dexamethasone - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	dexamethasone	go back to main search page
Accession:	CHEBI:41879	browse the term
Definition:	A fluorinated steroid that has formula C22H29FO5.
Synonyms:	exact_synonym:	9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione
	related_synonym:	1-Dehydro-16alpha-methyl-9alpha-fluorohydrocortisone; 16alpha-Methyl-9alpha-fluoro-1-dehydrocortisol; 9alpha-Fluoro-16alpha-methylprednisolone; C22H29FO5; Decadron; InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1; InChIKey=UREBDLICKHMUKA-CXSFZGCWSA-N; [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C; dexametasona; dexamethasonum
	alt_id:	CHEBI:41873; CHEBI:4461
	xref_casrn:	50-02-2
	xref:	Beilstein:2066652 "Beilstein Registry Number"; ChEMBL:465281 "ChEMBL COMPOUND"; ChemIDplus:50-02-2 "CAS Registry Number"; DrugBank:DB01234 "DrugBank"; KEGG DRUG:D00292 "KEGG DRUG"
	xref_mesh:	MESH:D003907
	xref:	Patent:DE1113690 "Patent"; Patent:GB869511 "Patent"; Patent:US3007923 "Patent"; Wikipedia:Dexamethasone "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

dexamethasone
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	A2m	alpha-2-macroglobulin		decreases expression	ISO	6	121,586,191	121,629,256	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, sub-family A (ABC1), member 1		increases expression	ISO	4	53,043,661	53,172,767	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, sub-family A (ABC1), member 1		multiple interactions	EXP	4	53,043,661	53,172,767	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, sub-family A (ABC1), member 1		multiple interactions	ISO	4	53,043,661	53,172,767	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	ISO	5	8,660,092	8,748,570	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		decreases activity	ISO	5	8,660,092	8,748,570	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	ISO	5	8,660,092	8,748,570	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, sub-family B (MDR/TAP), member 1B		multiple interactions	ISO	5	8,798,147	8,866,314	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, sub-family B (MDR/TAP), member 1B		increases expression	ISO	5	8,798,147	8,866,314	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, sub-family B (MDR/TAP), member 1B		increases expression	ISO	5	8,798,147	8,866,314	RGD:6480464	CTD
G	Abcb4	ATP-binding cassette, sub-family B (MDR/TAP), member 4		increases expression	ISO	5	8,893,721	8,959,226	RGD:6480464	CTD
G	Abcc1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		multiple interactions	ISO	16	14,361,653	14,474,968	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		decreases expression	ISO	19	43,856,798	43,912,708	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		multiple interactions	ISO	19	43,856,798	43,912,708	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		increases expression	ISO	19	43,856,798	43,912,708	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		increases expression	ISO	19	43,856,798	43,912,708	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		multiple interactions	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases activity	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases expression	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		affects expression	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		decreases expression	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		multiple interactions	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases expression	ISO	11	94,204,609	94,254,290	RGD:6480464	CTD
G	Abcc6	ATP-binding cassette, sub-family C (CFTR/MRP), member 6		affects expression	ISO	7	53,231,750	53,285,656	RGD:6480464	CTD
G	Abcc6	ATP-binding cassette, sub-family C (CFTR/MRP), member 6		decreases expression	ISO	7	53,231,750	53,285,656	RGD:6480464	CTD
G	Abcg2	ATP-binding cassette, sub-family G (WHITE), member 2		multiple interactions	ISO	6	58,546,666	58,642,445	RGD:6480464	CTD
G	Abhd1	abhydrolase domain containing 1		increases expression	ISO	5	31,252,439	31,257,468	RGD:6480464	CTD
G	Abhd1	abhydrolase domain containing 1		multiple interactions	ISO	5	31,252,439	31,257,468	RGD:6480464	CTD
G	Acadm	acyl-Coenzyme A dehydrogenase, medium chain		decreases expression	ISO	3	153,585,323	153,607,396	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	7	86,198,369	86,259,985	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	7	86,198,369	86,259,985	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		increases expression	ISO	11	105,829,261	105,851,259	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		multiple interactions	ISO	11	105,829,261	105,851,259	RGD:6480464	CTD
G	Acly	ATP citrate lyase		decreases expression	ISO	11	100,337,670	100,389,215	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		decreases expression	ISO	15	81,702,893	81,745,567	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		multiple interactions	ISO	15	81,702,893	81,745,567	RGD:6480464	CTD
G	Acot7	acyl-CoA thioesterase 7		decreases expression	ISO	4	151,552,209	151,645,964	RGD:6480464	CTD
G	Acox1	acyl-Coenzyme A oxidase 1, palmitoyl		decreases expression	ISO	11	116,033,202	116,060,359	RGD:6480464	CTD
G	Acp5	acid phosphatase 5, tartrate resistant		multiple interactions	ISO	9	21,931,171	21,940,190	RGD:6480464	CTD
G	Acsl1	acyl-CoA synthetase long-chain family member 1		multiple interactions	EXP	8	47,556,396	47,621,404	RGD:6480464	CTD
G	Acsl1	acyl-CoA synthetase long-chain family member 1		decreases expression	ISO	8	47,556,396	47,621,404	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		multiple interactions	EXP	X	138,752,536	138,825,078	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		increases expression	ISO	X	138,752,536	138,825,078	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		multiple interactions	ISO	X	138,752,536	138,825,078	RGD:6480464	CTD
G	Acta2	actin, alpha 2, smooth muscle, aorta		multiple interactions	EXP	19	34,315,581	34,329,826	RGD:6480464	CTD
G	Acta2	actin, alpha 2, smooth muscle, aorta		decreases expression	ISO	19	34,315,581	34,329,826	RGD:6480464	CTD
G	Actb	actin, beta		multiple interactions	EXP	5	143,664,795	143,668,403	RGD:6480464	CTD
G	Actc1	actin, alpha, cardiac muscle 1		multiple interactions	EXP	2	113,873,025	113,878,547	RGD:6480464	CTD
G	Actg2	actin, gamma 2, smooth muscle, enteric		multiple interactions	EXP	6	83,462,903	83,486,245	RGD:6480464	CTD
G	Adam12	a disintegrin and metallopeptidase domain 12 (meltrin alpha)		multiple interactions	EXP	7	141,074,882	141,416,780	RGD:6480464	CTD
G	Adam17	a disintegrin and metallopeptidase domain 17		decreases expression	ISO	12	21,329,370	21,379,452	RGD:6480464	CTD
G	Adamts1	a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 1		multiple interactions	EXP	16	85,794,072	85,803,360	RGD:6480464	CTD
G	Adh1	alcohol dehydrogenase 1 (class I)		increases expression	ISO	3	137,940,609	137,953,655	RGD:6480464	CTD
G	Adh1	alcohol dehydrogenase 1 (class I)		multiple interactions	ISO	3	137,940,609	137,953,655	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		multiple interactions	EXP	16	23,146,609	23,158,041	RGD:6480464	CTD
G	Adm	adrenomedullin		multiple interactions	EXP	7	117,771,183	117,773,333	RGD:6480464	CTD
G	Adora3	adenosine A3 receptor		increases expression	ISO	3	105,673,776	105,726,960	RGD:6480464	CTD
G	Adra1b	adrenergic receptor, alpha 1b		increases expression	ISO	11	43,588,108	43,649,834	RGD:6480464	CTD
G	Adra1d	adrenergic receptor, alpha 1d		increases expression	ISO	2	131,371,093	131,388,021	RGD:6480464	CTD
G	Adrb2	adrenergic receptor, beta 2		increases expression	ISO	18	62,337,470	62,339,613	RGD:6480464	CTD
G	Adrb2	adrenergic receptor, beta 2		multiple interactions	ISO	18	62,337,470	62,339,613	RGD:6480464	CTD
G	Adrb2	adrenergic receptor, beta 2		multiple interactions	EXP	18	62,337,470	62,339,613	RGD:6480464	CTD
G	Adrb3	adrenergic receptor, beta 3		decreases expression	EXP	8	28,336,248	28,340,060	RGD:6480464	CTD
G	Agr2	anterior gradient 2 (Xenopus laevis)		multiple interactions	ISO	12	36,719,512	36,730,668	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	8	127,080,487	127,093,607	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases expression	EXP	8	127,080,487	127,093,607	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	8	127,080,487	127,093,607	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	8	127,080,487	127,093,607	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	8	127,080,487	127,093,607	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		decreases expression	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		decreases expression	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	EXP	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	EXP	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		increases expression	EXP	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahr	aryl-hydrocarbon receptor		multiple interactions	ISO	12	36,182,651	36,219,661	RGD:6480464	CTD
G	Ahsa1	AHA1, activator of heat shock protein ATPase 1		increases expression	EXP	12	88,607,678	88,614,902	RGD:6480464	CTD
G	Ahsg	alpha-2-HS-glycoprotein		increases response to substance	ISO	16	22,892,115	22,899,511	RGD:6480464	CTD
G	Aifm1	apoptosis-inducing factor, mitochondrion-associated 1		multiple interactions	EXP	X	45,828,121	45,866,603	RGD:6480464	CTD
G	Aim1	absent in melanoma 1		increases expression	ISO	10	43,670,113	43,724,652	RGD:6480464	CTD
G	Akap12	A kinase (PRKA) anchor protein (gravin) 12		multiple interactions	EXP	10	5,987,070	6,080,212	RGD:6480464	CTD
G	Akap7	A kinase (PRKA) anchor protein 7		multiple interactions	ISO	10	24,888,896	25,018,969	RGD:6480464	CTD
G	Akt1	thymoma viral proto-oncogene 1		decreases phosphorylation	ISO	12	113,892,032	113,912,487	RGD:6480464	CTD
G	Akt1	thymoma viral proto-oncogene 1		decreases phosphorylation	ISO	12	113,892,032	113,912,487	RGD:6480464	CTD
G	Alb	albumin		multiple interactions	ISO	5	90,889,915	90,905,629	RGD:6480464	CTD
G	Alb	albumin		multiple interactions	ISO	5	90,889,915	90,905,629	RGD:6480464	CTD
G	Alb	albumin		increases expression	ISO	5	90,889,915	90,905,629	RGD:6480464	CTD
G	Alb	albumin		increases secretion	ISO	5	90,889,915	90,905,629	RGD:6480464	CTD
G	Aldh1a1	aldehyde dehydrogenase family 1, subfamily A1		affects expression	ISO	19	20,676,472	20,717,952	RGD:6480464	CTD
G	Aldh1b1	aldehyde dehydrogenase 1 family, member B1		affects expression	ISO	4	45,811,894	45,817,480	RGD:6480464	CTD
G	Aldoa	aldolase A, fructose-bisphosphate		increases expression	ISO	7	133,938,748	133,943,961	RGD:6480464	CTD
G	Alox5	arachidonate 5-lipoxygenase		multiple interactions	ISO	6	116,360,089	116,411,196	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		multiple interactions	EXP	4	137,297,647	137,352,292	RGD:6480464	CTD
G	Ampd3	adenosine monophosphate deaminase 3		increases expression	ISO	7	117,916,118	117,955,909	RGD:6480464	CTD
G	Ampd3	adenosine monophosphate deaminase 3		multiple interactions	ISO	7	117,916,118	117,955,909	RGD:6480464	CTD
G	Amy1	amylase 1, salivary		increases expression	EXP	3	113,258,870	113,280,668	RGD:6480464	CTD
G	Angpt1	angiopoietin 1		multiple interactions	ISO	15	42,256,269	42,508,341	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		increases expression	EXP	17	33,911,845	33,918,520	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		affects response to substance	EXP	17	33,911,845	33,918,520	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		multiple interactions	EXP	17	33,911,845	33,918,520	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		increases expression	ISO	17	33,911,845	33,918,520	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		multiple interactions	ISO	17	33,911,845	33,918,520	RGD:6480464	CTD
G	Ank1	ankyrin 1, erythroid		decreases expression	ISO	8	24,085,354	24,260,968	RGD:6480464	CTD
G	Ank1	ankyrin 1, erythroid		multiple interactions	ISO	8	24,085,354	24,260,968	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		increases expression	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		increases localization	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		increases phosphorylation	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		affects response to substance	EXP	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	EXP	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa1	annexin A1		affects response to substance	ISO	19	20,447,924	20,465,161	RGD:6480464	CTD
G	Anxa3	annexin A3		multiple interactions	EXP	5	97,222,404	97,274,987	RGD:6480464	CTD
G	Anxa6	annexin A6		multiple interactions	EXP	11	54,792,464	54,846,973	RGD:6480464	CTD
G	Anxa8	annexin A8		multiple interactions	ISO	14	34,899,176	34,913,757	RGD:6480464	CTD
G	Aox1	aldehyde oxidase 1		multiple interactions	ISO	1	58,086,813	58,163,254	RGD:6480464	CTD
G	Aox1	aldehyde oxidase 1		increases expression	ISO	1	58,086,813	58,163,254	RGD:6480464	CTD
G	Ap1g2	adaptor protein complex AP-1, gamma 2 subunit		increases expression	ISO	14	55,717,687	55,725,430	RGD:6480464	CTD
G	Apcdd1	adenomatosis polyposis coli down-regulated 1		multiple interactions	EXP	18	63,081,981	63,112,849	RGD:6480464	CTD
G	Apln	apelin		decreases expression	ISO	X	45,378,323	45,388,029	RGD:6480464	CTD
G	Apln	apelin		multiple interactions	ISO	X	45,378,323	45,388,029	RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		affects expression	ISO	9	46,036,713	46,038,549	RGD:6480464	CTD
G	Apoa4	apolipoprotein A-IV		affects expression	ISO	9	46,048,927	46,051,541	RGD:6480464	CTD
G	Apob	apolipoprotein B		increases expression	ISO	12	7,984,483	8,023,645	RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		increases expression	EXP	9	46,041,134	46,043,380	RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		multiple interactions	EXP	9	46,041,134	46,043,380	RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		increases expression	ISO	9	46,041,134	46,043,380	RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		multiple interactions	ISO	9	46,041,134	46,043,380	RGD:6480464	CTD
G	Aqp7	aquaporin 7		increases expression	ISO	4	40,980,107	40,995,169	RGD:6480464	CTD
G	Ar	androgen receptor		affects activity	ISO	X	95,345,089	95,512,486	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	95,345,089	95,512,486	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	95,345,089	95,512,486	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	95,345,089	95,512,486	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	95,345,089	95,512,486	RGD:6480464	CTD
G	Araf	v-raf murine sarcoma 3611 viral oncogene homolog		multiple interactions	ISO	X	20,425,669	20,437,647	RGD:6480464	CTD
G	Areg	amphiregulin		decreases expression	ISO	5	91,568,641	91,577,458	RGD:6480464	CTD
G	Arg2	arginase type II		increases expression	ISO	12	80,231,775	80,257,288	RGD:6480464	CTD
G	Arg2	arginase type II		multiple interactions	ISO	12	80,231,775	80,257,288	RGD:6480464	CTD
G	Arhgap10	Rho GTPase activating protein 10		increases expression	EXP	8	79,774,265	80,041,806	RGD:6480464	CTD
G	Arhgap30	Rho GTPase activating protein 30		increases expression	EXP	1	173,319,091	173,340,371	RGD:6480464	CTD
G	Arhgap5	Rho GTPase activating protein 5		multiple interactions	EXP	12	53,617,064	53,668,839	RGD:6480464	CTD
G	Arnt	aryl hydrocarbon receptor nuclear translocator		increases expression	ISO	3	95,238,312	95,301,162	RGD:6480464	CTD
G	Art1	ADP-ribosyltransferase 1		multiple interactions	ISO	7	109,250,257	109,259,662	RGD:6480464	CTD
G	Art1	ADP-ribosyltransferase 1		increases expression	ISO	7	109,250,257	109,259,662	RGD:6480464	CTD
G	Art5	ADP-ribosyltransferase 5		increases expression	ISO	7	109,245,393	109,248,743	RGD:6480464	CTD
G	Art5	ADP-ribosyltransferase 5		multiple interactions	ISO	7	109,245,393	109,248,743	RGD:6480464	CTD
G	Asah2	N-acylsphingosine amidohydrolase 2		decreases expression	ISO	19	32,059,136	32,177,630	RGD:6480464	CTD
G	Asah2	N-acylsphingosine amidohydrolase 2		multiple interactions	ISO	19	32,059,136	32,177,630	RGD:6480464	CTD
G	Ass1	argininosuccinate synthetase 1		increases expression	ISO	2	31,325,790	31,376,190	RGD:6480464	CTD
G	Ass1	argininosuccinate synthetase 1		multiple interactions	ISO	2	31,325,790	31,376,190	RGD:6480464	CTD
G	Atcay	ataxia, cerebellar, Cayman type homolog (human)		decreases expression	ISO	10	80,667,258	80,693,524	RGD:6480464	CTD
G	Atcay	ataxia, cerebellar, Cayman type homolog (human)		multiple interactions	ISO	10	80,667,258	80,693,524	RGD:6480464	CTD
G	Atp2a1	ATPase, Ca++ transporting, cardiac muscle, fast twitch 1		increases expression	ISO	7	133,589,374	133,606,587	RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	ISO	2	130,406,413	130,408,277	RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	ISO	2	130,406,413	130,408,277	RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	ISO	2	130,406,413	130,408,277	RGD:6480464	CTD
G	Avp	arginine vasopressin		increases activity	ISO	2	130,406,413	130,408,277	RGD:6480464	CTD
G	B2m	beta-2 microglobulin		decreases expression	ISO	2	121,973,423	121,978,818	RGD:6480464	CTD
G	B4galt6	UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6		decreases expression	ISO	18	20,843,100	20,904,905	RGD:6480464	CTD
G	B4galt6	UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6		multiple interactions	ISO	18	20,843,100	20,904,905	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		decreases phosphorylation	EXP	19	7,016,345	7,026,383	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		increases expression	EXP	19	7,016,345	7,026,383	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	EXP	19	7,016,345	7,026,383	RGD:6480464	CTD
G	Bambi	BMP and activin membrane-bound inhibitor		decreases expression	EXP	18	3,507,955	3,516,402	RGD:6480464	CTD
G	Basp1	brain abundant, membrane attached signal protein 1		decreases expression	ISO	15	25,293,032	25,343,519	RGD:6480464	CTD
G	Basp1	brain abundant, membrane attached signal protein 1		multiple interactions	ISO	15	25,293,032	25,343,519	RGD:6480464	CTD
G	Bax	BCL2-associated X protein		multiple interactions	EXP	7	52,717,065	52,722,268	RGD:6480464	CTD
G	Bax	BCL2-associated X protein		multiple interactions	ISO	7	52,717,065	52,722,268	RGD:6480464	CTD
G	Bax	BCL2-associated X protein		increases expression	ISO	7	52,717,065	52,722,268	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		increases response to substance	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases response to substance	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		increases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		increases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	EXP	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	EXP	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	EXP	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	EXP	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		increases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		decreases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases stability	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	EXP	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		increases expression	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l1	BCL2-like 1		multiple interactions	ISO	2	152,606,404	152,657,418	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	ISO	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases phosphorylation	ISO	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	ISO	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	ISO	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	EXP	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	EXP	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	EXP	2	127,951,774	127,988,283	RGD:6480464	CTD
G	Bcl3	B cell leukemia/lymphoma 3		decreases expression	ISO	7	20,393,811	20,408,104	RGD:6480464	CTD
G	Bcl3	B cell leukemia/lymphoma 3		multiple interactions	ISO	7	20,393,811	20,408,104	RGD:6480464	CTD
G	Bcr	breakpoint cluster region		decreases expression	ISO	10	74,523,641	74,647,668	RGD:6480464	CTD
G	Bcr	breakpoint cluster region		multiple interactions	ISO	10	74,523,641	74,647,668	RGD:6480464	CTD
G	Bdnf	brain derived neurotrophic factor		decreases expression	ISO	2	109,514,857	109,567,200	RGD:6480464	CTD
G	Bglap	bone gamma carboxyglutamate protein		multiple interactions	ISO	3	88,187,417	88,188,386	RGD:6480464	CTD
G	Bglap	bone gamma carboxyglutamate protein		multiple interactions	ISO	3	88,187,417	88,188,386	RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		multiple interactions	ISO	6	145,811,257	145,813,860	RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		decreases expression	ISO	6	145,811,257	145,813,860	RGD:6480464	CTD
G	Birc2	baculoviral IAP repeat-containing 2		multiple interactions	ISO	9	7,818,226	7,835,255	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		multiple interactions	ISO	9	7,848,699	7,873,170	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	ISO	9	7,848,699	7,873,170	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		multiple interactions	ISO	9	7,848,699	7,873,170	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	ISO	9	7,848,699	7,873,170	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	ISO	9	7,848,699	7,873,170	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		affects expression	ISO	11	117,710,551	117,717,057	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO	11	117,710,551	117,717,057	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO	11	117,710,551	117,717,057	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	ISO	2	133,378,935	133,388,621	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	ISO	2	133,378,935	133,388,621	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	ISO	14	47,003,195	47,010,274	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		affects expression	EXP	14	47,003,195	47,010,274	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	EXP	14	47,003,195	47,010,274	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		multiple interactions	ISO	13	38,437,585	38,591,597	RGD:6480464	CTD
G	Bmp8a	bone morphogenetic protein 8a		increases expression	EXP	4	122,989,888	123,020,046	RGD:6480464	CTD
G	Bmp8a	bone morphogenetic protein 8a		decreases response to substance	EXP	4	122,989,888	123,020,046	RGD:6480464	CTD
G	Btg1	B cell translocation gene 1, anti-proliferative		increases expression	ISO	10	96,079,635	96,085,447	RGD:6480464	CTD
G	Btg2	B cell translocation gene 2, anti-proliferative		increases expression	ISO	1	135,971,442	135,975,732	RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	ISO	17	57,343,396	57,367,559	RGD:6480464	CTD
G	Cacna2d1	calcium channel, voltage-dependent, alpha2/delta subunit 1		multiple interactions	EXP	5	15,440,509	15,880,329	RGD:6480464	CTD
G	Calb1	calbindin 1		decreases expression	ISO	4	15,808,411	15,833,856	RGD:6480464	CTD
G	Calca	calcitonin/calcitonin-related polypeptide, alpha		multiple interactions	ISO	7	121,774,992	121,779,871	RGD:6480464	CTD
G	Calca	calcitonin/calcitonin-related polypeptide, alpha		decreases response to substance	ISO	7	121,774,992	121,779,871	RGD:6480464	CTD
G	Calml4	calmodulin-like 4		multiple interactions	EXP	9	62,705,911	62,723,725	RGD:6480464	CTD
G	Calu	calumenin		increases expression	ISO	6	29,298,119	29,326,675	RGD:6480464	CTD
G	Camk4	calcium/calmodulin-dependent protein kinase IV		decreases expression	ISO	18	33,098,695	33,355,421	RGD:6480464	CTD
G	Camk4	calcium/calmodulin-dependent protein kinase IV		multiple interactions	ISO	18	33,098,695	33,355,421	RGD:6480464	CTD
G	Capn2	calpain 2		increases expression	ISO	1	184,397,390	184,447,614	RGD:6480464	CTD
G	Capn2	calpain 2		multiple interactions	ISO	1	184,397,390	184,447,614	RGD:6480464	CTD
G	Car4	carbonic anhydrase 4		decreases expression	ISO	11	84,771,256	84,779,556	RGD:6480464	CTD
G	Car4	carbonic anhydrase 4		multiple interactions	ISO	11	84,771,256	84,779,556	RGD:6480464	CTD
G	Casp1	caspase 1		multiple interactions	ISO	9	5,298,517	5,307,281	RGD:6480464	CTD
G	Casp2	caspase 2		decreases expression	ISO	6	42,215,038	42,232,495	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		decreases activity	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		increases expression	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	EXP	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		decreases activity	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Casp7	caspase 7		multiple interactions	ISO	19	56,471,619	56,516,834	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	1	58,852,218	58,904,347	RGD:6480464	CTD
G	Casp8	caspase 8		increases activity	ISO	1	58,852,218	58,904,347	RGD:6480464	CTD
G	Casp8	caspase 8		increases activity	EXP	1	58,852,218	58,904,347	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	1	58,852,218	58,904,347	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	EXP	1	58,852,218	58,904,347	RGD:6480464	CTD
G	Casp9	caspase 9		increases activity	ISO	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		increases cleavage	ISO	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		decreases expression	EXP	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		multiple interactions	ISO	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		increases activity	EXP	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		multiple interactions	EXP	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Casp9	caspase 9		multiple interactions	ISO	4	141,349,527	141,371,890	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	EXP	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	EXP	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		decreases activity	EXP	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		decreases expression	EXP	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		increases activity	EXP	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		decreases activity	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		decreases expression	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		increases activity	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cat	catalase		increases expression	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	EXP	6	17,256,370	17,291,324	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	EXP	6	17,256,370	17,291,324	RGD:6480464	CTD
G	Ccar1	cell division cycle and apoptosis regulator 1		increases expression	EXP	10	62,206,676	62,255,116	RGD:6480464	CTD
G	Ccdc86	coiled-coil domain containing 86		decreases expression	ISO	19	11,015,971	11,023,756	RGD:6480464	CTD
G	Cckbr	cholecystokinin B receptor		decreases expression	ISO	7	112,574,334	112,584,852	RGD:6480464	CTD
G	Cckbr	cholecystokinin B receptor		multiple interactions	ISO	7	112,574,334	112,584,852	RGD:6480464	CTD
G	Ccl17	chemokine (C-C motif) ligand 17		multiple interactions	EXP	8	97,334,353	97,335,936	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccl26	chemokine (C-C motif) ligand 26		multiple interactions	ISO	5	136,036,318	136,039,439	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	EXP	11	83,461,345	83,462,880	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	11	83,339,280	83,344,020	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	11	83,339,280	83,344,020	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	11	83,339,280	83,344,020	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		multiple interactions	EXP	11	81,859,214	81,861,027	RGD:6480464	CTD
G	Ccnb1	cyclin B1		decreases expression	ISO	13	101,548,694	101,556,441	RGD:6480464	CTD
G	Ccnb1	cyclin B1		multiple interactions	ISO	13	101,548,694	101,556,441	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases degradation	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases ubiquitination	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd2	cyclin D2		decreases expression	ISO	6	127,075,726	127,101,066	RGD:6480464	CTD
G	Ccng1	cyclin G1		increases expression	ISO	11	40,562,054	40,568,788	RGD:6480464	CTD
G	Ccr3	chemokine (C-C motif) receptor 3		decreases expression	ISO	9	123,936,703	123,946,421	RGD:6480464	CTD
G	Ccr4	chemokine (C-C motif) receptor 4		increases expression	ISO	9	114,399,434	114,405,662	RGD:6480464	CTD
G	Ccr9	chemokine (C-C motif) receptor 9		increases expression	EXP	9	123,676,329	123,692,575	RGD:6480464	CTD
G	Cd14	CD14 antigen		increases expression	ISO	18	36,884,721	36,886,308	RGD:6480464	CTD
G	Cd163	CD163 antigen		increases expression	ISO	6	124,254,669	124,280,545	RGD:6480464	CTD
G	Cd24a	CD24a antigen		increases expression	ISO	10	43,298,975	43,304,071	RGD:6480464	CTD
G	Cd24a	CD24a antigen		multiple interactions	ISO	10	43,298,975	43,304,071	RGD:6480464	CTD
G	Cd28	CD28 antigen		multiple interactions	ISO	1	60,803,232	60,830,203	RGD:6480464	CTD
G	Cd36	CD36 antigen		increases expression	ISO	5	17,287,508	17,394,777	RGD:6480464	CTD
G	Cd36	CD36 antigen		affects expression	ISO	5	17,287,508	17,394,777	RGD:6480464	CTD
G	Cd36	CD36 antigen		multiple interactions	ISO	5	17,287,508	17,394,777	RGD:6480464	CTD
G	Cd36	CD36 antigen		increases expression	ISO	5	17,287,508	17,394,777	RGD:6480464	CTD
G	Cd4	CD4 antigen		multiple interactions	ISO	6	124,814,711	124,838,227	RGD:6480464	CTD
G	Cd4	CD4 antigen		decreases expression	ISO	6	124,814,711	124,838,227	RGD:6480464	CTD
G	Cd53	CD53 antigen		increases expression	ISO	3	106,561,779	106,593,067	RGD:6480464	CTD
G	Cd68	CD68 antigen		increases expression	ISO	11	69,477,873	69,479,564	RGD:6480464	CTD
G	Cd69	CD69 antigen		increases expression	ISO	6	129,217,343	129,225,387	RGD:6480464	CTD
G	Cda	cytidine deaminase		increases activity	EXP	4	137,894,443	137,923,870	RGD:6480464	CTD
G	Cdc42	cell division cycle 42		multiple interactions	EXP	4	136,875,611	136,913,652	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		decreases expression	ISO	2	72,314,276	72,324,947	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		multiple interactions	ISO	2	72,314,276	72,324,947	RGD:6480464	CTD
G	Cdh13	cadherin 13		multiple interactions	EXP	8	120,807,655	121,847,348	RGD:6480464	CTD
G	Cdh13	cadherin 13		decreases expression	ISO	8	120,807,655	121,847,348	RGD:6480464	CTD
G	Cdh13	cadherin 13		multiple interactions	ISO	8	120,807,655	121,847,348	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		decreases expression	ISO	10	68,799,383	68,815,660	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A (P21)		increases expression	EXP	17	29,227,931	29,237,667	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A (P21)		multiple interactions	ISO	17	29,227,931	29,237,667	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A (P21)		increases expression	ISO	17	29,227,931	29,237,667	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A (P21)		increases expression	ISO	17	29,227,931	29,237,667	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A (P21)		multiple interactions	ISO	17	29,227,931	29,237,667	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		multiple interactions	ISO	14	47,380,216	47,391,200	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		decreases expression	ISO	14	47,380,216	47,391,200	RGD:6480464	CTD
G	Cdo1	cysteine dioxygenase 1, cytosolic		multiple interactions	EXP	18	46,872,859	46,887,996	RGD:6480464	CTD
G	Ceacam1	carcinoembryonic antigen-related cell adhesion molecule 1		increases expression	ISO	7	26,246,721	26,262,644	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	ISO	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	ISO	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	7	35,904,312	35,906,947	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	ISO	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	ISO	2	167,514,415	167,515,918	RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	EXP	16	15,887,379	15,889,638	RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		increases expression	ISO	16	15,887,379	15,889,638	RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	16	15,887,379	15,889,638	RGD:6480464	CTD
G	Celf2	CUGBP, Elav-like family member 2		multiple interactions	EXP	2	6,460,740	7,317,825	RGD:6480464	CTD
G	Celsr3	cadherin, EGF LAG seven-pass G-type receptor 3 (flamingo homolog, Drosophila)		decreases expression	ISO	9	108,728,651	108,755,300	RGD:6480464	CTD
G	Ces1d	carboxylesterase 1D		decreases expression	ISO	8	95,689,971	95,721,703	RGD:6480464	CTD
G	Ces1g	carboxylesterase 1G		increases expression	ISO	8	95,826,268	95,861,108	RGD:6480464	CTD
G	Ces1g	carboxylesterase 1G		decreases expression	ISO	8	95,826,268	95,861,108	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		affects expression	ISO	8	107,524,753	107,544,310	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		increases expression	ISO	8	107,524,753	107,544,310	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		multiple interactions	ISO	8	107,524,753	107,544,310	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		decreases expression	ISO	8	107,524,753	107,544,310	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		increases expression	ISO	8	107,524,753	107,544,310	RGD:6480464	CTD
G	Cfd	complement factor D (adipsin)		decreases expression	EXP	10	79,353,598	79,355,401	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		increases expression	ISO	1	58,770,130	58,815,728	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		multiple interactions	ISO	1	58,770,130	58,815,728	RGD:6480464	CTD
G	Chi3l1	chitinase 3-like 1		decreases expression	ISO	1	136,078,981	136,086,608	RGD:6480464	CTD
G	Chid1	chitinase domain containing 1		multiple interactions	ISO	7	148,679,035	148,725,756	RGD:6480464	CTD
G	Chid1	chitinase domain containing 1		increases expression	ISO	7	148,679,035	148,725,756	RGD:6480464	CTD
G	Chrnd	cholinergic receptor, nicotinic, delta polypeptide		increases expression	ISO	1	89,087,227	89,096,645	RGD:6480464	CTD
G	Chrnd	cholinergic receptor, nicotinic, delta polypeptide		multiple interactions	ISO	1	89,087,227	89,096,645	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		multiple interactions	ISO	19	44,147,824	44,181,967	RGD:6480464	CTD
G	Cib2	calcium and integrin binding family member 2		multiple interactions	ISO	9	54,393,159	54,407,886	RGD:6480464	CTD
G	Cib2	calcium and integrin binding family member 2		decreases expression	ISO	9	54,393,159	54,407,886	RGD:6480464	CTD
G	Cidea	cell death-inducing DNA fragmentation factor, alpha subunit-like effector A		increases expression	ISO	18	67,503,218	67,527,448	RGD:6480464	CTD
G	Cidea	cell death-inducing DNA fragmentation factor, alpha subunit-like effector A		multiple interactions	ISO	18	67,503,218	67,527,448	RGD:6480464	CTD
G	Cirbp	cold inducible RNA binding protein		decreases expression	EXP	10	79,630,586	79,634,398	RGD:6480464	CTD
G	Cited2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	EXP	10	17,443,034	17,445,480	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		increases expression	ISO	12	112,907,566	112,910,549	RGD:6480464	CTD
G	Clcn4-2	chloride channel 4-2		decreases expression	ISO	7	7,235,027	7,252,222	RGD:6480464	CTD
G	Clec3b	C-type lectin domain family 3, member b		multiple interactions	EXP	9	123,060,064	123,066,550	RGD:6480464	CTD
G	Clic3	chloride intracellular channel 3		multiple interactions	ISO	2	25,312,363	25,314,292	RGD:6480464	CTD
G	Cln6	ceroid-lipofuscinosis, neuronal 6		decreases expression	ISO	9	62,686,594	62,699,809	RGD:6480464	CTD
G	Cln6	ceroid-lipofuscinosis, neuronal 6		multiple interactions	ISO	9	62,686,594	62,699,809	RGD:6480464	CTD
G	Clu	clusterin		decreases expression	ISO	14	66,587,320	66,600,382	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	ISO	14	66,587,320	66,600,382	RGD:6480464	CTD
G	Cnksr1	connector enhancer of kinase suppressor of Ras 1		increases expression	ISO	4	133,783,957	133,794,314	RGD:6480464	CTD
G	Cnksr1	connector enhancer of kinase suppressor of Ras 1		multiple interactions	ISO	4	133,783,957	133,794,314	RGD:6480464	CTD
G	Cnn2	calponin 2		multiple interactions	EXP	10	79,451,345	79,458,145	RGD:6480464	CTD
G	Cntn1	contactin 1		decreases expression	ISO	15	91,881,596	92,172,398	RGD:6480464	CTD
G	Cntn1	contactin 1		multiple interactions	ISO	15	91,881,596	92,172,398	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		multiple interactions	EXP	3	113,733,458	113,923,244	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		multiple interactions	ISO	4	47,220,884	47,326,037	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		multiple interactions	ISO	4	47,220,884	47,326,037	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		decreases expression	ISO	4	47,220,884	47,326,037	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		decreases expression	ISO	11	94,797,584	94,813,181	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	15	97,806,033	97,835,155	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		affects expression	EXP	15	97,806,033	97,835,155	RGD:6480464	CTD
G	Col3a1	collagen, type III, alpha 1		decreases expression	ISO	1	45,368,383	45,406,551	RGD:6480464	CTD
G	Col3a1	collagen, type III, alpha 1		multiple interactions	ISO	1	45,368,383	45,406,551	RGD:6480464	CTD
G	Col4a1	collagen, type IV, alpha 1		multiple interactions	EXP	8	11,198,423	11,312,826	RGD:6480464	CTD
G	Col4a6	collagen, type IV, alpha 6		multiple interactions	ISO	X	137,599,946	137,908,619	RGD:6480464	CTD
G	Col5a1	collagen, type V, alpha 1		decreases expression	ISO	2	27,741,945	27,895,030	RGD:6480464	CTD
G	Col5a1	collagen, type V, alpha 1		multiple interactions	ISO	2	27,741,945	27,895,030	RGD:6480464	CTD
G	Col5a2	collagen, type V, alpha 2		decreases expression	ISO	1	45,431,176	45,560,127	RGD:6480464	CTD
G	Col5a2	collagen, type V, alpha 2		multiple interactions	ISO	1	45,431,176	45,560,127	RGD:6480464	CTD
G	Col5a3	collagen, type V, alpha 3		multiple interactions	ISO	9	20,574,494	20,619,478	RGD:6480464	CTD
G	Col5a3	collagen, type V, alpha 3		decreases expression	ISO	9	20,574,494	20,619,478	RGD:6480464	CTD
G	Col6a3	collagen, type VI, alpha 3		multiple interactions	EXP	1	92,663,435	92,740,514	RGD:6480464	CTD
G	Col6a3	collagen, type VI, alpha 3		decreases expression	ISO	1	92,663,435	92,740,514	RGD:6480464	CTD
G	Col6a3	collagen, type VI, alpha 3		multiple interactions	ISO	1	92,663,435	92,740,514	RGD:6480464	CTD
G	Col7a1	collagen, type VII, alpha 1		multiple interactions	ISO	9	108,855,790	108,886,920	RGD:6480464	CTD
G	Col9a1	collagen, type IX, alpha 1		affects expression	EXP	1	24,184,449	24,259,577	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		increases expression	ISO	16	18,406,975	18,426,809	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	ISO	16	18,406,975	18,426,809	RGD:6480464	CTD
G	Copb2	coatomer protein complex, subunit beta 2 (beta prime)		multiple interactions	ISO	9	98,464,150	98,488,794	RGD:6480464	CTD
G	Copb2	coatomer protein complex, subunit beta 2 (beta prime)		decreases expression	ISO	9	98,464,150	98,488,794	RGD:6480464	CTD
G	COX1	cytochrome c oxidase I, mitochondrial		increases expression	ISO	MT	5,328	6,872	RGD:6480464	CTD
G	COX2	cytochrome c oxidase II, mitochondrial		increases expression	ISO	MT	7,013	7,696	RGD:6480464	CTD
G	COX3	cytochrome c oxidase III, mitochondrial		increases expression	ISO	MT	8,607	9,390	RGD:6480464	CTD
G	Cp	ceruloplasmin		multiple interactions	EXP	3	19,857,054	19,907,609	RGD:6480464	CTD
G	Cp	ceruloplasmin		increases expression	ISO	3	19,857,054	19,907,609	RGD:6480464	CTD
G	Cp	ceruloplasmin		multiple interactions	ISO	3	19,857,054	19,907,609	RGD:6480464	CTD
G	Cpa1	carboxypeptidase A1, pancreatic		decreases expression	ISO	6	30,589,221	30,595,361	RGD:6480464	CTD
G	Cpa1	carboxypeptidase A1, pancreatic		multiple interactions	ISO	6	30,589,221	30,595,361	RGD:6480464	CTD
G	Cpe	carboxypeptidase E		decreases expression	ISO	8	67,071,339	67,171,837	RGD:6480464	CTD
G	Cpe	carboxypeptidase E		multiple interactions	ISO	8	67,071,339	67,171,837	RGD:6480464	CTD
G	Cpn1	carboxypeptidase N, polypeptide 1		increases expression	ISO	19	44,030,797	44,061,010	RGD:6480464	CTD
G	Cps1	carbamoyl-phosphate synthetase 1		increases expression	EXP	1	67,169,640	67,277,022	RGD:6480464	CTD
G	Cps1	carbamoyl-phosphate synthetase 1		increases expression	ISO	1	67,169,640	67,277,022	RGD:6480464	CTD
G	Crabp2	cellular retinoic acid binding protein II		decreases expression	EXP	3	87,752,615	87,757,294	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		increases phosphorylation	ISO	1	64,579,378	64,651,122	RGD:6480464	CTD
G	Crh	corticotropin releasing hormone		increases expression	ISO	3	19,593,401	19,595,396	RGD:6480464	CTD
G	Crisp4	cysteine-rich secretory protein 4		decreases expression	ISO	1	18,105,272	18,127,132	RGD:6480464	CTD
G	Crisp4	cysteine-rich secretory protein 4		multiple interactions	ISO	1	18,105,272	18,127,132	RGD:6480464	CTD
G	Crkl	v-crk sarcoma virus CT10 oncogene homolog (avian)-like		multiple interactions	EXP	16	17,452,080	17,486,348	RGD:6480464	CTD
G	Cryab	crystallin, alpha B		increases expression	ISO	9	50,560,863	50,564,738	RGD:6480464	CTD
G	Cryab	crystallin, alpha B		multiple interactions	ISO	9	50,560,863	50,564,738	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		multiple interactions	EXP	3	107,543,966	107,563,387	RGD:6480464	CTD
G	Csf1r	colony stimulating factor 1 receptor		increases expression	ISO	18	61,265,226	61,290,793	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		increases expression	ISO	11	98,562,627	98,564,943	RGD:6480464	CTD
G	Csrp3	cysteine and glycine-rich protein 3		increases expression	ISO	7	56,085,768	56,099,021	RGD:6480464	CTD
G	Csrp3	cysteine and glycine-rich protein 3		multiple interactions	ISO	7	56,085,768	56,099,021	RGD:6480464	CTD
G	Cst6	cystatin E/M		multiple interactions	ISO	19	5,344,705	5,349,574	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases expression	EXP	9	120,842,518	120,869,625	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases expression	ISO	9	120,842,518	120,869,625	RGD:6480464	CTD
G	Ctsl	cathepsin L		increases expression	ISO	13	64,464,522	64,471,614	RGD:6480464	CTD
G	Ctsl	cathepsin L		increases expression	ISO	13	64,464,522	64,471,614	RGD:6480464	CTD
G	Ctsl	cathepsin L		multiple interactions	ISO	13	64,464,522	64,471,614	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		multiple interactions	EXP	8	97,296,080	97,306,327	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1		multiple interactions	ISO	5	91,320,271	91,322,147	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1		multiple interactions	ISO	5	91,320,271	91,322,147	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1		multiple interactions	EXP	5	91,320,271	91,322,147	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1		multiple interactions	EXP	5	91,320,271	91,322,147	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	EXP	6	117,118,553	117,131,386	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	5	91,332,925	91,334,964	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	5	91,332,925	91,334,964	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	5	91,332,925	91,334,964	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	5	91,332,925	91,334,964	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		multiple interactions	EXP	5	91,188,325	91,190,651	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		increases expression	ISO	1	130,484,776	130,488,876	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		multiple interactions	ISO	1	130,484,776	130,488,876	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		increases expression	ISO	1	130,484,776	130,488,876	RGD:6480464	CTD
G	Cxcr7	chemokine (C-X-C motif) receptor 7		decreases expression	EXP	1	92,100,578	92,112,863	RGD:6480464	CTD
G	Cyb5r3	cytochrome b5 reductase 3		decreases expression	ISO	15	82,983,931	83,002,638	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		multiple interactions	ISO	X	9,012,378	9,046,450	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		multiple interactions	ISO	6	50,512,562	50,516,473	RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		multiple interactions	ISO	9	54,013,744	54,041,249	RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases expression	ISO	9	54,013,744	54,041,249	RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases activity	ISO	9	54,013,744	54,041,249	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		decreases activity	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		decreases expression	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		increases activity	ISO	9	57,535,735	57,551,629	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases expression	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases activity	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects expression	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases expression	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	EXP	17	80,106,293	80,114,381	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	ISO	17	80,106,293	80,114,381	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		affects activity	EXP	2	170,308,465	170,322,638	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		affects expression	EXP	2	170,308,465	170,322,638	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		increases expression	EXP	2	170,308,465	170,322,638	RGD:6480464	CTD
G	Cyp27a1	cytochrome P450, family 27, subfamily a, polypeptide 1		multiple interactions	ISO	1	74,760,148	74,784,464	RGD:6480464	CTD
G	Cyp27a1	cytochrome P450, family 27, subfamily a, polypeptide 1		increases expression	ISO	1	74,760,148	74,784,464	RGD:6480464	CTD
G	Cyp27b1	cytochrome P450, family 27, subfamily b, polypeptide 1		affects expression	EXP	10	126,485,302	126,490,062	RGD:6480464	CTD
G	Cyp27b1	cytochrome P450, family 27, subfamily b, polypeptide 1		affects activity	EXP	10	126,485,302	126,490,062	RGD:6480464	CTD
G	Cyp2a12	cytochrome P450, family 2, subfamily a, polypeptide 12		affects expression	ISO	7	27,814,109	27,821,837	RGD:6480464	CTD
G	Cyp2a4	cytochrome P450, family 2, subfamily a, polypeptide 4		multiple interactions	ISO	7	27,092,211	27,100,107	RGD:6480464	CTD
G	Cyp2a4	cytochrome P450, family 2, subfamily a, polypeptide 4		increases activity	ISO	7	27,092,211	27,100,107	RGD:6480464	CTD
G	Cyp2a4	cytochrome P450, family 2, subfamily a, polypeptide 4		increases expression	ISO	7	27,092,211	27,100,107	RGD:6480464	CTD
G	Cyp2b10	cytochrome P450, family 2, subfamily b, polypeptide 10		multiple interactions	ISO	7	26,682,683	26,711,643	RGD:6480464	CTD
G	Cyp2b10	cytochrome P450, family 2, subfamily b, polypeptide 10		increases expression	ISO	7	26,682,683	26,711,643	RGD:6480464	CTD
G	Cyp2b10	cytochrome P450, family 2, subfamily b, polypeptide 10		increases expression	EXP	7	26,682,683	26,711,643	RGD:6480464	CTD
G	Cyp2b13	cytochrome P450, family 2, subfamily b, polypeptide 13		increases expression	ISO	7	26,846,514	26,881,215	RGD:6480464	CTD
G	Cyp2b13	cytochrome P450, family 2, subfamily b, polypeptide 13		affects expression	ISO	7	26,846,514	26,881,215	RGD:6480464	CTD
G	Cyp2c38	cytochrome P450, family 2, subfamily c, polypeptide 38		affects expression	ISO	19	39,464,046	39,537,565	RGD:6480464	CTD
G	Cyp2c66	cytochrome P450, family 2, subfamily c, polypeptide 66		affects binding	ISO	19	39,188,388	39,261,246	RGD:6480464	CTD
G	Cyp2c66	cytochrome P450, family 2, subfamily c, polypeptide 66		increases expression	ISO	19	39,188,388	39,261,246	RGD:6480464	CTD
G	Cyp2d9	cytochrome P450, family 2, subfamily d, polypeptide 9		increases expression	ISO	15	82,282,807	82,287,257	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases expression	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		decreases expression	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases expression	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp3a11	cytochrome P450, family 3, subfamily a, polypeptide 11		multiple interactions	EXP	5	146,666,183	146,691,430	RGD:6480464	CTD
G	Cyp3a11	cytochrome P450, family 3, subfamily a, polypeptide 11		increases expression	EXP	5	146,666,183	146,691,430	RGD:6480464	CTD
G	Cyp3a13	cytochrome P450, family 3, subfamily a, polypeptide 13		increases expression	EXP	5	138,334,161	138,362,847	RGD:6480464	CTD
G	Cyp3a16	cytochrome P450, family 3, subfamily a, polypeptide 16		increases expression	EXP	5	146,197,178	146,230,592	RGD:6480464	CTD
G	Cyp3a25	cytochrome P450, family 3, subfamily a, polypeptide 25		affects expression	ISO	5	146,788,770	146,821,194	RGD:6480464	CTD
G	Cyp3a25	cytochrome P450, family 3, subfamily a, polypeptide 25		increases expression	ISO	5	146,788,770	146,821,194	RGD:6480464	CTD
G	Cyp3a25	cytochrome P450, family 3, subfamily a, polypeptide 25		increases expression	EXP	5	146,788,770	146,821,194	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		affects expression	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		increases expression	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		affects metabolic processing	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		multiple interactions	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		multiple interactions	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		multiple interactions	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		increases activity	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		increases expression	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		multiple interactions	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		increases expression	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cyp3a44	cytochrome P450, family 3, subfamily a, polypeptide 44		increases expression	EXP	5	146,585,559	146,617,450	RGD:6480464	CTD
G	Cyp4a14	cytochrome P450, family 4, subfamily a, polypeptide 14		increases expression	EXP	4	115,158,805	115,168,746	RGD:6480464	CTD
G	Cyp51	cytochrome P450, family 51		decreases expression	EXP	5	4,080,674	4,104,697	RGD:6480464	CTD
G	Cyp51	cytochrome P450, family 51		affects expression	ISO	5	4,080,674	4,104,697	RGD:6480464	CTD
G	Cyp7a1	cytochrome P450, family 7, subfamily a, polypeptide 1		increases expression	ISO	4	6,192,759	6,202,778	RGD:6480464	CTD
G	D14Abb1e	DNA segment, Chr 14, Abbott 1 expressed		increases expression	EXP	14	28,242,033	28,296,741	RGD:6480464	CTD
G	Dbh	dopamine beta hydroxylase		multiple interactions	ISO	2	27,021,027	27,038,724	RGD:6480464	CTD
G	Dbh	dopamine beta hydroxylase		increases expression	ISO	2	27,021,027	27,038,724	RGD:6480464	CTD
G	Dbh	dopamine beta hydroxylase		multiple interactions	ISO	2	27,021,027	27,038,724	RGD:6480464	CTD
G	Dbh	dopamine beta hydroxylase		decreases expression	ISO	2	27,021,027	27,038,724	RGD:6480464	CTD
G	Dbp	D site albumin promoter binding protein		decreases expression	ISO	7	52,960,617	52,965,573	RGD:6480464	CTD
G	Dbp	D site albumin promoter binding protein		increases expression	ISO	7	52,960,617	52,965,573	RGD:6480464	CTD
G	Dcn	decorin		multiple interactions	EXP	10	96,942,134	96,980,796	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		increases expression	EXP	10	59,412,423	59,414,518	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		multiple interactions	ISO	10	59,412,423	59,414,518	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		increases expression	ISO	10	59,412,423	59,414,518	RGD:6480464	CTD
G	Decr1	2,4-dienoyl CoA reductase 1, mitochondrial		increases expression	ISO	4	15,844,387	15,872,654	RGD:6480464	CTD
G	Degs1	degenerative spermatocyte homolog 1 (Drosophila)		decreases expression	ISO	1	184,205,901	184,212,890	RGD:6480464	CTD
G	Degs1	degenerative spermatocyte homolog 1 (Drosophila)		multiple interactions	ISO	1	184,205,901	184,212,890	RGD:6480464	CTD
G	Dfna5	deafness, autosomal dominant 5 (human)		increases expression	ISO	6	50,157,402	50,211,768	RGD:6480464	CTD
G	Dgat1	diacylglycerol O-acyltransferase 1		multiple interactions	EXP	15	76,332,445	76,342,248	RGD:6480464	CTD
G	Dgat2	diacylglycerol O-acyltransferase 2		increases expression	ISO	7	106,302,173	106,331,223	RGD:6480464	CTD
G	Dgat2	diacylglycerol O-acyltransferase 2		multiple interactions	ISO	7	106,302,173	106,331,223	RGD:6480464	CTD
G	Diablo	diablo homolog (Drosophila)		affects localization	ISO	5	123,961,339	123,974,173	RGD:6480464	CTD
G	Diablo	diablo homolog (Drosophila)		multiple interactions	ISO	5	123,961,339	123,974,173	RGD:6480464	CTD
G	Dio3	deiodinase, iodothyronine type III		decreases activity	ISO	12	111,517,440	111,519,307	RGD:6480464	CTD
G	Dnaja1	DnaJ (Hsp40) homolog, subfamily A, member 1		increases expression	EXP	4	40,669,501	40,684,186	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		multiple interactions	EXP	12	45,306,884	45,311,055	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		increases expression	EXP	12	45,306,884	45,311,055	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		increases expression	ISO	17	26,642,536	26,645,417	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		multiple interactions	EXP	17	26,642,536	26,645,417	RGD:6480464	CTD
G	Dusp28	dual specificity phosphatase 28		increases expression	EXP	1	94,803,566	94,805,197	RGD:6480464	CTD
G	Ednrb	endothelin receptor type B		multiple interactions	ISO	14	104,213,842	104,243,390	RGD:6480464	CTD
G	Eef1a2	eukaryotic translation elongation factor 1 alpha 2		increases expression	ISO	2	180,882,397	180,891,720	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	3	129,380,493	129,458,240	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	11	16,652,206	16,813,910	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	11	16,652,206	16,813,910	RGD:6480464	CTD
G	Egr1	early growth response 1		multiple interactions	ISO	18	35,020,861	35,024,610	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		increases expression	ISO	8	28,370,799	28,386,128	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	ISO	8	28,370,799	28,386,128	RGD:6480464	CTD
G	Eif4g3	eukaryotic translation initiation factor 4 gamma, 3		increases expression	ISO	4	137,549,385	137,762,398	RGD:6480464	CTD
G	Eif4g3	eukaryotic translation initiation factor 4 gamma, 3		multiple interactions	ISO	4	137,549,385	137,762,398	RGD:6480464	CTD
G	Elovl3	elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3		multiple interactions	EXP	19	46,206,389	46,210,184	RGD:6480464	CTD
G	Elovl6	ELOVL family member 6, elongation of long chain fatty acids (yeast)		multiple interactions	EXP	3	129,235,304	129,341,413	RGD:6480464	CTD
G	Emb	embigin		multiple interactions	EXP	13	118,009,380	118,063,222	RGD:6480464	CTD
G	Emp1	epithelial membrane protein 1		multiple interactions	EXP	6	135,312,949	135,333,191	RGD:6480464	CTD
G	Emp2	epithelial membrane protein 2		multiple interactions	ISO	16	10,281,842	10,314,061	RGD:6480464	CTD
G	Endod1	endonuclease domain containing 1		decreases expression	ISO	9	14,158,434	14,185,686	RGD:6480464	CTD
G	Enpp2	ectonucleotide pyrophosphatase/phosphodiesterase 2		multiple interactions	EXP	15	54,670,453	54,751,701	RGD:6480464	CTD
G	Ep300	E1A binding protein p300		multiple interactions	ISO	15	81,416,644	81,482,507	RGD:6480464	CTD
G	Epha7	Eph receptor A7		multiple interactions	ISO	4	28,740,295	28,894,649	RGD:6480464	CTD
G	Epha7	Eph receptor A7		decreases expression	ISO	4	28,740,295	28,894,649	RGD:6480464	CTD
G	Ephx2	epoxide hydrolase 2, cytoplasmic		multiple interactions	EXP	14	66,703,214	66,743,337	RGD:6480464	CTD
G	Ephx2	epoxide hydrolase 2, cytoplasmic		increases expression	ISO	14	66,703,214	66,743,337	RGD:6480464	CTD
G	Ereg	epiregulin		increases expression	ISO	5	91,503,643	91,522,675	RGD:6480464	CTD
G	Erp29	endoplasmic reticulum protein 29		decreases expression	ISO	5	121,894,762	121,902,483	RGD:6480464	CTD
G	Errfi1	ERBB receptor feedback inhibitor 1		increases expression	ISO	4	150,229,200	150,242,989	RGD:6480464	CTD
G	Espl1	extra spindle poles-like 1 (S. cerevisiae)		multiple interactions	ISO	15	102,126,724	102,154,787	RGD:6480464	CTD
G	Espl1	extra spindle poles-like 1 (S. cerevisiae)		decreases expression	ISO	15	102,126,724	102,154,787	RGD:6480464	CTD
G	Esr1	estrogen receptor 1 (alpha)		decreases expression	ISO	10	5,342,780	5,734,495	RGD:6480464	CTD
G	Ets1	E26 avian leukemia oncogene 1, 5' domain		decreases expression	ISO	9	32,503,627	32,565,405	RGD:6480464	CTD
G	Ets2	E26 avian leukemia oncogene 2, 3' domain		increases expression	ISO	16	95,924,014	95,942,656	RGD:6480464	CTD
G	Evl	Ena-vasodilator stimulated phosphoprotein		multiple interactions	ISO	12	109,792,930	109,926,726	RGD:6480464	CTD
G	Evl	Ena-vasodilator stimulated phosphoprotein		decreases expression	ISO	12	109,792,930	109,926,726	RGD:6480464	CTD
G	Exoc2	exocyst complex component 2		decreases expression	ISO	13	30,905,787	31,065,916	RGD:6480464	CTD
G	F2	coagulation factor II		multiple interactions	ISO	2	91,465,477	91,476,571	RGD:6480464	CTD
G	F2	coagulation factor II		multiple interactions	ISO	2	91,465,477	91,476,571	RGD:6480464	CTD
G	F2	coagulation factor II		affects expression	ISO	2	91,465,477	91,476,571	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		increases expression	ISO	13	96,371,744	96,388,388	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		affects expression	ISO	13	96,371,744	96,388,388	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		increases expression	ISO	13	96,371,744	96,388,388	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		multiple interactions	ISO	13	96,371,744	96,388,388	RGD:6480464	CTD
G	F3	coagulation factor III		multiple interactions	ISO	3	121,426,455	121,437,970	RGD:6480464	CTD
G	F3	coagulation factor III		multiple interactions	EXP	3	121,426,455	121,437,970	RGD:6480464	CTD
G	F3	coagulation factor III		multiple interactions	ISO	3	121,426,455	121,437,970	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		decreases expression	ISO	6	71,149,882	71,155,017	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	3	10,204,342	10,208,576	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	3	10,204,342	10,208,576	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	3	10,204,342	10,208,576	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	3	10,204,342	10,208,576	RGD:6480464	CTD
G	Fads1	fatty acid desaturase 1		decreases expression	ISO	19	10,257,378	10,271,364	RGD:6480464	CTD
G	Fah	fumarylacetoacetate hydrolase		increases expression	ISO	7	91,733,669	91,754,452	RGD:6480464	CTD
G	Fah	fumarylacetoacetate hydrolase		multiple interactions	ISO	7	91,733,669	91,754,452	RGD:6480464	CTD
G	Fam216a	family with sequence similarity 216, member A		decreases expression	ISO	5	122,814,593	122,821,972	RGD:6480464	CTD
G	Fam65b	family with sequence similarity 65, member B		increases expression	ISO	13	24,706,479	24,825,675	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily member 6)		increases expression	ISO	19	34,365,149	34,402,260	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily member 6)		multiple interactions	ISO	19	34,365,149	34,402,260	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily member 6)		multiple interactions	EXP	19	34,365,149	34,402,260	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily member 6)		decreases expression	ISO	19	34,365,149	34,402,260	RGD:6480464	CTD
G	Fasl	Fas ligand (TNF superfamily, member 6)		decreases expression	ISO	1	163,710,820	163,718,626	RGD:6480464	CTD
G	Fasl	Fas ligand (TNF superfamily, member 6)		decreases secretion	ISO	1	163,710,820	163,718,626	RGD:6480464	CTD
G	Fasl	Fas ligand (TNF superfamily, member 6)		decreases expression	ISO	1	163,710,820	163,718,626	RGD:6480464	CTD
G	Fbn2	fibrillin 2		multiple interactions	EXP	18	58,168,277	58,369,580	RGD:6480464	CTD
G	Fbp2	fructose bisphosphatase 2		decreases expression	ISO	13	62,938,245	62,959,730	RGD:6480464	CTD
G	Fbp2	fructose bisphosphatase 2		multiple interactions	ISO	13	62,938,245	62,959,730	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		multiple interactions	EXP	15	58,011,634	58,046,433	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		increases expression	EXP	15	58,011,634	58,046,433	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		increases expression	ISO	15	58,011,634	58,046,433	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		multiple interactions	ISO	15	58,011,634	58,046,433	RGD:6480464	CTD
G	Fdft1	farnesyl diphosphate farnesyl transferase 1		increases expression	ISO	14	63,763,987	63,796,630	RGD:6480464	CTD
G	Fdps	farnesyl diphosphate synthetase		multiple interactions	EXP	3	88,897,510	88,905,867	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		multiple interactions	EXP	9	51,751,412	51,771,638	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		decreases expression	ISO	9	51,751,412	51,771,638	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		multiple interactions	ISO	9	51,751,412	51,771,638	RGD:6480464	CTD
G	Fgb	fibrinogen beta chain		decreases expression	ISO	3	82,846,225	82,853,712	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		multiple interactions	ISO	3	37,247,575	37,303,752	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		multiple interactions	EXP	2	125,860,394	125,916,921	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		multiple interactions	EXP	7	137,305,965	137,410,322	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		decreases expression	ISO	7	137,305,965	137,410,322	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		multiple interactions	ISO	7	137,305,965	137,410,322	RGD:6480464	CTD
G	Fgfr3	fibroblast growth factor receptor 3		decreases response to substance	EXP	5	34,064,373	34,079,713	RGD:6480464	CTD
G	Fhl1	four and a half LIM domains 1		increases expression	ISO	X	53,984,964	54,046,523	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		multiple interactions	EXP	X	160,811,480	160,840,579	RGD:6480464	CTD
G	Fkbp4	FK506 binding protein 4		increases expression	EXP	6	128,380,125	128,388,649	RGD:6480464	CTD
G	Fkbp4	FK506 binding protein 4		multiple interactions	EXP	6	128,380,125	128,388,649	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	EXP	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	17	28,536,040	28,578,001	RGD:6480464	CTD
G	Flot1	flotillin 1		multiple interactions	ISO	17	35,960,302	35,969,732	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		affects expression	ISO	1	164,759,692	164,796,679	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		multiple interactions	EXP	1	164,759,692	164,796,679	RGD:6480464	CTD
G	Fmo3	flavin containing monooxygenase 3		multiple interactions	EXP	1	164,883,931	164,914,622	RGD:6480464	CTD
G	Fn1	fibronectin 1		multiple interactions	ISO	1	71,632,097	71,699,745	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	ISO	1	71,632,097	71,699,745	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	12	86,814,851	86,818,219	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	12	86,814,851	86,818,219	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		decreases expression	ISO	12	86,814,851	86,818,219	RGD:6480464	CTD
G	Fosl2	fos-like antigen 2		increases expression	EXP	5	32,438,845	32,460,213	RGD:6480464	CTD
G	Foxg1	forkhead box G1		decreases expression	ISO	12	50,483,870	50,487,854	RGD:6480464	CTD
G	Foxg1	forkhead box G1		multiple interactions	ISO	12	50,483,870	50,487,854	RGD:6480464	CTD
G	Foxo1	forkhead box O1		increases expression	ISO	3	52,072,259	52,154,031	RGD:6480464	CTD
G	Foxo1	forkhead box O1		increases expression	ISO	3	52,072,259	52,154,031	RGD:6480464	CTD
G	Foxo1	forkhead box O1		multiple interactions	ISO	3	52,072,259	52,154,031	RGD:6480464	CTD
G	Foxq1	forkhead box Q1		multiple interactions	ISO	13	31,650,039	31,652,845	RGD:6480464	CTD
G	Fpr1	formyl peptide receptor 1		increases expression	ISO	17	18,013,435	18,020,903	RGD:6480464	CTD
G	Fpr1	formyl peptide receptor 1		multiple interactions	ISO	17	18,013,435	18,020,903	RGD:6480464	CTD
G	Fscn1	fascin homolog 1, actin bundling protein (Strongylocentrotus purpuratus)		multiple interactions	EXP	5	143,722,034	143,734,868	RGD:6480464	CTD
G	Gys1	glycogen synthase 1, muscle		affects phosphorylation	ISO	7	52,690,209	52,711,987	RGD:6480464	CTD
G	H2-Aa	histocompatibility 2, class II antigen A, alpha		increases expression	ISO	17	34,419,696	34,424,716	RGD:6480464	CTD
G	H2-Ab1	histocompatibility 2, class II antigen A, beta 1		affects expression	ISO	17	34,400,172	34,406,363	RGD:6480464	CTD
G	H2-DMb1	histocompatibility 2, class II, locus Mb1		decreases expression	ISO	17	34,290,136	34,297,174	RGD:6480464	CTD
G	H2-Ea-ps	histocompatibility 2, class II antigen E alpha, pseudogene		increases expression	ISO	17	34,478,902	34,484,492	RGD:6480464	CTD
G	Hao1	hydroxyacid oxidase 1, liver		multiple interactions	ISO	2	134,323,097	134,380,088	RGD:6480464	CTD
G	Has2	hyaluronan synthase 2		decreases expression	ISO	15	56,497,182	56,526,101	RGD:6480464	CTD
G	Hbegf	heparin-binding EGF-like growth factor		decreases expression	ISO	18	36,664,581	36,675,459	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		multiple interactions	ISO	4	129,193,348	129,219,890	RGD:6480464	CTD
G	Hdac4	histone deacetylase 4		increases expression	ISO	1	93,829,311	94,044,970	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	ISO	2	126,419,404	126,444,401	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	ISO	2	126,419,404	126,444,401	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		decreases activity	ISO	2	126,419,404	126,444,401	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		decreases expression	ISO	2	126,419,404	126,444,401	RGD:6480464	CTD
G	Hes1	hairy and enhancer of split 1 (Drosophila)		decreases expression	ISO	16	30,065,443	30,067,882	RGD:6480464	CTD
G	Hibadh	3-hydroxyisobutyrate dehydrogenase		increases expression	ISO	6	52,496,224	52,590,294	RGD:6480464	CTD
G	Hist4h4	histone cluster 4, H4		increases acetylation	ISO	6	136,752,589	136,752,900	RGD:6480464	CTD
G	Hist4h4	histone cluster 4, H4		multiple interactions	ISO	6	136,752,589	136,752,900	RGD:6480464	CTD
G	Hk2	hexokinase 2		multiple interactions	EXP	6	82,675,019	82,724,448	RGD:6480464	CTD
G	Hk2	hexokinase 2		decreases expression	ISO	6	82,675,019	82,724,448	RGD:6480464	CTD
G	Hmgb2	high mobility group box 2		decreases expression	ISO	8	59,990,640	59,994,796	RGD:6480464	CTD
G	Hmgcr	3-hydroxy-3-methylglutaryl-Coenzyme A reductase		multiple interactions	EXP	13	97,418,917	97,440,891	RGD:6480464	CTD
G	Hmgcr	3-hydroxy-3-methylglutaryl-Coenzyme A reductase		increases expression	ISO	13	97,418,917	97,440,891	RGD:6480464	CTD
G	Hmgcs1	3-hydroxy-3-methylglutaryl-Coenzyme A synthase 1		decreases expression	ISO				RGD:6480464	CTD
G	Il10rb	interleukin 10 receptor, beta		multiple interactions	EXP	16	91,406,480	91,426,079	RGD:6480464	CTD
G	Il12b	interleukin 12b		multiple interactions	EXP	11	44,213,565	44,227,519	RGD:6480464	CTD
G	Il12b	interleukin 12b		multiple interactions	ISO	11	44,213,565	44,227,519	RGD:6480464	CTD
G	Il12rb1	interleukin 12 receptor, beta 1		decreases expression	ISO	8	73,332,348	73,345,323	RGD:6480464	CTD
G	Il12rb2	interleukin 12 receptor, beta 2		decreases expression	ISO	6	67,242,012	67,326,131	RGD:6480464	CTD
G	Il13	interleukin 13		multiple interactions	ISO	11	53,444,825	53,448,204	RGD:6480464	CTD
G	Il13	interleukin 13		decreases expression	EXP	11	53,444,825	53,448,204	RGD:6480464	CTD
G	Il15	interleukin 15		increases expression	ISO	8	84,855,523	84,926,444	RGD:6480464	CTD
G	Il15	interleukin 15		decreases expression	ISO	8	84,855,523	84,926,444	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	EXP	2	129,125,346	129,135,708	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Ins2	insulin II		multiple interactions	EXP	7	149,864,561	149,865,613	RGD:6480464	CTD
G	Insr	insulin receptor		multiple interactions	EXP	8	3,150,922	3,279,617	RGD:6480464	CTD
G	Irs1	insulin receptor substrate 1		multiple interactions	EXP	1	82,229,680	82,288,014	RGD:6480464	CTD
G	Itgam	integrin alpha M		multiple interactions	ISO	7	135,206,154	135,262,005	RGD:6480464	CTD
G	Itsn1	intersectin 1 (SH3 domain protein 1A)		decreases expression	ISO	16	91,729,616	91,920,824	RGD:6480464	CTD
G	Itsn1	intersectin 1 (SH3 domain protein 1A)		multiple interactions	ISO	16	91,729,616	91,920,824	RGD:6480464	CTD
G	Jag1	jagged 1		multiple interactions	ISO	2	136,907,194	136,942,067	RGD:6480464	CTD
G	Jam3	junction adhesion molecule 3		increases expression	ISO	9	26,904,969	26,962,965	RGD:6480464	CTD
G	Jun	Jun oncogene		decreases expression	ISO	4	94,715,727	94,718,913	RGD:6480464	CTD
G	Kcna2	potassium voltage-gated channel, shaker-related subfamily, member 2		multiple interactions	ISO	3	106,904,485	106,909,797	RGD:6480464	CTD
G	Kcna5	potassium voltage-gated channel, shaker-related subfamily, member 5		increases expression	ISO	6	126,482,569	126,485,573	RGD:6480464	CTD
G	Kcna5	potassium voltage-gated channel, shaker-related subfamily, member 5		multiple interactions	ISO	6	126,482,569	126,485,573	RGD:6480464	CTD
G	Kcnab1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		decreases expression	ISO	3	64,913,565	65,182,141	RGD:6480464	CTD
G	Kcnab1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		multiple interactions	ISO	3	64,913,565	65,182,141	RGD:6480464	CTD
G	Kcnb1	potassium voltage gated channel, Shab-related subfamily, member 1		multiple interactions	ISO	2	166,928,878	167,014,299	RGD:6480464	CTD
G	Kcnk1	potassium channel, subfamily K, member 1		increases expression	EXP	8	128,519,002	128,554,585	RGD:6480464	CTD
G	Kcnma1	potassium large conductance calcium-activated channel, subfamily M, alpha member 1		multiple interactions	ISO	14	24,117,983	24,823,427	RGD:6480464	CTD
G	Kcnn4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		decreases expression	ISO	7	25,155,282	25,170,231	RGD:6480464	CTD
G	Kcnn4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		multiple interactions	ISO	7	25,155,282	25,170,231	RGD:6480464	CTD
G	Kctd12	potassium channel tetramerisation domain containing 12		multiple interactions	ISO	14	103,375,798	103,381,854	RGD:6480464	CTD
G	Kif1a	kinesin family member 1A		multiple interactions	ISO	1	94,912,033	94,998,442	RGD:6480464	CTD
G	Kif1a	kinesin family member 1A		decreases expression	ISO	1	94,912,033	94,998,442	RGD:6480464	CTD
G	Kit	kit oncogene		decreases expression	EXP	5	75,971,012	76,052,747	RGD:6480464	CTD
G	Kitl	kit ligand		multiple interactions	EXP	10	99,478,458	99,563,046	RGD:6480464	CTD
G	Klf4	Kruppel-like factor 4 (gut)		multiple interactions	EXP	4	55,540,009	55,545,347	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	14	34,191,084	34,260,344	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	14	34,191,084	34,260,344	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	14	34,191,084	34,260,344	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		affects phosphorylation	ISO	14	34,191,084	34,260,344	RGD:6480464	CTD
G	Marcks	myristoylated alanine rich protein kinase C substrate		multiple interactions	EXP	10	36,853,049	36,858,732	RGD:6480464	CTD
G	Mbl2	mannose-binding lectin (protein C) 2		decreases expression	ISO	19	30,307,447	30,314,172	RGD:6480464	CTD
G	Mbl2	mannose-binding lectin (protein C) 2		multiple interactions	ISO	19	30,307,447	30,314,172	RGD:6480464	CTD
G	Mbnl1	muscleblind-like 1 (Drosophila)		increases expression	ISO	3	60,305,174	60,433,670	RGD:6480464	CTD
G	Mbnl1	muscleblind-like 1 (Drosophila)		multiple interactions	ISO	3	60,305,174	60,433,670	RGD:6480464	CTD
G	Mc5r	melanocortin 5 receptor		increases expression	ISO	18	68,497,257	68,499,365	RGD:6480464	CTD
G	Mc5r	melanocortin 5 receptor		multiple interactions	ISO	18	68,497,257	68,499,365	RGD:6480464	CTD
G	Mcam	melanoma cell adhesion molecule		decreases expression	ISO	9	43,942,741	43,950,809	RGD:6480464	CTD
G	Mcam	melanoma cell adhesion molecule		multiple interactions	ISO	9	43,942,741	43,950,809	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		increases expression	ISO	3	95,462,643	95,467,102	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		multiple interactions	ISO	3	95,462,643	95,467,102	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		increases expression	ISO	3	95,462,643	95,467,102	RGD:6480464	CTD
G	Mcoln2	mucolipin 2		decreases expression	ISO	3	145,812,797	145,858,476	RGD:6480464	CTD
G	Mcoln2	mucolipin 2		multiple interactions	ISO	3	145,812,797	145,858,476	RGD:6480464	CTD
G	Me1	malic enzyme 1, NADP(+)-dependent, cytosolic		multiple interactions	ISO	9	86,474,970	86,589,947	RGD:6480464	CTD
G	Me1	malic enzyme 1, NADP(+)-dependent, cytosolic		decreases expression	ISO	9	86,474,970	86,589,947	RGD:6480464	CTD
G	Med1	mediator complex subunit 1		affects response to substance	EXP	11	98,013,468	98,054,607	RGD:6480464	CTD
G	Mettl7a1	methyltransferase like 7A1		increases expression	ISO	15	100,135,248	100,144,779	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	EXP	2	164,773,751	164,781,346	RGD:6480464	CTD
G	Mt1	metallothionein 1		multiple interactions	ISO	8	96,702,989	96,704,227	RGD:6480464	CTD
G	Mt1	metallothionein 1		increases expression	ISO	8	96,702,989	96,704,227	RGD:6480464	CTD
G	Mt1	metallothionein 1		multiple interactions	ISO	8	96,702,989	96,704,227	RGD:6480464	CTD
G	Nelfa	negative elongation factor complex member A, Whsc2		increases expression	ISO	5	34,240,828	34,278,907	RGD:6480464	CTD
G	Noc2l	nucleolar complex associated 2 homolog (S. cerevisiae)		decreases expression	ISO				RGD:6480464	CTD
G	Noc3l	nucleolar complex associated 3 homolog (S. cerevisiae)		increases expression	EXP	19	38,862,618	38,893,727	RGD:6480464	CTD
G	Nol3	nucleolar protein 3 (apoptosis repressor with CARD domain)		multiple interactions	ISO	8	107,800,347	107,805,839	RGD:6480464	CTD
G	Nol3	nucleolar protein 3 (apoptosis repressor with CARD domain)		increases expression	ISO	8	107,800,347	107,805,839	RGD:6480464	CTD
G	Nop16	NOP16 nucleolar protein		decreases expression	ISO	13	54,685,552	54,691,435	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		decreases expression	EXP	5	118,317,128	118,403,822	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		multiple interactions	EXP	5	118,317,128	118,403,822	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	EXP	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		affects expression	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		affects response to substance	EXP	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		affects localization	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases expression	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases activity	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases expression	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	39,570,199	39,646,899	RGD:6480464	CTD
G	Nr3c2	nuclear receptor subfamily 3, group C, member 2		increases expression	ISO	8	79,426,407	79,767,538	RGD:6480464	CTD
G	Nr4a1	nuclear receptor subfamily 4, group A, member 1		multiple interactions	EXP	15	101,097,277	101,105,226	RGD:6480464	CTD
G	Nr4a1	nuclear receptor subfamily 4, group A, member 1		affects localization	ISO	15	101,097,277	101,105,226	RGD:6480464	CTD
G	Nr6a1	nuclear receptor subfamily 6, group A, member 1		increases expression	ISO	2	38,578,894	38,781,981	RGD:6480464	CTD
G	Nrxn2	neurexin II		multiple interactions	ISO	19	6,428,016	6,533,217	RGD:6480464	CTD
G	Nrxn2	neurexin II		increases expression	ISO	19	6,428,016	6,533,217	RGD:6480464	CTD
G	Nudt21	nudix (nucleoside diphosphate linked moiety X)-type motif 21		increases expression	EXP	8	96,543,303	96,560,939	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase, structural 1		decreases expression	ISO	12	17,551,679	17,558,308	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase, structural 1		increases expression	ISO	12	17,551,679	17,558,308	RGD:6480464	CTD
G	Ogn	osteoglycin		multiple interactions	EXP	13	49,703,440	49,719,869	RGD:6480464	CTD
G	Olfm4	olfactomedin 4		increases expression	ISO	14	80,400,109	80,421,737	RGD:6480464	CTD
G	Omd	osteomodulin		multiple interactions	EXP	13	49,678,116	49,687,978	RGD:6480464	CTD
G	Onecut1	one cut domain, family member 1		increases expression	ISO	9	74,709,728	74,737,455	RGD:6480464	CTD
G	Orm1	orosomucoid 1		multiple interactions	EXP	4	63,005,600	63,009,196	RGD:6480464	CTD
G	Orm2	orosomucoid 2		multiple interactions	EXP	4	63,023,483	63,026,911	RGD:6480464	CTD
G	Orm3	orosomucoid 3		multiple interactions	EXP	4	63,017,196	63,020,545	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase family, member 1		multiple interactions	ISO	1	182,499,106	182,531,385	RGD:6480464	CTD
G	Pou5f1	POU domain, class 5, transcription factor 1		multiple interactions	ISO	17	35,642,984	35,647,722	RGD:6480464	CTD
G	Ppard	peroxisome proliferator activator receptor delta		increases expression	ISO	17	28,369,699	28,438,414	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	ISO	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		decreases expression	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	EXP	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	ISO	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		increases expression	ISO	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		multiple interactions	ISO	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferative activated receptor, gamma, coactivator 1 alpha		increases expression	ISO	5	51,845,488	51,945,160	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferative activated receptor, gamma, coactivator 1 alpha		decreases expression	ISO	5	51,845,488	51,945,160	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferative activated receptor, gamma, coactivator 1 alpha		multiple interactions	ISO	5	51,845,488	51,945,160	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferative activated receptor, gamma, coactivator 1 alpha		increases expression	ISO	5	51,845,488	51,945,160	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferative activated receptor, gamma, coactivator 1 alpha		multiple interactions	ISO	5	51,845,488	51,945,160	RGD:6480464	CTD
G	Ppat	phosphoribosyl pyrophosphate amidotransferase		decreases expression	ISO	5	77,342,274	77,380,603	RGD:6480464	CTD
G	Ppib	peptidylprolyl isomerase B		increases expression	ISO	9	65,907,976	65,914,436	RGD:6480464	CTD
G	Ppib	peptidylprolyl isomerase B		multiple interactions	ISO	9	65,907,976	65,914,436	RGD:6480464	CTD
G	Ppp2r5a	protein phosphatase 2, regulatory subunit B (B56), alpha isoform		decreases expression	EXP	1	193,175,860	193,220,920	RGD:6480464	CTD
G	Ppp3cb	protein phosphatase 3, catalytic subunit, beta isoform		decreases expression	ISO	14	21,318,536	21,365,795	RGD:6480464	CTD
G	Prim2	DNA primase, p58 subunit		decreases expression	ISO	1	33,510,656	33,726,603	RGD:6480464	CTD
G	Prim2	DNA primase, p58 subunit		multiple interactions	ISO	1	33,510,656	33,726,603	RGD:6480464	CTD
G	Prkacb	protein kinase, cAMP dependent, catalytic, beta		decreases phosphorylation	ISO	3	146,392,543	146,475,910	RGD:6480464	CTD
G	Prkacb	protein kinase, cAMP dependent, catalytic, beta		multiple interactions	ISO	3	146,392,543	146,475,910	RGD:6480464	CTD
G	Rora	RAR-related orphan receptor alpha		multiple interactions	EXP	9	68,501,609	69,226,838	RGD:6480464	CTD
G	Rora	RAR-related orphan receptor alpha		increases expression	ISO	9	68,501,609	69,226,838	RGD:6480464	CTD
G	Rxra	retinoid X receptor alpha		increases expression	ISO	2	27,532,721	27,618,839	RGD:6480464	CTD
G	S100a8	S100 calcium binding protein A8 (calgranulin A)		increases expression	ISO	3	90,472,993	90,473,956	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9 (calgranulin B)		increases expression	ISO	3	90,496,555	90,499,613	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9 (calgranulin B)		decreases expression	ISO	3	90,496,555	90,499,613	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9 (calgranulin B)		increases expression	ISO	3	90,496,555	90,499,613	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9 (calgranulin B)		multiple interactions	ISO	3	90,496,555	90,499,613	RGD:6480464	CTD
G	Scarb1	scavenger receptor class B, member 1		decreases expression	ISO	5	125,757,460	125,821,444	RGD:6480464	CTD
G	Scd1	stearoyl-Coenzyme A desaturase 1		multiple interactions	EXP	19	44,468,940	44,482,199	RGD:6480464	CTD
G	Scd1	stearoyl-Coenzyme A desaturase 1		decreases expression	ISO	19	44,468,940	44,482,199	RGD:6480464	CTD
G	Scd2	stearoyl-Coenzyme A desaturase 2		decreases expression	ISO	19	44,368,166	44,381,354	RGD:6480464	CTD
G	Scd2	stearoyl-Coenzyme A desaturase 2		affects expression	ISO	19	44,368,166	44,381,354	RGD:6480464	CTD
G	Scel	sciellin		increases expression	ISO	14	103,912,558	104,012,563	RGD:6480464	CTD
G	Scn8a	sodium channel, voltage-gated, type VIII, alpha		decreases expression	ISO	15	100,701,114	100,876,360	RGD:6480464	CTD
G	Scn8a	sodium channel, voltage-gated, type VIII, alpha		multiple interactions	ISO	15	100,701,114	100,876,360	RGD:6480464	CTD
G	Scnn1a	sodium channel, nonvoltage-gated 1 alpha		increases expression	EXP	6	125,271,358	125,294,961	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1 beta		multiple interactions	ISO	7	129,008,625	129,062,030	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1 beta		increases expression	ISO	7	129,008,625	129,062,030	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1 beta		increases expression	EXP	7	129,008,625	129,062,030	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1 beta		increases expression	ISO	7	129,008,625	129,062,030	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1 gamma		multiple interactions	ISO	7	128,878,021	128,911,991	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1 gamma		increases expression	ISO	7	128,878,021	128,911,991	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1 gamma		increases expression	ISO	7	128,878,021	128,911,991	RGD:6480464	CTD
G	Sdc1	syndecan 1		decreases expression	ISO	12	8,778,202	8,800,494	RGD:6480464	CTD
G	Sdc2	syndecan 2		multiple interactions	EXP	15	32,850,478	32,964,476	RGD:6480464	CTD
G	Sdc4	syndecan 4		increases expression	ISO	2	164,249,747	164,268,688	RGD:6480464	CTD
G	Sdc4	syndecan 4		multiple interactions	ISO	2	164,249,747	164,268,688	RGD:6480464	CTD
G	Sdcbp	syndecan binding protein		increases expression	ISO	4	6,292,827	6,323,269	RGD:6480464	CTD
G	Sephs2	selenophosphate synthetase 2		increases expression	ISO	7	134,415,393	134,417,573	RGD:6480464	CTD
G	Sephs2	selenophosphate synthetase 2		multiple interactions	ISO	7	134,415,393	134,417,573	RGD:6480464	CTD
G	Sepp1	selenoprotein P, plasma, 1		increases expression	ISO	15	3,220,767	3,230,508	RGD:6480464	CTD
G	Sepp1	selenoprotein P, plasma, 1		increases secretion	ISO	15	3,220,767	3,230,508	RGD:6480464	CTD
G	Sepp1	selenoprotein P, plasma, 1		multiple interactions	ISO	15	3,220,767	3,230,508	RGD:6480464	CTD
G	Sirt1	sirtuin 1 (silent mating type information regulation 2, homolog) 1 (S. cerevisiae)		increases expression	ISO	10	62,781,753	62,801,783	RGD:6480464	CTD
G	Sirt1	sirtuin 1 (silent mating type information regulation 2, homolog) 1 (S. cerevisiae)		multiple interactions	ISO	10	62,781,753	62,801,783	RGD:6480464	CTD
G	Slc6a4	solute carrier family 6 (neurotransmitter transporter, serotonin), member 4		increases expression	ISO	11	76,812,099	76,845,845	RGD:6480464	CTD
G	Slc7a6	solute carrier family 7 (cationic amino acid transporter, y+ system), member 6		multiple interactions	ISO	8	108,692,775	108,722,604	RGD:6480464	CTD
G	Slc9a3	solute carrier family 9 (sodium/hydrogen exchanger), member 3		increases expression	ISO	13	74,258,963	74,303,512	RGD:6480464	CTD
G	Slc9a3	solute carrier family 9 (sodium/hydrogen exchanger), member 3		increases expression	ISO	13	74,258,963	74,303,512	RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		decreases expression	EXP	6	141,855,802	141,895,483	RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		multiple interactions	ISO	6	141,855,802	141,895,483	RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		decreases expression	ISO	6	141,855,802	141,895,483	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		multiple interactions	ISO	6	141,753,961	141,804,692	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		affects expression	ISO	6	141,753,961	141,804,692	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		increases expression	ISO	6	141,753,961	141,804,692	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		increases expression	ISO	6	141,753,961	141,804,692	RGD:6480464	CTD
G	Slco1b2	solute carrier organic anion transporter family, member 1b2		decreases expression	EXP	6	141,578,039	141,635,156	RGD:6480464	CTD
G	Slco1b2	solute carrier organic anion transporter family, member 1b2		decreases expression	ISO	6	141,578,039	141,635,156	RGD:6480464	CTD
G	Slco1b2	solute carrier organic anion transporter family, member 1b2		multiple interactions	ISO	6	141,578,039	141,635,156	RGD:6480464	CTD
G	Slco2a1	solute carrier organic anion transporter family, member 2a1		decreases expression	EXP	9	102,910,819	102,990,179	RGD:6480464	CTD
G	Slco2b1	solute carrier organic anion transporter family, member 2b1		decreases expression	EXP	7	106,806,314	106,859,850	RGD:6480464	CTD
G	Slco4c1	solute carrier organic anion transporter family, member 4C1		multiple interactions	ISO	1	98,715,361	98,768,748	RGD:6480464	CTD
G	Slpi	secretory leukocyte peptidase inhibitor		multiple interactions	EXP	2	164,179,806	164,182,243	RGD:6480464	CTD
G	Smad3	SMAD family member 3		affects expression	EXP	9	63,494,574	63,605,801	RGD:6480464	CTD
G	Smoc2	SPARC related modular calcium binding 2		decreases expression	ISO	17	14,416,513	14,541,797	RGD:6480464	CTD
G	Smoc2	SPARC related modular calcium binding 2		multiple interactions	ISO	17	14,416,513	14,541,797	RGD:6480464	CTD
G	Socs1	suppressor of cytokine signaling 1		increases expression	ISO	16	10,783,901	10,785,629	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	16	90,220,987	90,226,569	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	16	90,220,987	90,226,569	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	EXP	17	13,200,705	13,210,985	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	17	13,200,705	13,210,985	RGD:6480464	CTD
G	Sod3	superoxide dismutase 3, extracellular		multiple interactions	EXP	5	52,755,043	52,760,977	RGD:6480464	CTD
G	Sost	sclerostin		multiple interactions	ISO	11	101,823,772	101,828,329	RGD:6480464	CTD
G	Sox11	SRY-box containing gene 11		decreases expression	ISO	12	28,019,133	28,027,583	RGD:6480464	CTD
G	Sox2	SRY-box containing gene 2		multiple interactions	ISO	3	34,548,927	34,551,383	RGD:6480464	CTD
G	Sox9	SRY-box containing gene 9		multiple interactions	ISO	11	112,643,524	112,649,071	RGD:6480464	CTD
G	Tjap1	tight junction associated protein 1		decreases expression	ISO	17	46,394,825	46,419,962	RGD:6480464	CTD
G	Tjap1	tight junction associated protein 1		multiple interactions	ISO	17	46,394,825	46,419,962	RGD:6480464	CTD
G	Tle4	transducin-like enhancer of split 4, homolog of Drosophila E(spl)		decreases expression	ISO	19	14,522,562	14,672,473	RGD:6480464	CTD
G	Tlr3	toll-like receptor 3		decreases expression	ISO	8	46,481,019	46,495,893	RGD:6480464	CTD
G	Tmc5	transmembrane channel-like gene family 5		multiple interactions	ISO	7	125,740,811	125,818,599	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases activity	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Ugt2a1	UDP glucuronosyltransferase 2 family, polypeptide A1		affects expression	ISO	5	87,888,515	87,919,896	RGD:6480464	CTD
G	Ugt2b1	UDP glucuronosyltransferase 2 family, polypeptide B1		affects expression	ISO	5	87,345,664	87,355,528	RGD:6480464	CTD
G	Ugt2b1	UDP glucuronosyltransferase 2 family, polypeptide B1		increases expression	ISO	5	87,345,664	87,355,528	RGD:6480464	CTD
G	Usp3	ubiquitin specific peptidase 3		increases expression	ISO	9	66,365,688	66,440,787	RGD:6480464	CTD
G	Vangl1	vang-like 1 (van gogh, Drosophila)		decreases expression	ISO	3	101,960,618	102,008,616	RGD:6480464	CTD
G	Vangl1	vang-like 1 (van gogh, Drosophila)		multiple interactions	ISO	3	101,960,618	102,008,616	RGD:6480464	CTD
G	Vasp	vasodilator-stimulated phosphoprotein		decreases expression	ISO	7	19,842,278	19,857,203	RGD:6480464	CTD
G	Vasp	vasodilator-stimulated phosphoprotein		multiple interactions	ISO	7	19,842,278	19,857,203	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	3	115,812,938	115,832,606	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		decreases expression	ISO	3	115,812,938	115,832,606	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	EXP	3	115,812,938	115,832,606	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	3	115,812,938	115,832,606	RGD:6480464	CTD
G	Vcan	versican		multiple interactions	EXP	13	89,794,915	89,882,117	RGD:6480464	CTD
G	Vdr	vitamin D receptor		increases expression	EXP	15	97,684,858	97,738,727	RGD:6480464	CTD
G	Vdr	vitamin D receptor		multiple interactions	EXP	15	97,684,858	97,738,727	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	17	46,153,942	46,169,326	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases secretion	ISO	17	46,153,942	46,169,326	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	17	46,153,942	46,169,326	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	ISO	17	46,153,942	46,169,326	RGD:6480464	CTD
G	Wfdc1	WAP four-disulfide core domain 1		decreases expression	ISO	8	122,190,265	122,211,920	RGD:6480464	CTD
G	Wfs1	Wolfram syndrome 1 homolog (human)		increases expression	ISO	5	37,357,343	37,380,221	RGD:6480464	CTD
G	Wif1	Wnt inhibitory factor 1		multiple interactions	ISO	10	120,471,060	120,537,698	RGD:6480464	CTD
G	Wisp2	WNT1 inducible signaling pathway protein 2		multiple interactions	EXP	2	163,646,570	163,658,882	RGD:6480464	CTD
G	Wnk4	WNK lysine deficient protein kinase 4		increases expression	EXP	11	101,121,881	101,138,723	RGD:6480464	CTD
G	Wnt3a	wingless-related MMTV integration site 3A		multiple interactions	EXP	11	59,061,538	59,104,253	RGD:6480464	CTD
G	Wnt4	wingless-related MMTV integration site 4		decreases expression	ISO	4	136,833,550	136,852,694	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	500591
role	490275
application	248574
anti-inflammatory agent	34990
anti-inflammatory drug	22352
dexamethasone	2937
dexamethasone phosphate	5
dexamethasone sodium m-sulfobenzoate	0
Path 2
Term	Annotations
CHEBI ontology	500591
subatomic particle	499508
composite particle	499508
hadron	499508
baryon	499508
nucleon	499508
atomic nucleus	499508
atom	499508
main group element atom	468781
p-block element atom	466276
carbon group element atom	417557
carbon atom	414040
organic molecular entity	414034
organic group	170804
organic divalent group	169619
organodiyl group	169619
carbonyl group	169303
carbonyl compound	169303
ketone	31724
oxo steroid	13778
20-oxo steroid	7033
dexamethasone	2937
dexamethasone phosphate	5
dexamethasone sodium m-sulfobenzoate	0