 to C-3 short chain		multiple interactions	ISO	12	121,163,571	121,177,811	RGD:6480464	CTD
G	ACO2	aconitase 2, mitochondrial		multiple interactions	ISO	22	41,865,129	41,924,993	RGD:6480464	CTD
G	ACOT1	acyl-CoA thioesterase 1		multiple interactions	ISO	14	74,003,928	74,010,498	RGD:6480464	CTD
G	ACOT13	acyl-CoA thioesterase 13		multiple interactions	ISO	6	24,667,263	24,705,297	RGD:6480464	CTD
G	ACOX1	acyl-CoA oxidase 1, palmitoyl		multiple interactions	ISO	17	73,937,588	73,975,515	RGD:6480464	CTD
G	ACP1	acid phosphatase 1, soluble		multiple interactions	ISO	2	264,869	278,283	RGD:6480464	CTD
G	ACSL1	acyl-CoA synthetase long-chain family member 1		multiple interactions	ISO	4	185,676,749	185,747,215	RGD:6480464	CTD
G	ACSL5	acyl-CoA synthetase long-chain family member 5		multiple interactions	ISO	10	114,133,916	114,188,138	RGD:6480464	CTD
G	ACSM2A	acyl-CoA synthetase medium-chain family member 2A		decreases expression	ISO	16	20,462,859	20,498,991	RGD:6480464	CTD
G	ACTC1	actin, alpha, cardiac muscle 1		multiple interactions	ISO	15	35,080,297	35,087,927	RGD:6480464	CTD
G	ACTG1	actin, gamma 1		multiple interactions	ISO	17	79,476,997	79,479,892	RGD:6480464	CTD
G	ACVRL1	activin A receptor type II-like 1		multiple interactions	ISO	12	52,301,202	52,317,145	RGD:6480464	CTD
G	ADA	adenosine deaminase		decreases expression	ISO	20	43,248,163	43,280,376	RGD:6480464	CTD
G	ADAM15	ADAM metallopeptidase domain 15		multiple interactions	ISO	1	155,023,748	155,035,252	RGD:6480464	CTD
G	ADAM9	ADAM metallopeptidase domain 9		multiple interactions	ISO	8	38,854,505	38,962,780	RGD:6480464	CTD
G	ADAR	adenosine deaminase, RNA-specific		decreases expression	ISO	1	154,554,533	154,600,456	RGD:6480464	CTD
G	ADH1C	alcohol dehydrogenase 1C (class I), gamma polypeptide		multiple interactions	ISO	4	100,257,649	100,273,917	RGD:6480464	CTD
G	ADK	adenosine kinase		multiple interactions	ISO	10	75,910,943	76,469,061	RGD:6480464	CTD
G	ADORA1	adenosine A1 receptor		multiple interactions	ISO	1	203,096,836	203,136,533	RGD:6480464	CTD
G	ADRA1B	adrenoceptor alpha 1B		multiple interactions	ISO	5	159,343,740	159,400,017	RGD:6480464	CTD
G	ADRB1	adrenoceptor beta 1		multiple interactions	ISO	10	115,803,806	115,806,667	RGD:6480464	CTD
G	ADRB2	adrenoceptor beta 2, surface		multiple interactions	ISO	5	148,206,156	148,208,197	RGD:6480464	CTD
G	ADRB3	adrenoceptor beta 3		multiple interactions	ISO	8	37,820,513	37,824,184	RGD:6480464	CTD
G	ADRB3	adrenoceptor beta 3		decreases expression	ISO	8	37,820,513	37,824,184	RGD:6480464	CTD
G	ADSS	adenylosuccinate synthase		increases expression	ISO	1	244,571,794	244,615,436	RGD:6480464	CTD
G	AGRN	agrin		multiple interactions	ISO	1	955,503	991,499	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGXT	alanine-glyoxylate aminotransferase		multiple interactions	ISO	2	241,808,162	241,818,536	RGD:6480464	CTD
G	AHSG	alpha-2-HS-glycoprotein		multiple interactions	ISO	3	186,330,850	186,339,107	RGD:6480464	CTD
G	AIMP1	aminoacyl tRNA synthetase complex-interacting multifunctional protein 1		increases expression	ISO	4	107,236,767	107,270,382	RGD:6480464	CTD
G	AK3	adenylate kinase 3		multiple interactions	ISO	9	4,709,556	4,742,043	RGD:6480464	CTD
G	AK4	adenylate kinase 4		multiple interactions	ISO	1	65,613,232	65,697,828	RGD:6480464	CTD
G	AKAP12	A kinase (PRKA) anchor protein 12		multiple interactions	ISO	6	151,561,134	151,679,694	RGD:6480464	CTD
G	AKR1C1	aldo-keto reductase family 1, member C1		multiple interactions	ISO	10	5,005,454	5,020,158	RGD:6480464	CTD
G	AKR1C1	aldo-keto reductase family 1, member C1		decreases expression	ISO	10	5,005,454	5,020,158	RGD:6480464	CTD
G	AKR1E2	aldo-keto reductase family 1, member E2		multiple interactions	ISO	10	4,868,369	4,890,254	RGD:6480464	CTD
G	ALAD	aminolevulinate dehydratase		multiple interactions	ISO	9	116,148,592	116,163,618	RGD:6480464	CTD
G	ALAS1	aminolevulinate, delta-, synthase 1		multiple interactions	ISO	3	52,232,099	52,248,343	RGD:6480464	CTD
G	ALAS2	aminolevulinate, delta-, synthase 2		affects expression	ISO	X	55,035,488	55,057,497	RGD:6480464	CTD
G	ALAS2	aminolevulinate, delta-, synthase 2		multiple interactions	ISO	X	55,035,488	55,057,497	RGD:6480464	CTD
G	ALDH1A1	aldehyde dehydrogenase 1 family, member A1		multiple interactions	ISO	9	75,515,578	75,568,233	RGD:6480464	CTD
G	ALDH2	aldehyde dehydrogenase 2 family (mitochondrial)		multiple interactions	ISO	12	112,204,691	112,247,789	RGD:6480464	CTD
G	ALDH3A2	aldehyde dehydrogenase 3 family, member A2		multiple interactions	ISO	17	19,552,064	19,580,908	RGD:6480464	CTD
G	ALDH9A1	aldehyde dehydrogenase 9 family, member A1		multiple interactions	ISO	1	165,631,449	165,667,900	RGD:6480464	CTD
G	ALG2	ALG2, alpha-1,3/1,6-mannosyltransferase		multiple interactions	ISO	9	101,978,707	101,984,246	RGD:6480464	CTD
G	AMD1	adenosylmethionine decarboxylase 1		decreases expression	ISO	6	111,195,987	111,216,913	RGD:6480464	CTD
G	AMELX	amelogenin, X-linked		multiple interactions	ISO	X	11,311,533	11,318,881	RGD:6480464	CTD
G	ANKH	ankylosis, progressive homolog (mouse)		multiple interactions	ISO	5	14,704,909	14,871,887	RGD:6480464	CTD
G	ANKRD28	ankyrin repeat domain 28		multiple interactions	ISO	3	15,708,743	15,901,053	RGD:6480464	CTD
G	ANKRD40	ankyrin repeat domain 40		multiple interactions	ISO	17	48,770,551	48,785,270	RGD:6480464	CTD
G	ANXA5	annexin A5		multiple interactions	ISO	4	122,589,152	122,618,147	RGD:6480464	CTD
G	AP1AR	adaptor-related protein complex 1 associated regulatory protein		multiple interactions	ISO	4	113,152,895	113,191,211	RGD:6480464	CTD
G	AP3S1	adaptor-related protein complex 3, sigma 1 subunit		multiple interactions	ISO	5	115,177,619	115,249,778	RGD:6480464	CTD
G	APBB2	amyloid beta (A4) precursor protein-binding, family B, member 2		increases expression	ISO	4	40,812,044	41,216,635	RGD:6480464	CTD
G	APCS	amyloid P component, serum		multiple interactions	ISO	1	159,557,616	159,558,661	RGD:6480464	CTD
G	APLNR	apelin receptor		multiple interactions	ISO	11	57,001,051	57,004,927	RGD:6480464	CTD
G	APOA4	apolipoprotein A-IV		multiple interactions	ISO	11	116,691,418	116,694,011	RGD:6480464	CTD
G	APOF	apolipoprotein F		multiple interactions	ISO	12	56,754,355	56,756,583	RGD:6480464	CTD
G	APOM	apolipoprotein M		multiple interactions	ISO	6	31,620,187	31,625,987	RGD:6480464	CTD
G	AQP1	aquaporin 1 (Colton blood group)		multiple interactions	ISO	7	30,951,415	30,965,131	RGD:6480464	CTD
G	AQP4	aquaporin 4		decreases expression	ISO	18	24,432,007	24,445,716	RGD:6480464	CTD
G	AQP4	aquaporin 4		multiple interactions	ISO	18	24,432,007	24,445,716	RGD:6480464	CTD
G	ARCN1	archain 1		decreases expression	ISO	11	118,443,102	118,473,748	RGD:6480464	CTD
G	ARHGAP35	Rho GTPase activating protein 35		multiple interactions	ISO	19	47,421,933	47,508,334	RGD:6480464	CTD
G	ARHGAP5	Rho GTPase activating protein 5		multiple interactions	ISO	14	32,546,495	32,628,934	RGD:6480464	CTD
G	ARHGEF3	Rho guanine nucleotide exchange factor (GEF) 3		multiple interactions	ISO	3	56,761,446	57,113,336	RGD:6480464	CTD
G	ARIH1	ariadne homolog, ubiquitin-conjugating enzyme E2 binding protein, 1 (Drosophila)		increases expression	ISO	15	72,766,667	72,878,896	RGD:6480464	CTD
G	ARL4A	ADP-ribosylation factor-like 4A		multiple interactions	ISO	7	12,726,452	12,730,559	RGD:6480464	CTD
G	ARL8B	ADP-ribosylation factor-like 8B		multiple interactions	ISO	3	5,163,930	5,222,601	RGD:6480464	CTD
G	ART3	ADP-ribosyltransferase 3		multiple interactions	ISO	4	76,932,333	77,033,955	RGD:6480464	CTD
G	ASF1A	ASF1 anti-silencing function 1 homolog A (S. cerevisiae)		multiple interactions	ISO	6	119,215,241	119,230,336	RGD:6480464	CTD
G	ASF1B	ASF1 anti-silencing function 1 homolog B (S. cerevisiae)		multiple interactions	ISO	19	14,230,321	14,247,440	RGD:6480464	CTD
G	ASGR2	asialoglycoprotein receptor 2		multiple interactions	ISO	17	7,004,641	7,018,130	RGD:6480464	CTD
G	ASIC5	acid-sensing (proton-gated) ion channel family member 5		multiple interactions	ISO	4	156,750,881	156,787,425	RGD:6480464	CTD
G	ASPRV1	aspartic peptidase, retroviral-like 1		multiple interactions	ISO	2	70,187,221	70,189,397	RGD:6480464	CTD
G	ASS1	argininosuccinate synthase 1		increases expression	ISO	9	133,320,094	133,376,661	RGD:6480464	CTD
G	ASTN1	astrotactin 1		increases expression	ISO	1	176,830,203	177,134,024	RGD:6480464	CTD
G	ATAD3A	ATPase family, AAA domain containing 3A		multiple interactions	ISO	1	1,447,523	1,470,067	RGD:6480464	CTD
G	ATF3	activating transcription factor 3		affects expression	ISO	1	212,738,676	212,794,119	RGD:6480464	CTD
G	ATF3	activating transcription factor 3		multiple interactions	ISO	1	212,738,676	212,794,119	RGD:6480464	CTD
G	ATF3	activating transcription factor 3		increases expression	ISO	1	212,738,676	212,794,119	RGD:6480464	CTD
G	ATF4	activating transcription factor 4 (tax-responsive enhancer element B67)		decreases expression	ISO	22	39,916,569	39,918,691	RGD:6480464	CTD
G	ATF4	activating transcription factor 4 (tax-responsive enhancer element B67)		multiple interactions	ISO	22	39,916,569	39,918,691	RGD:6480464	CTD
G	ATF5	activating transcription factor 5		multiple interactions	ISO	19	50,431,959	50,437,193	RGD:6480464	CTD
G	ATG7	autophagy related 7		multiple interactions	ISO	3	11,314,010	11,599,139	RGD:6480464	CTD
G	ATP5C1	ATP synthase, H+ transporting, mitochondrial F1 complex, gamma polypeptide 1		multiple interactions	ISO	10	7,830,093	7,849,764	RGD:6480464	CTD
G	ATP5D	ATP synthase, H+ transporting, mitochondrial F1 complex, delta subunit		multiple interactions	ISO	19	1,241,749	1,244,824	RGD:6480464	CTD
G	ATP6V0A2	ATPase, H+ transporting, lysosomal V0 subunit a2		multiple interactions	ISO	12	124,196,865	124,246,302	RGD:6480464	CTD
G	ATP6V0B	ATPase, H+ transporting, lysosomal 21kDa, V0 subunit b		multiple interactions	ISO	1	44,440,602	44,443,972	RGD:6480464	CTD
G	ATXN10	ataxin 10		multiple interactions	ISO	22	46,067,678	46,241,187	RGD:6480464	CTD
G	AURKAIP1	aurora kinase A interacting protein 1		multiple interactions	ISO	1	1,309,110	1,310,818	RGD:6480464	CTD
G	B3GNT9	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9		multiple interactions	ISO	16	67,182,005	67,184,902	RGD:6480464	CTD
G	BACH1	BTB and CNC homology 1, basic leucine zipper transcription factor 1		multiple interactions	ISO	21	30,671,220	30,734,217	RGD:6480464	CTD
G	BAG3	BCL2-associated athanogene 3		multiple interactions	ISO	10	121,410,882	121,437,331	RGD:6480464	CTD
G	BASP1	brain abundant, membrane attached signal protein 1		increases expression	ISO	5	17,217,750	17,276,943	RGD:6480464	CTD
G	BATF	basic leucine zipper transcription factor, ATF-like		multiple interactions	ISO	14	75,988,784	76,013,335	RGD:6480464	CTD
G	BCAP29	B-cell receptor-associated protein 29		multiple interactions	ISO	7	107,220,422	107,263,762	RGD:6480464	CTD
G	BCAS3	breast carcinoma amplified sequence 3		decreases expression	ISO	17	58,755,172	59,470,199	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		decreases expression	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L10	BCL2-like 10 (apoptosis facilitator)		multiple interactions	ISO	15	52,401,822	52,404,972	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	ISO	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L13	BCL2-like 13 (apoptosis facilitator)		increases expression	ISO	22	18,121,350	18,213,621	RGD:6480464	CTD
G	BCL6B	B-cell CLL/lymphoma 6, member B		decreases expression	ISO	17	6,926,369	6,932,961	RGD:6480464	CTD
G	BMP8B	bone morphogenetic protein 8b		multiple interactions	ISO	1	40,223,903	40,254,533	RGD:6480464	CTD
G	BNIP3L	BCL2/adenovirus E1B 19kDa interacting protein 3-like		increases expression	ISO	8	26,240,523	26,270,644	RGD:6480464	CTD
G	BPGM	2,3-bisphosphoglycerate mutase		decreases expression	ISO	7	134,331,531	134,364,568	RGD:6480464	CTD
G	BPIFA2	BPI fold containing family A, member 2		multiple interactions	ISO	20	31,755,960	31,769,223	RGD:6480464	CTD
G	BRD2	bromodomain containing 2		multiple interactions	ISO	6	32,936,437	32,949,282	RGD:6480464	CTD
G	BTF3	basic transcription factor 3		multiple interactions	ISO	5	72,794,250	72,801,448	RGD:6480464	CTD
G	BTG1	B-cell translocation gene 1, anti-proliferative		affects expression	ISO	12	92,534,054	92,539,673	RGD:6480464	CTD
G	BTG2	BTG family, member 2		decreases expression	ISO	1	203,274,664	203,278,730	RGD:6480464	CTD
G	BTG2	BTG family, member 2		multiple interactions	ISO	1	203,274,664	203,278,730	RGD:6480464	CTD
G	C19orf73	chromosome 19 open reading frame 73		multiple interactions	ISO	19	49,621,654	49,622,397	RGD:6480464	CTD
G	C2	complement component 2		multiple interactions	ISO	6	31,865,562	31,913,449	RGD:6480464	CTD
G	C2CD3	C2 calcium-dependent domain containing 3		multiple interactions	ISO	11	73,745,480	73,882,064	RGD:6480464	CTD
G	C4BPA	complement component 4 binding protein, alpha		multiple interactions	ISO	1	207,277,607	207,318,317	RGD:6480464	CTD
G	CA14	carbonic anhydrase XIV		decreases expression	ISO	1	150,230,218	150,237,478	RGD:6480464	CTD
G	CA8	carbonic anhydrase VIII		multiple interactions	ISO	8	61,101,423	61,193,954	RGD:6480464	CTD
G	CACNG1	calcium channel, voltage-dependent, gamma subunit 1		multiple interactions	ISO	17	65,040,652	65,052,913	RGD:6480464	CTD
G	CAPN2	calpain 2, (m/II) large subunit		multiple interactions	ISO	1	223,889,295	223,963,720	RGD:6480464	CTD
G	CAPZB	capping protein (actin filament) muscle Z-line, beta		multiple interactions	ISO	1	19,665,267	19,812,066	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases expression	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases expression	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CCDC93	coiled-coil domain containing 93		increases expression	ISO	2	118,673,054	118,771,739	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		increases expression	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		increases expression	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL27	chemokine (C-C motif) ligand 27		increases expression	ISO	9	34,661,893	34,662,689	RGD:6480464	CTD
G	CCL3	chemokine (C-C motif) ligand 3		increases expression	ISO	17	34,415,602	34,417,506	RGD:6480464	CTD
G	CCND3	cyclin D3		multiple interactions	ISO	6	41,902,671	42,016,610	RGD:6480464	CTD
G	CCNI	cyclin I		decreases expression	ISO	4	77,969,165	77,997,125	RGD:6480464	CTD
G	CCNI	cyclin I		multiple interactions	ISO	4	77,969,165	77,997,125	RGD:6480464	CTD
G	CCRN4L	CCR4 carbon catabolite repression 4-like (S. cerevisiae)		multiple interactions	ISO	4	139,936,943	139,967,093	RGD:6480464	CTD
G	CCS	copper chaperone for superoxide dismutase		multiple interactions	ISO	11	66,360,690	66,373,490	RGD:6480464	CTD
G	CD151	CD151 molecule (Raph blood group)		multiple interactions	ISO	11	832,952	838,835	RGD:6480464	CTD
G	CD247	CD247 molecule		multiple interactions	ISO	1	167,399,877	167,487,847	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD4	CD4 molecule		multiple interactions	ISO	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD5L	CD5 molecule-like		multiple interactions	ISO	1	157,800,704	157,811,634	RGD:6480464	CTD
G	CD74	CD74 molecule, major histocompatibility complex, class II invariant chain		multiple interactions	ISO	5	149,781,200	149,792,499	RGD:6480464	CTD
G	CD86	CD86 molecule		decreases expression	ISO	3	121,774,209	121,839,990	RGD:6480464	CTD
G	CD8B	CD8b molecule		multiple interactions	ISO	2	87,042,460	87,089,047	RGD:6480464	CTD
G	CDC25C	cell division cycle 25C		multiple interactions	ISO	5	137,620,959	137,667,516	RGD:6480464	CTD
G	CDC34	cell division cycle 34		multiple interactions	ISO	19	531,733	542,087	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		multiple interactions	ISO	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK5RAP3	CDK5 regulatory subunit associated protein 3		multiple interactions	ISO	17	46,048,429	46,059,147	RGD:6480464	CTD
G	CDKL2	cyclin-dependent kinase-like 2 (CDC2-related kinase)		multiple interactions	ISO	4	76,501,704	76,555,721	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		multiple interactions	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDV3	CDV3 homolog (mouse)		multiple interactions	ISO	3	133,292,434	133,309,118	RGD:6480464	CTD
G	CEACAM1	carcinoembryonic antigen-related cell adhesion molecule 1 (biliary glycoprotein)		multiple interactions	ISO	19	43,011,458	43,032,661	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CELF2	CUGBP, Elav-like family member 2		multiple interactions	ISO	10	11,047,259	11,378,674	RGD:6480464	CTD
G	CER1	cerberus 1, DAN family BMP antagonist		multiple interactions	ISO	9	14,719,731	14,722,715	RGD:6480464	CTD
G	CES3	carboxylesterase 3		multiple interactions	ISO	16	66,995,132	67,009,052	RGD:6480464	CTD
G	CFH	complement factor H		multiple interactions	ISO	1	196,621,008	196,716,634	RGD:6480464	CTD
G	CFI	complement factor I		multiple interactions	ISO	4	110,661,848	110,723,335	RGD:6480464	CTD
G	CHAF1B	chromatin assembly factor 1, subunit B (p60)		multiple interactions	ISO	21	37,757,689	37,789,125	RGD:6480464	CTD
G	CHCHD10	coiled-coil-helix-coiled-coil-helix domain containing 10		multiple interactions	ISO	22	24,108,021	24,110,141	RGD:6480464	CTD
G	CHCHD3	coiled-coil-helix-coiled-coil-helix domain containing 3		multiple interactions	ISO	7	132,469,623	132,766,833	RGD:6480464	CTD
G	CHCHD6	coiled-coil-helix-coiled-coil-helix domain containing 6		multiple interactions	ISO	3	126,423,063	126,679,263	RGD:6480464	CTD
G	CHD4	chromodomain helicase DNA binding protein 4		multiple interactions	ISO	12	6,679,248	6,716,551	RGD:6480464	CTD
G	CHKA	choline kinase alpha		multiple interactions	ISO	11	67,820,326	67,888,858	RGD:6480464	CTD
G	CHKB	choline kinase beta		multiple interactions	ISO	22	51,017,387	51,021,428	RGD:6480464	CTD
G	CHPT1	choline phosphotransferase 1		multiple interactions	ISO	12	102,091,417	102,122,846	RGD:6480464	CTD
G	CHRNA1	cholinergic receptor, nicotinic, alpha 1 (muscle)		decreases expression	ISO	2	175,612,320	175,629,200	RGD:6480464	CTD
G	CHRNB2	cholinergic receptor, nicotinic, beta 2 (neuronal)		multiple interactions	ISO	1	154,540,257	154,552,354	RGD:6480464	CTD
G	CIC	capicua transcriptional repressor		affects expression	ISO	19	42,788,817	42,799,949	RGD:6480464	CTD
G	CKAP2	cytoskeleton associated protein 2		multiple interactions	ISO	13	53,029,495	53,050,763	RGD:6480464	CTD
G	CLCN1	chloride channel, voltage-sensitive 1		multiple interactions	ISO	7	143,013,219	143,049,097	RGD:6480464	CTD
G	CLDN6	claudin 6		multiple interactions	ISO	16	3,064,713	3,068,188	RGD:6480464	CTD
G	CLDN8	claudin 8		increases expression	ISO	21	31,586,324	31,588,469	RGD:6480464	CTD
G	CLEC4F	C-type lectin domain family 4, member F		multiple interactions	ISO	2	71,035,775	71,047,732	RGD:6480464	CTD
G	CLN6	ceroid-lipofuscinosis, neuronal 6, late infantile, variant		multiple interactions	ISO	15	68,499,330	68,522,080	RGD:6480464	CTD
G	CLVS1	clavesin 1		increases expression	ISO	8	62,200,525	62,414,204	RGD:6480464	CTD
G	CMBL	carboxymethylenebutenolidase homolog (Pseudomonas)		multiple interactions	ISO	5	10,277,707	10,308,168	RGD:6480464	CTD
G	CNTN1	contactin 1		multiple interactions	ISO	12	41,086,244	41,466,214	RGD:6480464	CTD
G	CNTNAP1	contactin associated protein 1		increases expression	ISO	17	40,834,632	40,852,011	RGD:6480464	CTD
G	COL17A1	collagen, type XVII, alpha 1		decreases expression	ISO	10	105,791,046	105,845,638	RGD:6480464	CTD
G	COL17A1	collagen, type XVII, alpha 1		multiple interactions	ISO	10	105,791,046	105,845,638	RGD:6480464	CTD
G	COL18A1	collagen, type XVIII, alpha 1		multiple interactions	ISO	21	46,825,097	46,933,634	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		multiple interactions	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL2A1	collagen, type II, alpha 1		decreases expression	ISO	12	48,366,748	48,398,285	RGD:6480464	CTD
G	COMT	catechol-O-methyltransferase		decreases expression	ISO	22	19,929,263	19,957,498	RGD:6480464	CTD
G	COPB2	coatomer protein complex, subunit beta 2 (beta prime)		increases expression	ISO	3	139,076,433	139,108,522	RGD:6480464	CTD
G	COPB2	coatomer protein complex, subunit beta 2 (beta prime)		multiple interactions	ISO	3	139,076,433	139,108,522	RGD:6480464	CTD
G	COPS6	COP9 signalosome subunit 6		multiple interactions	ISO	7	99,686,583	99,689,823	RGD:6480464	CTD
G	COPZ2	coatomer protein complex, subunit zeta 2		multiple interactions	ISO	17	46,103,533	46,115,152	RGD:6480464	CTD
G	COQ4	coenzyme Q4 homolog (S. cerevisiae)		multiple interactions	ISO	9	131,084,791	131,096,351	RGD:6480464	CTD
G	COQ9	coenzyme Q9 homolog (S. cerevisiae)		multiple interactions	ISO	16	57,481,337	57,495,187	RGD:6480464	CTD
G	COX17	cytochrome c oxidase assembly homolog 17 (yeast)		multiple interactions	ISO	3	119,388,372	119,396,243	RGD:6480464	CTD
G	COX6A1	cytochrome c oxidase subunit VIa polypeptide 1		multiple interactions	ISO	12	120,875,893	120,878,545	RGD:6480464	CTD
G	COX6B2	cytochrome c oxidase subunit VIb polypeptide 2 (testis)		multiple interactions	ISO	19	55,861,070	55,866,182	RGD:6480464	CTD
G	COX6C	cytochrome c oxidase subunit VIc		multiple interactions	ISO	8	100,890,223	100,906,242	RGD:6480464	CTD
G	COX7A1	cytochrome c oxidase subunit VIIa polypeptide 1 (muscle)		multiple interactions	ISO	19	36,641,824	36,643,771	RGD:6480464	CTD
G	CPOX	coproporphyrinogen oxidase		multiple interactions	ISO	3	98,298,290	98,312,455	RGD:6480464	CTD
G	CPS1	carbamoyl-phosphate synthase 1, mitochondrial		multiple interactions	ISO	2	211,342,406	211,543,831	RGD:6480464	CTD
G	CPT2	carnitine palmitoyltransferase 2		decreases expression	ISO	1	53,662,101	53,679,869	RGD:6480464	CTD
G	CPT2	carnitine palmitoyltransferase 2		multiple interactions	ISO	1	53,662,101	53,679,869	RGD:6480464	CTD
G	CR1L	complement component (3b/4b) receptor 1-like		multiple interactions	ISO	1	207,818,458	207,897,036	RGD:6480464	CTD
G	CRAT	carnitine O-acetyltransferase		multiple interactions	ISO	9	131,857,073	131,873,070	RGD:6480464	CTD
G	CREB1	cAMP responsive element binding protein 1		increases expression	ISO	2	208,394,616	208,470,284	RGD:6480464	CTD
G	CRKL	v-crk sarcoma virus CT10 oncogene homolog (avian)-like		decreases expression	ISO	22	21,271,714	21,308,037	RGD:6480464	CTD
G	CRY1	cryptochrome 1 (photolyase-like)		multiple interactions	ISO	12	107,385,142	107,487,635	RGD:6480464	CTD
G	CRYGD	crystallin, gamma D		decreases expression	ISO	2	208,986,331	208,989,313	RGD:6480464	CTD
G	CSF2RB	colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage)		multiple interactions	ISO	22	37,309,675	37,336,481	RGD:6480464	CTD
G	CSNK1D	casein kinase 1, delta		multiple interactions	ISO	17	80,200,537	80,231,594	RGD:6480464	CTD
G	CSNK1D	casein kinase 1, delta		increases expression	ISO	17	80,200,537	80,231,594	RGD:6480464	CTD
G	CSRP3	cysteine and glycine-rich protein 3 (cardiac LIM protein)		multiple interactions	ISO	11	19,203,577	19,232,118	RGD:6480464	CTD
G	CST7	cystatin F (leukocystatin)		decreases expression	ISO	20	24,929,866	24,940,564	RGD:6480464	CTD
G	CTGF	connective tissue growth factor		increases expression	ISO	6	132,269,316	132,272,518	RGD:6480464	CTD
G	CTGF	connective tissue growth factor		affects expression	ISO	6	132,269,316	132,272,518	RGD:6480464	CTD
G	CTSC	cathepsin C		multiple interactions	ISO	11	88,026,760	88,070,941	RGD:6480464	CTD
G	CTSE	cathepsin E		multiple interactions	ISO	1	206,317,459	206,332,104	RGD:6480464	CTD
G	CTSH	cathepsin H		multiple interactions	ISO	15	79,214,092	79,237,420	RGD:6480464	CTD
G	CTSL1	cathepsin L1		multiple interactions	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSS	cathepsin S		multiple interactions	ISO	1	150,702,672	150,738,433	RGD:6480464	CTD
G	CUTA	cutA divalent cation tolerance homolog (E. coli)		multiple interactions	ISO	6	33,384,319	33,386,065	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		increases expression	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		increases secretion	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		increases expression	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL10	chemokine (C-X-C motif) ligand 10		increases expression	ISO	4	76,942,269	76,944,689	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		increases expression	ISO	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CYB5B	cytochrome b5 type B (outer mitochondrial membrane)		multiple interactions	ISO	16	69,458,498	69,500,167	RGD:6480464	CTD
G	CYHR1	cysteine/histidine-rich 1		multiple interactions	ISO	8	145,675,315	145,691,031	RGD:6480464	CTD
G	CYP17A1	cytochrome P450, family 17, subfamily A, polypeptide 1		multiple interactions	ISO	10	104,590,288	104,597,290	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		increases expression	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		increases chemical synthesis	EXP	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		increases expression	ISO	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		multiple interactions	ISO	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		increases metabolic processing	EXP	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		multiple interactions	ISO	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP2F1	cytochrome P450, family 2, subfamily F, polypeptide 1		multiple interactions	ISO	19	41,620,353	41,634,281	RGD:6480464	CTD
G	CYP2S1	cytochrome P450, family 2, subfamily S, polypeptide 1		decreases expression	ISO	19	41,699,115	41,713,444	RGD:6480464	CTD
G	CYP3A7	cytochrome P450, family 3, subfamily A, polypeptide 7		multiple interactions	ISO	7	99,302,660	99,332,819	RGD:6480464	CTD
G	CYP4A11	cytochrome P450, family 4, subfamily A, polypeptide 11		multiple interactions	ISO	1	47,394,846	47,407,156	RGD:6480464	CTD
G	CYP4A22	cytochrome P450, family 4, subfamily A, polypeptide 22		multiple interactions	ISO	1	47,603,107	47,614,526	RGD:6480464	CTD
G	CYP7A1	cytochrome P450, family 7, subfamily A, polypeptide 1		affects expression	ISO	8	59,402,737	59,412,720	RGD:6480464	CTD
G	CYP8B1	cytochrome P450, family 8, subfamily B, polypeptide 1		multiple interactions	ISO	3	42,913,684	42,917,633	RGD:6480464	CTD
G	CYTH3	cytohesin 3		multiple interactions	ISO	7	6,201,410	6,312,242	RGD:6480464	CTD
G	CYTIP	cytohesin 1 interacting protein		multiple interactions	ISO	2	158,271,131	158,300,604	RGD:6480464	CTD
G	DAO	D-amino-acid oxidase		multiple interactions	ISO	12	109,273,857	109,294,710	RGD:6480464	CTD
G	DAP	death-associated protein		multiple interactions	ISO	5	10,679,342	10,761,387	RGD:6480464	CTD
G	DAPK2	death-associated protein kinase 2		increases expression	ISO	15	64,199,235	64,338,521	RGD:6480464	CTD
G	DAZL	deleted in azoospermia-like		decreases expression	ISO	3	16,628,299	16,647,006	RGD:6480464	CTD
G	DBI	diazepam binding inhibitor (GABA receptor modulator, acyl-CoA binding protein)		multiple interactions	ISO	2	120,124,504	120,130,122	RGD:6480464	CTD
G	DBT	dihydrolipoamide branched chain transacylase E2		multiple interactions	ISO	1	100,652,478	100,715,409	RGD:6480464	CTD
G	DCLRE1A	DNA cross-link repair 1A		multiple interactions	ISO	10	115,594,484	115,613,859	RGD:6480464	CTD
G	DCTPP1	dCTP pyrophosphatase 1		multiple interactions	ISO	16	30,435,019	30,441,373	RGD:6480464	CTD
G	DDA1	DET1 and DDB1 associated 1		multiple interactions	ISO	19	17,420,337	17,434,107	RGD:6480464	CTD
G	DDHD2	DDHD domain containing 2		multiple interactions	ISO	8	38,089,009	38,120,287	RGD:6480464	CTD
G	DDIT3	DNA-damage-inducible transcript 3		increases expression	ISO	12	57,910,371	57,914,300	RGD:6480464	CTD
G	DDIT3	DNA-damage-inducible transcript 3		multiple interactions	ISO	12	57,910,371	57,914,300	RGD:6480464	CTD
G	DDIT3	DNA-damage-inducible transcript 3		increases expression	ISO	12	57,910,371	57,914,300	RGD:6480464	CTD
G	DDIT4	DNA-damage-inducible transcript 4		multiple interactions	ISO	10	74,033,677	74,035,797	RGD:6480464	CTD
G	DDT	D-dopachrome tautomerase		multiple interactions	ISO	22	24,313,554	24,322,019	RGD:6480464	CTD
G	DDX3X	DEAD (Asp-Glu-Ala-Asp) box polypeptide 3, X-linked		multiple interactions	ISO	X	41,192,651	41,209,527	RGD:6480464	CTD
G	DDX52	DEAD (Asp-Glu-Ala-Asp) box polypeptide 52		multiple interactions	ISO	17	35,972,363	36,003,493	RGD:6480464	CTD
G	DDX6	DEAD (Asp-Glu-Ala-Asp) box helicase 6		decreases expression	ISO	11	118,618,472	118,661,972	RGD:6480464	CTD
G	DECR1	2,4-dienoyl CoA reductase 1, mitochondrial		multiple interactions	ISO	8	91,013,580	91,064,227	RGD:6480464	CTD
G	DEFA5	defensin, alpha 5, Paneth cell-specific		multiple interactions	ISO	8	6,912,829	6,914,259	RGD:6480464	CTD
G	DGAT1	diacylglycerol O-acyltransferase 1		multiple interactions	ISO	8	145,538,247	145,550,567	RGD:6480464	CTD
G	DHCR7	7-dehydrocholesterol reductase		multiple interactions	ISO	11	71,145,457	71,159,477	RGD:6480464	CTD
G	DHRS4	dehydrogenase/reductase (SDR family) member 4		multiple interactions	ISO	14	24,422,965	24,438,488	RGD:6480464	CTD
G	DHRS7B	dehydrogenase/reductase (SDR family) member 7B		multiple interactions	ISO	17	21,030,241	21,095,285	RGD:6480464	CTD
G	DIO1	deiodinase, iodothyronine, type I		multiple interactions	ISO	1	54,359,861	54,376,759	RGD:6480464	CTD
G	DKK1	dickkopf 1 homolog (Xenopus laevis)		multiple interactions	ISO	10	54,074,041	54,077,417	RGD:6480464	CTD
G	DLX4	distal-less homeobox 4		multiple interactions	ISO	17	48,046,562	48,052,323	RGD:6480464	CTD
G	DMGDH	dimethylglycine dehydrogenase		multiple interactions	ISO	5	78,293,429	78,365,449	RGD:6480464	CTD
G	DNAH8	dynein, axonemal, heavy chain 8		decreases expression	ISO	6	38,683,117	38,998,574	RGD:6480464	CTD
G	DNAJA1	DnaJ (Hsp40) homolog, subfamily A, member 1		multiple interactions	ISO	9	33,025,209	33,039,062	RGD:6480464	CTD
G	DNAJB1	DnaJ (Hsp40) homolog, subfamily B, member 1		multiple interactions	ISO	19	14,625,582	14,629,201	RGD:6480464	CTD
G	DNAJB1	DnaJ (Hsp40) homolog, subfamily B, member 1		increases expression	ISO	19	14,625,582	14,629,201	RGD:6480464	CTD
G	DNAJB1	DnaJ (Hsp40) homolog, subfamily B, member 1		increases expression	ISO	19	14,625,582	14,629,201	RGD:6480464	CTD
G	DNAJB6	DnaJ (Hsp40) homolog, subfamily B, member 6		multiple interactions	ISO	7	157,129,710	157,210,133	RGD:6480464	CTD
G	DNAJB9	DnaJ (Hsp40) homolog, subfamily B, member 9		multiple interactions	ISO	7	108,210,189	108,215,294	RGD:6480464	CTD
G	DNAJC1	DnaJ (Hsp40) homolog, subfamily C, member 1		multiple interactions	ISO	10	22,045,477	22,292,650	RGD:6480464	CTD
G	DNAJC15	DnaJ (Hsp40) homolog, subfamily C, member 15		multiple interactions	ISO	13	43,597,362	43,683,306	RGD:6480464	CTD
G	DNAJC3	DnaJ (Hsp40) homolog, subfamily C, member 3		multiple interactions	ISO	13	96,329,393	96,447,243	RGD:6480464	CTD
G	DNASE1	deoxyribonuclease I		increases expression	ISO	16	3,702,940	3,708,096	RGD:6480464	CTD
G	DNTTIP2	deoxynucleotidyltransferase, terminal, interacting protein 2		multiple interactions	ISO	1	94,335,014	94,344,762	RGD:6480464	CTD
G	DOCK9	dedicator of cytokinesis 9		increases expression	ISO	13	99,445,741	99,738,660	RGD:6480464	CTD
G	DOHH	deoxyhypusine hydroxylase/monooxygenase		affects expression	ISO	19	3,490,819	3,500,938	RGD:6480464	CTD
G	DRAM2	DNA-damage regulated autophagy modulator 2		multiple interactions	ISO	1	111,659,954	111,682,838	RGD:6480464	CTD
G	DSG2	desmoglein 2		decreases expression	ISO	18	29,078,027	29,128,814	RGD:6480464	CTD
G	DSG2	desmoglein 2		multiple interactions	ISO	18	29,078,027	29,128,814	RGD:6480464	CTD
G	DTNB	dystrobrevin, beta		multiple interactions	ISO	2	25,600,067	25,896,516	RGD:6480464	CTD
G	DTX2	deltex homolog 2 (Drosophila)		multiple interactions	ISO	7	76,090,972	76,135,312	RGD:6480464	CTD
G	DTYMK	deoxythymidylate kinase (thymidylate kinase)		increases expression	ISO	2	242,615,157	242,626,383	RGD:6480464	CTD
G	DUSP1	dual specificity phosphatase 1		multiple interactions	ISO	5	172,195,093	172,198,203	RGD:6480464	CTD
G	DUSP1	dual specificity phosphatase 1		increases expression	ISO	5	172,195,093	172,198,203	RGD:6480464	CTD
G	DUSP16	dual specificity phosphatase 16		multiple interactions	ISO	12	12,626,216	12,715,448	RGD:6480464	CTD
G	DUSP6	dual specificity phosphatase 6		multiple interactions	ISO	12	89,741,837	89,746,296	RGD:6480464	CTD
G	DUSP8	dual specificity phosphatase 8		multiple interactions	ISO	11	1,575,281	1,593,150	RGD:6480464	CTD
G	DYNLRB1	dynein, light chain, roadblock-type 1		multiple interactions	ISO	20	33,104,204	33,128,762	RGD:6480464	CTD
G	EBNA1BP2	EBNA1 binding protein 2		multiple interactions	ISO	1	43,629,845	43,638,241	RGD:6480464	CTD
G	ECH1	enoyl CoA hydratase 1, peroxisomal		multiple interactions	ISO	19	39,306,062	39,322,497	RGD:6480464	CTD
G	ECI1	enoyl-CoA delta isomerase 1		multiple interactions	ISO	16	2,289,873	2,301,602	RGD:6480464	CTD
G	ECI2	enoyl-CoA delta isomerase 2		multiple interactions	ISO	6	4,115,927	4,135,831	RGD:6480464	CTD
G	EEF2	eukaryotic translation elongation factor 2		multiple interactions	ISO	19	3,976,054	3,985,461	RGD:6480464	CTD
G	EFHD2	EF-hand domain family, member D2		multiple interactions	ISO	1	15,736,391	15,756,839	RGD:6480464	CTD
G	EFNA1	ephrin-A1		multiple interactions	ISO	1	155,100,349	155,107,386	RGD:6480464	CTD
G	EGFR	epidermal growth factor receptor		multiple interactions	ISO	7	55,086,725	55,275,031	RGD:6480464	CTD
G	EGR1	early growth response 1		multiple interactions	ISO	5	137,801,181	137,805,004	RGD:6480464	CTD
G	EGR2	early growth response 2		multiple interactions	ISO	10	64,571,756	64,578,927	RGD:6480464	CTD
G	EHHADH	enoyl-CoA, hydratase/3-hydroxyacyl CoA dehydrogenase		multiple interactions	ISO	3	184,908,412	184,971,886	RGD:6480464	CTD
G	EI24	etoposide induced 2.4		multiple interactions	ISO	11	125,439,298	125,454,575	RGD:6480464	CTD
G	EIF1AX	eukaryotic translation initiation factor 1A, X-linked		increases expression	ISO	X	20,142,636	20,159,966	RGD:6480464	CTD
G	EIF2B5	eukaryotic translation initiation factor 2B, subunit 5 epsilon, 82kDa		multiple interactions	ISO	3	183,852,810	183,863,099	RGD:6480464	CTD
G	EIF4EBP1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	ISO	8	37,888,020	37,917,883	RGD:6480464	CTD
G	EIF4G1	eukaryotic translation initiation factor 4 gamma, 1		increases expression	ISO	3	184,032,283	184,053,146	RGD:6480464	CTD
G	EIF5B	eukaryotic translation initiation factor 5B		multiple interactions	ISO	2	99,953,834	100,016,728	RGD:6480464	CTD
G	ELF1	E74-like factor 1 (ets domain transcription factor)		multiple interactions	ISO	13	41,506,055	41,593,508	RGD:6480464	CTD
G	ELOVL2	ELOVL fatty acid elongase 2		multiple interactions	ISO	6	10,980,992	11,044,624	RGD:6480464	CTD
G	ELOVL3	ELOVL fatty acid elongase 3		multiple interactions	ISO	10	103,986,143	103,989,346	RGD:6480464	CTD
G	ENPEP	glutamyl aminopeptidase (aminopeptidase A)		multiple interactions	ISO	4	111,397,229	111,484,493	RGD:6480464	CTD
G	ENSA	endosulfine alpha		multiple interactions	ISO	1	150,594,599	150,602,098	RGD:6480464	CTD
G	ENTPD5	ectonucleoside triphosphate diphosphohydrolase 5		multiple interactions	ISO	14	74,433,172	74,486,026	RGD:6480464	CTD
G	EPHX2	epoxide hydrolase 2, cytoplasmic		multiple interactions	ISO	8	27,348,519	27,402,439	RGD:6480464	CTD
G	EPOR	erythropoietin receptor		multiple interactions	ISO	19	11,487,881	11,495,018	RGD:6480464	CTD
G	ERBB3	v-erb-b2 erythroblastic leukemia viral oncogene homolog 3 (avian)		increases expression	ISO	12	56,473,809	56,497,291	RGD:6480464	CTD
G	ERF	Ets2 repressor factor		multiple interactions	ISO	19	42,751,717	42,759,309	RGD:6480464	CTD
G	ERMP1	endoplasmic reticulum metallopeptidase 1		multiple interactions	ISO	9	5,784,572	5,833,081	RGD:6480464	CTD
G	ERP44	endoplasmic reticulum protein 44		multiple interactions	ISO	9	102,741,461	102,861,330	RGD:6480464	CTD
G	ERRFI1	ERBB receptor feedback inhibitor 1		multiple interactions	ISO	1	8,071,779	8,086,393	RGD:6480464	CTD
G	ETFB	electron-transfer-flavoprotein, beta polypeptide		multiple interactions	ISO	19	51,848,409	51,869,672	RGD:6480464	CTD
G	ETFDH	electron-transferring-flavoprotein dehydrogenase		multiple interactions	ISO	4	159,593,277	159,629,842	RGD:6480464	CTD
G	ETHE1	ethylmalonic encephalopathy 1		multiple interactions	ISO	19	44,010,871	44,031,396	RGD:6480464	CTD
G	ETS2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		multiple interactions	ISO	21	40,177,231	40,196,879	RGD:6480464	CTD
G	EVI2A	ecotropic viral integration site 2A		multiple interactions	ISO	17	29,643,428	29,648,767	RGD:6480464	CTD
G	F10	coagulation factor X		multiple interactions	ISO	13	113,777,113	113,803,843	RGD:6480464	CTD
G	F13B	coagulation factor XIII, B polypeptide		multiple interactions	ISO	1	197,008,321	197,036,397	RGD:6480464	CTD
G	F5	coagulation factor V (proaccelerin, labile factor)		multiple interactions	ISO	1	169,481,192	169,555,769	RGD:6480464	CTD
G	F7	coagulation factor VII (serum prothrombin conversion accelerator)		multiple interactions	ISO	13	113,760,102	113,774,995	RGD:6480464	CTD
G	FABP1	fatty acid binding protein 1, liver		multiple interactions	ISO	2	88,422,501	88,427,650	RGD:6480464	CTD
G	FABP5	fatty acid binding protein 5 (psoriasis-associated)		multiple interactions	ISO	8	82,192,718	82,197,012	RGD:6480464	CTD
G	FABP7	fatty acid binding protein 7, brain		multiple interactions	ISO	6	123,100,646	123,105,219	RGD:6480464	CTD
G	FABP9	fatty acid binding protein 9, testis		multiple interactions	ISO	8	82,370,618	82,373,758	RGD:6480464	CTD
G	FAH	fumarylacetoacetate hydrolase (fumarylacetoacetase)		multiple interactions	ISO	15	80,445,233	80,478,924	RGD:6480464	CTD
G	FAM105A	family with sequence similarity 105, member A		multiple interactions	ISO	5	14,581,891	14,616,289	RGD:6480464	CTD
G	FAM110A	family with sequence similarity 110, member A		multiple interactions	ISO	20	814,356	826,922	RGD:6480464	CTD
G	FAM127C	family with sequence similarity 127, member C		multiple interactions	ISO	X	134,154,534	134,156,566	RGD:6480464	CTD
G	FASLG	Fas ligand (TNF superfamily, member 6)		increases expression	ISO	1	172,628,185	172,636,013	RGD:6480464	CTD
G	FASN	fatty acid synthase		decreases expression	ISO	17	80,036,214	80,056,106	RGD:6480464	CTD
G	FBXO3	F-box protein 3		increases expression	ISO	11	33,762,490	33,796,071	RGD:6480464	CTD
G	FCGR2A	Fc fragment of IgG, low affinity IIa, receptor (CD32)		increases expression	ISO	1	161,475,205	161,489,360	RGD:6480464	CTD
G	FCN1	ficolin (collagen/fibrinogen domain containing) 1		multiple interactions	ISO	9	137,801,431	137,809,806	RGD:6480464	CTD
G	FDPS	farnesyl diphosphate synthase		multiple interactions	ISO	1	155,278,539	155,290,457	RGD:6480464	CTD
G	FDX1	ferredoxin 1		multiple interactions	ISO	11	110,300,661	110,335,608	RGD:6480464	CTD
G	FGFR2	fibroblast growth factor receptor 2		multiple interactions	ISO	10	123,237,844	123,357,972	RGD:6480464	CTD
G	FGFR4	fibroblast growth factor receptor 4		multiple interactions	ISO	5	176,513,921	176,525,127	RGD:6480464	CTD
G	FH	fumarate hydratase		multiple interactions	ISO	1	241,660,857	241,683,085	RGD:6480464	CTD
G	FHL1	four and a half LIM domains 1		decreases expression	ISO	X	135,228,861	135,293,518	RGD:6480464	CTD
G	FKBP10	FK506 binding protein 10, 65 kDa		multiple interactions	ISO	17	39,968,962	39,979,469	RGD:6480464	CTD
G	FKBP11	FK506 binding protein 11, 19 kDa		multiple interactions	ISO	12	49,315,742	49,319,330	RGD:6480464	CTD
G	FKBP4	FK506 binding protein 4, 59kDa		multiple interactions	ISO	12	2,904,108	2,914,589	RGD:6480464	CTD
G	FLG	filaggrin		multiple interactions	ISO	1	152,274,651	152,297,679	RGD:6480464	CTD
G	FLNA	filamin A, alpha		increases expression	ISO	X	153,576,900	153,603,006	RGD:6480464	CTD
G	FMO1	flavin containing monooxygenase 1		multiple interactions	ISO	1	171,217,663	171,255,113	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		increases expression	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		decreases expression	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		multiple interactions	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOXA3	forkhead box A3		multiple interactions	ISO	19	46,367,518	46,377,055	RGD:6480464	CTD
G	FOXK1	forkhead box K1		multiple interactions	ISO	7	4,721,930	4,811,074	RGD:6480464	CTD
G	FOXL1	forkhead box L1		multiple interactions	ISO	16	86,612,115	86,615,304	RGD:6480464	CTD
G	FOXN1	forkhead box N1		multiple interactions	ISO	17	26,850,959	26,865,175	RGD:6480464	CTD
G	FOXO3	forkhead box O3		multiple interactions	ISO	6	108,881,026	109,005,971	RGD:6480464	CTD
G	FSTL1	follistatin-like 1		increases expression	ISO	3	120,113,061	120,169,918	RGD:6480464	CTD
G	FTSJD2	FtsJ methyltransferase domain containing 2		increases expression	ISO	6	37,400,907	37,449,284	RGD:6480464	CTD
G	FUT7	fucosyltransferase 7 (alpha (1,3) fucosyltransferase)		multiple interactions	ISO	9	139,924,626	139,927,292	RGD:6480464	CTD
G	FXYD2	FXYD domain containing ion transport regulator 2		multiple interactions	ISO	11	117,690,790	117,698,807	RGD:6480464	CTD
G	FZD4	frizzled family receptor 4		multiple interactions	ISO	11	86,656,717	86,666,440	RGD:6480464	CTD
G	G6PC	glucose-6-phosphatase, catalytic subunit		multiple interactions	ISO	17	41,052,814	41,066,450	RGD:6480464	CTD
G	G6PC	glucose-6-phosphatase, catalytic subunit		affects expression	ISO	17	41,052,814	41,066,450	RGD:6480464	CTD
G	GADD45G	growth arrest and DNA-damage-inducible, gamma		multiple interactions	ISO	9	92,219,927	92,221,470	RGD:6480464	CTD
G	GALK1	galactokinase 1		multiple interactions	ISO	17	73,754,018	73,761,280	RGD:6480464	CTD
G	GAR1	GAR1 ribonucleoprotein homolog (yeast)		multiple interactions	ISO	4	110,736,666	110,745,893	RGD:6480464	CTD
G	GAST	gastrin		increases expression	ISO	17	39,868,578	39,872,221	RGD:6480464	CTD
G	GATA6	GATA binding protein 6		increases expression	ISO	18	19,749,404	19,782,491	RGD:6480464	CTD
G	GATA6	GATA binding protein 6		multiple interactions	ISO	18	19,749,404	19,782,491	RGD:6480464	CTD
G	GATM	glycine amidinotransferase (L-arginine:glycine amidinotransferase)		multiple interactions	ISO	15	45,653,322	45,670,980	RGD:6480464	CTD
G	GCK	glucokinase (hexokinase 4)		multiple interactions	ISO	7	44,183,870	44,229,022	RGD:6480464	CTD
G	GCLC	glutamate-cysteine ligase, catalytic subunit		increases expression	ISO	6	53,362,139	53,409,927	RGD:6480464	CTD
G	GCLC	glutamate-cysteine ligase, catalytic subunit		increases expression	ISO	6	53,362,139	53,409,927	RGD:6480464	CTD
G	GCLC	glutamate-cysteine ligase, catalytic subunit		increases expression	ISO	6	53,362,139	53,409,927	RGD:6480464	CTD
G	GCLM	glutamate-cysteine ligase, modifier subunit		increases expression	ISO	1	94,352,590	94,375,012	RGD:6480464	CTD
G	GDF15	growth differentiation factor 15		multiple interactions	ISO	19	18,496,968	18,499,986	RGD:6480464	CTD
G	GDPD5	glycerophosphodiester phosphodiesterase domain containing 5		multiple interactions	ISO	11	75,145,685	75,236,599	RGD:6480464	CTD
G	GFAP	glial fibrillary acidic protein		multiple interactions	ISO	17	42,982,994	42,992,920	RGD:6480464	CTD
G	GFI1B	growth factor independent 1B transcription repressor		decreases expression	ISO	9	135,854,098	135,867,084	RGD:6480464	CTD
G	GLB1L	galactosidase, beta 1-like		decreases expression	ISO	2	220,101,493	220,110,131	RGD:6480464	CTD
G	GLUL	glutamate-ammonia ligase		multiple interactions	ISO	1	182,350,839	182,361,341	RGD:6480464	CTD
G	GM2A	GM2 ganglioside activator		multiple interactions	ISO	5	150,632,613	150,649,955	RGD:6480464	CTD
G	GNAT2	guanine nucleotide binding protein (G protein), alpha transducing activity polypeptide 2		multiple interactions	ISO	1	110,145,889	110,155,705	RGD:6480464	CTD
G	GNE	glucosamine (UDP-N-acetyl)-2-epimerase/N-acetylmannosamine kinase		multiple interactions	ISO	9	36,214,438	36,277,053	RGD:6480464	CTD
G	GNL3	guanine nucleotide binding protein-like 3 (nucleolar)		multiple interactions	ISO	3	52,719,936	52,728,513	RGD:6480464	CTD
G	GNMT	glycine N-methyltransferase		multiple interactions	ISO	6	42,928,500	42,931,618	RGD:6480464	CTD
G	GNPAT	glyceronephosphate O-acyltransferase		decreases expression	ISO	1	231,376,919	231,413,719	RGD:6480464	CTD
G	GNRHR	gonadotropin-releasing hormone receptor		decreases expression	ISO	4	68,603,093	68,621,804	RGD:6480464	CTD
G	GOSR2	golgi SNAP receptor complex member 2		multiple interactions	ISO	17	45,000,486	45,018,733	RGD:6480464	CTD
G	GPD1	glycerol-3-phosphate dehydrogenase 1 (soluble)		multiple interactions	ISO	12	50,497,602	50,505,103	RGD:6480464	CTD
G	GPD2	glycerol-3-phosphate dehydrogenase 2 (mitochondrial)		multiple interactions	ISO	2	157,291,965	157,442,915	RGD:6480464	CTD
G	GPLD1	glycosylphosphatidylinositol specific phospholipase D1		multiple interactions	ISO	6	24,426,060	24,489,850	RGD:6480464	CTD
G	GRHPR	glyoxylate reductase/hydroxypyruvate reductase		multiple interactions	ISO	9	37,422,707	37,436,986	RGD:6480464	CTD
G	GRIK5	glutamate receptor, ionotropic, kainate 5		increases expression	ISO	19	42,502,468	42,569,957	RGD:6480464	CTD
G	GSS	glutathione synthetase		multiple interactions	ISO	20	33,516,236	33,543,601	RGD:6480464	CTD
G	GSTK1	glutathione S-transferase kappa 1		multiple interactions	ISO	7	142,960,522	142,966,222	RGD:6480464	CTD
G	GSTM2	glutathione S-transferase mu 2 (muscle)		multiple interactions	ISO	1	110,210,644	110,226,619	RGD:6480464	CTD
G	GSTP1	glutathione S-transferase pi 1		multiple interactions	ISO	11	67,351,066	67,354,124	RGD:6480464	CTD
G	GSTT1	glutathione S-transferase theta 1		multiple interactions	ISO	22	24,376,139	24,384,284	RGD:6480464	CTD
G	GSTT2	glutathione S-transferase theta 2		multiple interactions	ISO	22	24,322,314	24,326,106	RGD:6480464	CTD
G	GTF2B	general transcription factor IIB		increases expression	ISO	1	89,318,321	89,357,301	RGD:6480464	CTD
G	GTF2E2	general transcription factor IIE, polypeptide 2, beta 34kDa		multiple interactions	ISO	8	30,436,031	30,515,738	RGD:6480464	CTD
G	GTF2F2	general transcription factor IIF, polypeptide 2, 30kDa		multiple interactions	ISO	13	45,694,631	45,858,240	RGD:6480464	CTD
G	GTF2I	general transcription factor IIi		multiple interactions	ISO	7	74,072,030	74,175,022	RGD:6480464	CTD
G	GTPBP2	GTP binding protein 2		multiple interactions	ISO	6	43,588,218	43,596,936	RGD:6480464	CTD
G	H1F0	H1 histone family, member 0		multiple interactions	ISO	22	38,201,114	38,203,443	RGD:6480464	CTD
G	H3F3B	H3 histone, family 3B (H3.3B)		multiple interactions	ISO	17	73,772,515	73,775,860	RGD:6480464	CTD
G	HADH	hydroxyacyl-CoA dehydrogenase		multiple interactions	ISO	4	108,910,870	108,956,331	RGD:6480464	CTD
G	HAUS6	HAUS augmin-like complex, subunit 6		multiple interactions	ISO	9	19,053,135	19,102,940	RGD:6480464	CTD
G	HAX1	HCLS1 associated protein X-1		increases expression	ISO	1	154,245,039	154,248,351	RGD:6480464	CTD
G	HCCS	holocytochrome c synthase		multiple interactions	ISO	X	11,129,406	11,141,206	RGD:6480464	CTD
G	HDC	histidine decarboxylase		multiple interactions	ISO	15	50,534,144	50,558,162	RGD:6480464	CTD
G	HEBP1	heme binding protein 1		multiple interactions	ISO	12	13,127,798	13,153,243	RGD:6480464	CTD
G	HERC1	HECT and RLD domain containing E3 ubiquitin protein ligase family member 1		multiple interactions	ISO	15	63,900,817	64,126,147	RGD:6480464	CTD
G	HERPUD1	homocysteine-inducible, endoplasmic reticulum stress-inducible, ubiquitin-like domain member 1		multiple interactions	ISO	16	56,965,748	56,977,793	RGD:6480464	CTD
G	HES5	hairy and enhancer of split 5 (Drosophila)		multiple interactions	ISO	1	2,460,184	2,461,684	RGD:6480464	CTD
G	HIC1	hypermethylated in cancer 1		multiple interactions	ISO	17	1,958,393	1,962,981	RGD:6480464	CTD
G	HIPK1	homeodomain interacting protein kinase 1		increases expression	ISO	1	114,471,996	114,520,491	RGD:6480464	CTD
G	HIST1H1C	histone cluster 1, H1c		multiple interactions	ISO	6	26,055,968	26,056,699	RGD:6480464	CTD
G	HLA-A	major histocompatibility complex, class I, A		multiple interactions	ISO	6	29,910,247	29,913,661	RGD:6480464	CTD
G	HLA-DMB	major histocompatibility complex, class II, DM beta		multiple interactions	ISO	6	32,902,406	32,908,847	RGD:6480464	CTD
G	HLA-DMB	major histocompatibility complex, class II, DM beta		decreases expression	ISO	6	32,902,406	32,908,847	RGD:6480464	CTD
G	HLTF	helicase-like transcription factor		increases expression	ISO	3	148,747,904	148,804,341	RGD:6480464	CTD
G	HMGCL	3-hydroxymethyl-3-methylglutaryl-CoA lyase		multiple interactions	ISO	1	24,128,367	24,151,949	RGD:6480464	CTD
G	HMGCS2	3-hydroxy-3-methylglutaryl-CoA synthase 2 (mitochondrial)		multiple interactions	ISO	1	120,290,619	120,311,555	RGD:6480464	CTD
G	HMOX1	heme oxygenase (decycling) 1		increases expression	ISO	22	35,777,060	35,790,207	RGD:6480464	CTD
G	HMOX1	heme oxygenase (decycling) 1		multiple interactions	ISO	22	35,777,060	35,790,207	RGD:6480464	CTD
G	HMOX1	heme oxygenase (decycling) 1		increases expression	ISO	22	35,777,060	35,790,207	RGD:6480464	CTD
G	HNRNPM	heterogeneous nuclear ribonucleoprotein M		increases expression	ISO	19	8,509,803	8,554,002	RGD:6480464	CTD
G	HOMER3	homer homolog 3 (Drosophila)		increases expression	ISO	19	19,040,010	19,052,041	RGD:6480464	CTD
G	HPCAL4	hippocalcin like 4		multiple interactions	ISO	1	40,144,645	40,157,089	RGD:6480464	CTD
G	HPGD	hydroxyprostaglandin dehydrogenase 15-(NAD)		multiple interactions	ISO	4	175,411,328	175,444,049	RGD:6480464	CTD
G	HPRT1	hypoxanthine phosphoribosyltransferase 1		multiple interactions	ISO	X	133,594,175	133,634,698	RGD:6480464	CTD
G	HPS4	Hermansky-Pudlak syndrome 4		multiple interactions	ISO	22	26,846,848	26,879,829	RGD:6480464	CTD
G	HPS4	Hermansky-Pudlak syndrome 4		decreases expression	ISO	22	26,846,848	26,879,829	RGD:6480464	CTD
G	HPVC1	human papillomavirus (type 18) E5 central sequence-like 1		increases expression	ISO	7	54,268,917	54,270,114	RGD:6480464	CTD
G	HRG	histidine-rich glycoprotein		multiple interactions	ISO	3	186,383,798	186,396,023	RGD:6480464	CTD
G	HSD11B1	hydroxysteroid (11-beta) dehydrogenase 1		multiple interactions	ISO	1	209,859,525	209,908,295	RGD:6480464	CTD
G	HSD11B2	hydroxysteroid (11-beta) dehydrogenase 2		decreases expression	ISO	16	67,465,036	67,471,456	RGD:6480464	CTD
G	HSD17B10	hydroxysteroid (17-beta) dehydrogenase 10		multiple interactions	ISO	X	53,458,206	53,461,323	RGD:6480464	CTD
G	HSD17B11	hydroxysteroid (17-beta) dehydrogenase 11		multiple interactions	ISO	4	88,257,691	88,312,455	RGD:6480464	CTD
G	HSD17B12	hydroxysteroid (17-beta) dehydrogenase 12		multiple interactions	ISO	11	43,702,143	43,878,169	RGD:6480464	CTD
G	HSD17B4	hydroxysteroid (17-beta) dehydrogenase 4		multiple interactions	ISO	5	118,788,138	118,878,030	RGD:6480464	CTD
G	HSD3B2	hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2		multiple interactions	ISO	1	119,957,554	119,965,662	RGD:6480464	CTD
G	HSD3B7	hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 7		multiple interactions	ISO	16	30,996,519	31,000,473	RGD:6480464	CTD
G	HSDL2	hydroxysteroid dehydrogenase like 2		multiple interactions	ISO	9	115,142,189	115,234,685	RGD:6480464	CTD
G	HSP90AB1	heat shock protein 90kDa alpha (cytosolic), class B member 1		increases expression	ISO	6	44,214,849	44,221,614	RGD:6480464	CTD
G	HSPA1A	heat shock 70kDa protein 1A		multiple interactions	ISO	6	31,783,291	31,785,719	RGD:6480464	CTD
G	HSPA1L	heat shock 70kDa protein 1-like		multiple interactions	ISO	6	31,777,396	31,782,835	RGD:6480464	CTD
G	HSPA8	heat shock 70kDa protein 8		affects expression	ISO	11	122,928,200	122,932,901	RGD:6480464	CTD
G	HSPB1	heat shock 27kDa protein 1		increases expression	ISO	7	75,931,875	75,933,614	RGD:6480464	CTD
G	HSPB1	heat shock 27kDa protein 1		increases expression	ISO	7	75,931,875	75,933,614	RGD:6480464	CTD
G	HSPB8	heat shock 22kDa protein 8		multiple interactions	ISO	12	119,616,595	119,632,551	RGD:6480464	CTD
G	HSPH1	heat shock 105kDa/110kDa protein 1		increases expression	ISO	13	31,710,762	31,736,117	RGD:6480464	CTD
G	HTR1F	5-hydroxytryptamine (serotonin) receptor 1F, G protein-coupled		decreases expression	ISO	3	88,031,726	88,042,919	RGD:6480464	CTD
G	HTR2B	5-hydroxytryptamine (serotonin) receptor 2B, G protein-coupled		multiple interactions	ISO	2	231,972,947	231,989,824	RGD:6480464	CTD
G	HTRA1	HtrA serine peptidase 1		decreases expression	ISO	10	124,221,041	124,274,424	RGD:6480464	CTD
G	HTRA3	HtrA serine peptidase 3		multiple interactions	ISO	4	8,271,489	8,308,838	RGD:6480464	CTD
G	HUS1	HUS1 checkpoint homolog (S. pombe)		multiple interactions	ISO	7	48,002,885	48,019,222	RGD:6480464	CTD
G	ICAM1	intercellular adhesion molecule 1		increases expression	ISO	19	10,381,517	10,397,291	RGD:6480464	CTD
G	ID1	inhibitor of DNA binding 1, dominant negative helix-loop-helix protein		multiple interactions	ISO	20	30,193,086	30,194,318	RGD:6480464	CTD
G	ID2	inhibitor of DNA binding 2, dominant negative helix-loop-helix protein		decreases expression	ISO	2	8,822,113	8,824,583	RGD:6480464	CTD
G	ID3	inhibitor of DNA binding 3, dominant negative helix-loop-helix protein		multiple interactions	ISO	1	23,884,421	23,886,285	RGD:6480464	CTD
G	IDE	insulin-degrading enzyme		multiple interactions	ISO	10	94,211,441	94,333,852	RGD:6480464	CTD
G	IDH1	isocitrate dehydrogenase 1 (NADP+), soluble		multiple interactions	ISO	2	209,100,953	209,119,806	RGD:6480464	CTD
G	IER2	immediate early response 2		multiple interactions	ISO	19	13,261,282	13,265,722	RGD:6480464	CTD
G	IFI27L1	interferon, alpha-inducible protein 27-like 1		multiple interactions	ISO	14	94,547,639	94,569,060	RGD:6480464	CTD
G	IFI27L1	interferon, alpha-inducible protein 27-like 1		increases expression	ISO	14	94,547,639	94,569,060	RGD:6480464	CTD
G	IFIT3	interferon-induced protein with tetratricopeptide repeats 3		multiple interactions	ISO	10	91,087,602	91,100,725	RGD:6480464	CTD
G	IFITM3	interferon induced transmembrane protein 3		multiple interactions	ISO	11	319,673	320,914	RGD:6480464	CTD
G	IFNG	interferon, gamma		multiple interactions	ISO	12	68,548,550	68,553,521	RGD:6480464	CTD
G	IFNG	interferon, gamma		increases expression	ISO	12	68,548,550	68,553,521	RGD:6480464	CTD
G	IFRD1	interferon-related developmental regulator 1		multiple interactions	ISO	7	112,063,199	112,117,258	RGD:6480464	CTD
G	IFT88	intraflagellar transport 88 homolog (Chlamydomonas)		increases expression	ISO	13	21,141,208	21,265,576	RGD:6480464	CTD
G	IGDCC3	immunoglobulin superfamily, DCC subclass, member 3		multiple interactions	ISO	15	65,619,465	65,670,378	RGD:6480464	CTD
G	IGF1	insulin-like growth factor 1 (somatomedin C)		increases expression	ISO	12	102,789,645	102,874,378	RGD:6480464	CTD
G	IGF1	insulin-like growth factor 1 (somatomedin C)		multiple interactions	ISO	12	102,789,645	102,874,378	RGD:6480464	CTD
G	IGFBP1	insulin-like growth factor binding protein 1		increases expression	ISO	7	45,927,959	45,933,267	RGD:6480464	CTD
G	IGFBP1	insulin-like growth factor binding protein 1		multiple interactions	ISO	7	45,927,959	45,933,267	RGD:6480464	CTD
G	IGFBPL1	insulin-like growth factor binding protein-like 1		multiple interactions	ISO	9	38,408,991	38,424,444	RGD:6480464	CTD
G	IKZF2	IKAROS family zinc finger 2 (Helios)		multiple interactions	ISO	2	213,864,408	214,016,333	RGD:6480464	CTD
G	IL10	interleukin 10		increases expression	ISO	1	206,940,948	206,945,839	RGD:6480464	CTD
G	IL10	interleukin 10		increases expression	ISO	1	206,940,948	206,945,839	RGD:6480464	CTD
G	IL10RA	interleukin 10 receptor, alpha		multiple interactions	ISO	11	117,857,106	117,872,198	RGD:6480464	CTD
G	IL11RA	interleukin 11 receptor, alpha		multiple interactions	ISO	9	34,652,182	34,661,899	RGD:6480464	CTD
G	IL12RB2	interleukin 12 receptor, beta 2		decreases expression	ISO	1	67,773,047	67,862,583	RGD:6480464	CTD
G	IL13	interleukin 13		increases expression	ISO	5	131,993,865	131,996,801	RGD:6480464	CTD
G	IL18	interleukin 18 (interferon-gamma-inducing factor)		increases expression	ISO	11	112,013,974	112,034,840	RGD:6480464	CTD
G	IL1A	interleukin 1, alpha		increases expression	ISO	2	113,531,492	113,542,971	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		increases expression	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1RL1	interleukin 1 receptor-like 1		increases expression	ISO	2	102,927,962	102,968,497	RGD:6480464	CTD
G	IL4I1	interleukin 4 induced 1		increases expression	ISO	19	50,392,911	50,432,796	RGD:6480464	CTD
G	IL6	interleukin 6 (interferon, beta 2)		increases expression	ISO	7	22,766,766	22,771,621	RGD:6480464	CTD
G	IL6	interleukin 6 (interferon, beta 2)		increases expression	ISO	7	22,766,766	22,771,621	RGD:6480464	CTD
G	ILF2	interleukin enhancer binding factor 2		multiple interactions	ISO	1	153,634,264	153,643,504	RGD:6480464	CTD
G	ILVBL	ilvB (bacterial acetolactate synthase)-like		multiple interactions	ISO	19	15,225,785	15,236,577	RGD:6480464	CTD
G	IMP3	IMP3, U3 small nucleolar ribonucleoprotein, homolog (yeast)		multiple interactions	ISO	15	75,931,426	75,932,664	RGD:6480464	CTD
G	INA	internexin neuronal intermediate filament protein, alpha		multiple interactions	ISO	10	105,036,920	105,050,108	RGD:6480464	CTD
G	INCA1	inhibitor of CDK, cyclin A1 interacting protein 1		multiple interactions	ISO	17	4,891,425	4,900,905	RGD:6480464	CTD
G	INMT	indolethylamine N-methyltransferase		affects expression	ISO	7	30,791,751	30,797,218	RGD:6480464	CTD
G	INMT	indolethylamine N-methyltransferase		decreases expression	ISO	7	30,791,751	30,797,218	RGD:6480464	CTD
G	INMT	indolethylamine N-methyltransferase		multiple interactions	ISO	7	30,791,751	30,797,218	RGD:6480464	CTD
G	INO80E	INO80 complex subunit E		multiple interactions	ISO	16	30,007,531	30,017,112	RGD:6480464	CTD
G	INSIG1	insulin induced gene 1		increases expression	ISO	7	155,089,486	155,101,945	RGD:6480464	CTD
G	INSRR	insulin receptor-related receptor		multiple interactions	ISO	1	156,810,665	156,828,712	RGD:6480464	CTD
G	IPO8	importin 8		multiple interactions	ISO	12	30,781,915	30,848,929	RGD:6480464	CTD
G	IRF5	interferon regulatory factor 5		multiple interactions	ISO	7	128,577,994	128,590,089	RGD:6480464	CTD
G	IRF6	interferon regulatory factor 6		multiple interactions	ISO	1	209,958,968	209,979,520	RGD:6480464	CTD
G	IRF9	interferon regulatory factor 9		multiple interactions	ISO	14	24,630,422	24,635,774	RGD:6480464	CTD
G	ISG15	ISG15 ubiquitin-like modifier		multiple interactions	ISO	1	948,847	949,920	RGD:6480464	CTD
G	ISOC1	isochorismatase domain containing 1		multiple interactions	ISO	5	128,430,442	128,449,721	RGD:6480464	CTD
G	ITGA4	integrin, alpha 4 (antigen CD49D, alpha 4 subunit of VLA-4 receptor)		increases expression	ISO	2	182,321,619	182,402,474	RGD:6480464	CTD
G	ITIH1	inter-alpha-trypsin inhibitor heavy chain 1		multiple interactions	ISO	3	52,811,602	52,826,084	RGD:6480464	CTD
G	ITIH2	inter-alpha-trypsin inhibitor heavy chain 2		multiple interactions	ISO	10	7,745,236	7,791,483	RGD:6480464	CTD
G	ITIH4	inter-alpha-trypsin inhibitor heavy chain family, member 4		multiple interactions	ISO	3	52,847,006	52,864,717	RGD:6480464	CTD
G	JKAMP	JNK1/MAPK8-associated membrane protein		multiple interactions	ISO	14	59,951,161	59,972,081	RGD:6480464	CTD
G	JMJD8	jumonji domain containing 8		multiple interactions	ISO	16	731,667	734,439	RGD:6480464	CTD
G	JPH3	junctophilin 3		multiple interactions	ISO	16	87,636,499	87,731,762	RGD:6480464	CTD
G	JUN	jun proto-oncogene		increases expression	ISO	1	59,246,463	59,249,785	RGD:6480464	CTD
G	JUN	jun proto-oncogene		multiple interactions	ISO	1	59,246,463	59,249,785	RGD:6480464	CTD
G	JUNB	jun B proto-oncogene		decreases expression	ISO	19	12,902,310	12,904,125	RGD:6480464	CTD
G	JUNB	jun B proto-oncogene		multiple interactions	ISO	19	12,902,310	12,904,125	RGD:6480464	CTD
G	KCNA3	potassium voltage-gated channel, shaker-related subfamily, member 3		multiple interactions	ISO	1	111,214,310	111,217,655	RGD:6480464	CTD
G	KCNA4	potassium voltage-gated channel, shaker-related subfamily, member 4		decreases expression	ISO	11	30,031,288	30,038,577	RGD:6480464	CTD
G	KCNJ15	potassium inwardly-rectifying channel, subfamily J, member 15		decreases expression	ISO	21	39,628,664	39,673,748	RGD:6480464	CTD
G	KCNJ2	potassium inwardly-rectifying channel, subfamily J, member 2		multiple interactions	ISO	17	68,165,676	68,176,185	RGD:6480464	CTD
G	KDM3B	lysine (K)-specific demethylase 3B		multiple interactions	ISO	5	137,688,285	137,772,716	RGD:6480464	CTD
G	KDR	kinase insert domain receptor (a type III receptor tyrosine kinase)		multiple interactions	ISO	4	55,944,426	55,991,762	RGD:6480464	CTD
G	KIF20A	kinesin family member 20A		multiple interactions	ISO	5	137,514,417	137,523,404	RGD:6480464	CTD
G	KIF23	kinesin family member 23		multiple interactions	ISO	15	69,706,627	69,740,764	RGD:6480464	CTD
G	KIF2A	kinesin heavy chain member 2A		multiple interactions	ISO	5	61,601,989	61,683,011	RGD:6480464	CTD
G	KIFC2	kinesin family member C2		decreases expression	ISO	8	145,691,738	145,699,499	RGD:6480464	CTD
G	KITLG	KIT ligand		decreases response to substance	ISO	12	88,886,570	88,974,250	RGD:6480464	CTD
G	KLF13	Kruppel-like factor 13		multiple interactions	ISO	15	31,619,083	31,670,102	RGD:6480464	CTD
G	KLF3	Kruppel-like factor 3 (basic)		multiple interactions	ISO	4	38,665,790	38,703,129	RGD:6480464	CTD
G	KLF5	Kruppel-like factor 5 (intestinal)		decreases expression	ISO	13	73,633,142	73,651,676	RGD:6480464	CTD
G	KLF6	Kruppel-like factor 6		multiple interactions	ISO	10	3,818,188	3,827,473	RGD:6480464	CTD
G	KLK4	kallikrein-related peptidase 4		multiple interactions	ISO	19	51,409,608	51,413,994	RGD:6480464	CTD
G	KRT2	keratin 2		multiple interactions	ISO	12	53,038,342	53,045,959	RGD:6480464	CTD
G	KRT33B	keratin 33B		multiple interactions	ISO	17	39,519,746	39,526,052	RGD:6480464	CTD
G	KRT36	keratin 36		multiple interactions	ISO	17	39,642,388	39,646,116	RGD:6480464	CTD
G	KRT4	keratin 4		multiple interactions	ISO	12	53,200,327	53,207,900	RGD:6480464	CTD
G	KRT8	keratin 8		multiple interactions	ISO	12	53,290,971	53,343,650	RGD:6480464	CTD
G	KRTCAP2	keratinocyte associated protein 2		multiple interactions	ISO	1	155,141,884	155,145,804	RGD:6480464	CTD
G	LAMB3	laminin, beta 3		multiple interactions	ISO	1	209,788,215	209,825,820	RGD:6480464	CTD
G	LANCL1	LanC lantibiotic synthetase component C-like 1 (bacterial)		multiple interactions	ISO	2	211,295,973	211,341,499	RGD:6480464	CTD
G	LARP7	La ribonucleoprotein domain family, member 7		multiple interactions	ISO	4	113,558,120	113,578,748	RGD:6480464	CTD
G	LBP	lipopolysaccharide binding protein		increases expression	ISO	20	36,974,814	37,005,653	RGD:6480464	CTD
G	LBR	lamin B receptor		multiple interactions	ISO	1	225,589,204	225,616,557	RGD:6480464	CTD
G	LCAT	lecithin-cholesterol acyltransferase		multiple interactions	ISO	16	67,973,787	67,978,015	RGD:6480464	CTD
G	LEMD2	LEM domain containing 2		multiple interactions	ISO	6	33,738,990	33,756,906	RGD:6480464	CTD
G	LEP	leptin		multiple interactions	ISO	7	127,881,331	127,897,682	RGD:6480464	CTD
G	LHB	luteinizing hormone beta polypeptide		multiple interactions	ISO	19	49,519,237	49,520,347	RGD:6480464	CTD
G	LIFR	leukemia inhibitory factor receptor alpha		multiple interactions	ISO	5	38,475,065	38,595,507	RGD:6480464	CTD
G	LIG3	ligase III, DNA, ATP-dependent		multiple interactions	ISO	17	33,307,517	33,332,088	RGD:6480464	CTD
G	LIMK2	LIM domain kinase 2		decreases expression	ISO	22	31,608,250	31,676,066	RGD:6480464	CTD
G	LMNA	lamin A/C		multiple interactions	ISO	1	156,052,369	156,109,880	RGD:6480464	CTD
G	LONP2	lon peptidase 2, peroxisomal		multiple interactions	ISO	16	48,278,211	48,387,407	RGD:6480464	CTD
G	LPIN2	lipin 2		multiple interactions	ISO	18	2,916,992	3,011,945	RGD:6480464	CTD
G	LPL	lipoprotein lipase		multiple interactions	ISO	8	19,796,582	19,824,770	RGD:6480464	CTD
G	LRMP	lymphoid-restricted membrane protein		increases expression	ISO	12	25,205,181	25,261,269	RGD:6480464	CTD
G	LRP1	low density lipoprotein receptor-related protein 1		multiple interactions	ISO	12	57,522,282	57,607,142	RGD:6480464	CTD
G	LRP5	low density lipoprotein receptor-related protein 5		multiple interactions	ISO	11	68,080,108	68,216,743	RGD:6480464	CTD
G	LYPLA1	lysophospholipase I		increases expression	ISO	8	54,958,938	55,014,577	RGD:6480464	CTD
G	LYPLA1	lysophospholipase I		multiple interactions	ISO	8	54,958,938	55,014,577	RGD:6480464	CTD
G	LYRM2	LYR motif containing 2		increases expression	ISO	6	90,341,943	90,348,474	RGD:6480464	CTD
G	MADCAM1	mucosal vascular addressin cell adhesion molecule 1		decreases expression	ISO	19	496,490	505,343	RGD:6480464	CTD
G	MAFF	v-maf musculoaponeurotic fibrosarcoma oncogene homolog F (avian)		multiple interactions	ISO	22	38,597,939	38,612,518	RGD:6480464	CTD
G	MAFK	v-maf musculoaponeurotic fibrosarcoma oncogene homolog K (avian)		multiple interactions	ISO	7	1,570,368	1,582,679	RGD:6480464	CTD
G	MAL	mal, T-cell differentiation protein		multiple interactions	ISO	2	95,691,400	95,719,737	RGD:6480464	CTD
G	MAP1LC3A	microtubule-associated protein 1 light chain 3 alpha		multiple interactions	ISO	20	33,134,688	33,148,149	RGD:6480464	CTD
G	MARCO	macrophage receptor with collagenous structure		increases expression	ISO	2	119,699,745	119,752,236	RGD:6480464	CTD
G	MATK	megakaryocyte-associated tyrosine kinase		decreases expression	ISO	19	3,777,967	3,801,810	RGD:6480464	CTD
G	MB	myoglobin		multiple interactions	ISO	22	36,002,811	36,019,401	RGD:6480464	CTD
G	MB	myoglobin		increases expression	ISO	22	36,002,811	36,019,401	RGD:6480464	CTD
G	MBL2	mannose-binding lectin (protein C) 2, soluble		multiple interactions	ISO	10	54,525,140	54,531,460	RGD:6480464	CTD
G	MC1R	melanocortin 1 receptor (alpha melanocyte stimulating hormone receptor)		multiple interactions	ISO	16	89,984,287	89,987,385	RGD:6480464	CTD
G	MCM7	minichromosome maintenance complex component 7		multiple interactions	ISO	7	99,690,404	99,699,427	RGD:6480464	CTD
G	MCRS1	microspherule protein 1		multiple interactions	ISO	12	49,952,085	49,961,911	RGD:6480464	CTD
G	MDM2	MDM2 oncogene, E3 ubiquitin protein ligase		multiple interactions	ISO	12	69,201,971	69,239,320	RGD:6480464	CTD
G	ME1	malic enzyme 1, NADP(+)-dependent, cytosolic		multiple interactions	ISO	6	83,920,108	84,140,938	RGD:6480464	CTD
G	MED12L	mediator complex subunit 12-like		decreases expression	ISO	3	150,804,676	151,154,465	RGD:6480464	CTD
G	MERTK	c-mer proto-oncogene tyrosine kinase		multiple interactions	ISO	2	112,656,191	112,786,945	RGD:6480464	CTD
G	MET	met proto-oncogene (hepatocyte growth factor receptor)		decreases expression	ISO	7	116,312,459	116,438,440	RGD:6480464	CTD
G	METTL3	methyltransferase like 3		multiple interactions	ISO	14	21,966,282	21,979,457	RGD:6480464	CTD
G	METTL9	methyltransferase like 9		multiple interactions	ISO	16	21,610,856	21,668,792	RGD:6480464	CTD
G	MFAP4	microfibrillar-associated protein 4		multiple interactions	ISO	17	19,286,755	19,290,532	RGD:6480464	CTD
G	MFSD1	major facilitator superfamily domain containing 1		increases expression	ISO	3	158,519,715	158,547,508	RGD:6480464	CTD
G	MGLL	monoglyceride lipase		multiple interactions	ISO	3	127,407,905	127,542,093	RGD:6480464	CTD
G	MGST1	microsomal glutathione S-transferase 1		multiple interactions	ISO	12	16,500,076	16,530,123	RGD:6480464	CTD
G	MGST3	microsomal glutathione S-transferase 3		multiple interactions	ISO	1	165,600,110	165,625,373	RGD:6480464	CTD
G	MID1IP1	MID1 interacting protein 1		multiple interactions	ISO	X	38,660,685	38,665,785	RGD:6480464	CTD
G	MIIP	migration and invasion inhibitory protein		decreases expression	ISO	1	12,079,299	12,092,106	RGD:6480464	CTD
G	MIP	major intrinsic protein of lens fiber		multiple interactions	ISO	12	56,843,286	56,848,435	RGD:6480464	CTD
G	MKNK2	MAP kinase interacting serine/threonine kinase 2		affects expression	ISO	19	2,037,470	2,051,243	RGD:6480464	CTD
G	MMP7	matrix metallopeptidase 7 (matrilysin, uterine)		multiple interactions	ISO	11	102,391,239	102,401,478	RGD:6480464	CTD
G	MMP9	matrix metallopeptidase 9 (gelatinase B, 92kDa gelatinase, 92kDa type IV collagenase)		increases expression	ISO	20	44,637,547	44,645,200	RGD:6480464	CTD
G	MNDA	myeloid cell nuclear differentiation antigen		multiple interactions	ISO	1	158,801,168	158,819,270	RGD:6480464	CTD
G	MOB1A	MOB kinase activator 1A		multiple interactions	ISO	2	74,383,211	74,405,995	RGD:6480464	CTD
G	MOGAT2	monoacylglycerol O-acyltransferase 2		multiple interactions	ISO	11	75,428,934	75,442,331	RGD:6480464	CTD
G	MPC2	mitochondrial pyruvate carrier 2		multiple interactions	ISO	1	167,885,913	167,906,307	RGD:6480464	CTD
G	MPO	myeloperoxidase		increases activity	ISO	17	56,347,217	56,358,296	RGD:6480464	CTD
G	MPP1	membrane protein, palmitoylated 1, 55kDa		multiple interactions	ISO	X	154,006,959	154,033,802	RGD:6480464	CTD
G	MRPL45	mitochondrial ribosomal protein L45		multiple interactions	ISO	17	36,452,989	36,479,101	RGD:6480464	CTD
G	MRPL46	mitochondrial ribosomal protein L46		multiple interactions	ISO	15	89,002,709	89,010,633	RGD:6480464	CTD
G	MRPL53	mitochondrial ribosomal protein L53		multiple interactions	ISO	2	74,699,085	74,699,942	RGD:6480464	CTD
G	MSH6	mutS homolog 6 (E. coli)		decreases expression	ISO	2	48,010,221	48,034,092	RGD:6480464	CTD
G	MT1A	metallothionein 1A		multiple interactions	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	MT1A	metallothionein 1A		increases expression	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	MT2A	metallothionein 2A		multiple interactions	ISO	16	56,642,478	56,643,409	RGD:6480464	CTD
G	MTOR	mechanistic target of rapamycin (serine/threonine kinase)		multiple interactions	ISO	1	11,166,588	11,322,608	RGD:6480464	CTD
G	MUC13	mucin 13, cell surface associated		multiple interactions	ISO	3	124,624,289	124,653,595	RGD:6480464	CTD
G	MUC17	mucin 17, cell surface associated		multiple interactions	ISO	7	100,663,364	100,702,140	RGD:6480464	CTD
G	MVD	mevalonate (diphospho) decarboxylase		multiple interactions	ISO	16	88,718,348	88,729,495	RGD:6480464	CTD
G	MVP	major vault protein		multiple interactions	ISO	16	29,831,715	29,859,360	RGD:6480464	CTD
G	MXD3	MAX dimerization protein 3		multiple interactions	ISO	5	176,732,501	176,739,292	RGD:6480464	CTD
G	MYBL1	v-myb myeloblastosis viral oncogene homolog (avian)-like 1		multiple interactions	ISO	8	67,474,410	67,525,480	RGD:6480464	CTD
G	MYC	v-myc myelocytomatosis viral oncogene homolog (avian)		decreases expression	ISO	8	128,748,315	128,753,680	RGD:6480464	CTD
G	MYC	v-myc myelocytomatosis viral oncogene homolog (avian)		multiple interactions	ISO	8	128,748,315	128,753,680	RGD:6480464	CTD
G	MYC	v-myc myelocytomatosis viral oncogene homolog (avian)		increases expression	ISO	8	128,748,315	128,753,680	RGD:6480464	CTD
G	MYC	v-myc myelocytomatosis viral oncogene homolog (avian)		increases expression	ISO	8	128,748,315	128,753,680	RGD:6480464	CTD
G	MYCN	v-myc myelocytomatosis viral related oncogene, neuroblastoma derived (avian)		decreases expression	ISO	2	16,080,683	16,087,129	RGD:6480464	CTD
G	MYF6	myogenic factor 6 (herculin)		increases expression	ISO	12	81,101,408	81,103,257	RGD:6480464	CTD
G	MYH2	myosin, heavy chain 2, skeletal muscle, adult		increases expression	ISO	17	10,424,465	10,453,017	RGD:6480464	CTD
G	MYH6	myosin, heavy chain 6, cardiac muscle, alpha		increases expression	ISO	14	23,851,199	23,877,486	RGD:6480464	CTD
G	MYL9	myosin, light chain 9, regulatory		multiple interactions	ISO	20	35,169,887	35,178,226	RGD:6480464	CTD
G	MYO1B	myosin IB		increases expression	ISO	2	192,110,107	192,290,115	RGD:6480464	CTD
G	MYO1E	myosin IE		increases expression	ISO	15	59,428,168	59,665,071	RGD:6480464	CTD
G	MYOM2	myomesin 2		multiple interactions	ISO	8	1,993,158	2,093,380	RGD:6480464	CTD
G	NAA60	N(alpha)-acetyltransferase 60, NatF catalytic subunit		multiple interactions	ISO	16	3,493,668	3,536,963	RGD:6480464	CTD
G	NAB1	NGFI-A binding protein 1 (EGR1 binding protein 1)		multiple interactions	ISO	2	191,513,848	191,557,492	RGD:6480464	CTD
G	NACA	nascent polypeptide-associated complex alpha subunit		increases expression	ISO	12	57,106,211	57,119,326	RGD:6480464	CTD
G	NAGA	N-acetylgalactosaminidase, alpha-		multiple interactions	ISO	22	42,454,338	42,466,846	RGD:6480464	CTD
G	NAPB	N-ethylmaleimide-sensitive factor attachment protein, beta		multiple interactions	ISO	20	23,355,156	23,402,156	RGD:6480464	CTD
G	NBR1	neighbor of BRCA1 gene 1		multiple interactions	ISO	17	41,322,498	41,363,707	RGD:6480464	CTD
G	NCAM2	neural cell adhesion molecule 2		increases expression	ISO	21	22,370,633	22,912,517	RGD:6480464	CTD
G	NCF2	neutrophil cytosolic factor 2		multiple interactions	ISO	1	183,524,697	183,560,056	RGD:6480464	CTD
G	NCKAP1	NCK-associated protein 1		multiple interactions	ISO	2	183,789,605	183,903,229	RGD:6480464	CTD
G	NCOA1	nuclear receptor coactivator 1		multiple interactions	ISO	2	24,807,346	24,993,571	RGD:6480464	CTD
G	NDP	Norrie disease (pseudoglioma)		multiple interactions	ISO	X	43,808,022	43,832,921	RGD:6480464	CTD
G	NDRG1	N-myc downstream regulated 1		multiple interactions	ISO	8	134,249,414	134,309,547	RGD:6480464	CTD
G	NDUFA3	NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 3, 9kDa		multiple interactions	ISO	19	54,606,160	54,610,281	RGD:6480464	CTD
G	NDUFA5	NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 5, 13kDa		multiple interactions	ISO	7	123,181,083	123,197,958	RGD:6480464	CTD
G	NDUFA6	NADH dehydrogenase (ubiquinone) 1 alpha subcomplex, 6, 14kDa		multiple interactions	ISO	22	42,481,530	42,486,888	RGD:6480464	CTD
G	NDUFAB1	NADH dehydrogenase (ubiquinone) 1, alpha/beta subcomplex, 1, 8kDa		multiple interactions	ISO	16	23,592,335	23,607,639	RGD:6480464	CTD
G	NDUFB3	NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 3, 12kDa		multiple interactions	ISO	2	201,936,462	201,950,473	RGD:6480464	CTD
G	NDUFS6	NADH dehydrogenase (ubiquinone) Fe-S protein 6, 13kDa (NADH-coenzyme Q reductase)		multiple interactions	ISO	5	1,801,496	1,816,165	RGD:6480464	CTD
G	NET1	neuroepithelial cell transforming 1		multiple interactions	ISO	10	5,454,514	5,501,019	RGD:6480464	CTD
G	NFATC1	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 1		increases expression	ISO	18	77,155,772	77,289,323	RGD:6480464	CTD
G	NFATC2	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 2		multiple interactions	ISO	20	50,003,494	50,179,370	RGD:6480464	CTD
G	NFE2L2	nuclear factor (erythroid-derived 2)-like 2		decreases response to substance	ISO	2	178,095,031	178,129,859	RGD:6480464	CTD
G	NFIC	nuclear factor I/C (CCAAT-binding transcription factor)		decreases expression	ISO	19	3,359,561	3,469,215	RGD:6480464	CTD
G	NMB	neuromedin B		multiple interactions	ISO	15	85,198,360	85,201,802	RGD:6480464	CTD
G	NNMT	nicotinamide N-methyltransferase		multiple interactions	ISO	11	114,166,535	114,183,238	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		increases expression	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		increases expression	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		increases response to substance	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOX4	NADPH oxidase 4		decreases expression	ISO	11	89,057,521	89,322,779	RGD:6480464	CTD
G	NPAS1	neuronal PAS domain protein 1		multiple interactions	ISO	19	47,524,143	47,549,017	RGD:6480464	CTD
G	NPY	neuropeptide Y		multiple interactions	ISO	7	24,323,807	24,331,484	RGD:6480464	CTD
G	NPY	neuropeptide Y		decreases expression	ISO	7	24,323,807	24,331,484	RGD:6480464	CTD
G	NPY5R	neuropeptide Y receptor Y5		multiple interactions	ISO	4	164,265,091	164,273,086	RGD:6480464	CTD
G	NQO1	NAD(P)H dehydrogenase, quinone 1		increases expression	ISO	16	69,743,304	69,760,533	RGD:6480464	CTD
G	NQO1	NAD(P)H dehydrogenase, quinone 1		increases expression	ISO	16	69,743,304	69,760,533	RGD:6480464	CTD
G	NR0B2	nuclear receptor subfamily 0, group B, member 2		multiple interactions	ISO	1	27,237,975	27,240,567	RGD:6480464	CTD
G	NR1D1	nuclear receptor subfamily 1, group D, member 1		multiple interactions	ISO	17	38,249,037	38,256,973	RGD:6480464	CTD
G	NR1D2	nuclear receptor subfamily 1, group D, member 2		multiple interactions	ISO	3	23,986,751	24,022,109	RGD:6480464	CTD
G	NR1H4	nuclear receptor subfamily 1, group H, member 4		multiple interactions	ISO	12	100,867,551	100,957,645	RGD:6480464	CTD
G	NR5A2	nuclear receptor subfamily 5, group A, member 2		decreases expression	ISO	1	199,996,770	200,146,552	RGD:6480464	CTD
G	NRBP2	nuclear receptor binding protein 2		multiple interactions	ISO	8	144,915,755	144,923,146	RGD:6480464	CTD
G	NRP1	neuropilin 1		multiple interactions	ISO	10	33,466,419	33,623,833	RGD:6480464	CTD
G	NRTN	neurturin		multiple interactions	ISO	19	5,823,818	5,828,335	RGD:6480464	CTD
G	NT5DC2	5'-nucleotidase domain containing 2		multiple interactions	ISO	3	52,558,385	52,569,093	RGD:6480464	CTD
G	NTAN1	N-terminal asparagine amidase		decreases expression	ISO	16	15,131,710	15,149,936	RGD:6480464	CTD
G	NUDT1	nudix (nucleoside diphosphate linked moiety X)-type motif 1		multiple interactions	ISO	7	2,281,857	2,290,780	RGD:6480464	CTD
G	NUDT9	nudix (nucleoside diphosphate linked moiety X)-type motif 9		multiple interactions	ISO	4	88,343,728	88,380,606	RGD:6480464	CTD
G	NUP88	nucleoporin 88kDa		multiple interactions	ISO	17	5,289,346	5,323,059	RGD:6480464	CTD
G	NXN	nucleoredoxin		multiple interactions	ISO	17	702,553	882,998	RGD:6480464	CTD
G	OAT	ornithine aminotransferase		multiple interactions	ISO	10	126,085,872	126,107,545	RGD:6480464	CTD
G	OAZ3	ornithine decarboxylase antizyme 3		multiple interactions	ISO	1	151,735,445	151,743,806	RGD:6480464	CTD
G	ODC1	ornithine decarboxylase 1		increases expression	ISO	2	10,580,508	10,588,453	RGD:6480464	CTD
G	OGFR	opioid growth factor receptor		multiple interactions	ISO	20	61,436,177	61,445,352	RGD:6480464	CTD
G	OLR1	oxidized low density lipoprotein (lectin-like) receptor 1		multiple interactions	ISO	12	10,310,899	10,324,790	RGD:6480464	CTD
G	ORM1	orosomucoid 1		multiple interactions	ISO	9	117,085,303	117,088,759	RGD:6480464	CTD
G	ORM1	orosomucoid 1		increases expression	ISO	9	117,085,303	117,088,759	RGD:6480464	CTD
G	ORM2	orosomucoid 2		multiple interactions	ISO	9	117,092,069	117,095,536	RGD:6480464	CTD
G	OS9	osteosarcoma amplified 9, endoplasmic reticulum lectin		multiple interactions	ISO	12	58,087,738	58,115,340	RGD:6480464	CTD
G	OTUD7B	OTU domain containing 7B		multiple interactions	ISO	1	149,912,231	149,982,686	RGD:6480464	CTD
G	OXT	oxytocin/neurophysin I prepropeptide		multiple interactions	ISO	20	3,052,266	3,053,162	RGD:6480464	CTD
G	PAFAH2	platelet-activating factor acetylhydrolase 2, 40kDa		multiple interactions	ISO	1	26,286,258	26,324,648	RGD:6480464	CTD
G	PAK2	p21 protein (Cdc42/Rac)-activated kinase 2		decreases expression	ISO	3	196,466,728	196,559,518	RGD:6480464	CTD
G	PAM	peptidylglycine alpha-amidating monooxygenase		multiple interactions	ISO	5	102,201,527	102,366,809	RGD:6480464	CTD
G	PAM16	presequence translocase-associated motor 16 homolog (S. cerevisiae)		increases expression	ISO	16	4,390,252	4,401,373	RGD:6480464	CTD
G	PCDH7	protocadherin 7		decreases expression	ISO	4	30,722,030	31,148,423	RGD:6480464	CTD
G	PCK1	phosphoenolpyruvate carboxykinase 1 (soluble)		multiple interactions	ISO	20	56,136,137	56,141,513	RGD:6480464	CTD
G	PCSK4	proprotein convertase subtilisin/kexin type 4		multiple interactions	ISO	19	1,481,427	1,490,407	RGD:6480464	CTD
G	PCSK5	proprotein convertase subtilisin/kexin type 5		multiple interactions	ISO	9	78,505,560	78,977,255	RGD:6480464	CTD
G	PDCD1	programmed cell death 1		multiple interactions	ISO	2	242,792,033	242,801,058	RGD:6480464	CTD
G	PDE6G	phosphodiesterase 6G, cGMP-specific, rod, gamma		increases expression	ISO	17	79,617,489	79,623,607	RGD:6480464	CTD
G	PDIA5	protein disulfide isomerase family A, member 5		multiple interactions	ISO	3	122,785,856	122,880,953	RGD:6480464	CTD
G	PDIA6	protein disulfide isomerase family A, member 6		multiple interactions	ISO	2	10,923,517	10,952,960	RGD:6480464	CTD
G	PDK3	pyruvate dehydrogenase kinase, isozyme 3		multiple interactions	ISO	X	24,483,344	24,568,583	RGD:6480464	CTD
G	PDXK	pyridoxal (pyridoxine, vitamin B6) kinase		multiple interactions	ISO	21	45,138,978	45,182,188	RGD:6480464	CTD
G	PEBP1	phosphatidylethanolamine binding protein 1		multiple interactions	ISO	12	118,573,870	118,583,390	RGD:6480464	CTD
G	PEMT	phosphatidylethanolamine N-methyltransferase		multiple interactions	ISO	17	17,408,877	17,495,017	RGD:6480464	CTD
G	PEX11A	peroxisomal biogenesis factor 11 alpha		multiple interactions	ISO	15	90,226,284	90,233,958	RGD:6480464	CTD
G	PEX11B	peroxisomal biogenesis factor 11 beta		multiple interactions	ISO	1	145,516,165	145,523,732	RGD:6480464	CTD
G	PEX19	peroxisomal biogenesis factor 19		multiple interactions	ISO	1	160,246,599	160,254,941	RGD:6480464	CTD
G	PGM2	phosphoglucomutase 2		multiple interactions	ISO	4	37,828,282	37,864,559	RGD:6480464	CTD
G	PHB	prohibitin		multiple interactions	ISO	17	47,481,420	47,492,242	RGD:6480464	CTD
G	PHF12	PHD finger protein 12		decreases expression	ISO	17	27,232,271	27,278,508	RGD:6480464	CTD
G	PHF23	PHD finger protein 23		multiple interactions	ISO	17	7,138,347	7,142,825	RGD:6480464	CTD
G	PHLDA1	pleckstrin homology-like domain, family A, member 1		decreases expression	ISO	12	76,419,227	76,425,556	RGD:6480464	CTD
G	PIPOX	pipecolic acid oxidase		multiple interactions	ISO	17	27,369,918	27,384,236	RGD:6480464	CTD
G	PKLR	pyruvate kinase, liver and RBC		decreases expression	ISO	1	155,259,084	155,271,225	RGD:6480464	CTD
G	PLA2G5	phospholipase A2, group V		multiple interactions	ISO	1	20,396,701	20,418,394	RGD:6480464	CTD
G	PLAC8	placenta-specific 8		multiple interactions	ISO	4	84,011,201	84,035,911	RGD:6480464	CTD
G	PLEKHA1	pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1		multiple interactions	ISO	10	124,134,094	124,191,871	RGD:6480464	CTD
G	PLG	plasminogen		multiple interactions	ISO	6	161,123,225	161,175,086	RGD:6480464	CTD
G	PLIN4	perilipin 4		multiple interactions	ISO	19	4,502,192	4,517,716	RGD:6480464	CTD
G	PLK2	polo-like kinase 2		multiple interactions	ISO	5	57,749,809	57,755,966	RGD:6480464	CTD
G	PLK3	polo-like kinase 3		multiple interactions	ISO	1	45,266,036	45,271,667	RGD:6480464	CTD
G	PLOD3	procollagen-lysine, 2-oxoglutarate 5-dioxygenase 3		multiple interactions	ISO	7	100,849,258	100,861,011	RGD:6480464	CTD
G	PLS3	plastin 3		multiple interactions	ISO	X	114,795,177	114,885,181	RGD:6480464	CTD
G	PLTP	phospholipid transfer protein		multiple interactions	ISO	20	44,527,259	44,541,003	RGD:6480464	CTD
G	PNLIPRP1	pancreatic lipase-related protein 1		multiple interactions	ISO	10	118,350,490	118,368,686	RGD:6480464	CTD
G	PNP	purine nucleoside phosphorylase		multiple interactions	ISO	14	20,937,538	20,946,165	RGD:6480464	CTD
G	PNPLA2	patatin-like phospholipase domain containing 2		multiple interactions	ISO	11	818,901	825,573	RGD:6480464	CTD
G	PNRC2	proline-rich nuclear receptor coactivator 2		multiple interactions	ISO	1	24,286,301	24,289,952	RGD:6480464	CTD
G	POLE2	polymerase (DNA directed), epsilon 2, accessory subunit		decreases expression	ISO	14	50,110,270	50,155,098	RGD:6480464	CTD
G	POLG2	polymerase (DNA directed), gamma 2, accessory subunit		decreases expression	ISO	17	62,473,902	62,493,184	RGD:6480464	CTD
G	POLR2G	polymerase (RNA) II (DNA directed) polypeptide G		multiple interactions	ISO	11	62,529,011	62,534,187	RGD:6480464	CTD
G	POLR3K	polymerase (RNA) III (DNA directed) polypeptide K, 12.3 kDa		multiple interactions	ISO	16	96,979	103,632	RGD:6480464	CTD
G	POLRMT	polymerase (RNA) mitochondrial (DNA directed)		decreases expression	ISO	19	617,223	633,568	RGD:6480464	CTD
G	POU2F1	POU class 2 homeobox 1		increases expression	ISO	1	167,190,066	167,396,582	RGD:6480464	CTD
G	POU2F1	POU class 2 homeobox 1		multiple interactions	ISO	1	167,190,066	167,396,582	RGD:6480464	CTD
G	POU5F1	POU class 5 homeobox 1		decreases expression	ISO	6	31,132,114	31,138,451	RGD:6480464	CTD
G	PPARA	peroxisome proliferator-activated receptor alpha		multiple interactions	ISO	22	46,546,499	46,639,653	RGD:6480464	CTD
G	PPAT	phosphoribosyl pyrophosphate amidotransferase		increases expression	ISO	4	57,259,528	57,301,802	RGD:6480464	CTD
G	PPM1M	protein phosphatase, Mg2+/Mn2+ dependent, 1M		decreases expression	ISO	3	52,279,809	52,284,615	RGD:6480464	CTD
G	PPP1R15A	protein phosphatase 1, regulatory subunit 15A		multiple interactions	ISO	19	49,375,649	49,379,319	RGD:6480464	CTD
G	PPP1R2	protein phosphatase 1, regulatory (inhibitor) subunit 2		multiple interactions	ISO	3	195,241,221	195,270,224	RGD:6480464	CTD
G	PPP2R2A	protein phosphatase 2, regulatory subunit B, alpha		multiple interactions	ISO	8	26,149,007	26,230,196	RGD:6480464	CTD
G	PPY	pancreatic polypeptide		multiple interactions	ISO	17	42,018,172	42,019,833	RGD:6480464	CTD
G	PRCC	papillary renal cell carcinoma (translocation-associated)		multiple interactions	ISO	1	156,737,274	156,770,609	RGD:6480464	CTD
G	PRDX2	peroxiredoxin 2		decreases expression	ISO	19	12,907,634	12,912,694	RGD:6480464	CTD
G	PRG2	proteoglycan 2, bone marrow (natural killer cell activator, eosinophil granule major basic protein)		multiple interactions	ISO	11	57,154,834	57,158,130	RGD:6480464	CTD
G	PRIM2	primase, DNA, polypeptide 2 (58kDa)		multiple interactions	ISO	6	57,182,415	57,512,702	RGD:6480464	CTD
G	PRKAB1	protein kinase, AMP-activated, beta 1 non-catalytic subunit		multiple interactions	ISO	12	120,105,761	120,119,429	RGD:6480464	CTD
G	PRKCSH	protein kinase C substrate 80K-H		multiple interactions	ISO	19	11,546,269	11,561,783	RGD:6480464	CTD
G	PRKDC	protein kinase, DNA-activated, catalytic polypeptide		multiple interactions	ISO	8	48,685,669	48,872,743	RGD:6480464	CTD
G	PRODH2	proline dehydrogenase (oxidase) 2		multiple interactions	ISO	19	36,290,892	36,304,201	RGD:6480464	CTD
G	PRPH2	peripherin 2 (retinal degeneration, slow)		decreases expression	ISO	6	42,664,333	42,690,358	RGD:6480464	CTD
G	PRRC1	proline-rich coiled-coil 1		multiple interactions	ISO	5	126,853,309	126,890,781	RGD:6480464	CTD
G	PSAP	prosaposin		multiple interactions	ISO	10	73,576,055	73,611,082	RGD:6480464	CTD
G	PSEN2	presenilin 2 (Alzheimer disease 4)		multiple interactions	ISO	1	227,058,273	227,083,804	RGD:6480464	CTD
G	PSMA3	proteasome (prosome, macropain) subunit, alpha type, 3		multiple interactions	ISO	14	58,711,523	58,738,727	RGD:6480464	CTD
G	PSMA4	proteasome (prosome, macropain) subunit, alpha type, 4		multiple interactions	ISO	15	78,832,747	78,841,562	RGD:6480464	CTD
G	PSMB4	proteasome (prosome, macropain) subunit, beta type, 4		multiple interactions	ISO	1	151,372,041	151,374,412	RGD:6480464	CTD
G	PSMB5	proteasome (prosome, macropain) subunit, beta type, 5		multiple interactions	ISO	14	23,495,060	23,504,429	RGD:6480464	CTD
G	PSMB7	proteasome (prosome, macropain) subunit, beta type, 7		multiple interactions	ISO	9	127,115,744	127,177,752	RGD:6480464	CTD
G	PSMC3	proteasome (prosome, macropain) 26S subunit, ATPase, 3		multiple interactions	ISO	11	47,440,320	47,448,024	RGD:6480464	CTD
G	PSMD11	proteasome (prosome, macropain) 26S subunit, non-ATPase, 11		increases expression	ISO	17	30,771,481	30,810,337	RGD:6480464	CTD
G	PSMD4	proteasome (prosome, macropain) 26S subunit, non-ATPase, 4		multiple interactions	ISO	1	151,227,197	151,239,955	RGD:6480464	CTD
G	PSPC1	paraspeckle component 1		increases expression	ISO	13	20,248,892	20,357,159	RGD:6480464	CTD
G	PTAFR	platelet-activating factor receptor		decreases expression	ISO	1	28,473,677	28,520,447	RGD:6480464	CTD
G	PTGDR	prostaglandin D2 receptor (DP)		decreases expression	ISO	14	52,734,431	52,743,442	RGD:6480464	CTD
G	PTGS1	prostaglandin-endoperoxide synthase 1 (prostaglandin G/H synthase and cyclooxygenase)		decreases activity	EXP	9	125,132,809	125,157,982	RGD:6480464	CTD
G	PTGS2	prostaglandin-endoperoxide synthase 2 (prostaglandin G/H synthase and cyclooxygenase)		increases expression	ISO	1	186,640,944	186,649,559	RGD:6480464	CTD
G	PTOV1	prostate tumor overexpressed 1		multiple interactions	ISO	19	50,354,416	50,363,999	RGD:6480464	CTD
G	PTPLAD1	protein tyrosine phosphatase-like A domain containing 1		multiple interactions	ISO	15	65,822,827	65,870,693	RGD:6480464	CTD
G	PTPRC	protein tyrosine phosphatase, receptor type, C		multiple interactions	ISO	1	198,608,098	198,726,605	RGD:6480464	CTD
G	PTPRD	protein tyrosine phosphatase, receptor type, D		multiple interactions	ISO	9	8,314,246	10,612,723	RGD:6480464	CTD
G	PTPRJ	protein tyrosine phosphatase, receptor type, J		multiple interactions	ISO	11	48,002,110	48,192,394	RGD:6480464	CTD
G	PVRL2	poliovirus receptor-related 2 (herpesvirus entry mediator B)		multiple interactions	ISO	19	45,349,393	45,392,485	RGD:6480464	CTD
G	RAB11A	RAB11A, member RAS oncogene family		multiple interactions	ISO	15	66,161,797	66,184,329	RGD:6480464	CTD
G	RAB23	RAB23, member RAS oncogene family		multiple interactions	ISO	6	57,053,581	57,087,078	RGD:6480464	CTD
G	RAB24	RAB24, member RAS oncogene family		multiple interactions	ISO	5	176,728,199	176,730,744	RGD:6480464	CTD
G	RAB31	RAB31, member RAS oncogene family		multiple interactions	ISO	18	9,708,228	9,862,553	RGD:6480464	CTD
G	RAB3D	RAB3D, member RAS oncogene family		multiple interactions	ISO	19	11,432,722	11,450,344	RGD:6480464	CTD
G	RAB4A	RAB4A, member RAS oncogene family		multiple interactions	ISO	1	229,406,879	229,440,518	RGD:6480464	CTD
G	RAB9A	RAB9A, member RAS oncogene family		increases expression	ISO	X	13,707,240	13,727,944	RGD:6480464	CTD
G	RABAC1	Rab acceptor 1 (prenylated)		multiple interactions	ISO	19	42,460,833	42,463,528	RGD:6480464	CTD
G	RAD51B	RAD51 homolog B (S. cerevisiae)		multiple interactions	ISO	14	68,286,496	69,062,738	RGD:6480464	CTD
G	RAET1E	retinoic acid early transcript 1E		decreases expression	ISO	6	150,204,511	150,217,195	RGD:6480464	CTD
G	RAET1E	retinoic acid early transcript 1E		multiple interactions	ISO	6	150,204,511	150,217,195	RGD:6480464	CTD
G	RASA4	RAS p21 protein activator 4		multiple interactions	ISO	7	102,220,093	102,257,205	RGD:6480464	CTD
G	RASD1	RAS, dexamethasone-induced 1		decreases expression	ISO	17	17,397,751	17,399,709	RGD:6480464	CTD
G	RASGRF2	Ras protein-specific guanine nucleotide-releasing factor 2		multiple interactions	ISO	5	80,256,508	80,525,981	RGD:6480464	CTD
G	RBM8A	RNA binding motif protein 8A		multiple interactions	ISO	1	145,507,557	145,513,536	RGD:6480464	CTD
G	RBP1	retinol binding protein 1, cellular		multiple interactions	ISO	3	139,236,276	139,258,671	RGD:6480464	CTD
G	RCL1	RNA terminal phosphate cyclase-like 1		multiple interactions	ISO	9	4,792,834	4,861,064	RGD:6480464	CTD
G	RCVRN	recoverin		decreases expression	ISO	17	9,801,027	9,808,684	RGD:6480464	CTD
G	RDH16	retinol dehydrogenase 16 (all-trans)		multiple interactions	ISO	12	57,345,215	57,351,418	RGD:6480464	CTD
G	RDH5	retinol dehydrogenase 5 (11-cis/9-cis)		multiple interactions	ISO	12	56,114,151	56,118,526	RGD:6480464	CTD
G	RECQL	RecQ protein-like (DNA helicase Q1-like)		decreases expression	ISO	12	21,621,844	21,654,603	RGD:6480464	CTD
G	RECQL5	RecQ protein-like 5		decreases expression	ISO	17	73,622,925	73,663,269	RGD:6480464	CTD
G	RECQL5	RecQ protein-like 5		multiple interactions	ISO	17	73,622,925	73,663,269	RGD:6480464	CTD
G	REEP6	receptor accessory protein 6		multiple interactions	ISO	19	1,491,165	1,497,924	RGD:6480464	CTD
G	REG1B	regenerating islet-derived 1 beta		multiple interactions	ISO	2	79,312,149	79,315,150	RGD:6480464	CTD
G	RELB	v-rel reticuloendotheliosis viral oncogene homolog B		multiple interactions	ISO	19	45,504,707	45,541,456	RGD:6480464	CTD
G	REN	renin		multiple interactions	ISO	1	204,123,944	204,135,465	RGD:6480464	CTD
G	RESP18	regulated endocrine-specific protein 18		decreases expression	ISO	2	220,192,131	220,197,899	RGD:6480464	CTD
G	RETSAT	retinol saturase (all-trans-retinol 13,14-reductase)		multiple interactions	ISO	2	85,569,078	85,581,821	RGD:6480464	CTD
G	RGN	regucalcin (senescence marker protein-30)		multiple interactions	ISO	X	46,937,775	46,952,712	RGD:6480464	CTD
G	RGN	regucalcin (senescence marker protein-30)		increases expression	ISO	X	46,937,775	46,952,712	RGD:6480464	CTD
G	RGS16	regulator of G-protein signaling 16		multiple interactions	ISO	1	182,567,758	182,573,548	RGD:6480464	CTD
G	RHOA	ras homolog family member A		multiple interactions	ISO	3	49,396,578	49,449,526	RGD:6480464	CTD
G	RHOB	ras homolog family member B		multiple interactions	ISO	2	20,646,835	20,649,201	RGD:6480464	CTD
G	RHOD	ras homolog family member D		multiple interactions	ISO	11	66,824,289	66,839,488	RGD:6480464	CTD
G	RHOU	ras homolog family member U		multiple interactions	ISO	1	228,780,394	228,882,416	RGD:6480464	CTD
G	RIMKLB	ribosomal modification protein rimK-like family member B		increases expression	ISO	12	8,850,518	8,929,787	RGD:6480464	CTD
G	RMDN3	regulator of microtubule dynamics 3		multiple interactions	ISO	15	41,028,086	41,047,458	RGD:6480464	CTD
G	RNASE1	ribonuclease, RNase A family, 1 (pancreatic)		multiple interactions	ISO	14	21,269,515	21,271,036	RGD:6480464	CTD
G	RNASEH2B	ribonuclease H2, subunit B		multiple interactions	ISO	13	51,483,814	51,544,596	RGD:6480464	CTD
G	RNASET2	ribonuclease T2		multiple interactions	ISO	6	167,343,004	167,370,077	RGD:6480464	CTD
G	RNF11	ring finger protein 11		multiple interactions	ISO	1	51,701,945	51,739,119	RGD:6480464	CTD
G	RNF19A	ring finger protein 19A, E3 ubiquitin protein ligase		multiple interactions	ISO	8	101,269,288	101,322,379	RGD:6480464	CTD
G	RNPEP	arginyl aminopeptidase (aminopeptidase B)		multiple interactions	ISO	1	201,951,766	201,975,275	RGD:6480464	CTD
G	RNPEPL1	arginyl aminopeptidase (aminopeptidase B)-like 1		multiple interactions	ISO	2	241,508,004	241,518,149	RGD:6480464	CTD
G	ROGDI	rogdi homolog (Drosophila)		multiple interactions	ISO	16	4,846,963	4,852,951	RGD:6480464	CTD
G	RORA	RAR-related orphan receptor A		multiple interactions	ISO	15	60,780,483	61,521,502	RGD:6480464	CTD
G	RPF2	ribosome production factor 2 homolog (S. cerevisiae)		increases expression	ISO	6	111,303,291	111,346,794	RGD:6480464	CTD
G	RPL15	ribosomal protein L15		multiple interactions	ISO	3	23,958,295	23,965,187	RGD:6480464	CTD
G	RPL27A	ribosomal protein L27a		multiple interactions	ISO	11	8,703,995	8,711,419	RGD:6480464	CTD
G	RPL36	ribosomal protein L36		multiple interactions	ISO	19	5,690,272	5,691,678	RGD:6480464	CTD
G	RPL37A	ribosomal protein L37a		multiple interactions	ISO	2	217,363,520	217,366,190	RGD:6480464	CTD
G	RPL8	ribosomal protein L8		multiple interactions	ISO	8	146,015,154	146,017,805	RGD:6480464	CTD
G	RPS16	ribosomal protein S16		multiple interactions	ISO	19	39,923,847	39,926,618	RGD:6480464	CTD
G	RPS23	ribosomal protein S23		multiple interactions	ISO	5	81,569,139	81,574,235	RGD:6480464	CTD
G	RPS6KC1	ribosomal protein S6 kinase, 52kDa, polypeptide 1		multiple interactions	ISO	1	213,224,588	213,446,808	RGD:6480464	CTD
G	RRAS	related RAS viral (r-ras) oncogene homolog		multiple interactions	ISO	19	50,138,552	50,143,400	RGD:6480464	CTD
G	RRH	retinal pigment epithelium-derived rhodopsin homolog		decreases expression	ISO	4	110,749,150	110,765,863	RGD:6480464	CTD
G	RRM2B	ribonucleotide reductase M2 B (TP53 inducible)		multiple interactions	ISO	8	103,216,729	103,251,346	RGD:6480464	CTD
G	RSL1D1	ribosomal L1 domain containing 1		multiple interactions	ISO	16	11,928,053	11,945,442	RGD:6480464	CTD
G	RSRC2	arginine/serine-rich coiled-coil 2		decreases expression	ISO	12	122,989,190	123,011,560	RGD:6480464	CTD
G	RTKN	rhotekin		increases expression	ISO	2	74,652,988	74,669,060	RGD:6480464	CTD
G	RTN4	reticulon 4		multiple interactions	ISO	2	55,199,325	55,277,734	RGD:6480464	CTD
G	S100A10	S100 calcium binding protein A10		multiple interactions	ISO	1	151,955,386	151,966,714	RGD:6480464	CTD
G	S100A13	S100 calcium binding protein A13		multiple interactions	ISO	1	153,591,275	153,606,568	RGD:6480464	CTD
G	S100A3	S100 calcium binding protein A3		multiple interactions	ISO	1	153,519,809	153,521,734	RGD:6480464	CTD
G	S1PR4	sphingosine-1-phosphate receptor 4		increases expression	ISO	19	3,178,736	3,180,330	RGD:6480464	CTD
G	SAA4	serum amyloid A4, constitutive		multiple interactions	ISO	11	18,252,902	18,258,384	RGD:6480464	CTD
G	SACM1L	SAC1 suppressor of actin mutations 1-like (yeast)		increases expression	ISO	3	45,730,754	45,786,900	RGD:6480464	CTD
G	SAMM50	sorting and assembly machinery component 50 homolog (S. cerevisiae)		multiple interactions	ISO	22	44,351,261	44,392,412	RGD:6480464	CTD
G	SAT1	spermidine/spermine N1-acetyltransferase 1		multiple interactions	ISO	X	23,801,275	23,804,327	RGD:6480464	CTD
G	SCARB2	scavenger receptor class B, member 2		multiple interactions	ISO	4	77,079,890	77,135,052	RGD:6480464	CTD
G	SCG2	secretogranin II		multiple interactions	ISO	2	224,461,658	224,467,217	RGD:6480464	CTD
G	SDC4	syndecan 4		multiple interactions	ISO	20	43,953,928	43,977,064	RGD:6480464	CTD
G	SDSL	serine dehydratase-like		multiple interactions	ISO	12	113,860,216	113,876,081	RGD:6480464	CTD
G	SEC13	SEC13 homolog (S. cerevisiae)		multiple interactions	ISO	3	10,342,615	10,362,858	RGD:6480464	CTD
G	SEC14L2	SEC14-like 2 (S. cerevisiae)		multiple interactions	ISO	22	30,792,930	30,821,291	RGD:6480464	CTD
G	SEC61A1	Sec61 alpha 1 subunit (S. cerevisiae)		multiple interactions	ISO	3	127,771,212	127,790,526	RGD:6480464	CTD
G	SEC61B	Sec61 beta subunit		multiple interactions	ISO	9	101,984,570	101,992,901	RGD:6480464	CTD
G	SELPLG	selectin P ligand		multiple interactions	ISO	12	109,015,671	109,027,670	RGD:6480464	CTD
G	SEMA3F	sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3F		multiple interactions	ISO	3	50,192,848	50,226,508	RGD:6480464	CTD
G	SEPP1	selenoprotein P, plasma, 1		multiple interactions	ISO	5	42,799,982	42,812,024	RGD:6480464	CTD
G	SERPINA10	serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 10		multiple interactions	ISO	14	94,749,650	94,759,596	RGD:6480464	CTD
G	SERPINA3	serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 3		multiple interactions	ISO	14	95,078,714	95,090,390	RGD:6480464	CTD
G	SERPINA6	serpin peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 6		multiple interactions	ISO	14	94,770,585	94,789,688	RGD:6480464	CTD
G	SERPINB5	serpin peptidase inhibitor, clade B (ovalbumin), member 5		decreases expression	ISO	18	61,144,144	61,172,318	RGD:6480464	CTD
G	SERPIND1	serpin peptidase inhibitor, clade D (heparin cofactor), member 1		multiple interactions	ISO	22	21,128,383	21,142,008	RGD:6480464	CTD
G	SERPINE1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		increases expression	ISO	7	100,770,370	100,782,547	RGD:6480464	CTD
G	SERPINF1	serpin peptidase inhibitor, clade F (alpha-2 antiplasmin, pigment epithelium derived factor), member 1		multiple interactions	ISO	17	1,665,259	1,680,859	RGD:6480464	CTD
G	SERPING1	serpin peptidase inhibitor, clade G (C1 inhibitor), member 1		multiple interactions	ISO	11	57,365,027	57,382,326	RGD:6480464	CTD
G	SFT2D1	SFT2 domain containing 1		affects expression	ISO	6	166,733,516	166,755,991	RGD:6480464	CTD
G	SFTPB	surfactant protein B		multiple interactions	ISO	2	85,884,440	85,895,864	RGD:6480464	CTD
G	SFXN1	sideroflexin 1		multiple interactions	ISO	5	174,905,514	174,955,621	RGD:6480464	CTD
G	SGK1	serum/glucocorticoid regulated kinase 1		multiple interactions	ISO	6	134,490,384	134,639,196	RGD:6480464	CTD
G	SGOL1	shugoshin-like 1 (S. pombe)		multiple interactions	ISO	3	20,202,085	20,227,724	RGD:6480464	CTD
G	SH3BP5	SH3-domain binding protein 5 (BTK-associated)		multiple interactions	ISO	3	15,295,860	15,382,901	RGD:6480464	CTD
G	SH3GL3	SH3-domain GRB2-like 3		multiple interactions	ISO	15	84,116,091	84,287,495	RGD:6480464	CTD
G	SH3PXD2A	SH3 and PX domains 2A		multiple interactions	ISO	10	105,353,784	105,615,164	RGD:6480464	CTD
G	SHISA5	shisa homolog 5 (Xenopus laevis)		multiple interactions	ISO	3	48,509,197	48,541,661	RGD:6480464	CTD
G	SIGMAR1	sigma non-opioid intracellular receptor 1		multiple interactions	ISO	9	34,634,719	34,637,768	RGD:6480464	CTD
G	SIRT1	sirtuin 1		multiple interactions	ISO	10	69,644,427	69,678,147	RGD:6480464	CTD
G	SKP1	S-phase kinase-associated protein 1		multiple interactions	ISO	5	133,492,082	133,512,724	RGD:6480464	CTD
G	SLA	Src-like-adaptor		multiple interactions	ISO	8	134,048,973	134,115,310	RGD:6480464	CTD
G	SLC10A1	solute carrier family 10 (sodium/bile acid cotransporter family), member 1		multiple interactions	ISO	14	70,242,552	70,264,006	RGD:6480464	CTD
G	SLC11A1	solute carrier family 11 (proton-coupled divalent metal ion transporters), member 1		multiple interactions	ISO	2	219,246,752	219,261,617	RGD:6480464	CTD
G	SLC12A4	solute carrier family 12 (potassium/chloride transporters), member 4		increases expression	ISO	16	67,977,377	68,002,597	RGD:6480464	CTD
G	SLC17A1	solute carrier family 17 (sodium phosphate), member 1		multiple interactions	ISO	6	25,783,125	25,832,287	RGD:6480464	CTD
G	SLC1A4	solute carrier family 1 (glutamate/neutral amino acid transporter), member 4		increases expression	ISO	2	65,215,579	65,250,999	RGD:6480464	CTD
G	SLC22A24	solute carrier family 22, member 24		multiple interactions	ISO	11	62,847,412	62,911,693	RGD:6480464	CTD
G	SLC22A9	solute carrier family 22 (organic anion transporter), member 9		multiple interactions	ISO	11	63,137,261	63,177,731	RGD:6480464	CTD
G	SLC25A10	solute carrier family 25 (mitochondrial carrier; dicarboxylate transporter), member 10		multiple interactions	ISO	17	79,679,266	79,688,046	RGD:6480464	CTD
G	SLC25A20	solute carrier family 25 (carnitine/acylcarnitine translocase), member 20		multiple interactions	ISO	3	48,894,356	48,936,426	RGD:6480464	CTD
G	SLC25A25	solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 25		multiple interactions	ISO	9	130,830,479	130,871,537	RGD:6480464	CTD
G	SLC25A36	solute carrier family 25 (pyrimidine nucleotide carrier ), member 36		affects expression	ISO	3	140,660,662	140,698,785	RGD:6480464	CTD
G	SLC27A1	solute carrier family 27 (fatty acid transporter), member 1		multiple interactions	ISO	19	17,581,300	17,616,977	RGD:6480464	CTD
G	SLC27A2	solute carrier family 27 (fatty acid transporter), member 2		multiple interactions	ISO	15	50,474,393	50,528,589	RGD:6480464	CTD
G	SLC27A4	solute carrier family 27 (fatty acid transporter), member 4		multiple interactions	ISO	9	131,102,839	131,123,749	RGD:6480464	CTD
G	SLC2A2	solute carrier family 2 (facilitated glucose transporter), member 2		decreases expression	ISO	3	170,714,137	170,744,768	RGD:6480464	CTD
G	SLC35D1	solute carrier family 35 (UDP-glucuronic acid/UDP-N-acetylgalactosamine dual transporter), member D1		multiple interactions	ISO	1	67,465,015	67,520,080	RGD:6480464	CTD
G	SLC38A10	solute carrier family 38, member 10		decreases expression	ISO	17	79,218,799	79,269,096	RGD:6480464	CTD
G	SLC38A2	solute carrier family 38, member 2		multiple interactions	ISO	12	46,751,971	46,766,645	RGD:6480464	CTD
G	SLC44A1	solute carrier family 44, member 1		multiple interactions	ISO	9	108,006,929	108,153,682	RGD:6480464	CTD
G	SLC4A1	solute carrier family 4, anion exchanger, member 1 (erythrocyte membrane protein band 3, Diego blood group)		decreases expression	ISO	17	42,325,758	42,345,502	RGD:6480464	CTD
G	SLC4A1AP	solute carrier family 4 (anion exchanger), member 1, adaptor protein		multiple interactions	ISO	2	27,886,338	27,917,847	RGD:6480464	CTD
G	SLC4A3	solute carrier family 4, anion exchanger, member 3		multiple interactions	ISO	2	220,492,292	220,506,702	RGD:6480464	CTD
G	SLC6A15	solute carrier family 6 (neutral amino acid transporter), member 15		increases expression	ISO	12	85,253,267	85,306,608	RGD:6480464	CTD
G	SLC7A2	solute carrier family 7 (cationic amino acid transporter, y+ system), member 2		multiple interactions	ISO	8	17,354,597	17,428,077	RGD:6480464	CTD
G	SMAD1	SMAD family member 1		multiple interactions	ISO	4	146,402,951	146,480,328	RGD:6480464	CTD
G	SMAD6	SMAD family member 6		multiple interactions	ISO	15	66,994,674	67,074,338	RGD:6480464	CTD
G	SMAP1	small ArfGAP 1		increases expression	ISO	6	71,377,479	71,571,718	RGD:6480464	CTD
G	SMO	smoothened, frizzled family receptor		multiple interactions	ISO	7	128,828,713	128,853,386	RGD:6480464	CTD
G	SNCG	synuclein, gamma (breast cancer-specific protein 1)		decreases expression	ISO	10	88,718,288	88,723,017	RGD:6480464	CTD
G	SNHG11	small nucleolar RNA host gene 11 (non-protein coding)		increases expression	ISO	20	37,075,297	37,079,564	RGD:6480464	CTD
G	SNRK	SNF related kinase		decreases expression	ISO	3	43,328,004	43,392,635	RGD:6480464	CTD
G	SNX2	sorting nexin 2		multiple interactions	ISO	5	122,110,750	122,165,803	RGD:6480464	CTD
G	SOWAHA	sosondowah ankyrin repeat domain family member A		increases expression	ISO	5	132,149,033	132,152,489	RGD:6480464	CTD
G	SOX18	SRY (sex determining region Y)-box 18		increases expression	ISO	20	62,679,079	62,680,979	RGD:6480464	CTD
G	SP100	SP100 nuclear antigen		multiple interactions	ISO	2	231,280,871	231,410,317	RGD:6480464	CTD
G	SPATA6	spermatogenesis associated 6		multiple interactions	ISO	1	48,761,044	48,937,876	RGD:6480464	CTD
G	SPIB	Spi-B transcription factor (Spi-1/PU.1 related)		multiple interactions	ISO	19	50,922,195	50,934,310	RGD:6480464	CTD
G	SPIN1	spindlin 1		multiple interactions	ISO	9	91,003,297	91,093,623	RGD:6480464	CTD
G	SPRR2D	small proline-rich protein 2D		multiple interactions	ISO	1	153,012,201	153,013,594	RGD:6480464	CTD
G	SPSB1	splA/ryanodine receptor domain and SOCS box containing 1		multiple interactions	ISO	1	9,352,941	9,429,591	RGD:6480464	CTD
G	SQLE	squalene epoxidase		multiple interactions	ISO	8	126,010,720	126,034,525	RGD:6480464	CTD
G	SQRDL	sulfide quinone reductase-like (yeast)		multiple interactions	ISO	15	45,923,346	45,983,492	RGD:6480464	CTD
G	SQSTM1	sequestosome 1		increases expression	ISO	5	179,233,388	179,265,078	RGD:6480464	CTD
G	SQSTM1	sequestosome 1		multiple interactions	ISO	5	179,233,388	179,265,078	RGD:6480464	CTD
G	SREBF1	sterol regulatory element binding transcription factor 1		multiple interactions	ISO	17	17,714,663	17,740,325	RGD:6480464	CTD
G	SRR	serine racemase		multiple interactions	ISO	17	2,207,248	2,228,553	RGD:6480464	CTD
G	SRSF5	serine/arginine-rich splicing factor 5		decreases expression	ISO	14	70,233,829	70,238,722	RGD:6480464	CTD
G	SRSF7	serine/arginine-rich splicing factor 7		multiple interactions	ISO	2	38,970,741	38,978,636	RGD:6480464	CTD
G	SSBP4	single stranded DNA binding protein 4		multiple interactions	ISO	19	18,530,146	18,545,372	RGD:6480464	CTD
G	SSR3	signal sequence receptor, gamma (translocon-associated protein gamma)		multiple interactions	ISO	3	156,257,929	156,272,973	RGD:6480464	CTD
G	ST6GALNAC1	ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1		multiple interactions	ISO	17	74,620,845	74,639,894	RGD:6480464	CTD
G	STK16	serine/threonine kinase 16		multiple interactions	ISO	2	220,110,192	220,115,059	RGD:6480464	CTD
G	STRADA	STE20-related kinase adaptor alpha		multiple interactions	ISO	17	61,780,192	61,819,330	RGD:6480464	CTD
G	STRBP	spermatid perinuclear RNA binding protein		multiple interactions	ISO	9	125,883,899	126,030,855	RGD:6480464	CTD
G	SUCLG1	succinate-CoA ligase, alpha subunit		multiple interactions	ISO	2	84,650,647	84,686,586	RGD:6480464	CTD
G	SULT1A1	sulfotransferase family, cytosolic, 1A, phenol-preferring, member 1		multiple interactions	ISO	16	28,616,908	28,634,907	RGD:6480464	CTD
G	SULT1C3	sulfotransferase family, cytosolic, 1C, member 3		decreases expression	ISO	2	108,863,651	108,881,807	RGD:6480464	CTD
G	SULT1C3	sulfotransferase family, cytosolic, 1C, member 3		affects expression	ISO	2	108,863,651	108,881,807	RGD:6480464	CTD
G	SUPT5H	suppressor of Ty 5 homolog (S. cerevisiae)		multiple interactions	ISO	19	39,936,186	39,967,310	RGD:6480464	CTD
G	SUV39H2	suppressor of variegation 3-9 homolog 2 (Drosophila)		decreases expression	ISO	10	14,920,782	14,946,314	RGD:6480464	CTD
G	SUV420H2	suppressor of variegation 4-20 homolog 2 (Drosophila)		increases expression	ISO	19	55,851,221	55,859,489	RGD:6480464	CTD
G	SYN1	synapsin I		multiple interactions	ISO	X	47,431,300	47,479,256	RGD:6480464	CTD
G	SYN2	synapsin II		decreases expression	ISO	3	12,182,150	12,233,532	RGD:6480464	CTD
G	SYT6	synaptotagmin VI		multiple interactions	ISO	1	114,631,914	114,696,472	RGD:6480464	CTD
G	TALDO1	transaldolase 1		multiple interactions	ISO	11	747,432	765,024	RGD:6480464	CTD
G	TANK	TRAF family member-associated NFKB activator		decreases expression	ISO	2	161,993,466	162,092,683	RGD:6480464	CTD
G	TAOK3	TAO kinase 3		increases expression	ISO	12	118,587,606	118,810,750	RGD:6480464	CTD
G	TAT	tyrosine aminotransferase		multiple interactions	ISO	16	71,600,754	71,610,998	RGD:6480464	CTD
G	TAX1BP3	Tax1 (human T-cell leukemia virus type I) binding protein 3		increases expression	ISO	17	3,566,187	3,571,973	RGD:6480464	CTD
G	TBC1D1	TBC1 (tre-2/USP6, BUB2, cdc16) domain family, member 1		multiple interactions	ISO	4	37,892,705	38,140,796	RGD:6480464	CTD
G	TBC1D10A	TBC1 domain family, member 10A		decreases expression	ISO	22	30,687,979	30,722,955	RGD:6480464	CTD
G	TBCE	tubulin folding cofactor E		multiple interactions	ISO	1	235,530,728	235,612,280	RGD:6480464	CTD
G	TBCE	tubulin folding cofactor E		decreases expression	ISO	1	235,530,728	235,612,280	RGD:6480464	CTD
G	TCEA3	transcription elongation factor A (SII), 3		multiple interactions	ISO	1	23,707,555	23,751,261	RGD:6480464	CTD
G	TCF7L2	transcription factor 7-like 2 (T-cell specific, HMG-box)		multiple interactions	ISO	10	114,710,009	114,927,437	RGD:6480464	CTD
G	TCTA	T-cell leukemia translocation altered		multiple interactions	ISO	3	49,449,639	49,453,909	RGD:6480464	CTD
G	TCTE1	t-complex-associated-testis-expressed 1		multiple interactions	ISO	6	44,247,897	44,265,458	RGD:6480464	CTD
G	TDO2	tryptophan 2,3-dioxygenase		decreases expression	ISO	4	156,824,845	156,841,558	RGD:6480464	CTD
G	TFPI	tissue factor pathway inhibitor (lipoprotein-associated coagulation inhibitor)		decreases expression	ISO	2	188,328,957	188,419,219	RGD:6480464	CTD
G	TFPI2	tissue factor pathway inhibitor 2		multiple interactions	ISO	7	93,514,709	93,520,303	RGD:6480464	CTD
G	TG	thyroglobulin		multiple interactions	ISO	8	133,879,205	134,147,143	RGD:6480464	CTD
G	TGIF1	TGFB-induced factor homeobox 1		multiple interactions	ISO	18	3,412,072	3,458,409	RGD:6480464	CTD
G	THBS1	thrombospondin 1		decreases expression	ISO	15	39,873,280	39,889,668	RGD:6480464	CTD
G	THBS1	thrombospondin 1		multiple interactions	ISO	15	39,873,280	39,889,668	RGD:6480464	CTD
G	THRSP	thyroid hormone responsive		decreases expression	ISO	11	77,774,907	77,779,403	RGD:6480464	CTD
G	THRSP	thyroid hormone responsive		multiple interactions	ISO	11	77,774,907	77,779,403	RGD:6480464	CTD
G	TIAM1	T-cell lymphoma invasion and metastasis 1		multiple interactions	ISO	21	32,490,736	32,931,290	RGD:6480464	CTD
G	TIMM10B	translocase of inner mitochondrial membrane 10 homolog B (yeast)		multiple interactions	ISO	11	6,502,677	6,505,911	RGD:6480464	CTD
G	TIMM10B	translocase of inner mitochondrial membrane 10 homolog B (yeast)		decreases expression	ISO	11	6,502,677	6,505,911	RGD:6480464	CTD
G	TLK2	tousled-like kinase 2		multiple interactions	ISO	17	60,556,386	60,692,842	RGD:6480464	CTD
G	TLX2	T-cell leukemia homeobox 2		multiple interactions	ISO	2	74,741,596	74,744,275	RGD:6480464	CTD
G	TM2D2	TM2 domain containing 2		multiple interactions	ISO	8	38,846,327	38,854,041	RGD:6480464	CTD
G	TPRXL	tetra-peptide repeat homeobox-like		multiple interactions	ISO	3	13,978,807	14,107,484	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	513696
role	503218
biological role	501391
biochemical role	202214
metabolite	183224
secondary metabolite	178264
paracetamol	13685
acetaminophen O-beta-D-glucosiduronic acid	3
acetaminophen glutathione conjugate	0
paracetamol sulfate	0
Path 2
Term	Annotations
CHEBI ontology	513696
subatomic particle	512589
composite particle	512589
hadron	512589
baryon	512589
nucleon	512589
atomic nucleus	512589
atom	512589
main group element atom	480600
p-block element atom	478018
carbon group element atom	427607
carbon atom	424015
organic molecular entity	424008
organic group	174595
organic divalent group	173394
organodiyl group	173394
carbonyl group	173077
carbonyl compound	173077
carboxylic acid	126516
carboacyl group	43021