dexamethasone - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	dexamethasone	go back to main search page
Accession:	CHEBI:41879	browse the term
Definition:	A fluorinated steroid that has formula C22H29FO5.
Synonyms:	exact_synonym:	9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione
	related_synonym:	1-Dehydro-16alpha-methyl-9alpha-fluorohydrocortisone; 16alpha-Methyl-9alpha-fluoro-1-dehydrocortisol; 9alpha-Fluoro-16alpha-methylprednisolone; C22H29FO5; Decadron; InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1; InChIKey=UREBDLICKHMUKA-CXSFZGCWSA-N; [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C; dexametasona; dexamethasonum
	alt_id:	CHEBI:41873; CHEBI:4461
	xref_casrn:	50-02-2
	xref:	Beilstein:2066652 "Beilstein Registry Number"; ChEMBL:465281 "ChEMBL COMPOUND"; ChemIDplus:50-02-2 "CAS Registry Number"; DrugBank:DB01234 "DrugBank"; KEGG DRUG:D00292 "KEGG DRUG"
	xref_mesh:	MESH:D003907
	xref:	Patent:DE1113690 "Patent"; Patent:GB869511 "Patent"; Patent:US3007923 "Patent"; Wikipedia:Dexamethasone "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

dexamethasone
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	A2M	alpha-2-macroglobulin		decreases expression	ISO	12	9,220,304	9,268,558	RGD:6480464	CTD
G	ABCA1	ATP-binding cassette, sub-family A (ABC1), member 1		increases expression	ISO	9	107,543,283	107,690,527	RGD:6480464	CTD
G	ABCA1	ATP-binding cassette, sub-family A (ABC1), member 1		multiple interactions	ISO	9	107,543,283	107,690,527	RGD:6480464	CTD
G	ABCA1	ATP-binding cassette, sub-family A (ABC1), member 1		multiple interactions	ISO	9	107,543,283	107,690,527	RGD:6480464	CTD
G	ABCB1	ATP-binding cassette, sub-family B (MDR/TAP), member 1		increases expression	EXP	7	87,133,179	87,342,639	RGD:6480464	CTD
G	ABCB1	ATP-binding cassette, sub-family B (MDR/TAP), member 1		decreases activity	EXP	7	87,133,179	87,342,639	RGD:6480464	CTD
G	ABCB1	ATP-binding cassette, sub-family B (MDR/TAP), member 1		increases expression	ISO	7	87,133,179	87,342,639	RGD:6480464	CTD
G	ABCB4	ATP-binding cassette, sub-family B (MDR/TAP), member 4		increases expression	ISO	7	87,031,361	87,105,019	RGD:6480464	CTD
G	ABCC1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		multiple interactions	ISO	16	16,043,434	16,236,931	RGD:6480464	CTD
G	ABCC2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		decreases expression	ISO	10	101,542,463	101,611,662	RGD:6480464	CTD
G	ABCC2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		multiple interactions	ISO	10	101,542,463	101,611,662	RGD:6480464	CTD
G	ABCC2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		increases expression	ISO	10	101,542,463	101,611,662	RGD:6480464	CTD
G	ABCC2	ATP-binding cassette, sub-family C (CFTR/MRP), member 2		increases expression	ISO	10	101,542,463	101,611,662	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		multiple interactions	EXP	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases activity	EXP	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases expression	EXP	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		affects expression	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		decreases expression	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		multiple interactions	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC3	ATP-binding cassette, sub-family C (CFTR/MRP), member 3		increases expression	ISO	17	48,712,218	48,769,063	RGD:6480464	CTD
G	ABCC6	ATP-binding cassette, sub-family C (CFTR/MRP), member 6		affects expression	ISO	16	16,243,422	16,317,328	RGD:6480464	CTD
G	ABCC6	ATP-binding cassette, sub-family C (CFTR/MRP), member 6		decreases expression	ISO	16	16,243,422	16,317,328	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		multiple interactions	EXP	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ABHD1	abhydrolase domain containing 1		increases expression	ISO	2	27,346,657	27,353,680	RGD:6480464	CTD
G	ABHD1	abhydrolase domain containing 1		multiple interactions	ISO	2	27,346,657	27,353,680	RGD:6480464	CTD
G	ACADM	acyl-CoA dehydrogenase, C-4 to C-12 straight chain		decreases expression	ISO	1	76,190,043	76,229,355	RGD:6480464	CTD
G	ACAN	aggrecan		multiple interactions	EXP	15	89,346,674	89,418,585	RGD:6480464	CTD
G	ACAN	aggrecan		increases expression	EXP	15	89,346,674	89,418,585	RGD:6480464	CTD
G	ACE	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		increases expression	ISO	17	61,554,422	61,575,741	RGD:6480464	CTD
G	ACE	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		multiple interactions	ISO	17	61,554,422	61,575,741	RGD:6480464	CTD
G	ACLY	ATP citrate lyase		decreases expression	ISO	17	40,023,179	40,075,272	RGD:6480464	CTD
G	ACO2	aconitase 2, mitochondrial		decreases expression	ISO	22	41,865,129	41,924,993	RGD:6480464	CTD
G	ACO2	aconitase 2, mitochondrial		multiple interactions	ISO	22	41,865,129	41,924,993	RGD:6480464	CTD
G	ACOT7	acyl-CoA thioesterase 7		decreases expression	ISO	1	6,324,332	6,453,826	RGD:6480464	CTD
G	ACOX1	acyl-CoA oxidase 1, palmitoyl		decreases expression	ISO	17	73,937,588	73,975,515	RGD:6480464	CTD
G	ACP5	acid phosphatase 5, tartrate resistant		multiple interactions	EXP	19	11,685,475	11,689,801	RGD:6480464	CTD
G	ACSL1	acyl-CoA synthetase long-chain family member 1		multiple interactions	ISO	4	185,676,749	185,747,215	RGD:6480464	CTD
G	ACSL1	acyl-CoA synthetase long-chain family member 1		decreases expression	ISO	4	185,676,749	185,747,215	RGD:6480464	CTD
G	ACSL4	acyl-CoA synthetase long-chain family member 4		multiple interactions	ISO	X	108,884,564	108,976,621	RGD:6480464	CTD
G	ACSL4	acyl-CoA synthetase long-chain family member 4		increases expression	ISO	X	108,884,564	108,976,621	RGD:6480464	CTD
G	ACSL4	acyl-CoA synthetase long-chain family member 4		multiple interactions	ISO	X	108,884,564	108,976,621	RGD:6480464	CTD
G	ACTA2	actin, alpha 2, smooth muscle, aorta		multiple interactions	ISO	10	90,694,831	90,751,147	RGD:6480464	CTD
G	ACTA2	actin, alpha 2, smooth muscle, aorta		decreases expression	ISO	10	90,694,831	90,751,147	RGD:6480464	CTD
G	ACTB	actin, beta		multiple interactions	ISO	7	5,566,779	5,570,232	RGD:6480464	CTD
G	ACTC1	actin, alpha, cardiac muscle 1		multiple interactions	ISO	15	35,080,297	35,087,927	RGD:6480464	CTD
G	ACTG2	actin, gamma 2, smooth muscle, enteric		multiple interactions	ISO	2	74,120,093	74,146,780	RGD:6480464	CTD
G	ADAM12	ADAM metallopeptidase domain 12		multiple interactions	ISO	10	127,702,898	128,077,127	RGD:6480464	CTD
G	ADAM17	ADAM metallopeptidase domain 17		decreases expression	ISO	2	9,629,392	9,695,917	RGD:6480464	CTD
G	ADAMTS1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	ISO	21	28,208,606	28,217,728	RGD:6480464	CTD
G	ADH1C	alcohol dehydrogenase 1C (class I), gamma polypeptide		increases expression	ISO	4	100,257,649	100,273,917	RGD:6480464	CTD
G	ADH1C	alcohol dehydrogenase 1C (class I), gamma polypeptide		multiple interactions	ISO	4	100,257,649	100,273,917	RGD:6480464	CTD
G	ADIPOQ	adiponectin, C1Q and collagen domain containing		multiple interactions	ISO	3	186,560,463	186,576,252	RGD:6480464	CTD
G	ADM	adrenomedullin		multiple interactions	ISO	11	10,326,642	10,328,923	RGD:6480464	CTD
G	ADORA3	adenosine A3 receptor		increases expression	ISO	1	112,025,970	112,106,597	RGD:6480464	CTD
G	ADRA1B	adrenoceptor alpha 1B		increases expression	EXP	5	159,343,740	159,400,017	RGD:6480464	CTD
G	ADRA1D	adrenoceptor alpha 1D		increases expression	EXP	20	4,201,278	4,229,659	RGD:6480464	CTD
G	ADRB2	adrenoceptor beta 2, surface		increases expression	ISO	5	148,206,156	148,208,197	RGD:6480464	CTD
G	ADRB2	adrenoceptor beta 2, surface		multiple interactions	ISO	5	148,206,156	148,208,197	RGD:6480464	CTD
G	ADRB2	adrenoceptor beta 2, surface		multiple interactions	ISO	5	148,206,156	148,208,197	RGD:6480464	CTD
G	ADRB3	adrenoceptor beta 3		decreases expression	ISO	8	37,820,513	37,824,184	RGD:6480464	CTD
G	AGR2	anterior gradient 2 homolog (Xenopus laevis)		multiple interactions	EXP	7	16,832,264	16,844,738	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases expression	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	EXP	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	EXP	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		decreases expression	EXP	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	EXP	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		decreases expression	EXP	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	ISO	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	ISO	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		increases expression	ISO	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHR	aryl hydrocarbon receptor		multiple interactions	ISO	7	17,338,276	17,385,775	RGD:6480464	CTD
G	AHSA1	AHA1, activator of heat shock 90kDa protein ATPase homolog 1 (yeast)		increases expression	ISO	14	77,924,373	77,935,815	RGD:6480464	CTD
G	AHSG	alpha-2-HS-glycoprotein		increases response to substance	EXP	3	186,330,850	186,339,107	RGD:6480464	CTD
G	AIFM1	apoptosis-inducing factor, mitochondrion-associated, 1		multiple interactions	ISO	X	129,263,337	129,299,861	RGD:6480464	CTD
G	AIM1	absent in melanoma 1		increases expression	EXP	6	106,959,730	107,018,335	RGD:6480464	CTD
G	AKAP12	A kinase (PRKA) anchor protein 12		multiple interactions	ISO	6	151,561,134	151,679,694	RGD:6480464	CTD
G	AKAP7	A kinase (PRKA) anchor protein 7		multiple interactions	EXP	6	131,456,826	131,604,675	RGD:6480464	CTD
G	AKR1CL1	aldo-keto reductase family 1, member C-like 1		multiple interactions	ISO	10	5,196,655	5,227,150	RGD:6480464	CTD
G	AKR1CL1	aldo-keto reductase family 1, member C-like 1		increases expression	ISO	10	5,196,655	5,227,150	RGD:6480464	CTD
G	AKT1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	EXP	14	105,235,686	105,262,080	RGD:6480464	CTD
G	AKT1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	14	105,235,686	105,262,080	RGD:6480464	CTD
G	ALB	albumin		multiple interactions	EXP	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALB	albumin		multiple interactions	EXP	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALB	albumin		increases expression	ISO	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALB	albumin		increases secretion	ISO	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALDH1A1	aldehyde dehydrogenase 1 family, member A1		affects expression	ISO	9	75,515,578	75,568,233	RGD:6480464	CTD
G	ALDH1B1	aldehyde dehydrogenase 1 family, member B1		affects expression	ISO	9	38,392,661	38,398,662	RGD:6480464	CTD
G	ALDOA	aldolase A, fructose-bisphosphate		increases expression	ISO	16	30,064,411	30,081,741	RGD:6480464	CTD
G	ALOX5	arachidonate 5-lipoxygenase		multiple interactions	ISO	10	45,869,624	45,941,567	RGD:6480464	CTD
G	ALPL	alkaline phosphatase, liver/bone/kidney		multiple interactions	ISO	1	21,835,858	21,904,905	RGD:6480464	CTD
G	AMPD3	adenosine monophosphate deaminase 3		increases expression	ISO	11	10,471,868	10,529,126	RGD:6480464	CTD
G	AMPD3	adenosine monophosphate deaminase 3		multiple interactions	ISO	11	10,471,868	10,529,126	RGD:6480464	CTD
G	AMY1A	amylase, alpha 1A (salivary)		increases expression	ISO	1	104,198,141	104,207,173	RGD:6480464	CTD
G	ANGPT1	angiopoietin 1		multiple interactions	EXP	8	108,261,710	108,510,254	RGD:6480464	CTD
G	ANGPTL4	angiopoietin-like 4		increases expression	ISO	19	8,429,011	8,439,257	RGD:6480464	CTD
G	ANGPTL4	angiopoietin-like 4		affects response to substance	ISO	19	8,429,011	8,439,257	RGD:6480464	CTD
G	ANGPTL4	angiopoietin-like 4		multiple interactions	ISO	19	8,429,011	8,439,257	RGD:6480464	CTD
G	ANGPTL4	angiopoietin-like 4		increases expression	ISO	19	8,429,011	8,439,257	RGD:6480464	CTD
G	ANGPTL4	angiopoietin-like 4		multiple interactions	ISO	19	8,429,011	8,439,257	RGD:6480464	CTD
G	ANK1	ankyrin 1, erythrocytic		decreases expression	ISO	8	41,510,744	41,754,280	RGD:6480464	CTD
G	ANK1	ankyrin 1, erythrocytic		multiple interactions	ISO	8	41,510,744	41,754,280	RGD:6480464	CTD
G	ANXA1	annexin A1		multiple interactions	EXP	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		multiple interactions	EXP	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		increases expression	EXP	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		increases localization	EXP	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		increases phosphorylation	EXP	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		affects response to substance	ISO	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		multiple interactions	ISO	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA1	annexin A1		affects response to substance	ISO	9	75,766,781	75,785,307	RGD:6480464	CTD
G	ANXA3	annexin A3		multiple interactions	ISO	4	79,472,742	79,531,605	RGD:6480464	CTD
G	ANXA6	annexin A6		multiple interactions	ISO	5	150,480,267	150,537,443	RGD:6480464	CTD
G	ANXA8	annexin A8		multiple interactions	EXP				RGD:6480464	CTD
G	AOX1	aldehyde oxidase 1		multiple interactions	ISO	2	201,450,731	201,536,218	RGD:6480464	CTD
G	AOX1	aldehyde oxidase 1		increases expression	ISO	2	201,450,731	201,536,218	RGD:6480464	CTD
G	AP1G2	adaptor-related protein complex 1, gamma 2 subunit		increases expression	EXP	14	24,028,777	24,037,279	RGD:6480464	CTD
G	APCDD1	adenomatosis polyposis coli down-regulated 1		multiple interactions	ISO	18	10,454,625	10,488,698	RGD:6480464	CTD
G	APLN	apelin		decreases expression	ISO	X	128,779,236	128,788,933	RGD:6480464	CTD
G	APLN	apelin		multiple interactions	ISO	X	128,779,236	128,788,933	RGD:6480464	CTD
G	APOA1	apolipoprotein A-I		affects expression	ISO	11	116,706,469	116,708,338	RGD:6480464	CTD
G	APOA4	apolipoprotein A-IV		affects expression	ISO	11	116,691,418	116,694,011	RGD:6480464	CTD
G	APOB	apolipoprotein B (including Ag(x) antigen)		increases expression	ISO	2	21,224,301	21,266,945	RGD:6480464	CTD
G	APOC3	apolipoprotein C-III		increases expression	ISO	11	116,700,624	116,703,787	RGD:6480464	CTD
G	APOC3	apolipoprotein C-III		multiple interactions	ISO	11	116,700,624	116,703,787	RGD:6480464	CTD
G	APOC3	apolipoprotein C-III		increases expression	ISO	11	116,700,624	116,703,787	RGD:6480464	CTD
G	APOC3	apolipoprotein C-III		multiple interactions	ISO	11	116,700,624	116,703,787	RGD:6480464	CTD
G	AQP7	aquaporin 7		increases expression	ISO	9	33,384,948	33,402,517	RGD:6480464	CTD
G	AR	androgen receptor		affects activity	EXP	X	66,763,874	66,950,461	RGD:6480464	CTD
G	AR	androgen receptor		affects binding	EXP	X	66,763,874	66,950,461	RGD:6480464	CTD
G	AR	androgen receptor		multiple interactions	ISO	X	66,763,874	66,950,461	RGD:6480464	CTD
G	AR	androgen receptor		decreases expression	EXP	X	66,763,874	66,950,461	RGD:6480464	CTD
G	AR	androgen receptor		affects binding	ISO	X	66,763,874	66,950,461	RGD:6480464	CTD
G	ARAF	v-raf murine sarcoma 3611 viral oncogene homolog		multiple interactions	EXP	X	47,420,499	47,431,320	RGD:6480464	CTD
G	AREG	amphiregulin		decreases expression	ISO	4	75,310,853	75,320,726	RGD:6480464	CTD
G	ARG2	arginase, type II		increases expression	ISO	14	68,086,579	68,118,437	RGD:6480464	CTD
G	ARG2	arginase, type II		multiple interactions	ISO	14	68,086,579	68,118,437	RGD:6480464	CTD
G	ARHGAP10	Rho GTPase activating protein 10		increases expression	ISO	4	148,653,453	148,993,927	RGD:6480464	CTD
G	ARHGAP30	Rho GTPase activating protein 30		increases expression	ISO	1	161,016,732	161,039,760	RGD:6480464	CTD
G	ARHGAP5	Rho GTPase activating protein 5		multiple interactions	ISO	14	32,546,495	32,628,934	RGD:6480464	CTD
G	ARNT	aryl hydrocarbon receptor nuclear translocator		increases expression	ISO	1	150,782,181	150,849,244	RGD:6480464	CTD
G	ART1	ADP-ribosyltransferase 1		multiple interactions	ISO	11	3,666,361	3,685,646	RGD:6480464	CTD
G	ART1	ADP-ribosyltransferase 1		increases expression	ISO	11	3,666,361	3,685,646	RGD:6480464	CTD
G	ART5	ADP-ribosyltransferase 5		increases expression	ISO	11	3,659,736	3,663,546	RGD:6480464	CTD
G	ART5	ADP-ribosyltransferase 5		multiple interactions	ISO	11	3,659,736	3,663,546	RGD:6480464	CTD
G	ASAH2	N-acylsphingosine amidohydrolase (non-lysosomal ceramidase) 2		decreases expression	ISO	10	51,947,000	52,008,370	RGD:6480464	CTD
G	ASAH2	N-acylsphingosine amidohydrolase (non-lysosomal ceramidase) 2		multiple interactions	ISO	10	51,947,000	52,008,370	RGD:6480464	CTD
G	ASS1	argininosuccinate synthase 1		increases expression	ISO	9	133,320,094	133,376,661	RGD:6480464	CTD
G	ASS1	argininosuccinate synthase 1		multiple interactions	ISO	9	133,320,094	133,376,661	RGD:6480464	CTD
G	ATCAY	ataxia, cerebellar, Cayman type		decreases expression	ISO	19	3,880,618	3,928,080	RGD:6480464	CTD
G	ATCAY	ataxia, cerebellar, Cayman type		multiple interactions	ISO	19	3,880,618	3,928,080	RGD:6480464	CTD
G	ATP2A1	ATPase, Ca++ transporting, cardiac muscle, fast twitch 1		increases expression	ISO	16	28,889,809	28,915,830	RGD:6480464	CTD
G	AVP	arginine vasopressin		multiple interactions	ISO	20	3,063,202	3,065,370	RGD:6480464	CTD
G	AVP	arginine vasopressin		multiple interactions	ISO	20	3,063,202	3,065,370	RGD:6480464	CTD
G	AVP	arginine vasopressin		multiple interactions	ISO	20	3,063,202	3,065,370	RGD:6480464	CTD
G	AVP	arginine vasopressin		increases activity	ISO	20	3,063,202	3,065,370	RGD:6480464	CTD
G	B2M	beta-2-microglobulin		decreases expression	EXP	15	45,003,685	45,010,357	RGD:6480464	CTD
G	B4GALT6	UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 6		decreases expression	ISO	18	29,202,209	29,264,686	RGD:6480464	CTD
G	B4GALT6	UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 6		multiple interactions	ISO	18	29,202,209	29,264,686	RGD:6480464	CTD
G	BAD	BCL2-associated agonist of cell death		decreases phosphorylation	ISO	11	64,037,300	64,052,176	RGD:6480464	CTD
G	BAD	BCL2-associated agonist of cell death		increases expression	ISO	11	64,037,300	64,052,176	RGD:6480464	CTD
G	BAD	BCL2-associated agonist of cell death		multiple interactions	ISO	11	64,037,300	64,052,176	RGD:6480464	CTD
G	BAMBI	BMP and activin membrane-bound inhibitor homolog (Xenopus laevis)		decreases expression	ISO	10	28,966,424	28,971,868	RGD:6480464	CTD
G	BASP1	brain abundant, membrane attached signal protein 1		decreases expression	ISO	5	17,217,750	17,276,943	RGD:6480464	CTD
G	BASP1	brain abundant, membrane attached signal protein 1		multiple interactions	ISO	5	17,217,750	17,276,943	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		multiple interactions	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		multiple interactions	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		increases expression	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		increases response to substance	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		decreases response to substance	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		increases expression	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		increases expression	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		decreases expression	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		decreases expression	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		decreases expression	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		increases expression	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		decreases expression	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases expression	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases expression	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases stability	EXP	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases expression	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases expression	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		increases expression	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases expression	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases phosphorylation	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	ISO	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BCL3	B-cell CLL/lymphoma 3		decreases expression	ISO	19	45,251,978	45,263,301	RGD:6480464	CTD
G	BCL3	B-cell CLL/lymphoma 3		multiple interactions	ISO	19	45,251,978	45,263,301	RGD:6480464	CTD
G	BCR	breakpoint cluster region		decreases expression	ISO	22	23,522,552	23,660,224	RGD:6480464	CTD
G	BCR	breakpoint cluster region		multiple interactions	ISO	22	23,522,552	23,660,224	RGD:6480464	CTD
G	BDNF	brain-derived neurotrophic factor		decreases expression	EXP	11	27,676,440	27,743,605	RGD:6480464	CTD
G	BHLHE41	basic helix-loop-helix family, member e41		multiple interactions	ISO	12	26,272,959	26,278,003	RGD:6480464	CTD
G	BHLHE41	basic helix-loop-helix family, member e41		decreases expression	ISO	12	26,272,959	26,278,003	RGD:6480464	CTD
G	BIRC2	baculoviral IAP repeat containing 2		multiple interactions	EXP	11	102,217,913	102,249,401	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		multiple interactions	EXP	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	EXP	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		multiple interactions	ISO	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	ISO	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	EXP	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC5	baculoviral IAP repeat containing 5		affects expression	EXP	17	76,210,277	76,221,716	RGD:6480464	CTD
G	BIRC5	baculoviral IAP repeat containing 5		multiple interactions	EXP	17	76,210,277	76,221,716	RGD:6480464	CTD
G	BIRC5	baculoviral IAP repeat containing 5		multiple interactions	EXP	17	76,210,277	76,221,716	RGD:6480464	CTD
G	BMP2	bone morphogenetic protein 2		multiple interactions	EXP	20	6,748,745	6,760,910	RGD:6480464	CTD
G	BMP2	bone morphogenetic protein 2		multiple interactions	EXP	20	6,748,745	6,760,910	RGD:6480464	CTD
G	BMP4	bone morphogenetic protein 4		multiple interactions	EXP	14	54,416,454	54,423,554	RGD:6480464	CTD
G	BMP4	bone morphogenetic protein 4		affects expression	ISO	14	54,416,454	54,423,554	RGD:6480464	CTD
G	BMP4	bone morphogenetic protein 4		multiple interactions	ISO	14	54,416,454	54,423,554	RGD:6480464	CTD
G	BMP6	bone morphogenetic protein 6		multiple interactions	EXP	6	7,727,011	7,881,961	RGD:6480464	CTD
G	BMP8A	bone morphogenetic protein 8a		increases expression	ISO	1	39,957,318	39,995,541	RGD:6480464	CTD
G	BMP8A	bone morphogenetic protein 8a		decreases response to substance	ISO	1	39,957,318	39,995,541	RGD:6480464	CTD
G	BTG1	B-cell translocation gene 1, anti-proliferative		increases expression	EXP	12	92,534,054	92,539,673	RGD:6480464	CTD
G	BTG2	BTG family, member 2		increases expression	EXP	1	203,274,664	203,278,730	RGD:6480464	CTD
G	C1QTNF3	C1q and tumor necrosis factor related protein 3		decreases expression	ISO	5	34,017,963	34,043,371	RGD:6480464	CTD
G	C1QTNF3	C1q and tumor necrosis factor related protein 3		multiple interactions	ISO	5	34,017,963	34,043,371	RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	ISO	19	6,677,846	6,720,662	RGD:6480464	CTD
G	C4A	complement component 4A (Rodgers blood group)		multiple interactions	ISO	6	31,949,834	31,970,457	RGD:6480464	CTD
G	C4A	complement component 4A (Rodgers blood group)		increases expression	ISO	6	31,949,834	31,970,457	RGD:6480464	CTD
G	CA4	carbonic anhydrase IV		decreases expression	ISO	17	58,227,302	58,236,907	RGD:6480464	CTD
G	CA4	carbonic anhydrase IV		multiple interactions	ISO	17	58,227,302	58,236,907	RGD:6480464	CTD
G	CACNA2D1	calcium channel, voltage-dependent, alpha 2/delta subunit 1		multiple interactions	ISO	7	81,579,418	82,073,031	RGD:6480464	CTD
G	CALB1	calbindin 1, 28kDa		decreases expression	ISO	8	91,070,838	91,095,107	RGD:6480464	CTD
G	CALCA	calcitonin-related polypeptide alpha		multiple interactions	ISO	11	14,988,215	14,993,832	RGD:6480464	CTD
G	CALCA	calcitonin-related polypeptide alpha		decreases response to substance	EXP	11	14,988,215	14,993,832	RGD:6480464	CTD
G	CALML4	calmodulin-like 4		multiple interactions	ISO	15	68,483,043	68,498,448	RGD:6480464	CTD
G	CALU	calumenin		increases expression	ISO	7	128,379,346	128,413,477	RGD:6480464	CTD
G	CAMK4	calcium/calmodulin-dependent protein kinase IV		decreases expression	ISO	5	110,559,947	110,820,749	RGD:6480464	CTD
G	CAMK4	calcium/calmodulin-dependent protein kinase IV		multiple interactions	ISO	5	110,559,947	110,820,749	RGD:6480464	CTD
G	CAPN2	calpain 2, (m/II) large subunit		increases expression	ISO	1	223,889,295	223,963,720	RGD:6480464	CTD
G	CAPN2	calpain 2, (m/II) large subunit		multiple interactions	ISO	1	223,889,295	223,963,720	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		multiple interactions	EXP	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP2	caspase 2, apoptosis-related cysteine peptidase		decreases expression	ISO	7	142,985,308	143,004,789	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		decreases activity	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases expression	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		decreases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		multiple interactions	ISO	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		multiple interactions	EXP	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		increases activity	EXP	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		increases activity	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		multiple interactions	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		multiple interactions	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		increases activity	EXP	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		increases cleavage	EXP	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		decreases expression	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	EXP	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		increases activity	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases activity	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases expression	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		increases activity	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases activity	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		decreases expression	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		increases activity	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		increases expression	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAV1	caveolin 1, caveolae protein, 22kDa		multiple interactions	ISO	7	116,164,839	116,201,239	RGD:6480464	CTD
G	CAV1	caveolin 1, caveolae protein, 22kDa		multiple interactions	ISO	7	116,164,839	116,201,239	RGD:6480464	CTD
G	CCAR1	cell division cycle and apoptosis regulator 1		increases expression	ISO	10	70,480,971	70,551,309	RGD:6480464	CTD
G	CCDC86	coiled-coil domain containing 86		decreases expression	EXP	11	60,609,429	60,618,561	RGD:6480464	CTD
G	CCKBR	cholecystokinin B receptor		decreases expression	ISO	11	6,280,904	6,293,357	RGD:6480464	CTD
G	CCKBR	cholecystokinin B receptor		multiple interactions	ISO	11	6,280,904	6,293,357	RGD:6480464	CTD
G	CCL17	chemokine (C-C motif) ligand 17		multiple interactions	ISO	16	57,438,679	57,449,974	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		increases expression	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL26	chemokine (C-C motif) ligand 26		multiple interactions	EXP	7	75,398,842	75,419,064	RGD:6480464	CTD
G	CCL3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	17	34,415,602	34,417,506	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL7	chemokine (C-C motif) ligand 7		multiple interactions	ISO	17	32,597,240	32,599,256	RGD:6480464	CTD
G	CCNB1	cyclin B1		decreases expression	ISO	5	68,462,837	68,474,072	RGD:6480464	CTD
G	CCNB1	cyclin B1		multiple interactions	ISO	5	68,462,837	68,474,072	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		increases degradation	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		increases ubiquitination	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND2	cyclin D2		decreases expression	ISO	12	4,382,902	4,414,522	RGD:6480464	CTD
G	CCNG1	cyclin G1		increases expression	ISO	5	162,864,577	162,872,022	RGD:6480464	CTD
G	CCR3	chemokine (C-C motif) receptor 3		decreases expression	EXP	3	46,283,872	46,308,197	RGD:6480464	CTD
G	CCR4	chemokine (C-C motif) receptor 4		increases expression	EXP	3	32,993,066	32,996,403	RGD:6480464	CTD
G	CCR9	chemokine (C-C motif) receptor 9		increases expression	ISO	3	45,927,996	45,944,667	RGD:6480464	CTD
G	CD14	CD14 molecule		increases expression	EXP	5	140,011,313	140,013,286	RGD:6480464	CTD
G	CD163	CD163 molecule		increases expression	ISO	12	7,623,412	7,656,414	RGD:6480464	CTD
G	CD24	CD24 molecule		increases expression	ISO				RGD:6480464	CTD
G	CD24	CD24 molecule		multiple interactions	ISO				RGD:6480464	CTD
G	CD28	CD28 molecule		multiple interactions	EXP	2	204,571,198	204,603,635	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		increases expression	EXP	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		affects expression	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		increases expression	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD4	CD4 molecule		multiple interactions	EXP	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD4	CD4 molecule		decreases expression	EXP	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD53	CD53 molecule		increases expression	EXP	1	111,413,821	111,442,558	RGD:6480464	CTD
G	CD68	CD68 molecule		increases expression	EXP	17	7,482,805	7,485,429	RGD:6480464	CTD
G	CD69	CD69 molecule		increases expression	EXP	12	9,905,082	9,913,497	RGD:6480464	CTD
G	CDA	cytidine deaminase		increases activity	ISO	1	20,915,444	20,945,401	RGD:6480464	CTD
G	CDC42	cell division cycle 42		multiple interactions	ISO	1	22,379,120	22,419,436	RGD:6480464	CTD
G	CDCA7	cell division cycle associated 7		decreases expression	ISO	2	174,219,561	174,233,718	RGD:6480464	CTD
G	CDCA7	cell division cycle associated 7		multiple interactions	ISO	2	174,219,561	174,233,718	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		multiple interactions	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		decreases expression	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		multiple interactions	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDK1	cyclin-dependent kinase 1		decreases expression	ISO	10	62,538,089	62,554,610	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		multiple interactions	EXP	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		decreases activity	EXP	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		decreases expression	EXP	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		multiple interactions	ISO	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		multiple interactions	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		multiple interactions	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN3	cyclin-dependent kinase inhibitor 3		multiple interactions	ISO	14	54,863,673	54,886,936	RGD:6480464	CTD
G	CDKN3	cyclin-dependent kinase inhibitor 3		decreases expression	ISO	14	54,863,673	54,886,936	RGD:6480464	CTD
G	CDO1	cysteine dioxygenase, type I		multiple interactions	ISO	5	115,140,430	115,152,405	RGD:6480464	CTD
G	CEACAM1	carcinoembryonic antigen-related cell adhesion molecule 1 (biliary glycoprotein)		increases expression	ISO	19	43,011,458	43,032,661	RGD:6480464	CTD
G	CEACAM6	carcinoembryonic antigen-related cell adhesion molecule 6 (non-specific cross reacting antigen)		multiple interactions	EXP	19	42,259,398	42,276,113	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		increases expression	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CELF2	CUGBP, Elav-like family member 2		multiple interactions	ISO	10	11,047,259	11,378,674	RGD:6480464	CTD
G	CELSR3	cadherin, EGF LAG seven-pass G-type receptor 3		decreases expression	EXP	3	48,673,896	48,700,348	RGD:6480464	CTD
G	CES1	carboxylesterase 1		increases expression	EXP	16	55,836,763	55,867,075	RGD:6480464	CTD
G	CES1	carboxylesterase 1		decreases expression	ISO	16	55,836,763	55,867,075	RGD:6480464	CTD
G	CES2	carboxylesterase 2		affects expression	ISO	16	66,968,347	66,978,999	RGD:6480464	CTD
G	CES2	carboxylesterase 2		increases expression	EXP	16	66,968,347	66,978,999	RGD:6480464	CTD
G	CES2	carboxylesterase 2		multiple interactions	ISO	16	66,968,347	66,978,999	RGD:6480464	CTD
G	CES2	carboxylesterase 2		decreases expression	ISO	16	66,968,347	66,978,999	RGD:6480464	CTD
G	CES2	carboxylesterase 2		increases expression	ISO	16	66,968,347	66,978,999	RGD:6480464	CTD
G	CES3	carboxylesterase 3		decreases expression	ISO	16	66,995,132	67,009,052	RGD:6480464	CTD
G	CFD	complement factor D (adipsin)		decreases expression	ISO	19	859,665	863,624	RGD:6480464	CTD
G	CFLAR	CASP8 and FADD-like apoptosis regulator		increases expression	EXP	2	201,980,877	202,037,411	RGD:6480464	CTD
G	CFLAR	CASP8 and FADD-like apoptosis regulator		multiple interactions	EXP	2	201,980,877	202,037,411	RGD:6480464	CTD
G	CHI3L1	chitinase 3-like 1 (cartilage glycoprotein-39)		decreases expression	EXP	1	203,148,059	203,155,922	RGD:6480464	CTD
G	CHID1	chitinase domain containing 1		multiple interactions	EXP	11	867,859	915,058	RGD:6480464	CTD
G	CHID1	chitinase domain containing 1		increases expression	EXP	11	867,859	915,058	RGD:6480464	CTD
G	CHRND	cholinergic receptor, nicotinic, delta (muscle)		increases expression	ISO	2	233,390,870	233,401,375	RGD:6480464	CTD
G	CHRND	cholinergic receptor, nicotinic, delta (muscle)		multiple interactions	ISO	2	233,390,870	233,401,375	RGD:6480464	CTD
G	CHUK	conserved helix-loop-helix ubiquitous kinase		multiple interactions	EXP	10	101,948,124	101,989,344	RGD:6480464	CTD
G	CIB2	calcium and integrin binding family member 2		multiple interactions	ISO	15	78,396,991	78,423,878	RGD:6480464	CTD
G	CIB2	calcium and integrin binding family member 2		decreases expression	ISO	15	78,396,991	78,423,878	RGD:6480464	CTD
G	CIDEA	cell death-inducing DFFA-like effector a		increases expression	ISO	18	12,254,318	12,277,594	RGD:6480464	CTD
G	CIDEA	cell death-inducing DFFA-like effector a		multiple interactions	ISO	18	12,254,318	12,277,594	RGD:6480464	CTD
G	CIRBP	cold inducible RNA binding protein		decreases expression	ISO	19	1,269,267	1,274,809	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	ISO	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CKB	creatine kinase, brain		increases expression	ISO	14	103,985,995	103,989,196	RGD:6480464	CTD
G	CLCN4	chloride channel, voltage-sensitive 4		decreases expression	ISO	X	10,124,985	10,205,700	RGD:6480464	CTD
G	CLEC3B	C-type lectin domain family 3, member B		multiple interactions	ISO	3	45,067,759	45,077,563	RGD:6480464	CTD
G	CLIC3	chloride intracellular channel 3		multiple interactions	EXP	9	139,889,060	139,891,024	RGD:6480464	CTD
G	CLN6	ceroid-lipofuscinosis, neuronal 6, late infantile, variant		decreases expression	ISO	15	68,499,330	68,522,080	RGD:6480464	CTD
G	CLN6	ceroid-lipofuscinosis, neuronal 6, late infantile, variant		multiple interactions	ISO	15	68,499,330	68,522,080	RGD:6480464	CTD
G	CLU	clusterin		decreases expression	ISO	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CLU	clusterin		multiple interactions	ISO	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CNKSR1	connector enhancer of kinase suppressor of Ras 1		increases expression	ISO	1	26,503,981	26,516,375	RGD:6480464	CTD
G	CNKSR1	connector enhancer of kinase suppressor of Ras 1		multiple interactions	ISO	1	26,503,981	26,516,375	RGD:6480464	CTD
G	CNN2	calponin 2		multiple interactions	ISO	19	1,026,298	1,039,064	RGD:6480464	CTD
G	CNTN1	contactin 1		decreases expression	ISO	12	41,086,244	41,466,214	RGD:6480464	CTD
G	CNTN1	contactin 1		multiple interactions	ISO	12	41,086,244	41,466,214	RGD:6480464	CTD
G	COL11A1	collagen, type XI, alpha 1		multiple interactions	ISO	1	103,342,023	103,574,052	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		multiple interactions	EXP	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		multiple interactions	ISO	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		decreases expression	ISO	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		decreases expression	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL2A1	collagen, type II, alpha 1		multiple interactions	EXP	12	48,366,748	48,398,285	RGD:6480464	CTD
G	COL2A1	collagen, type II, alpha 1		affects expression	ISO	12	48,366,748	48,398,285	RGD:6480464	CTD
G	COL3A1	collagen, type III, alpha 1		decreases expression	ISO	2	189,839,099	189,877,472	RGD:6480464	CTD
G	COL3A1	collagen, type III, alpha 1		multiple interactions	ISO	2	189,839,099	189,877,472	RGD:6480464	CTD
G	COL4A1	collagen, type IV, alpha 1		multiple interactions	ISO	13	110,801,310	110,959,496	RGD:6480464	CTD
G	COL4A6	collagen, type IV, alpha 6		multiple interactions	EXP	X	107,398,837	107,682,704	RGD:6480464	CTD
G	COL5A1	collagen, type V, alpha 1		decreases expression	ISO	9	137,533,652	137,736,689	RGD:6480464	CTD
G	COL5A1	collagen, type V, alpha 1		multiple interactions	ISO	9	137,533,652	137,736,689	RGD:6480464	CTD
G	COL5A2	collagen, type V, alpha 2		decreases expression	ISO	2	189,896,641	190,044,605	RGD:6480464	CTD
G	COL5A2	collagen, type V, alpha 2		multiple interactions	ISO	2	189,896,641	190,044,605	RGD:6480464	CTD
G	COL5A3	collagen, type V, alpha 3		multiple interactions	ISO	19	10,070,237	10,121,147	RGD:6480464	CTD
G	COL5A3	collagen, type V, alpha 3		decreases expression	ISO	19	10,070,237	10,121,147	RGD:6480464	CTD
G	COL6A3	collagen, type VI, alpha 3		multiple interactions	ISO	2	238,232,655	238,322,850	RGD:6480464	CTD
G	COL6A3	collagen, type VI, alpha 3		decreases expression	ISO	2	238,232,655	238,322,850	RGD:6480464	CTD
G	COL6A3	collagen, type VI, alpha 3		multiple interactions	ISO	2	238,232,655	238,322,850	RGD:6480464	CTD
G	COL7A1	collagen, type VII, alpha 1		multiple interactions	EXP	3	48,601,506	48,632,593	RGD:6480464	CTD
G	COL9A1	collagen, type IX, alpha 1		affects expression	ISO	6	70,925,743	71,012,786	RGD:6480464	CTD
G	COMT	catechol-O-methyltransferase		increases expression	ISO	22	19,929,263	19,957,498	RGD:6480464	CTD
G	COMT	catechol-O-methyltransferase		multiple interactions	ISO	22	19,929,263	19,957,498	RGD:6480464	CTD
G	COPB2	coatomer protein complex, subunit beta 2 (beta prime)		multiple interactions	ISO	3	139,076,433	139,108,522	RGD:6480464	CTD
G	COPB2	coatomer protein complex, subunit beta 2 (beta prime)		decreases expression	ISO	3	139,076,433	139,108,522	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		multiple interactions	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		increases expression	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		multiple interactions	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CPA1	carboxypeptidase A1 (pancreatic)		decreases expression	ISO	7	130,020,290	130,027,949	RGD:6480464	CTD
G	CPA1	carboxypeptidase A1 (pancreatic)		multiple interactions	ISO	7	130,020,290	130,027,949	RGD:6480464	CTD
G	CPE	carboxypeptidase E		decreases expression	ISO	4	166,300,097	166,419,482	RGD:6480464	CTD
G	CPE	carboxypeptidase E		multiple interactions	ISO	4	166,300,097	166,419,482	RGD:6480464	CTD
G	CPN1	carboxypeptidase N, polypeptide 1		increases expression	ISO	10	101,802,065	101,841,642	RGD:6480464	CTD
G	CPS1	carbamoyl-phosphate synthase 1, mitochondrial		increases expression	ISO	2	211,342,406	211,543,831	RGD:6480464	CTD
G	CPS1	carbamoyl-phosphate synthase 1, mitochondrial		increases expression	ISO	2	211,342,406	211,543,831	RGD:6480464	CTD
G	CRABP2	cellular retinoic acid binding protein 2		decreases expression	ISO	1	156,669,398	156,675,608	RGD:6480464	CTD
G	CREB1	cAMP responsive element binding protein 1		increases phosphorylation	EXP	2	208,394,616	208,470,284	RGD:6480464	CTD
G	CRH	corticotropin releasing hormone		increases expression	ISO	8	67,088,612	67,090,846	RGD:6480464	CTD
G	CRISP1	cysteine-rich secretory protein 1		decreases expression	ISO	6	49,801,970	49,844,809	RGD:6480464	CTD
G	CRISP1	cysteine-rich secretory protein 1		multiple interactions	ISO	6	49,801,970	49,844,809	RGD:6480464	CTD
G	CRKL	v-crk sarcoma virus CT10 oncogene homolog (avian)-like		multiple interactions	ISO	22	21,271,714	21,308,037	RGD:6480464	CTD
G	CRYAB	crystallin, alpha B		increases expression	EXP	11	111,779,350	111,782,473	RGD:6480464	CTD
G	CRYAB	crystallin, alpha B		multiple interactions	EXP	11	111,779,350	111,782,473	RGD:6480464	CTD
G	CSF1	colony stimulating factor 1 (macrophage)		multiple interactions	ISO	1	110,453,233	110,473,616	RGD:6480464	CTD
G	CSF1R	colony stimulating factor 1 receptor		increases expression	EXP	5	149,432,854	149,492,935	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF3	colony stimulating factor 3 (granulocyte)		increases expression	EXP	17	38,171,614	38,174,066	RGD:6480464	CTD
G	CSRP3	cysteine and glycine-rich protein 3 (cardiac LIM protein)		increases expression	ISO	11	19,203,577	19,232,118	RGD:6480464	CTD
G	CSRP3	cysteine and glycine-rich protein 3 (cardiac LIM protein)		multiple interactions	ISO	11	19,203,577	19,232,118	RGD:6480464	CTD
G	CST6	cystatin E/M		multiple interactions	EXP	11	65,779,462	65,780,976	RGD:6480464	CTD
G	CTNNB1	catenin (cadherin-associated protein), beta 1, 88kDa		decreases expression	ISO	3	41,240,942	41,281,939	RGD:6480464	CTD
G	CTNNB1	catenin (cadherin-associated protein), beta 1, 88kDa		decreases expression	ISO	3	41,240,942	41,281,939	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		multiple interactions	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CX3CL1	chemokine (C-X3-C motif) ligand 1		multiple interactions	ISO	16	57,406,414	57,418,956	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CXCL5	chemokine (C-X-C motif) ligand 5		multiple interactions	ISO	4	74,861,359	74,864,416	RGD:6480464	CTD
G	CXCR4	chemokine (C-X-C motif) receptor 4		increases expression	EXP	2	136,871,919	136,875,725	RGD:6480464	CTD
G	CXCR4	chemokine (C-X-C motif) receptor 4		multiple interactions	EXP	2	136,871,919	136,875,725	RGD:6480464	CTD
G	CXCR4	chemokine (C-X-C motif) receptor 4		increases expression	EXP	2	136,871,919	136,875,725	RGD:6480464	CTD
G	CXCR7	chemokine (C-X-C motif) receptor 7		decreases expression	ISO	2	237,478,380	237,490,997	RGD:6480464	CTD
G	CYB5R3	cytochrome b5 reductase 3		decreases expression	ISO	22	43,013,846	43,045,405	RGD:6480464	CTD
G	CYBB	cytochrome b-245, beta polypeptide		multiple interactions	EXP	X	37,639,270	37,672,714	RGD:6480464	CTD
G	CYCS	cytochrome c, somatic		multiple interactions	EXP	7	25,158,270	25,164,980	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		multiple interactions	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases expression	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases activity	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		decreases activity	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		decreases expression	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		increases activity	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		multiple interactions	EXP	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		decreases expression	EXP	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		decreases activity	EXP	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		affects expression	ISO	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		multiple interactions	ISO	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1A2	cytochrome P450, family 1, subfamily A, polypeptide 2		increases expression	ISO	15	75,041,184	75,048,941	RGD:6480464	CTD
G	CYP1B1	cytochrome P450, family 1, subfamily B, polypeptide 1		multiple interactions	ISO	2	38,294,746	38,303,323	RGD:6480464	CTD
G	CYP1B1	cytochrome P450, family 1, subfamily B, polypeptide 1		multiple interactions	ISO	2	38,294,746	38,303,323	RGD:6480464	CTD
G	CYP24A1	cytochrome P450, family 24, subfamily A, polypeptide 1		affects activity	ISO	20	52,769,988	52,790,516	RGD:6480464	CTD
G	CYP24A1	cytochrome P450, family 24, subfamily A, polypeptide 1		affects expression	ISO	20	52,769,988	52,790,516	RGD:6480464	CTD
G	CYP24A1	cytochrome P450, family 24, subfamily A, polypeptide 1		increases expression	ISO	20	52,769,988	52,790,516	RGD:6480464	CTD
G	CYP27A1	cytochrome P450, family 27, subfamily A, polypeptide 1		multiple interactions	EXP	2	219,646,472	219,680,016	RGD:6480464	CTD
G	CYP27A1	cytochrome P450, family 27, subfamily A, polypeptide 1		increases expression	EXP	2	219,646,472	219,680,016	RGD:6480464	CTD
G	CYP27B1	cytochrome P450, family 27, subfamily B, polypeptide 1		affects expression	ISO	12	58,156,117	58,160,976	RGD:6480464	CTD
G	CYP27B1	cytochrome P450, family 27, subfamily B, polypeptide 1		affects activity	ISO	12	58,156,117	58,160,976	RGD:6480464	CTD
G	CYP2A6	cytochrome P450, family 2, subfamily A, polypeptide 6		multiple interactions	EXP	19	41,349,443	41,356,352	RGD:6480464	CTD
G	CYP2A6	cytochrome P450, family 2, subfamily A, polypeptide 6		increases activity	EXP	19	41,349,443	41,356,352	RGD:6480464	CTD
G	CYP2A6	cytochrome P450, family 2, subfamily A, polypeptide 6		increases expression	EXP	19	41,349,443	41,356,352	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		affects expression	ISO	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		increases expression	ISO	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		multiple interactions	EXP	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		multiple interactions	EXP	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		increases expression	EXP	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2B6	cytochrome P450, family 2, subfamily B, polypeptide 6		increases expression	EXP	19	41,497,204	41,524,301	RGD:6480464	CTD
G	CYP2C8	cytochrome P450, family 2, subfamily C, polypeptide 8		affects binding	EXP	10	96,796,529	96,829,254	RGD:6480464	CTD
G	CYP2C8	cytochrome P450, family 2, subfamily C, polypeptide 8		increases expression	EXP	10	96,796,529	96,829,254	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		multiple interactions	EXP	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		increases expression	EXP	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		increases expression	ISO	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		decreases expression	ISO	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		increases expression	ISO	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP3A	cytochrome P450, subfamily IIA (niphedipine oxidase)		increases expression	ISO				RGD:6480464	CTD
G	CYP3A	cytochrome P450, subfamily IIA (niphedipine oxidase)		increases expression	ISO				RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		increases expression	ISO	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		affects expression	ISO	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		increases expression	ISO	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		affects metabolic processing	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		multiple interactions	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		multiple interactions	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		multiple interactions	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		increases activity	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		increases expression	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		multiple interactions	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A4	cytochrome P450, family 3, subfamily A, polypeptide 4		increases expression	EXP	7	99,354,583	99,381,811	RGD:6480464	CTD
G	CYP3A5	cytochrome P450, family 3, subfamily A, polypeptide 5		increases expression	EXP	7	99,245,813	99,277,621	RGD:6480464	CTD
G	CYP3A5	cytochrome P450, family 3, subfamily A, polypeptide 5		decreases expression	ISO	7	99,245,813	99,277,621	RGD:6480464	CTD
G	CYP3A7	cytochrome P450, family 3, subfamily A, polypeptide 7		increases expression	ISO	7	99,302,660	99,332,819	RGD:6480464	CTD
G	CYP4Z1	cytochrome P450, family 4, subfamily Z, polypeptide 1		increases expression	EXP	1	47,533,160	47,583,992	RGD:6480464	CTD
G	CYP4Z1	cytochrome P450, family 4, subfamily Z, polypeptide 1		multiple interactions	EXP	1	47,533,160	47,583,992	RGD:6480464	CTD
G	CYP51A1	cytochrome P450, family 51, subfamily A, polypeptide 1		decreases expression	ISO	7	91,741,463	91,764,059	RGD:6480464	CTD
G	CYP51A1	cytochrome P450, family 51, subfamily A, polypeptide 1		affects expression	ISO	7	91,741,463	91,764,059	RGD:6480464	CTD
G	CYP7A1	cytochrome P450, family 7, subfamily A, polypeptide 1		increases expression	ISO	8	59,402,737	59,412,720	RGD:6480464	CTD
G	DBH	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		multiple interactions	ISO	9	136,501,485	136,524,466	RGD:6480464	CTD
G	DBH	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		increases expression	ISO	9	136,501,485	136,524,466	RGD:6480464	CTD
G	DBH	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		multiple interactions	ISO	9	136,501,485	136,524,466	RGD:6480464	CTD
G	DBH	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		decreases expression	ISO	9	136,501,485	136,524,466	RGD:6480464	CTD
G	DBP	D site of albumin promoter (albumin D-box) binding protein		decreases expression	ISO	19	49,133,817	49,140,639	RGD:6480464	CTD
G	DBP	D site of albumin promoter (albumin D-box) binding protein		increases expression	ISO	19	49,133,817	49,140,639	RGD:6480464	CTD
G	DCN	decorin		multiple interactions	ISO	12	91,539,035	91,576,806	RGD:6480464	CTD
G	DDIT4	DNA-damage-inducible transcript 4		increases expression	ISO	10	74,033,677	74,035,797	RGD:6480464	CTD
G	DDIT4	DNA-damage-inducible transcript 4		multiple interactions	ISO	10	74,033,677	74,035,797	RGD:6480464	CTD
G	DDIT4	DNA-damage-inducible transcript 4		increases expression	ISO	10	74,033,677	74,035,797	RGD:6480464	CTD
G	DECR1	2,4-dienoyl CoA reductase 1, mitochondrial		increases expression	ISO	8	91,013,580	91,064,227	RGD:6480464	CTD
G	DEGS1	delta(4)-desaturase, sphingolipid 1		decreases expression	ISO	1	224,370,910	224,381,143	RGD:6480464	CTD
G	DEGS1	delta(4)-desaturase, sphingolipid 1		multiple interactions	ISO	1	224,370,910	224,381,143	RGD:6480464	CTD
G	DFNA5	deafness, autosomal dominant 5		increases expression	EXP	7	24,737,974	24,797,639	RGD:6480464	CTD
G	DGAT1	diacylglycerol O-acyltransferase 1		multiple interactions	ISO	8	145,538,247	145,550,567	RGD:6480464	CTD
G	DGAT2	diacylglycerol O-acyltransferase 2		increases expression	ISO	11	75,479,778	75,512,581	RGD:6480464	CTD
G	DGAT2	diacylglycerol O-acyltransferase 2		multiple interactions	ISO	11	75,479,778	75,512,581	RGD:6480464	CTD
G	DIABLO	diablo, IAP-binding mitochondrial protein		affects localization	EXP	12	122,692,209	122,712,068	RGD:6480464	CTD
G	DIABLO	diablo, IAP-binding mitochondrial protein		multiple interactions	EXP	12	122,692,209	122,712,068	RGD:6480464	CTD
G	DIO3	deiodinase, iodothyronine, type III		decreases activity	EXP	14	102,027,688	102,029,789	RGD:6480464	CTD
G	DNAJA1	DnaJ (Hsp40) homolog, subfamily A, member 1		increases expression	ISO	9	33,025,209	33,039,062	RGD:6480464	CTD
G	DNAJB9	DnaJ (Hsp40) homolog, subfamily B, member 9		multiple interactions	ISO	7	108,210,189	108,215,294	RGD:6480464	CTD
G	DNAJB9	DnaJ (Hsp40) homolog, subfamily B, member 9		increases expression	ISO	7	108,210,189	108,215,294	RGD:6480464	CTD
G	DUSP1	dual specificity phosphatase 1		increases expression	EXP	5	172,195,093	172,198,203	RGD:6480464	CTD
G	DUSP1	dual specificity phosphatase 1		multiple interactions	ISO	5	172,195,093	172,198,203	RGD:6480464	CTD
G	DUSP28	dual specificity phosphatase 28		increases expression	ISO	2	241,499,471	241,503,431	RGD:6480464	CTD
G	EDN1	endothelin 1		multiple interactions	ISO	6	12,290,529	12,297,427	RGD:6480464	CTD
G	EDN1	endothelin 1		decreases expression	EXP	6	12,290,529	12,297,427	RGD:6480464	CTD
G	EDN1	endothelin 1		multiple interactions	ISO	6	12,290,529	12,297,427	RGD:6480464	CTD
G	EDNRB	endothelin receptor type B		multiple interactions	ISO	13 13	78,469,616 78,513,393	78,549,664 78,549,674	RGD:6480464	CTD
G	EEF1A2	eukaryotic translation elongation factor 1 alpha 2		increases expression	EXP	20	62,119,365	62,130,668	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	ISO	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	ISO	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	EXP	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	EXP	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	ISO	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGF	epidermal growth factor		multiple interactions	ISO	4	110,834,040	110,934,118	RGD:6480464	CTD
G	EGFR	epidermal growth factor receptor		multiple interactions	EXP	7	55,086,725	55,275,031	RGD:6480464	CTD
G	EGFR	epidermal growth factor receptor		multiple interactions	ISO	7	55,086,725	55,275,031	RGD:6480464	CTD
G	EGR1	early growth response 1		multiple interactions	ISO	5	137,801,181	137,805,004	RGD:6480464	CTD
G	EIF4EBP1	eukaryotic translation initiation factor 4E binding protein 1		increases expression	ISO	8	37,888,020	37,917,883	RGD:6480464	CTD
G	EIF4EBP1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	ISO	8	37,888,020	37,917,883	RGD:6480464	CTD
G	EIF4G3	eukaryotic translation initiation factor 4 gamma, 3		increases expression	ISO	1	21,132,785	21,503,381	RGD:6480464	CTD
G	EIF4G3	eukaryotic translation initiation factor 4 gamma, 3		multiple interactions	ISO	1	21,132,785	21,503,381	RGD:6480464	CTD
G	ELOVL3	ELOVL fatty acid elongase 3		multiple interactions	ISO	10	103,986,143	103,989,346	RGD:6480464	CTD
G	ELOVL6	ELOVL fatty acid elongase 6		multiple interactions	ISO	4	110,970,229	111,119,820	RGD:6480464	CTD
G	EMB	embigin		multiple interactions	ISO	5	49,692,031	49,737,234	RGD:6480464	CTD
G	EMP1	epithelial membrane protein 1		multiple interactions	ISO	12	13,349,602	13,369,708	RGD:6480464	CTD
G	EMP2	epithelial membrane protein 2		multiple interactions	EXP	16	10,622,279	10,674,539	RGD:6480464	CTD
G	ENDOD1	endonuclease domain containing 1		decreases expression	EXP	11	94,822,974	94,865,815	RGD:6480464	CTD
G	ENPP2	ectonucleotide pyrophosphatase/phosphodiesterase 2		multiple interactions	ISO	8	120,569,317	120,651,106	RGD:6480464	CTD
G	EP300	E1A binding protein p300		multiple interactions	ISO	22	41,488,614	41,576,081	RGD:6480464	CTD
G	EPHA7	EPH receptor A7		multiple interactions	ISO	6	93,949,738	94,129,300	RGD:6480464	CTD
G	EPHA7	EPH receptor A7		decreases expression	ISO	6	93,949,738	94,129,300	RGD:6480464	CTD
G	EPHX2	epoxide hydrolase 2, cytoplasmic		multiple interactions	ISO	8	27,348,519	27,402,439	RGD:6480464	CTD
G	EPHX2	epoxide hydrolase 2, cytoplasmic		increases expression	ISO	8	27,348,519	27,402,439	RGD:6480464	CTD
G	ERBB4	v-erb-a erythroblastic leukemia viral oncogene homolog 4 (avian)		increases expression	EXP	2	212,240,442	213,403,352	RGD:6480464	CTD
G	EREG	epiregulin		increases expression	EXP	4	75,230,860	75,254,477	RGD:6480464	CTD
G	ERP29	endoplasmic reticulum protein 29		decreases expression	ISO	12	112,451,152	112,461,024	RGD:6480464	CTD
G	ERRFI1	ERBB receptor feedback inhibitor 1		increases expression	ISO	1	8,071,779	8,086,393	RGD:6480464	CTD
G	ESPL1	extra spindle pole bodies homolog 1 (S. cerevisiae)		multiple interactions	ISO	12	53,662,083	53,687,427	RGD:6480464	CTD
G	ESPL1	extra spindle pole bodies homolog 1 (S. cerevisiae)		decreases expression	ISO	12	53,662,083	53,687,427	RGD:6480464	CTD
G	ESR1	estrogen receptor 1		decreases expression	EXP	6	152,011,631	152,424,409	RGD:6480464	CTD
G	ETS1	v-ets erythroblastosis virus E26 oncogene homolog 1 (avian)		decreases expression	ISO	11	128,328,656	128,457,453	RGD:6480464	CTD
G	ETS2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		increases expression	EXP	21	40,177,231	40,196,879	RGD:6480464	CTD
G	EVL	Enah/Vasp-like		multiple interactions	ISO	14	100,531,751	100,610,573	RGD:6480464	CTD
G	EVL	Enah/Vasp-like		decreases expression	ISO	14	100,531,751	100,610,573	RGD:6480464	CTD
G	EXOC2	exocyst complex component 2		decreases expression	ISO	6	485,138	693,141	RGD:6480464	CTD
G	F2	coagulation factor II (thrombin)		multiple interactions	EXP	11	46,740,743	46,761,056	RGD:6480464	CTD
G	F2	coagulation factor II (thrombin)		multiple interactions	ISO	11	46,740,743	46,761,056	RGD:6480464	CTD
G	F2	coagulation factor II (thrombin)		affects expression	ISO	11	46,740,743	46,761,056	RGD:6480464	CTD
G	F2R	coagulation factor II (thrombin) receptor		increases expression	EXP	5	76,011,868	76,031,595	RGD:6480464	CTD
G	F2R	coagulation factor II (thrombin) receptor		affects expression	ISO	5	76,011,868	76,031,595	RGD:6480464	CTD
G	F2R	coagulation factor II (thrombin) receptor		increases expression	ISO	5	76,011,868	76,031,595	RGD:6480464	CTD
G	F2R	coagulation factor II (thrombin) receptor		multiple interactions	ISO	5	76,011,868	76,031,595	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	EXP	1	94,994,732	95,007,413	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	1	94,994,732	95,007,413	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	1	94,994,732	95,007,413	RGD:6480464	CTD
G	FABP1	fatty acid binding protein 1, liver		decreases expression	ISO	2	88,422,501	88,427,650	RGD:6480464	CTD
G	FABP4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	8	82,390,732	82,395,473	RGD:6480464	CTD
G	FABP4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	8	82,390,732	82,395,473	RGD:6480464	CTD
G	FABP4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	8	82,390,732	82,395,473	RGD:6480464	CTD
G	FABP4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	8	82,390,732	82,395,473	RGD:6480464	CTD
G	FADS1	fatty acid desaturase 1		decreases expression	ISO	11	61,567,097	61,584,529	RGD:6480464	CTD
G	FAH	fumarylacetoacetate hydrolase (fumarylacetoacetase)		increases expression	ISO	15	80,445,233	80,478,924	RGD:6480464	CTD
G	FAH	fumarylacetoacetate hydrolase (fumarylacetoacetase)		multiple interactions	ISO	15	80,445,233	80,478,924	RGD:6480464	CTD
G	FAM208A	family with sequence similarity 208, member A		increases expression	ISO	3	56,654,160	56,717,135	RGD:6480464	CTD
G	FAM216A	family with sequence similarity 216, member A		decreases expression	EXP	12	110,906,232	110,928,192	RGD:6480464	CTD
G	FAM65B	family with sequence similarity 65, member B		increases expression	EXP	6	24,804,513	24,911,195	RGD:6480464	CTD
G	FAS	Fas (TNF receptor superfamily, member 6)		increases expression	EXP	10	90,750,288	90,775,542	RGD:6480464	CTD
G	FAS	Fas (TNF receptor superfamily, member 6)		multiple interactions	EXP	10	90,750,288	90,775,542	RGD:6480464	CTD
G	FAS	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	10	90,750,288	90,775,542	RGD:6480464	CTD
G	FAS	Fas (TNF receptor superfamily, member 6)		decreases expression	ISO	10	90,750,288	90,775,542	RGD:6480464	CTD
G	FASLG	Fas ligand (TNF superfamily, member 6)		decreases expression	EXP	1	172,628,185	172,636,013	RGD:6480464	CTD
G	FASLG	Fas ligand (TNF superfamily, member 6)		decreases secretion	EXP	1	172,628,185	172,636,013	RGD:6480464	CTD
G	FASLG	Fas ligand (TNF superfamily, member 6)		decreases expression	ISO	1	172,628,185	172,636,013	RGD:6480464	CTD
G	FASN	fatty acid synthase		increases expression	ISO	17	80,036,214	80,056,106	RGD:6480464	CTD
G	FBN2	fibrillin 2		multiple interactions	ISO	5	127,593,601	127,873,735	RGD:6480464	CTD
G	FBP2	fructose-1,6-bisphosphatase 2		decreases expression	ISO	9	97,321,002	97,356,075	RGD:6480464	CTD
G	FBP2	fructose-1,6-bisphosphatase 2		multiple interactions	ISO	9	97,321,002	97,356,075	RGD:6480464	CTD
G	FBXO32	F-box protein 32		multiple interactions	ISO	8	124,510,127	124,553,493	RGD:6480464	CTD
G	FBXO32	F-box protein 32		increases expression	ISO	8	124,510,127	124,553,493	RGD:6480464	CTD
G	FBXO32	F-box protein 32		increases expression	ISO	8	124,510,127	124,553,493	RGD:6480464	CTD
G	FBXO32	F-box protein 32		multiple interactions	ISO	8	124,510,127	124,553,493	RGD:6480464	CTD
G	FDFT1	farnesyl-diphosphate farnesyltransferase 1		increases expression	ISO	8	11,660,190	11,696,818	RGD:6480464	CTD
G	FDPS	farnesyl diphosphate synthase		multiple interactions	ISO	1	155,278,539	155,290,457	RGD:6480464	CTD
G	FDX1	ferredoxin 1		multiple interactions	ISO	11	110,300,661	110,335,608	RGD:6480464	CTD
G	FDX1	ferredoxin 1		decreases expression	ISO	11	110,300,661	110,335,608	RGD:6480464	CTD
G	FDX1	ferredoxin 1		multiple interactions	ISO	11	110,300,661	110,335,608	RGD:6480464	CTD
G	FGB	fibrinogen beta chain		decreases expression	ISO	4	155,484,132	155,493,915	RGD:6480464	CTD
G	FGF2	fibroblast growth factor 2 (basic)		multiple interactions	ISO	4	123,747,863	123,819,390	RGD:6480464	CTD
G	FGF7	fibroblast growth factor 7		multiple interactions	ISO	15	49,715,375	49,779,523	RGD:6480464	CTD
G	FGFR2	fibroblast growth factor receptor 2		multiple interactions	ISO	10	123,237,844	123,357,972	RGD:6480464	CTD
G	FGFR2	fibroblast growth factor receptor 2		decreases expression	ISO	10	123,237,844	123,357,972	RGD:6480464	CTD
G	FGFR2	fibroblast growth factor receptor 2		multiple interactions	ISO	10	123,237,844	123,357,972	RGD:6480464	CTD
G	FGFR3	fibroblast growth factor receptor 3		decreases response to substance	ISO	4	1,795,039	1,810,599	RGD:6480464	CTD
G	FHL1	four and a half LIM domains 1		increases expression	EXP	X	135,228,861	135,293,518	RGD:6480464	CTD
G	FIGF	c-fos induced growth factor (vascular endothelial growth factor D)		multiple interactions	ISO	X	15,363,713	15,402,535	RGD:6480464	CTD
G	FKBP4	FK506 binding protein 4, 59kDa		increases expression	ISO	12	2,904,108	2,914,589	RGD:6480464	CTD
G	FKBP4	FK506 binding protein 4, 59kDa		multiple interactions	ISO	12	2,904,108	2,914,589	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		increases expression	EXP	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		multiple interactions	EXP	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		multiple interactions	ISO	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		increases expression	ISO	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		multiple interactions	ISO	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		multiple interactions	EXP	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FKBP5	FK506 binding protein 5		increases expression	EXP	6	35,541,362	35,696,360	RGD:6480464	CTD
G	FLOT1	flotillin 1		multiple interactions	EXP	6	30,695,511	30,710,453	RGD:6480464	CTD
G	FMO1	flavin containing monooxygenase 1		affects expression	ISO	1	171,217,663	171,255,113	RGD:6480464	CTD
G	FMO1	flavin containing monooxygenase 1		multiple interactions	ISO	1	171,217,663	171,255,113	RGD:6480464	CTD
G	FMO3	flavin containing monooxygenase 3		multiple interactions	ISO	1	171,060,018	171,086,959	RGD:6480464	CTD
G	FN1	fibronectin 1		multiple interactions	ISO	2	216,225,177	216,300,791	RGD:6480464	CTD
G	FN1	fibronectin 1		decreases expression	ISO	2	216,225,177	216,300,791	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		multiple interactions	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		multiple interactions	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOS	FBJ murine osteosarcoma viral oncogene homolog		decreases expression	ISO	14	75,745,481	75,748,937	RGD:6480464	CTD
G	FOSL2	FOS-like antigen 2		increases expression	ISO	2	28,615,779	28,637,516	RGD:6480464	CTD
G	FOXG1B	forkhead box G1B		decreases expression	ISO				RGD:6480464	CTD
G	FOXG1B	forkhead box G1B		multiple interactions	ISO				RGD:6480464	CTD
G	FOXO1	forkhead box O1		increases expression	ISO	13	41,129,801	41,240,734	RGD:6480464	CTD
G	FOXO1	forkhead box O1		increases expression	ISO	13	41,129,801	41,240,734	RGD:6480464	CTD
G	FOXO1	forkhead box O1		multiple interactions	ISO	13	41,129,801	41,240,734	RGD:6480464	CTD
G	FOXQ1	forkhead box Q1		multiple interactions	ISO	6	1,312,675	1,314,993	RGD:6480464	CTD
G	FPR1	formyl peptide receptor 1		increases expression	EXP	19	52,249,023	52,255,150	RGD:6480464	CTD
G	FPR1	formyl peptide receptor 1		multiple interactions	EXP	19	52,249,023	52,255,150	RGD:6480464	CTD
G	FSCN1	fascin homolog 1, actin-bundling protein (Strongylocentrotus purpuratus)		multiple interactions	ISO	7	5,632,436	5,646,287	RGD:6480464	CTD
G	HAO1	hydroxyacid oxidase (glycolate oxidase) 1		multiple interactions	ISO	20	7,863,631	7,921,093	RGD:6480464	CTD
G	HAS2	hyaluronan synthase 2		decreases expression	EXP	8	122,625,271	122,653,630	RGD:6480464	CTD
G	HBEGF	heparin-binding EGF-like growth factor		decreases expression	ISO	5	139,712,428	139,726,188	RGD:6480464	CTD
G	HDAC1	histone deacetylase 1		multiple interactions	ISO	1	32,757,708	32,799,224	RGD:6480464	CTD
G	HDAC4	histone deacetylase 4		increases expression	EXP	2	239,969,864	240,322,643	RGD:6480464	CTD
G	HDC	histidine decarboxylase		multiple interactions	ISO	15	50,534,144	50,558,162	RGD:6480464	CTD
G	HDC	histidine decarboxylase		multiple interactions	ISO	15	50,534,144	50,558,162	RGD:6480464	CTD
G	HDC	histidine decarboxylase		decreases activity	ISO	15	50,534,144	50,558,162	RGD:6480464	CTD
G	HDC	histidine decarboxylase		decreases expression	ISO	15	50,534,144	50,558,162	RGD:6480464	CTD
G	HES1	hairy and enhancer of split 1, (Drosophila)		decreases expression	EXP	3	193,853,931	193,856,401	RGD:6480464	CTD
G	HIBADH	3-hydroxyisobutyrate dehydrogenase		increases expression	ISO	7	27,565,059	27,702,620	RGD:6480464	CTD
G	HIST4H4	histone cluster 4, H4		increases acetylation	EXP	12	14,923,654	14,924,065	RGD:6480464	CTD
G	HIST4H4	histone cluster 4, H4		multiple interactions	EXP	12	14,923,654	14,924,065	RGD:6480464	CTD
G	HK2	hexokinase 2		multiple interactions	ISO	2	75,059,782	75,120,481	RGD:6480464	CTD
G	HK2	hexokinase 2		decreases expression	ISO	2	75,059,782	75,120,481	RGD:6480464	CTD
G	HLA-DMB	major histocompatibility complex, class II, DM beta		decreases expression	EXP	6	32,902,406	32,908,847	RGD:6480464	CTD
G	HLA-DPB1	major histocompatibility complex, class II, DP beta 1		increases expression	EXP	6	33,043,703	33,057,473	RGD:6480464	CTD
G	HLA-DQA1	major histocompatibility complex, class II, DQ alpha 1		increases expression	EXP	6	32,605,183	32,611,429	RGD:6480464	CTD
G	HLA-DQB1	major histocompatibility complex, class II, DQ beta 1		affects expression	EXP	6	32,627,241	32,634,466	RGD:6480464	CTD
G	HLA-DRA	major histocompatibility complex, class II, DR alpha		increases expression	EXP	6	32,407,619	32,412,823	RGD:6480464	CTD
G	HMGB2	high mobility group box 2		decreases expression	ISO	4	174,252,527	174,255,595	RGD:6480464	CTD
G	HMGCR	3-hydroxy-3-methylglutaryl-CoA reductase		multiple interactions	ISO	5	74,632,993	74,657,926	RGD:6480464	CTD
G	HMGCR	3-hydroxy-3-methylglutaryl-CoA reductase		increases expression	ISO	5	74,632,993	74,657,926	RGD:6480464	CTD
G	HMGCS1	3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble)		decreases expression	EXP	5	43,287,572	43,313,614	RGD:6480464	CTD
G	HMGCS1	3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble)		increases expression	ISO	5	43,287,572	43,313,614	RGD:6480464	CTD
G	IL12B	interleukin 12B (natural killer cell stimulatory factor 2, cytotoxic lymphocyte maturation factor 2, p40)		multiple interactions	ISO	5	158,741,791	158,757,481	RGD:6480464	CTD
G	IL12B	interleukin 12B (natural killer cell stimulatory factor 2, cytotoxic lymphocyte maturation factor 2, p40)		multiple interactions	ISO	5	158,741,791	158,757,481	RGD:6480464	CTD
G	IL12RB1	interleukin 12 receptor, beta 1		decreases expression	EXP	19	18,170,371	18,197,697	RGD:6480464	CTD
G	IL12RB2	interleukin 12 receptor, beta 2		decreases expression	EXP	1	67,773,047	67,862,583	RGD:6480464	CTD
G	IL13	interleukin 13		multiple interactions	EXP	5	131,993,865	131,996,801	RGD:6480464	CTD
G	IL13	interleukin 13		decreases expression	ISO	5	131,993,865	131,996,801	RGD:6480464	CTD
G	IL13RA1	interleukin 13 receptor, alpha 1		increases expression	ISO	X	117,861,559	117,928,496	RGD:6480464	CTD
G	IL15	interleukin 15		increases expression	EXP	4	142,557,749	142,655,140	RGD:6480464	CTD
G	IL15	interleukin 15		decreases expression	ISO	4	142,557,749	142,655,140	RGD:6480464	CTD
G	IL1A	interleukin 1, alpha		multiple interactions	ISO	2	113,531,492	113,542,971	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	EXP	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	INS	insulin		multiple interactions	ISO	11	2,181,009	2,182,439	RGD:6480464	CTD
G	INSR	insulin receptor		multiple interactions	ISO	19	7,112,266	7,294,011	RGD:6480464	CTD
G	IRS1	insulin receptor substrate 1		multiple interactions	ISO	2	227,596,033	227,663,506	RGD:6480464	CTD
G	ITGAM	integrin, alpha M (complement component 3 receptor 3 subunit)		multiple interactions	EXP	16	31,271,288	31,344,213	RGD:6480464	CTD
G	ITSN1	intersectin 1 (SH3 domain protein)		decreases expression	ISO	21	35,014,784	35,261,609	RGD:6480464	CTD
G	ITSN1	intersectin 1 (SH3 domain protein)		multiple interactions	ISO	21	35,014,784	35,261,609	RGD:6480464	CTD
G	JAG1	jagged 1		multiple interactions	ISO	20	10,618,332	10,654,694	RGD:6480464	CTD
G	JAM3	junctional adhesion molecule 3		increases expression	EXP	11	133,938,820	134,021,652	RGD:6480464	CTD
G	JUN	jun proto-oncogene		decreases expression	ISO	1	59,246,463	59,249,785	RGD:6480464	CTD
G	KCNA2	potassium voltage-gated channel, shaker-related subfamily, member 2		multiple interactions	ISO	1	111,136,202	111,174,096	RGD:6480464	CTD
G	KCNA5	potassium voltage-gated channel, shaker-related subfamily, member 5		increases expression	ISO	12	5,153,085	5,155,954	RGD:6480464	CTD
G	KCNA5	potassium voltage-gated channel, shaker-related subfamily, member 5		multiple interactions	ISO	12	5,153,085	5,155,954	RGD:6480464	CTD
G	KCNAB1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		decreases expression	ISO	3	155,838,337	156,256,927	RGD:6480464	CTD
G	KCNAB1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		multiple interactions	ISO	3	155,838,337	156,256,927	RGD:6480464	CTD
G	KCNB1	potassium voltage-gated channel, Shab-related subfamily, member 1		multiple interactions	ISO	20	47,988,505	48,099,181	RGD:6480464	CTD
G	KCNK1	potassium channel, subfamily K, member 1		increases expression	ISO	1	233,749,750	233,808,258	RGD:6480464	CTD
G	KCNMA1	potassium large conductance calcium-activated channel, subfamily M, alpha member 1		multiple interactions	ISO	10	78,629,359	79,397,577	RGD:6480464	CTD
G	KCNN4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		decreases expression	ISO	19	44,270,685	44,285,409	RGD:6480464	CTD
G	KCNN4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		multiple interactions	ISO	19	44,270,685	44,285,409	RGD:6480464	CTD
G	KCTD12	potassium channel tetramerisation domain containing 12		multiple interactions	EXP	13	77,454,304	77,460,540	RGD:6480464	CTD
G	KIF1A	kinesin family member 1A		multiple interactions	ISO	2	241,653,181	241,759,725	RGD:6480464	CTD
G	KIF1A	kinesin family member 1A		decreases expression	ISO	2	241,653,181	241,759,725	RGD:6480464	CTD
G	KIT	v-kit Hardy-Zuckerman 4 feline sarcoma viral oncogene homolog		decreases expression	ISO	4	55,524,095	55,606,881	RGD:6480464	CTD
G	KITLG	KIT ligand		multiple interactions	ISO	12	88,886,570	88,974,250	RGD:6480464	CTD
G	KLF4	Kruppel-like factor 4 (gut)		multiple interactions	ISO	9	110,247,133	110,252,047	RGD:6480464	CTD
G	MAPK8	mitogen-activated protein kinase 8		multiple interactions	EXP	10	49,609,687	49,643,183	RGD:6480464	CTD
G	MAPK8	mitogen-activated protein kinase 8		multiple interactions	ISO	10	49,609,687	49,643,183	RGD:6480464	CTD
G	MAPK8	mitogen-activated protein kinase 8		multiple interactions	ISO	10	49,609,687	49,643,183	RGD:6480464	CTD
G	MAPK8	mitogen-activated protein kinase 8		affects phosphorylation	ISO	10	49,609,687	49,643,183	RGD:6480464	CTD
G	MARCKS	myristoylated alanine-rich protein kinase C substrate		multiple interactions	ISO	6	114,178,527	114,184,652	RGD:6480464	CTD
G	MBL2	mannose-binding lectin (protein C) 2, soluble		decreases expression	ISO	10	54,525,140	54,531,460	RGD:6480464	CTD
G	MBL2	mannose-binding lectin (protein C) 2, soluble		multiple interactions	ISO	10	54,525,140	54,531,460	RGD:6480464	CTD
G	MBNL1	muscleblind-like splicing regulator 1		increases expression	ISO	3	151,985,829	152,183,569	RGD:6480464	CTD
G	MBNL1	muscleblind-like splicing regulator 1		multiple interactions	ISO	3	151,985,829	152,183,569	RGD:6480464	CTD
G	MC5R	melanocortin 5 receptor		increases expression	ISO	18	13,825,543	13,826,861	RGD:6480464	CTD
G	MC5R	melanocortin 5 receptor		multiple interactions	ISO	18	13,825,543	13,826,861	RGD:6480464	CTD
G	MCAM	melanoma cell adhesion molecule		decreases expression	ISO	11	119,179,234	119,187,840	RGD:6480464	CTD
G	MCAM	melanoma cell adhesion molecule		multiple interactions	ISO	11	119,179,234	119,187,840	RGD:6480464	CTD
G	MCL1	myeloid cell leukemia sequence 1 (BCL2-related)		increases expression	EXP	1	150,547,027	150,552,214	RGD:6480464	CTD
G	MCL1	myeloid cell leukemia sequence 1 (BCL2-related)		multiple interactions	ISO	1	150,547,027	150,552,214	RGD:6480464	CTD
G	MCL1	myeloid cell leukemia sequence 1 (BCL2-related)		increases expression	ISO	1	150,547,027	150,552,214	RGD:6480464	CTD
G	MCOLN2	mucolipin 2		decreases expression	ISO	1	85,391,266	85,462,796	RGD:6480464	CTD
G	MCOLN2	mucolipin 2		multiple interactions	ISO	1	85,391,266	85,462,796	RGD:6480464	CTD
G	ME1	malic enzyme 1, NADP(+)-dependent, cytosolic		multiple interactions	ISO	6	83,920,108	84,140,938	RGD:6480464	CTD
G	ME1	malic enzyme 1, NADP(+)-dependent, cytosolic		decreases expression	ISO	6	83,920,108	84,140,938	RGD:6480464	CTD
G	MED1	mediator complex subunit 1		affects response to substance	ISO	17	37,560,538	37,607,527	RGD:6480464	CTD
G	METTL7A	methyltransferase like 7A		increases expression	EXP	12	51,318,534	51,326,300	RGD:6480464	CTD
G	MMP9	matrix metallopeptidase 9 (gelatinase B, 92kDa gelatinase, 92kDa type IV collagenase)		multiple interactions	ISO	20	44,637,547	44,645,200	RGD:6480464	CTD
G	MT-CO2	mitochondrially encoded cytochrome c oxidase II		increases expression	ISO	MT	7,586	8,269	RGD:6480464	CTD
G	MT-CO3	mitochondrially encoded cytochrome c oxidase III		increases expression	ISO				RGD:6480464	CTD
G	MT-COI	mitochondrially encoded cytochrome c oxidase I		increases expression	ISO	MT	5,904	7,445	RGD:6480464	CTD
G	MT1A	metallothionein 1A		multiple interactions	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	MT1A	metallothionein 1A		increases expression	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	MT1A	metallothionein 1A		multiple interactions	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	NELFA	negative elongation factor complex member A		increases expression	EXP	4	1,984,441	2,010,962	RGD:6480464	CTD
G	NOC2L	nucleolar complex associated 2 homolog (S. cerevisiae)		decreases expression	EXP	1	879,583	894,679	RGD:6480464	CTD
G	NOC3L	nucleolar complex associated 3 homolog (S. cerevisiae)		increases expression	ISO	10	96,092,989	96,122,683	RGD:6480464	CTD
G	NOL3	nucleolar protein 3 (apoptosis repressor with CARD domain)		multiple interactions	ISO	16	67,204,405	67,209,643	RGD:6480464	CTD
G	NOL3	nucleolar protein 3 (apoptosis repressor with CARD domain)		increases expression	ISO	16	67,204,405	67,209,643	RGD:6480464	CTD
G	NOP16	NOP16 nucleolar protein		decreases expression	EXP	5	175,810,940	175,815,763	RGD:6480464	CTD
G	NOS1	nitric oxide synthase 1 (neuronal)		decreases expression	ISO	12	117,645,947	117,799,607	RGD:6480464	CTD
G	NOS1	nitric oxide synthase 1 (neuronal)		multiple interactions	ISO	12	117,645,947	117,799,607	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		decreases expression	EXP	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		decreases expression	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		decreases expression	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		affects expression	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		affects response to substance	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		affects localization	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		increases expression	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		increases activity	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		increases expression	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		multiple interactions	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C2	nuclear receptor subfamily 3, group C, member 2		increases expression	EXP	4	148,999,915	149,363,672	RGD:6480464	CTD
G	NR4A1	nuclear receptor subfamily 4, group A, member 1		multiple interactions	ISO	12	52,416,616	52,453,291	RGD:6480464	CTD
G	NR4A1	nuclear receptor subfamily 4, group A, member 1		affects localization	ISO	12	52,416,616	52,453,291	RGD:6480464	CTD
G	NR6A1	nuclear receptor subfamily 6, group A, member 1		increases expression	EXP	9	127,284,703	127,533,576	RGD:6480464	CTD
G	NRXN2	neurexin 2		multiple interactions	ISO	11	64,373,646	64,490,660	RGD:6480464	CTD
G	NRXN2	neurexin 2		increases expression	ISO	11	64,373,646	64,490,660	RGD:6480464	CTD
G	NUDT21	nudix (nucleoside diphosphate linked moiety X)-type motif 21		increases expression	ISO	16	56,463,048	56,485,261	RGD:6480464	CTD
G	ODC1	ornithine decarboxylase 1		decreases expression	ISO	2	10,580,508	10,588,453	RGD:6480464	CTD
G	ODC1	ornithine decarboxylase 1		increases expression	ISO	2	10,580,508	10,588,453	RGD:6480464	CTD
G	OGN	osteoglycin		multiple interactions	ISO	9	95,146,249	95,166,937	RGD:6480464	CTD
G	OLFM4	olfactomedin 4		increases expression	EXP	13	53,602,876	53,626,196	RGD:6480464	CTD
G	OMD	osteomodulin		multiple interactions	ISO	9	95,176,527	95,186,836	RGD:6480464	CTD
G	ONECUT1	one cut homeobox 1		increases expression	ISO	15	53,049,353	53,082,209	RGD:6480464	CTD
G	ORM1	orosomucoid 1		multiple interactions	ISO	9	117,085,303	117,088,759	RGD:6480464	CTD
G	ORM2	orosomucoid 2		multiple interactions	ISO	9	117,092,069	117,095,536	RGD:6480464	CTD
G	PARP1	poly (ADP-ribose) polymerase 1		multiple interactions	EXP	1	226,548,392	226,595,801	RGD:6480464	CTD
G	POU5F1	POU class 5 homeobox 1		multiple interactions	ISO	6	31,132,114	31,138,451	RGD:6480464	CTD
G	PPARD	peroxisome proliferator-activated receptor delta		increases expression	EXP	6	35,310,335	35,395,968	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		increases expression	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARG	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	3	12,329,349	12,475,855	RGD:6480464	CTD
G	PPARGC1A	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		increases expression	EXP	4	23,793,644	23,891,700	RGD:6480464	CTD
G	PPARGC1A	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		decreases expression	ISO	4	23,793,644	23,891,700	RGD:6480464	CTD
G	PPARGC1A	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	ISO	4	23,793,644	23,891,700	RGD:6480464	CTD
G	PPARGC1A	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		increases expression	ISO	4	23,793,644	23,891,700	RGD:6480464	CTD
G	PPARGC1A	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	ISO	4	23,793,644	23,891,700	RGD:6480464	CTD
G	PPAT	phosphoribosyl pyrophosphate amidotransferase		decreases expression	EXP	4	57,259,528	57,301,802	RGD:6480464	CTD
G	PPIB	peptidylprolyl isomerase B (cyclophilin B)		increases expression	ISO	15	64,448,014	64,455,354	RGD:6480464	CTD
G	PPIB	peptidylprolyl isomerase B (cyclophilin B)		multiple interactions	ISO	15	64,448,014	64,455,354	RGD:6480464	CTD
G	PPP2R5A	protein phosphatase 2, regulatory subunit B', alpha		decreases expression	ISO	1	212,458,879	212,535,205	RGD:6480464	CTD
G	PPP3CB	protein phosphatase 3, catalytic subunit, beta isozyme		decreases expression	EXP	10	75,196,563	75,255,782	RGD:6480464	CTD
G	PRIM2	primase, DNA, polypeptide 2 (58kDa)		decreases expression	ISO	6	57,182,415	57,512,702	RGD:6480464	CTD
G	PRIM2	primase, DNA, polypeptide 2 (58kDa)		multiple interactions	ISO	6	57,182,415	57,512,702	RGD:6480464	CTD
G	PRKACB	protein kinase, cAMP-dependent, catalytic, beta		decreases phosphorylation	ISO	1	84,543,745	84,704,181	RGD:6480464	CTD
G	PRKACB	protein kinase, cAMP-dependent, catalytic, beta		multiple interactions	ISO	1	84,543,745	84,704,181	RGD:6480464	CTD
G	RASA3	RAS p21 protein activator 3		multiple interactions	ISO	13	114,747,194	114,898,095	RGD:6480464	CTD
G	RORA	RAR-related orphan receptor A		multiple interactions	ISO	15	60,780,483	61,521,502	RGD:6480464	CTD
G	RXRA	retinoid X receptor, alpha		increases expression	EXP	9	137,218,316	137,332,431	RGD:6480464	CTD
G	S100A8	S100 calcium binding protein A8		increases expression	EXP	1	153,362,508	153,363,664	RGD:6480464	CTD
G	S100A9	S100 calcium binding protein A9		increases expression	EXP	1	153,330,330	153,333,503	RGD:6480464	CTD
G	S100A9	S100 calcium binding protein A9		decreases expression	ISO	1	153,330,330	153,333,503	RGD:6480464	CTD
G	S100A9	S100 calcium binding protein A9		increases expression	ISO	1	153,330,330	153,333,503	RGD:6480464	CTD
G	S100A9	S100 calcium binding protein A9		multiple interactions	ISO	1	153,330,330	153,333,503	RGD:6480464	CTD
G	SCARB1	scavenger receptor class B, member 1		decreases expression	ISO	12	125,262,174	125,348,519	RGD:6480464	CTD
G	SCD	stearoyl-CoA desaturase (delta-9-desaturase)		decreases expression	ISO	10	102,106,772	102,124,588	RGD:6480464	CTD
G	SCD	stearoyl-CoA desaturase (delta-9-desaturase)		affects expression	ISO	10	102,106,772	102,124,588	RGD:6480464	CTD
G	SCEL	sciellin		increases expression	EXP	13	78,109,809	78,219,398	RGD:6480464	CTD
G	SCN8A	sodium channel, voltage gated, type VIII, alpha subunit		decreases expression	ISO	12	51,985,020	52,206,648	RGD:6480464	CTD
G	SCN8A	sodium channel, voltage gated, type VIII, alpha subunit		multiple interactions	ISO	12	51,985,020	52,206,648	RGD:6480464	CTD
G	SCNN1A	sodium channel, non-voltage-gated 1 alpha subunit		increases expression	ISO	12	6,456,009	6,486,523	RGD:6480464	CTD
G	SCNN1B	sodium channel, non-voltage-gated 1, beta subunit		multiple interactions	EXP	16	23,313,591	23,392,620	RGD:6480464	CTD
G	SCNN1B	sodium channel, non-voltage-gated 1, beta subunit		increases expression	EXP	16	23,313,591	23,392,620	RGD:6480464	CTD
G	SCNN1B	sodium channel, non-voltage-gated 1, beta subunit		increases expression	ISO	16	23,313,591	23,392,620	RGD:6480464	CTD
G	SCNN1B	sodium channel, non-voltage-gated 1, beta subunit		increases expression	ISO	16	23,313,591	23,392,620	RGD:6480464	CTD
G	SCNN1G	sodium channel, non-voltage-gated 1, gamma subunit		multiple interactions	EXP	16	23,194,040	23,228,200	RGD:6480464	CTD
G	SCNN1G	sodium channel, non-voltage-gated 1, gamma subunit		increases expression	EXP	16	23,194,040	23,228,200	RGD:6480464	CTD
G	SCNN1G	sodium channel, non-voltage-gated 1, gamma subunit		increases expression	ISO	16	23,194,040	23,228,200	RGD:6480464	CTD
G	SDC1	syndecan 1		decreases expression	EXP	2	20,400,558	20,425,194	RGD:6480464	CTD
G	SDC2	syndecan 2		multiple interactions	ISO	8	97,505,882	97,624,037	RGD:6480464	CTD
G	SDC4	syndecan 4		increases expression	ISO	20	43,953,928	43,977,064	RGD:6480464	CTD
G	SDC4	syndecan 4		multiple interactions	ISO	20	43,953,928	43,977,064	RGD:6480464	CTD
G	SDCBP	syndecan binding protein (syntenin)		increases expression	EXP	8	59,465,728	59,495,419	RGD:6480464	CTD
G	SEPHS2	selenophosphate synthetase 2		increases expression	ISO	16	30,454,952	30,457,224	RGD:6480464	CTD
G	SEPHS2	selenophosphate synthetase 2		multiple interactions	ISO	16	30,454,952	30,457,224	RGD:6480464	CTD
G	SEPP1	selenoprotein P, plasma, 1		increases expression	ISO	5	42,799,982	42,812,024	RGD:6480464	CTD
G	SEPP1	selenoprotein P, plasma, 1		increases secretion	ISO	5	42,799,982	42,812,024	RGD:6480464	CTD
G	SEPP1	selenoprotein P, plasma, 1		multiple interactions	ISO	5	42,799,982	42,812,024	RGD:6480464	CTD
G	SLC6A4	solute carrier family 6 (neurotransmitter transporter, serotonin), member 4		increases expression	ISO	17	28,523,376	28,562,954	RGD:6480464	CTD
G	SLC7A6	solute carrier family 7 (amino acid transporter light chain, y+L system), member 6		multiple interactions	ISO	16	68,298,419	68,335,726	RGD:6480464	CTD
G	SLC9A3	solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3		increases expression	ISO	5	473,334	524,549	RGD:6480464	CTD
G	SLC9A3	solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3		increases expression	EXP	5	473,334	524,549	RGD:6480464	CTD
G	SLCO1A2	solute carrier organic anion transporter family, member 1A2		multiple interactions	ISO	12	21,417,534	21,548,371	RGD:6480464	CTD
G	SLCO1A2	solute carrier organic anion transporter family, member 1A2		affects expression	ISO	12	21,417,534	21,548,371	RGD:6480464	CTD
G	SLCO1A2	solute carrier organic anion transporter family, member 1A2		increases expression	ISO	12	21,417,534	21,548,371	RGD:6480464	CTD
G	SLCO1A2	solute carrier organic anion transporter family, member 1A2		increases expression	ISO	12	21,417,534	21,548,371	RGD:6480464	CTD
G	SLCO1B3	solute carrier organic anion transporter family, member 1B3		decreases expression	ISO	12	20,963,638	21,069,845	RGD:6480464	CTD
G	SLCO1B3	solute carrier organic anion transporter family, member 1B3		decreases expression	ISO	12	20,963,638	21,069,845	RGD:6480464	CTD
G	SLCO1B3	solute carrier organic anion transporter family, member 1B3		multiple interactions	ISO	12	20,963,638	21,069,845	RGD:6480464	CTD
G	SLCO2A1	solute carrier organic anion transporter family, member 2A1		decreases expression	ISO	3	133,651,540	133,748,920	RGD:6480464	CTD
G	SLCO2B1	solute carrier organic anion transporter family, member 2B1		decreases expression	ISO	11	74,862,032	74,917,445	RGD:6480464	CTD
G	SLCO4C1	solute carrier organic anion transporter family, member 4C1		multiple interactions	EXP	5	101,569,690	101,632,253	RGD:6480464	CTD
G	SLPI	secretory leukocyte peptidase inhibitor		multiple interactions	ISO	20	43,880,879	43,883,206	RGD:6480464	CTD
G	SMAD3	SMAD family member 3		affects expression	ISO	15	67,358,195	67,487,533	RGD:6480464	CTD
G	SMOC2	SPARC related modular calcium binding 2		decreases expression	ISO	6	168,841,831	169,068,674	RGD:6480464	CTD
G	SMOC2	SPARC related modular calcium binding 2		multiple interactions	ISO	6	168,841,831	169,068,674	RGD:6480464	CTD
G	SOCS1	suppressor of cytokine signaling 1		increases expression	EXP	16	11,348,274	11,350,039	RGD:6480464	CTD
G	SOD1	superoxide dismutase 1, soluble		multiple interactions	ISO	21	33,031,935	33,041,244	RGD:6480464	CTD
G	SOD1	superoxide dismutase 1, soluble		multiple interactions	ISO	21	33,031,935	33,041,244	RGD:6480464	CTD
G	SOD2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	6	160,100,148	160,114,353	RGD:6480464	CTD
G	SOD2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	6	160,100,148	160,114,353	RGD:6480464	CTD
G	SOD3	superoxide dismutase 3, extracellular		multiple interactions	ISO	4	24,797,085	24,802,467	RGD:6480464	CTD
G	SOST	sclerostin		multiple interactions	EXP	17	41,831,099	41,836,156	RGD:6480464	CTD
G	SOX11	SRY (sex determining region Y)-box 11		decreases expression	ISO	2	5,832,799	5,841,517	RGD:6480464	CTD
G	SOX2	SRY (sex determining region Y)-box 2		multiple interactions	ISO	3	181,429,712	181,432,224	RGD:6480464	CTD
G	SOX9	SRY (sex determining region Y)-box 9		multiple interactions	EXP	17	70,117,161	70,122,561	RGD:6480464	CTD
G	TJAP1	tight junction associated protein 1 (peripheral)		decreases expression	ISO	6	43,445,261	43,474,294	RGD:6480464	CTD
G	TJAP1	tight junction associated protein 1 (peripheral)		multiple interactions	ISO	6	43,445,261	43,474,294	RGD:6480464	CTD
G	TLE4	transducin-like enhancer of split 4 (E(sp1) homolog, Drosophila)		decreases expression	EXP	9	82,186,878	82,341,656	RGD:6480464	CTD
G	TLR3	toll-like receptor 3		decreases expression	EXP	4	186,990,309	187,006,252	RGD:6480464	CTD
G	TMC5	transmembrane channel-like 5		multiple interactions	EXP	16	19,422,057	19,510,435	RGD:6480464	CTD
G	TNC	tenascin C		multiple interactions	EXP	9	117,781,854	117,880,536	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		decreases activity	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		decreases expression	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		decreases expression	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	EXP	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	UGT2A1	UDP glucuronosyltransferase 2 family, polypeptide A1, complex locus		affects expression	ISO	4	70,454,135	70,518,967	RGD:6480464	CTD
G	UGT2B4	UDP glucuronosyltransferase 2 family, polypeptide B4		affects expression	ISO	4	70,345,883	70,361,626	RGD:6480464	CTD
G	UGT2B4	UDP glucuronosyltransferase 2 family, polypeptide B4		increases expression	ISO	4	70,345,883	70,361,626	RGD:6480464	CTD
G	USP3	ubiquitin specific peptidase 3		increases expression	ISO	15	63,796,710	63,886,839	RGD:6480464	CTD
G	VANGL1	VANGL planar cell polarity protein 1		decreases expression	ISO	1	116,184,574	116,240,845	RGD:6480464	CTD
G	VANGL1	VANGL planar cell polarity protein 1		multiple interactions	ISO	1	116,184,574	116,240,845	RGD:6480464	CTD
G	VASP	vasodilator-stimulated phosphoprotein		decreases expression	ISO	19	46,010,688	46,030,241	RGD:6480464	CTD
G	VASP	vasodilator-stimulated phosphoprotein		multiple interactions	ISO	19	46,010,688	46,030,241	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		multiple interactions	EXP	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		decreases expression	EXP	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		multiple interactions	ISO	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		multiple interactions	ISO	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VCAN	versican		multiple interactions	ISO	5	82,767,493	82,878,122	RGD:6480464	CTD
G	VDR	vitamin D (1,25- dihydroxyvitamin D3) receptor		increases expression	ISO	12	48,235,320	48,298,814	RGD:6480464	CTD
G	VDR	vitamin D (1,25- dihydroxyvitamin D3) receptor		multiple interactions	ISO	12	48,235,320	48,298,814	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		multiple interactions	EXP	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		decreases secretion	EXP	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		multiple interactions	ISO	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		decreases expression	ISO	6	43,737,946	43,754,224	RGD:6480464	CTD
G	WFDC1	WAP four-disulfide core domain 1		decreases expression	ISO	16	84,328,401	84,363,450	RGD:6480464	CTD
G	WFS1	Wolfram syndrome 1 (wolframin)		increases expression	EXP	4	6,271,577	6,304,992	RGD:6480464	CTD
G	WIF1	WNT inhibitory factor 1		multiple interactions	EXP	12	65,444,404	65,515,346	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	513708
role	503229
application	255100
anti-inflammatory agent	36083
anti-inflammatory drug	22967
dexamethasone	2969
dexamethasone phosphate	5
dexamethasone sodium m-sulfobenzoate	0
Path 2
Term	Annotations
CHEBI ontology	513708
subatomic particle	512601
composite particle	512601
hadron	512601
baryon	512601
nucleon	512601
atomic nucleus	512601
atom	512601
main group element atom	480609
p-block element atom	478027
carbon group element atom	427614
carbon atom	424022
organic molecular entity	424015
organic group	174681
organic divalent group	173480
organodiyl group	173480
carbonyl group	173163
carbonyl compound	173163
ketone	32734
oxo steroid	14190
20-oxo steroid	7122
dexamethasone	2969
dexamethasone phosphate	5
&