1,10-phenanthroline - Ontology Report

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	1,10-phenanthroline	go back to main search page
Accession:	CHEBI:44975	browse the term
Definition:	A phenanthroline that has formula C12H8N2.
Synonyms:	related_synonym:	4,5-diazaphenanthrene; C12H8N2; InChI=1S/C12H8N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H; InChIKey=DGEZNRSVGBDHLK-UHFFFAOYSA-N; c1cnc2c(c1)ccc1cccnc21; o-Phenanthroline; orthophenanthroline; phen
	alt_id:	CHEBI:44973; CHEBI:476
	xref_casrn:	66-71-7
	xref:	Beilstein:126461 "Beilstein Registry Number"; ChEMBL:154715 "ChEMBL COMPOUND"; ChemIDplus:66-71-7 "CAS Registry Number"; DrugBank:DB02365 "DrugBank"; Gmelin:4040 "Gmelin Registry Number"; KEGG COMPOUND:66-71-7 "CAS Registry Number"; KEGG COMPOUND:C00604 "KEGG COMPOUND"
	xref_mesh:	MESH:C025205
	xref:	NIST Chemistry WebBook:66-71-7 "CAS Registry Number"; PDBeChem:PHN "PDBeChem"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

1,10-phenanthroline
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		decreases expression	ISO	10	95,361,338	95,381,455	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		decreases activity	EXP	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	EXP	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	EXP	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ak1	adenylate kinase 1		decreases expression	ISO	2	19,821,482	19,822,544	RGD:6480464	CTD
G	Akap9	A kinase (PRKA) anchor protein (yotiao) 9		increases expression	ISO	4	26,772,929	26,803,149	RGD:6480464	CTD
G	Akr1c1	aldo-keto reductase family 1, member C1		decreases activity	ISO	17	77,084,306	77,112,994	RGD:6480464	CTD
G	Akr1c2	aldo-keto reductase family 1, member C2		decreases activity	ISO	17	77,034,737	77,081,406	RGD:6480464	CTD
G	Akr1c3	aldo-keto reductase family 1, member C3		decreases activity	ISO	17	77,269,626	77,286,521	RGD:6480464	CTD
G	Aldoa	aldolase A, fructose-bisphosphate		increases expression	ISO	1	185,970,658	185,974,615	RGD:6480464	CTD
G	Aldoc	aldolase C, fructose-bisphosphate		increases expression	ISO	10	64,308,826	64,312,415	RGD:6480464	CTD
G	Ankrd37	ankyrin repeat domain 37		increases expression	ISO	16	49,549,527	49,552,416	RGD:6480464	CTD
G	Anpep	alanyl (membrane) aminopeptidase		multiple interactions	ISO	1	135,600,751	135,619,208	RGD:6480464	CTD
G	Anpep	alanyl (membrane) aminopeptidase		decreases activity	ISO	1	135,600,751	135,619,208	RGD:6480464	CTD
G	Aqp3	aquaporin 3		decreases expression	ISO	5	58,501,642	58,507,159	RGD:6480464	CTD
G	Aspa	aspartoacylase		decreases activity	ISO	10	60,178,509	60,199,207	RGD:6480464	CTD
G	Atf6	activating transcription factor 6		multiple interactions	ISO	13	86,543,773	86,718,970	RGD:6480464	CTD
G	Bnip3l	BCL2/adenovirus E1B interacting protein 3-like		decreases expression	ISO	15	46,516,626	46,539,756	RGD:6480464	CTD
G	Car9	carbonic anhydrase 9		increases expression	ISO	5	59,986,413	59,993,015	RGD:6480464	CTD
G	Cat	catalase		decreases expression	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cd83	CD83 molecule		increases expression	ISO	17	26,705,646	26,725,470	RGD:6480464	CTD
G	Cd86	CD86 molecule		increases expression	ISO	11	66,215,233	66,238,882	RGD:6480464	CTD
G	Cd86	CD86 molecule		multiple interactions	ISO	11	66,215,233	66,238,882	RGD:6480464	CTD
G	Cftr	cystic fibrosis transmembrane conductance regulator		increases activity	ISO	4	43,874,852	44,041,870	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		increases stability	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Egln1	EGL nine homolog 1 (C. elegans)		increases expression	ISO	19	55,080,670	55,118,226	RGD:6480464	CTD
G	Egln2	EGL nine homolog 2 (C. elegans)		decreases expression	ISO	1	82,233,239	82,240,990	RGD:6480464	CTD
G	Egr1	early growth response 1		increases expression	ISO	18	27,343,919	27,346,117	RGD:6480464	CTD
G	Eno1	enolase 1, (alpha)		increases expression	ISO	5	167,394,131	167,405,516	RGD:6480464	CTD
G	Eno2	enolase 2, gamma, neuronal		increases expression	ISO	4	160,891,003	160,897,723	RGD:6480464	CTD
G	Ercc2	excision repair cross-complementing rodent repair deficiency, complementation group 2		decreases expression	ISO				RGD:6480464	CTD
G	Gapdh	glyceraldehyde-3-phosphate dehydrogenase		increases expression	ISO	4	161,282,215	161,286,090	RGD:6480464	CTD
G	Gpx3	glutathione peroxidase 3		decreases expression	ISO	10	40,311,094	40,319,382	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		increases activity	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif3a	hypoxia inducible factor 3, alpha subunit		decreases expression	ISO	1	77,377,465	77,408,704	RGD:6480464	CTD
G	Hilpda	hypoxia inducible lipid droplet-associated		increases expression	ISO	4	56,146,654	56,147,441	RGD:6480464	CTD
G	Hk1	hexokinase 1		increases expression	ISO				RGD:6480464	CTD
G	Hk2	hexokinase 2		increases expression	ISO	4	116,925,725	116,975,211	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		decreases degradation	EXP	9	72,003,637	72,016,263	RGD:6480464	CTD
G	Il1r1	interleukin 1 receptor, type I		decreases expression	ISO	9	39,434,910	39,473,552	RGD:6480464	CTD
G	Lamc2	laminin, gamma 2		multiple interactions	ISO	13	68,151,074	68,211,117	RGD:6480464	CTD
G	Ldha	lactate dehydrogenase A		increases expression	ISO	1	97,403,077	97,412,547	RGD:6480464	CTD
G	Mbtps2	membrane-bound transcription factor peptidase, site 2		multiple interactions	ISO	X	58,708,065	58,757,022	RGD:6480464	CTD
G	Mdm2	p53 E3 ubiquitin protein ligase		increases expression	ISO	7	56,996,694	57,020,926	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		increases expression	ISO	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mmp8	matrix metallopeptidase 8		decreases activity	ISO	8	4,402,124	4,410,976	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	EXP	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Nppb	natriuretic peptide B		increases expression	ISO	5	165,062,348	165,063,650	RGD:6480464	CTD
G	Nub1	negative regulator of ubiquitin-like proteins 1		increases expression	ISO	4	5,820,488	5,850,809	RGD:6480464	CTD
G	Ocln	occludin		multiple interactions	ISO	2	31,317,090	31,367,485	RGD:6480464	CTD
G	P4ha2	prolyl 4-hydroxylase, alpha polypeptide II		increases expression	ISO	10	39,522,157	39,551,063	RGD:6480464	CTD
G	Pdk1	pyruvate dehydrogenase kinase, isozyme 1		increases expression	ISO	3	54,292,076	54,319,242	RGD:6480464	CTD
G	Pdk3	pyruvate dehydrogenase kinase, isozyme 3		increases expression	ISO	X	81,104,667	81,171,536	RGD:6480464	CTD
G	Pgk1	phosphoglycerate kinase 1		increases expression	ISO	X	94,324,219	94,340,193	RGD:6480464	CTD
G	Plau	plasminogen activator, urokinase		multiple interactions	ISO	15	3,680,072	3,686,232	RGD:6480464	CTD
G	Plod3	procollagen-lysine, 2-oxoglutarate 5-dioxygenase 3		increases expression	ISO	12	20,856,527	20,867,088	RGD:6480464	CTD
G	Ppp2r1b	protein phosphatase 2, regulatory subunit A, beta		decreases expression	ISO	8	54,208,126	54,229,044	RGD:6480464	CTD
G	Psph	phosphoserine phosphatase		decreases expression	ISO	12	27,969,748	27,984,318	RGD:6480464	CTD
G	Sele	selectin E		multiple interactions	ISO	13	79,813,455	79,822,845	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		increases expression	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Srebf1	sterol regulatory element binding transcription factor 1		multiple interactions	ISO	10	46,461,684	46,483,646	RGD:6480464	CTD
G	Stat3	signal transducer and activator of transcription 3 (acute-phase response factor)		multiple interactions	ISO	10	89,821,078	89,872,970	RGD:6480464	CTD
G	Tfrc	transferrin receptor		increases expression	ISO	11	69,976,258	69,998,098	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		increases expression	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
bathocuproine disulfonic acid
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Actb	actin, beta		multiple interactions	ISO	12	12,047,070	12,050,040	RGD:6480464	CTD
G	Arhgdia	Rho GDP dissociation inhibitor (GDI) alpha		multiple interactions	ISO	10	109,967,771	109,971,260	RGD:6480464	CTD
G	Atf4	activating transcription factor 4 (tax-responsive enhancer element B67)		multiple interactions	ISO	7	118,537,718	118,538,994	RGD:6480464	CTD
G	Atox1	ATX1 antioxidant protein 1 homolog (yeast)		multiple interactions	ISO	10	40,858,190	40,873,226	RGD:6480464	CTD
G	Atp7a	ATPase, Cu++ transporting, alpha polypeptide		multiple interactions	ISO	X	94,192,540	94,249,776	RGD:6480464	CTD
G	Atp7a	ATPase, Cu++ transporting, alpha polypeptide		multiple interactions	ISO	X	94,192,540	94,249,776	RGD:6480464	CTD
G	Atp7b	ATPase, Cu++ transporting, beta polypeptide		multiple interactions	ISO	16	74,607,988	74,680,080	RGD:6480464	CTD
G	Bcl2a1	BCL2-related protein A1		multiple interactions	ISO	8	94,045,109	94,053,777	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Cct5	chaperonin containing Tcp1, subunit 5 (epsilon)		multiple interactions	ISO	2	83,681,785	83,692,937	RGD:6480464	CTD
G	Cd200	Cd200 molecule		multiple interactions	ISO	11	56,946,504	56,974,256	RGD:6480464	CTD
G	Cd44	Cd44 molecule		multiple interactions	ISO	3	88,022,962	88,110,352	RGD:6480464	CTD
G	Cdh17	cadherin 17		multiple interactions	ISO	5	26,047,222	26,099,173	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	ISO	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Cntnap1	contactin associated protein 1		multiple interactions	ISO	10	90,185,756	90,210,837	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	ISO	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Cp	ceruloplasmin (ferroxidase)		multiple interactions	ISO	2	105,086,278	105,135,367	RGD:6480464	CTD
G	Cpsf1	cleavage and polyadenylation specific factor 1, 160kDa		multiple interactions	ISO	7	114,647,975	114,658,568	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	ISO	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Crem	cAMP responsive element modulator		multiple interactions	ISO	17	62,770,633	62,837,670	RGD:6480464	CTD
G	Cul5	cullin 5		multiple interactions	ISO	8	57,080,787	57,132,486	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		multiple interactions	EXP	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Dnajb1	DnaJ (Hsp40) homolog, subfamily B, member 1		multiple interactions	ISO	19	26,213,739	26,217,480	RGD:6480464	CTD
G	Dusp4	dual specificity phosphatase 4		multiple interactions	ISO	16	61,109,626	61,119,981	RGD:6480464	CTD
G	Egr2	early growth response 2		multiple interactions	ISO	20	21,883,885	21,888,177	RGD:6480464	CTD
G	Egr3	early growth response 3		multiple interactions	ISO	15	50,477,453	50,479,909	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fyb	FYN binding protein		multiple interactions	ISO	2	55,858,764	55,950,014	RGD:6480464	CTD
G	Gfra2	GDNF family receptor alpha 2		multiple interactions	ISO	15	51,279,770	51,371,053	RGD:6480464	CTD
G	Gnas	GNAS complex locus		multiple interactions	ISO	3	165,213,399	165,214,551	RGD:6480464	CTD
G	Hadha	hydroxyacyl-CoA dehydrogenase/3-ketoacyl-CoA thiolase/enoyl-CoA hydratase (trifunctional protein), alpha subunit		multiple interactions	ISO	6	26,173,798	26,191,433	RGD:6480464	CTD
G	Hck	hemopoietic cell kinase		multiple interactions	ISO	3	143,447,697	143,490,281	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hnrnpul1	heterogeneous nuclear ribonucleoprotein U-like 1		multiple interactions	ISO	1	80,926,575	80,960,767	RGD:6480464	CTD
G	Hpx	hemopexin		multiple interactions	ISO	1	163,319,509	163,327,017	RGD:6480464	CTD
G	Hspa8	heat shock 70kDa protein 8		multiple interactions	ISO	8	43,784,035	43,787,760	RGD:6480464	CTD
G	Hyal3	hyaluronoglucosaminidase 3		multiple interactions	ISO	8	112,828,150	112,833,785	RGD:6480464	CTD
G	Il2	interleukin 2		multiple interactions	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il2rb	interleukin 2 receptor, beta		multiple interactions	ISO				RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Lcp1	lymphocyte cytosolic protein 1		multiple interactions	ISO	15	56,034,457	56,091,880	RGD:6480464	CTD
G	Ltbp4	latent transforming growth factor beta binding protein 4		multiple interactions	ISO	1	82,385,953	82,418,177	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mta1	metastasis associated 1		multiple interactions	ISO	6	138,118,468	138,143,983	RGD:6480464	CTD
G	Mtf1	metal-regulatory transcription factor 1		multiple interactions	ISO	5	144,135,674	144,180,430	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		multiple interactions	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Nell1	NEL-like 1 (chicken)		multiple interactions	ISO	1	99,805,922	100,758,002	RGD:6480464	CTD
G	Nfe2l2	nuclear factor, erythroid derived 2, like 2		multiple interactions	ISO	3	58,366,693	58,394,116	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nmi	N-myc (and STAT) interactor		multiple interactions	ISO	3	32,962,021	32,996,031	RGD:6480464	CTD
G	Nr4a3	nuclear receptor subfamily 4, group A, member 3		multiple interactions	ISO	5	64,713,468	64,753,311	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase 1		multiple interactions	ISO	6	41,309,211	41,315,796	RGD:6480464	CTD
G	Pax8	paired box 8		multiple interactions	EXP	3	2,671,478	2,726,801	RGD:6480464	CTD
G	Ppp1r10	protein phosphatase 1, regulatory subunit 10		multiple interactions	ISO	20	2,940,605	2,984,636	RGD:6480464	CTD
G	Prnp	prion protein		multiple interactions	EXP	3	119,676,137	119,691,507	RGD:6480464	CTD
G	Rel	v-rel reticuloendotheliosis viral oncogene homolog (avian)		multiple interactions	ISO	14	104,645,370	104,671,275	RGD:6480464	CTD
G	Sla	src-like adaptor		multiple interactions	ISO	7	104,153,028	104,202,272	RGD:6480464	CTD
G	Slc31a1	solute carrier family 31 (copper transporters), member 1		multiple interactions	ISO	5	79,359,420	79,385,988	RGD:6480464	CTD
G	Slc31a2	solute carrier family 31 (copper transporters), member 2		multiple interactions	ISO	5	79,281,958	79,292,436	RGD:6480464	CTD
G	Slc31a2	solute carrier family 31 (copper transporters), member 2		multiple interactions	ISO	5	79,281,958	79,292,436	RGD:6480464	CTD
G	Slc31a2	solute carrier family 31 (copper transporters), member 2		affects localization	ISO	5	79,281,958	79,292,436	RGD:6480464	CTD
G	Snrnp70	small nuclear ribonucleoprotein 70 (U1)		multiple interactions	ISO	1	95,853,923	95,868,393	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sp1	Sp1 transcription factor		multiple interactions	ISO	7	141,164,180	141,194,509	RGD:6480464	CTD
G	Srgn	serglycin		multiple interactions	ISO	20	29,746,729	29,761,072	RGD:6480464	CTD
G	Srpr	signal recognition particle receptor ('docking protein')		multiple interactions	ISO	8	34,992,187	34,998,270	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf1b	tumor necrosis factor receptor superfamily, member 1b		multiple interactions	ISO	5	163,666,541	163,697,484	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tpo	thyroid peroxidase		multiple interactions	EXP	6	47,954,848	48,025,740	RGD:6480464	CTD
G	Tyr	tyrosinase		multiple interactions	ISO	1	143,641,257	143,746,315	RGD:6480464	CTD
G	Tyrobp	Tyro protein tyrosine kinase binding protein		multiple interactions	ISO	1	85,365,371	85,369,224	RGD:6480464	CTD
G	Ube2l6	ubiquitin-conjugating enzyme E2L 6		multiple interactions	ISO	3	68,000,239	68,016,331	RGD:6480464	CTD
G	Ubl4a	ubiquitin-like 4A		multiple interactions	ISO	X	160,239,300	160,242,152	RGD:6480464	CTD
G	Vim	vimentin		multiple interactions	ISO	17	87,847,280	87,855,763	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
chemical entity	492574
molecular entity	475835
mancude ring	10665
organic mancude parent	10665
mancude organic heterocyclic parent	10665
mancude organic heterotricyclic parent	207
phenanthroline	176
1,10-phenanthroline	163
bathocuproine disulfonic acid	89
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
p-block element atom	458699
carbon group element atom	410677
carbon atom	407233
organic molecular entity	407226
organic molecule	359465
organic cyclic compound	298342
organic heterocyclic compound	154273
organic heteropolycyclic compound	95654
organic heterotricyclic compound	37983
mancude organic heterotricyclic parent	207
phenanthroline	176
1,10-phenanthroline	163
bathocuproine disulfonic acid	89