dexamethasone - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	dexamethasone	go back to main search page
Accession:	CHEBI:41879	browse the term
Definition:	A fluorinated steroid that has formula C22H29FO5.
Synonyms:	exact_synonym:	9-fluoro-11beta,17,21-trihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione
	related_synonym:	1-Dehydro-16alpha-methyl-9alpha-fluorohydrocortisone; 16alpha-Methyl-9alpha-fluoro-1-dehydrocortisol; 9alpha-Fluoro-16alpha-methylprednisolone; C22H29FO5; Decadron; InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1; InChIKey=UREBDLICKHMUKA-CXSFZGCWSA-N; [H][C@@]12C[C@@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C; dexametasona; dexamethasonum
	alt_id:	CHEBI:41873; CHEBI:4461
	xref_casrn:	50-02-2
	xref:	Beilstein:2066652 "Beilstein Registry Number"; ChEMBL:465281 "ChEMBL COMPOUND"; ChemIDplus:50-02-2 "CAS Registry Number"; DrugBank:DB01234 "DrugBank"; KEGG DRUG:D00292 "KEGG DRUG"
	xref_mesh:	MESH:D003907
	xref:	Patent:DE1113690 "Patent"; Patent:GB869511 "Patent"; Patent:US3007923 "Patent"; Wikipedia:Dexamethasone "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

dexamethasone
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	A2m	alpha-2-macroglobulin		decreases expression	EXP	4	158,103,711	158,153,423	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		increases expression	EXP	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		multiple interactions	ISO	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		multiple interactions	EXP	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	ISO	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		decreases activity	ISO	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	EXP	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, subfamily B (MDR/TAP), member 1B		multiple interactions	EXP	4	21,829,489	21,912,239	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, subfamily B (MDR/TAP), member 1B		increases expression	EXP	4	21,829,489	21,912,239	RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, subfamily B (MDR/TAP), member 1B		increases expression	EXP	4	21,829,489	21,912,239	RGD:6480464	CTD
G	Abcb4	ATP-binding cassette, subfamily B (MDR/TAP), member 4		increases expression	EXP	4	21,946,274	22,004,328	RGD:6480464	CTD
G	Abcc1	ATP-binding cassette, subfamily C (CFTR/MRP), member 1		multiple interactions	EXP	10	452,239	575,705	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		decreases expression	EXP				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		multiple interactions	EXP				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		increases expression	EXP				RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		increases expression	EXP				RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		multiple interactions	ISO	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		increases activity	ISO	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		increases expression	ISO	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		affects expression	EXP	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		decreases expression	EXP	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		multiple interactions	EXP	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		increases expression	EXP	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc6	ATP-binding cassette, subfamily C (CFTR/MRP), member 6		affects expression	EXP	1	96,448,588	96,524,655	RGD:6480464	CTD
G	Abcc6	ATP-binding cassette, subfamily C (CFTR/MRP), member 6		decreases expression	EXP	1	96,448,588	96,524,655	RGD:6480464	CTD
G	Abcg2	ATP-binding cassette, subfamily G (WHITE), member 2		multiple interactions	ISO	4	87,502,584	87,560,017	RGD:6480464	CTD
G	Acadm	acyl-CoA dehydrogenase, C-4 to C-12 straight chain		decreases expression	EXP	2	251,866,645	251,890,729	RGD:6480464	CTD
G	Acan	aggrecan		multiple interactions	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Acan	aggrecan		increases expression	ISO	1	134,787,341	134,848,992	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		increases expression	EXP	10	95,361,338	95,381,455	RGD:6480464	CTD
G	Ace	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		multiple interactions	EXP	10	95,361,338	95,381,455	RGD:6480464	CTD
G	Acly	ATP citrate lyase		decreases expression	EXP	10	89,420,934	89,471,398	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		decreases expression	EXP	7	120,223,788	120,266,944	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		multiple interactions	EXP	7	120,223,788	120,266,944	RGD:6480464	CTD
G	Acot7	acyl-CoA thioesterase 7		decreases expression	EXP	5	169,409,306	169,501,907	RGD:6480464	CTD
G	Acox1	acyl-CoA oxidase 1, palmitoyl		decreases expression	EXP	10	106,281,977	106,319,382	RGD:6480464	CTD
G	Acp5	acid phosphatase 5, tartrate resistant		multiple interactions	ISO				RGD:6480464	CTD
G	Acsl1	acyl-CoA synthetase long-chain family member 1		multiple interactions	ISO	16	49,036,892	49,081,416	RGD:6480464	CTD
G	Acsl1	acyl-CoA synthetase long-chain family member 1		decreases expression	EXP	16	49,036,892	49,081,416	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		multiple interactions	ISO	X	36,168,547	36,232,162	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		increases expression	EXP	X	36,168,547	36,232,162	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		multiple interactions	EXP	X	36,168,547	36,232,162	RGD:6480464	CTD
G	Actb	actin, beta		multiple interactions	ISO	12	12,047,070	12,050,040	RGD:6480464	CTD
G	Actc1	actin, alpha, cardiac muscle 1		multiple interactions	ISO	3	99,901,022	99,906,558	RGD:6480464	CTD
G	Actg2	actin, gamma 2, smooth muscle, enteric		multiple interactions	ISO	4	117,732,482	117,747,006	RGD:6480464	CTD
G	Adam12	ADAM metallopeptidase domain 12		multiple interactions	ISO	1	193,384,457	193,650,892	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		decreases expression	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adh1	alcohol dehydrogenase 1 (class I)		increases expression	EXP	2	235,799,396	235,811,584	RGD:6480464	CTD
G	Adh1	alcohol dehydrogenase 1 (class I)		multiple interactions	EXP	2	235,799,396	235,811,584	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		multiple interactions	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adm	adrenomedullin		multiple interactions	ISO	1	168,380,255	168,382,426	RGD:6480464	CTD
G	Adora3	adenosine A3 receptor		increases expression	EXP	2	201,157,782	201,161,425	RGD:6480464	CTD
G	Adra1b	adrenoceptor alpha 1B		increases expression	ISO	10	28,889,092	28,946,889	RGD:6480464	CTD
G	Adra1d	adrenoceptor alpha 1D		increases expression	ISO	3	119,279,974	119,295,985	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		increases expression	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	EXP	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		decreases expression	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Agr2	anterior gradient 2 homolog (Xenopus laevis)		multiple interactions	ISO	6	54,695,633	54,716,858	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases expression	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Agt	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	EXP	19	54,738,556	54,750,349	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		decreases expression	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		decreases expression	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		increases expression	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	EXP	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahsg	alpha-2-HS-glycoprotein		increases response to substance	ISO	11	80,330,615	80,336,658	RGD:6480464	CTD
G	Aifm1	apoptosis-inducing factor, mitochondrion-associated 1		multiple interactions	ISO	X	134,868,878	134,908,166	RGD:6480464	CTD
G	Akap12	A kinase (PRKA) anchor protein 12		multiple interactions	ISO	1	34,979,039	35,068,763	RGD:6480464	CTD
G	Akap7	A kinase (PRKA) anchor protein 7		multiple interactions	ISO	1	20,573,215	20,704,564	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases phosphorylation	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Alb	albumin		multiple interactions	ISO	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Alb	albumin		multiple interactions	ISO	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Alb	albumin		increases expression	EXP	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Alb	albumin		increases secretion	EXP	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Aldh1a1	aldehyde dehydrogenase 1 family, member A1		affects expression	EXP	1	223,731,675	223,773,285	RGD:6480464	CTD
G	Aldh1b1	aldehyde dehydrogenase 1 family, member B1		affects expression	EXP	5	62,311,268	62,316,276	RGD:6480464	CTD
G	Aldoa	aldolase A, fructose-bisphosphate		increases expression	EXP	1	185,970,658	185,974,615	RGD:6480464	CTD
G	Alox5	arachidonate 5-lipoxygenase		multiple interactions	EXP	4	152,610,283	152,657,891	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		multiple interactions	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Ampd3	adenosine monophosphate deaminase 3		increases expression	EXP	1	168,519,462	168,568,291	RGD:6480464	CTD
G	Ampd3	adenosine monophosphate deaminase 3		multiple interactions	EXP	1	168,519,462	168,568,291	RGD:6480464	CTD
G	Amy1a	amylase, alpha 1A (salivary)		increases expression	ISO	2	209,548,721	209,563,532	RGD:6480464	CTD
G	Angpt1	angiopoietin 1		multiple interactions	ISO	7	78,195,504	78,451,471	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		increases expression	ISO	7	16,261,623	16,267,852	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		affects response to substance	ISO	7	16,261,623	16,267,852	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		multiple interactions	ISO	7	16,261,623	16,267,852	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		increases expression	EXP	7	16,261,623	16,267,852	RGD:6480464	CTD
G	Angptl4	angiopoietin-like 4		multiple interactions	EXP	7	16,261,623	16,267,852	RGD:6480464	CTD
G	Ank1	ankyrin 1, erythrocytic		decreases expression	EXP	16	73,333,564	73,437,926	RGD:6480464	CTD
G	Ank1	ankyrin 1, erythrocytic		multiple interactions	EXP	16	73,333,564	73,437,926	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		increases expression	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		increases localization	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		increases phosphorylation	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		affects response to substance	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa1	annexin A1		affects response to substance	EXP	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa3	annexin A3		multiple interactions	ISO	14	14,245,112	14,297,100	RGD:6480464	CTD
G	Anxa6	annexin A6		multiple interactions	ISO	10	40,383,975	40,439,683	RGD:6480464	CTD
G	Anxa8	annexin A8		multiple interactions	ISO	16	9,715,644	9,730,584	RGD:6480464	CTD
G	Aox1	aldehyde oxidase 1		multiple interactions	EXP	9	56,693,698	56,774,115	RGD:6480464	CTD
G	Aox1	aldehyde oxidase 1		increases expression	EXP	9	56,693,698	56,774,115	RGD:6480464	CTD
G	Apcdd1	adenomatosis polyposis coli down-regulated 1		multiple interactions	ISO	18	59,088,709	59,091,205	RGD:6480464	CTD
G	Apln	apelin		decreases expression	EXP	X	134,387,285	134,396,762	RGD:6480464	CTD
G	Apln	apelin		multiple interactions	EXP	X	134,387,285	134,396,762	RGD:6480464	CTD
G	Apoa1	apolipoprotein A-I		affects expression	EXP				RGD:6480464	CTD
G	Apoa4	apolipoprotein A-IV		affects expression	EXP	8	49,233,142	49,233,431	RGD:6480464	CTD
G	Apob	apolipoprotein B		increases expression	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		increases expression	ISO				RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		multiple interactions	ISO				RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		increases expression	EXP				RGD:6480464	CTD
G	Apoc3	apolipoprotein C-III		multiple interactions	EXP				RGD:6480464	CTD
G	Aqp7	aquaporin 7		increases expression	EXP	5	58,433,731	58,447,853	RGD:6480464	CTD
G	Ar	androgen receptor		affects activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Araf	v-raf murine sarcoma 3611 viral oncogene homolog		multiple interactions	ISO	X	12,556,904	12,568,583	RGD:6480464	CTD
G	Areg	amphiregulin		decreases expression	EXP	14	18,466,313	18,475,571	RGD:6480464	CTD
G	Arg2	arginase type II		increases expression	EXP	6	101,901,653	101,928,282	RGD:6480464	CTD
G	Arg2	arginase type II		multiple interactions	EXP	6	101,901,653	101,928,282	RGD:6480464	CTD
G	Arhgap10	Rho GTPase activating protein 10		increases expression	ISO	19	32,261,771	32,521,913	RGD:6480464	CTD
G	Arhgap30	Rho GTPase activating protein 30		increases expression	ISO	13	87,295,074	87,335,018	RGD:6480464	CTD
G	Arhgap5	Rho GTPase activating protein 5		multiple interactions	ISO	6	72,685,231	72,693,052	RGD:6480464	CTD
G	Arnt	aryl hydrocarbon receptor nuclear translocator		increases expression	EXP	2	190,333,978	190,391,015	RGD:6480464	CTD
G	Art1	ADP-ribosyltransferase 1		multiple interactions	EXP	1	159,586,246	159,590,797	RGD:6480464	CTD
G	Art1	ADP-ribosyltransferase 1		increases expression	EXP	1	159,586,246	159,590,797	RGD:6480464	CTD
G	Art5	ADP-ribosyltransferase 5		increases expression	EXP	1	159,576,990	159,586,949	RGD:6480464	CTD
G	Art5	ADP-ribosyltransferase 5		multiple interactions	EXP	1	159,576,990	159,586,949	RGD:6480464	CTD
G	Asah2	N-acylsphingosine amidohydrolase (non-lysosomal ceramidase) 2		decreases expression	EXP	1	236,000,768	236,072,477	RGD:6480464	CTD
G	Asah2	N-acylsphingosine amidohydrolase (non-lysosomal ceramidase) 2		multiple interactions	EXP	1	236,000,768	236,072,477	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		increases expression	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		multiple interactions	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Atcay	ataxia, cerebellar, Cayman type		decreases expression	EXP	7	9,971,563	9,995,528	RGD:6480464	CTD
G	Atcay	ataxia, cerebellar, Cayman type		multiple interactions	EXP	7	9,971,563	9,995,528	RGD:6480464	CTD
G	Atp2a1	ATPase, Ca++ transporting, cardiac muscle, fast twitch 1		increases expression	EXP				RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	EXP	3	118,205,007	118,206,985	RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	EXP	3	118,205,007	118,206,985	RGD:6480464	CTD
G	Avp	arginine vasopressin		multiple interactions	EXP	3	118,205,007	118,206,985	RGD:6480464	CTD
G	Avp	arginine vasopressin		increases activity	EXP	3	118,205,007	118,206,985	RGD:6480464	CTD
G	B2m	beta-2 microglobulin		decreases expression	ISO	3	108,927,919	108,932,718	RGD:6480464	CTD
G	B4galt6	UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6		decreases expression	EXP	18	12,421,062	12,478,276	RGD:6480464	CTD
G	B4galt6	UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6		multiple interactions	EXP	18	12,421,062	12,478,276	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		decreases phosphorylation	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		increases expression	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		multiple interactions	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bambi	BMP and activin membrane-bound inhibitor, homolog (Xenopus laevis)		decreases expression	ISO	17	62,654,385	62,658,641	RGD:6480464	CTD
G	Basp1	brain abundant, membrane attached signal protein 1		decreases expression	EXP	2	76,877,616	76,927,721	RGD:6480464	CTD
G	Basp1	brain abundant, membrane attached signal protein 1		multiple interactions	EXP	2	76,877,616	76,927,721	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases response to substance	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases response to substance	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases expression	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases stability	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases phosphorylation	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		multiple interactions	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases expression	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl2l11	BCL2-like 11 (apoptosis facilitator)		increases response to substance	ISO	3	115,692,323	115,722,701	RGD:6480464	CTD
G	Bcl3	B-cell CLL/lymphoma 3		decreases expression	EXP	1	79,122,801	79,137,035	RGD:6480464	CTD
G	Bcl3	B-cell CLL/lymphoma 3		multiple interactions	EXP	1	79,122,801	79,137,035	RGD:6480464	CTD
G	Bcr	breakpoint cluster region		decreases expression	EXP	20	13,972,773	14,097,816	RGD:6480464	CTD
G	Bcr	breakpoint cluster region		multiple interactions	EXP	20	13,972,773	14,097,816	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		decreases expression	ISO				RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		multiple interactions	EXP				RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		decreases expression	EXP				RGD:6480464	CTD
G	Birc2	baculoviral IAP repeat-containing 2		multiple interactions	ISO	8	4,649,559	4,667,733	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		multiple interactions	ISO	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	ISO	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		multiple interactions	EXP	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	EXP	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc3	baculoviral IAP repeat-containing 3		increases expression	ISO	8	4,682,202	4,696,856	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		affects expression	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO				RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	ISO	3	121,372,692	121,381,236	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	ISO	3	121,372,692	121,381,236	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	ISO	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		affects expression	ISO	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	ISO	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmp6	bone morphogenetic protein 6		multiple interactions	ISO	17	32,380,199	32,689,295	RGD:6480464	CTD
G	Bmp8a	bone morphogenetic protein 8a		increases expression	ISO	5	142,627,733	142,653,782	RGD:6480464	CTD
G	Bmp8a	bone morphogenetic protein 8a		decreases response to substance	ISO	5	142,627,733	142,653,782	RGD:6480464	CTD
G	Btg1	B-cell translocation gene 1, anti-proliferative		increases expression	ISO	7	34,029,300	34,031,557	RGD:6480464	CTD
G	Btg2	BTG family, member 2		increases expression	ISO	13	47,026,986	47,030,745	RGD:6480464	CTD
G	C3	complement component 3		multiple interactions	EXP				RGD:6480464	CTD
G	C4a	complement component 4A (Rodgers blood group)		multiple interactions	EXP	20	4,106,123	4,145,904	RGD:6480464	CTD
G	C4a	complement component 4A (Rodgers blood group)		increases expression	EXP	20	4,106,123	4,145,904	RGD:6480464	CTD
G	Cacna2d1	calcium channel, voltage-dependent, alpha2/delta subunit 1		multiple interactions	ISO	4	15,139,881	15,566,740	RGD:6480464	CTD
G	Calb1	calbindin 1		decreases expression	EXP	5	30,455,665	30,480,122	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		decreases response to substance	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calml4	calmodulin-like 4		multiple interactions	ISO	8	67,007,122	67,018,886	RGD:6480464	CTD
G	Camk4	calcium/calmodulin-dependent protein kinase IV		decreases expression	EXP	18	25,404,123	25,625,785	RGD:6480464	CTD
G	Camk4	calcium/calmodulin-dependent protein kinase IV		multiple interactions	EXP	18	25,404,123	25,625,785	RGD:6480464	CTD
G	Capn2	calpain 2, (m/II) large subunit		increases expression	EXP	13	98,473,367	98,524,463	RGD:6480464	CTD
G	Capn2	calpain 2, (m/II) large subunit		multiple interactions	EXP	13	98,473,367	98,524,463	RGD:6480464	CTD
G	Car4	carbonic anhydrase 4		decreases expression	EXP	10	73,229,211	73,237,707	RGD:6480464	CTD
G	Car4	carbonic anhydrase 4		multiple interactions	EXP	10	73,229,211	73,237,707	RGD:6480464	CTD
G	Casp1	caspase 1		multiple interactions	ISO	8	2,027,976	2,036,872	RGD:6480464	CTD
G	Casp2	caspase 2		decreases expression	EXP	4	70,029,728	70,047,164	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		decreases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases expression	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		decreases activity	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp7	caspase 7		multiple interactions	EXP	1	262,689,300	262,721,591	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		increases activity	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		increases activity	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	EXP	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases activity	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases cleavage	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		decreases expression	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases activity	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	EXP	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		decreases activity	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		decreases expression	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		increases activity	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		decreases activity	EXP	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		decreases expression	EXP	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		increases activity	EXP	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	EXP	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		increases expression	EXP	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	ISO	4	42,956,102	42,989,057	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		multiple interactions	ISO	4	42,956,102	42,989,057	RGD:6480464	CTD
G	Ccar1	cell division cycle and apoptosis regulator 1		increases expression	ISO	20	29,997,000	30,039,602	RGD:6480464	CTD
G	Ccdc86	coiled-coil domain containing 86		decreases expression	ISO	1	213,440,231	213,445,812	RGD:6480464	CTD
G	Cckbr	cholecystokinin B receptor		decreases expression	EXP	1	163,156,914	163,166,969	RGD:6480464	CTD
G	Cckbr	cholecystokinin B receptor		multiple interactions	EXP	1	163,156,914	163,166,969	RGD:6480464	CTD
G	Ccl17	chemokine (C-C motif) ligand 17		multiple interactions	ISO	19	10,641,376	10,642,827	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl26	chemokine (C-C motif) ligand 26		multiple interactions	ISO	12	22,265,430	22,268,793	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl7	chemokine (C-C motif) ligand 7		multiple interactions	ISO	10	70,267,281	70,269,131	RGD:6480464	CTD
G	Ccnb1	cyclin B1		decreases expression	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb1	cyclin B1		multiple interactions	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases degradation	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases ubiquitination	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd2	cyclin D2		decreases expression	EXP	4	163,523,817	163,546,501	RGD:6480464	CTD
G	Ccng1	cyclin G1		increases expression	EXP	10	25,776,380	25,782,754	RGD:6480464	CTD
G	Ccr3	chemokine (C-C motif) receptor 3		decreases expression	ISO	8	128,759,943	128,769,341	RGD:6480464	CTD
G	Ccr4	chemokine (C-C motif) receptor 4		increases expression	ISO	8	118,883,148	118,884,230	RGD:6480464	CTD
G	Ccr9	chemokine (C-C motif) receptor 9		increases expression	ISO	8	128,527,943	128,541,982	RGD:6480464	CTD
G	Cd14	CD14 molecule		increases expression	ISO	18	29,374,593	29,376,190	RGD:6480464	CTD
G	Cd163	CD163 molecule		increases expression	EXP	4	160,394,833	160,428,208	RGD:6480464	CTD
G	Cd24	CD24 molecule		increases expression	EXP	20	47,502,354	47,507,663	RGD:6480464	CTD
G	Cd24	CD24 molecule		multiple interactions	EXP	20	47,502,354	47,507,663	RGD:6480464	CTD
G	Cd28	Cd28 molecule		multiple interactions	ISO	9	59,342,273	59,367,743	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		increases expression	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		affects expression	EXP	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		multiple interactions	EXP	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		increases expression	EXP	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd4	Cd4 molecule		multiple interactions	ISO	4	160,988,512	161,014,038	RGD:6480464	CTD
G	Cd4	Cd4 molecule		decreases expression	ISO	4	160,988,512	161,014,038	RGD:6480464	CTD
G	Cd53	Cd53 molecule		increases expression	ISO	2	202,186,125	202,234,570	RGD:6480464	CTD
G	Cd68	Cd68 molecule		increases expression	ISO	10	56,481,701	56,483,580	RGD:6480464	CTD
G	Cd69	Cd69 molecule		increases expression	ISO	4	166,527,683	166,535,601	RGD:6480464	CTD
G	Cda	cytidine deaminase		increases activity	ISO	5	157,117,303	157,143,989	RGD:6480464	CTD
G	Cdc42	cell division cycle 42 (GTP binding protein)		multiple interactions	ISO	5	156,106,123	156,143,040	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		decreases expression	EXP	3	54,948,493	54,959,128	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		multiple interactions	EXP	3	54,948,493	54,959,128	RGD:6480464	CTD
G	Cdh13	cadherin 13		multiple interactions	ISO	19	48,507,173	49,575,123	RGD:6480464	CTD
G	Cdh13	cadherin 13		decreases expression	EXP	19	48,507,173	49,575,123	RGD:6480464	CTD
G	Cdh13	cadherin 13		multiple interactions	EXP	19	48,507,173	49,575,123	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		decreases expression	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		multiple interactions	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		decreases activity	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		decreases expression	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		multiple interactions	EXP	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		multiple interactions	EXP	15	22,617,409	22,624,922	RGD:6480464	CTD
G	Cdkn3	cyclin-dependent kinase inhibitor 3		decreases expression	EXP	15	22,617,409	22,624,922	RGD:6480464	CTD
G	Cdo1	cysteine dioxygenase, type I		multiple interactions	ISO	18	40,914,028	40,928,671	RGD:6480464	CTD
G	Ceacam1	carcinoembryonic antigen-related cell adhesion molecule 1 (biliary glycoprotein)		increases expression	EXP	1	80,742,540	80,758,943	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	EXP	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	EXP	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	EXP	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO				RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		increases expression	EXP				RGD:6480464	CTD
G	Cebpd	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	EXP				RGD:6480464	CTD
G	Celf2	CUGBP, Elav-like family member 2		multiple interactions	ISO	17	82,708,354	83,025,139	RGD:6480464	CTD
G	Celsr3	cadherin, EGF LAG seven-pass G-type receptor 3		decreases expression	ISO	8	113,882,883	113,923,950	RGD:6480464	CTD
G	Ces1d	carboxylesterase 1D		decreases expression	EXP	19	14,928,539	14,967,082	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		affects expression	EXP	19	34,910,981	34,925,547	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		increases expression	ISO	19	34,910,981	34,925,547	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		multiple interactions	EXP	19	34,910,981	34,925,547	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		decreases expression	EXP	19	34,910,981	34,925,547	RGD:6480464	CTD
G	Ces2h	carboxylesterase 2H		increases expression	EXP	19	34,910,981	34,925,547	RGD:6480464	CTD
G	Cfd	complement factor D (adipsin)		decreases expression	ISO	7	11,325,538	11,327,261	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		increases expression	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		multiple interactions	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Chi3l1	chitinase 3-like 1 (cartilage glycoprotein-39)		decreases expression	ISO	13	47,139,658	47,147,591	RGD:6480464	CTD
G	Chid1	chitinase domain containing 1		multiple interactions	ISO	1	201,683,719	201,718,785	RGD:6480464	CTD
G	Chid1	chitinase domain containing 1		increases expression	ISO	1	201,683,719	201,718,785	RGD:6480464	CTD
G	Chrnd	cholinergic receptor, nicotinic, delta (muscle)		increases expression	EXP	9	85,996,421	86,004,839	RGD:6480464	CTD
G	Chrnd	cholinergic receptor, nicotinic, delta (muscle)		multiple interactions	EXP	9	85,996,421	86,004,839	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		multiple interactions	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Cib2	calcium and integrin binding family member 2		multiple interactions	EXP	8	58,093,941	58,110,808	RGD:6480464	CTD
G	Cib2	calcium and integrin binding family member 2		decreases expression	EXP	8	58,093,941	58,110,808	RGD:6480464	CTD
G	Cidea	cell death-inducing DFFA-like effector a		increases expression	EXP	18	63,871,538	63,896,975	RGD:6480464	CTD
G	Cidea	cell death-inducing DFFA-like effector a		multiple interactions	EXP	18	63,871,538	63,896,975	RGD:6480464	CTD
G	Cirbp	cold inducible RNA binding protein		decreases expression	ISO	7	11,047,003	11,050,820	RGD:6480464	CTD
G	Cited2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	ISO	1	12,721,500	12,723,943	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		increases expression	EXP	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Clcn4	chloride channel, voltage-sensitive 4		decreases expression	EXP	X	44,355,648	44,419,524	RGD:6480464	CTD
G	Cln6	ceroid-lipofuscinosis, neuronal 6, late infantile, variant		decreases expression	EXP	8	66,987,057	67,002,013	RGD:6480464	CTD
G	Cln6	ceroid-lipofuscinosis, neuronal 6, late infantile, variant		multiple interactions	EXP	8	66,987,057	67,002,013	RGD:6480464	CTD
G	Clu	clusterin		decreases expression	EXP	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	EXP	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Cnksr1	connector enhancer of kinase suppressor of Ras 1		increases expression	EXP	5	152,972,551	152,983,208	RGD:6480464	CTD
G	Cnksr1	connector enhancer of kinase suppressor of Ras 1		multiple interactions	EXP	5	152,972,551	152,983,208	RGD:6480464	CTD
G	Cntn1	contactin 1		decreases expression	EXP	7	130,658,836	130,845,071	RGD:6480464	CTD
G	Cntn1	contactin 1		multiple interactions	EXP	7	130,658,836	130,845,071	RGD:6480464	CTD
G	Col11a1	collagen, type XI, alpha 1		multiple interactions	ISO	2	209,996,467	210,193,379	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		multiple interactions	ISO	5	63,825,907	63,930,633	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		multiple interactions	EXP	5	63,825,907	63,930,633	RGD:6480464	CTD
G	Col15a1	collagen, type XV, alpha 1		decreases expression	EXP	5	63,825,907	63,930,633	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		decreases expression	EXP	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		affects expression	ISO	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Col4a1	collagen, type IV, alpha 1		multiple interactions	ISO	16	83,045,183	83,157,835	RGD:6480464	CTD
G	Col5a1	collagen, type V, alpha 1		decreases expression	EXP	3	6,826,169	6,971,054	RGD:6480464	CTD
G	Col5a1	collagen, type V, alpha 1		multiple interactions	EXP	3	6,826,169	6,971,054	RGD:6480464	CTD
G	Col5a2	collagen, type V, alpha 2		decreases expression	EXP	9	44,374,113	44,525,086	RGD:6480464	CTD
G	Col5a2	collagen, type V, alpha 2		multiple interactions	EXP	9	44,374,113	44,525,086	RGD:6480464	CTD
G	Col5a3	collagen, type V, alpha 3		multiple interactions	EXP	8	19,789,061	19,834,241	RGD:6480464	CTD
G	Col5a3	collagen, type V, alpha 3		decreases expression	EXP	8	19,789,061	19,834,241	RGD:6480464	CTD
G	Col9a1	collagen, type IX, alpha 1		affects expression	ISO	9	22,907,157	22,990,836	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		increases expression	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Comt	catechol-O-methyltransferase		multiple interactions	EXP	11	84,561,591	84,581,713	RGD:6480464	CTD
G	Copb2	coatomer protein complex, subunit beta 2 (beta prime)		multiple interactions	EXP				RGD:6480464	CTD
G	Copb2	coatomer protein complex, subunit beta 2 (beta prime)		decreases expression	EXP				RGD:6480464	CTD
G	Cp	ceruloplasmin (ferroxidase)		multiple interactions	ISO	2	105,086,278	105,135,367	RGD:6480464	CTD
G	Cp	ceruloplasmin (ferroxidase)		increases expression	EXP	2	105,086,278	105,135,367	RGD:6480464	CTD
G	Cp	ceruloplasmin (ferroxidase)		multiple interactions	EXP	2	105,086,278	105,135,367	RGD:6480464	CTD
G	Cpa1	carboxypeptidase A1 (pancreatic)		decreases expression	EXP	4	57,549,260	57,555,361	RGD:6480464	CTD
G	Cpa1	carboxypeptidase A1 (pancreatic)		multiple interactions	EXP	4	57,549,260	57,555,361	RGD:6480464	CTD
G	Cpe	carboxypeptidase E		decreases expression	EXP				RGD:6480464	CTD
G	Cpe	carboxypeptidase E		multiple interactions	EXP				RGD:6480464	CTD
G	Cpn1	carboxypeptidase N, polypeptide 1		increases expression	EXP				RGD:6480464	CTD
G	Cps1	carbamoyl-phosphate synthetase 1		increases expression	ISO	9	65,907,211	66,017,942	RGD:6480464	CTD
G	Cps1	carbamoyl-phosphate synthetase 1		increases expression	EXP	9	65,907,211	66,017,942	RGD:6480464	CTD
G	Crabp2	cellular retinoic acid binding protein 2		decreases expression	ISO	2	180,029,801	180,034,147	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		increases phosphorylation	ISO	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Crh	corticotropin releasing hormone		increases expression	EXP	2	104,764,023	104,765,887	RGD:6480464	CTD
G	Crisp1	cysteine-rich secretory protein 1		decreases expression	EXP	9	16,975,151	17,002,149	RGD:6480464	CTD
G	Crisp1	cysteine-rich secretory protein 1		multiple interactions	EXP	9	16,975,151	17,002,149	RGD:6480464	CTD
G	Crkl	v-crk sarcoma virus CT10 oncogene homolog (avian)-like		multiple interactions	ISO	11	85,520,244	85,554,667	RGD:6480464	CTD
G	Cryab	crystallin, alpha B		increases expression	ISO	8	54,107,824	54,111,502	RGD:6480464	CTD
G	Cryab	crystallin, alpha B		multiple interactions	ISO	8	54,107,824	54,111,502	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		multiple interactions	ISO	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf1r	colony stimulating factor 1 receptor		increases expression	ISO	18	57,080,324	57,107,295	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		increases expression	ISO	10	87,473,990	87,476,365	RGD:6480464	CTD
G	Csrp3	cysteine and glycine-rich protein 3 (cardiac LIM protein)		increases expression	EXP	1	98,601,681	98,611,747	RGD:6480464	CTD
G	Csrp3	cysteine and glycine-rich protein 3 (cardiac LIM protein)		multiple interactions	EXP	1	98,601,681	98,611,747	RGD:6480464	CTD
G	Cst6	cystatin E/M		multiple interactions	ISO	1	207,991,313	207,993,021	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases expression	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases expression	EXP	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		increases expression	EXP	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		increases expression	EXP	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		multiple interactions	EXP	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		multiple interactions	ISO	19	10,666,940	10,676,424	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	EXP	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		multiple interactions	ISO	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		increases expression	ISO	13	41,308,286	41,312,190	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		multiple interactions	ISO	13	41,308,286	41,312,190	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		increases expression	ISO	13	41,308,286	41,312,190	RGD:6480464	CTD
G	Cxcr7	chemokine (C-X-C motif) receptor 7		decreases expression	ISO	9	89,343,528	89,355,053	RGD:6480464	CTD
G	Cyb5r3	cytochrome b5 reductase 3		decreases expression	EXP	7	121,187,821	121,205,382	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		multiple interactions	ISO	X	25,514,572	25,547,181	RGD:6480464	CTD
G	Cycs	cytochrome c, somatic		multiple interactions	ISO	4	78,825,878	78,827,978	RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		multiple interactions	ISO				RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases expression	ISO				RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases activity	ISO				RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		decreases activity	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		decreases expression	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		increases activity	EXP	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases expression	ISO	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases activity	ISO	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects expression	EXP	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	EXP	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases expression	EXP	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	ISO	6	2,548,224	2,553,767	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	EXP	6	2,548,224	2,553,767	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		affects activity	ISO	3	161,542,131	161,553,801	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		affects expression	ISO	3	161,542,131	161,553,801	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		increases expression	ISO	3	161,542,131	161,553,801	RGD:6480464	CTD
G	Cyp27a1	cytochrome P450, family 27, subfamily a, polypeptide 1		multiple interactions	ISO	9	74,039,204	74,068,648	RGD:6480464	CTD
G	Cyp27a1	cytochrome P450, family 27, subfamily a, polypeptide 1		increases expression	ISO	9	74,039,204	74,068,648	RGD:6480464	CTD
G	Cyp27b1	cytochrome P450, family 27, subfamily b, polypeptide 1		affects expression	ISO				RGD:6480464	CTD
G	Cyp27b1	cytochrome P450, family 27, subfamily b, polypeptide 1		affects activity	ISO				RGD:6480464	CTD
G	Cyp2a1	cytochrome P450, family 2, subfamily a, polypeptide 1		affects expression	EXP	1	82,006,828	82,020,282	RGD:6480464	CTD
G	Cyp2a2	cytochrome P450, family 2, subfamily a, polypeptide 2		affects expression	EXP	1	82,039,229	82,064,293	RGD:6480464	CTD
G	Cyp2a3	cytochrome P450, family 2, subfamily a, polypeptide 3		multiple interactions	ISO	1	81,944,896	81,953,007	RGD:6480464	CTD
G	Cyp2a3	cytochrome P450, family 2, subfamily a, polypeptide 3		increases activity	ISO	1	81,944,896	81,953,007	RGD:6480464	CTD
G	Cyp2a3	cytochrome P450, family 2, subfamily a, polypeptide 3		increases expression	ISO	1	81,944,896	81,953,007	RGD:6480464	CTD
G	Cyp2b1	cytochrome P450, family 2, subfamily b, polypeptide 1		multiple interactions	EXP	1	81,266,828	81,290,471	RGD:6480464	CTD
G	Cyp2b1	cytochrome P450, family 2, subfamily b, polypeptide 1		increases expression	EXP	1	81,266,828	81,290,471	RGD:6480464	CTD
G	Cyp2b1	cytochrome P450, family 2, subfamily b, polypeptide 1		increases expression	ISO	1	81,266,828	81,290,471	RGD:6480464	CTD
G	Cyp2b15	cytochrome P450, family 2, subfamily b, polypeptide 15		affects expression	EXP	1	81,839,930	81,852,366	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		affects expression	EXP	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		increases expression	EXP	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		multiple interactions	ISO	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		multiple interactions	ISO	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		increases expression	ISO	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2b2	cytochrome P450, family 2, subfamily b, polypeptide 2		increases expression	ISO	1	81,345,425	81,359,415	RGD:6480464	CTD
G	Cyp2c11	cytochrome P450, subfamily 2, polypeptide 11		increases expression	EXP	1	243,281,320	243,320,945	RGD:6480464	CTD
G	Cyp2c11	cytochrome P450, subfamily 2, polypeptide 11		increases expression	EXP	1	243,281,320	243,320,945	RGD:6480464	CTD
G	Cyp2c79	cytochrome P450, family 2, subfamily c, polypeptide 79		affects binding	ISO	1	244,400,004	244,493,624	RGD:6480464	CTD
G	Cyp2c79	cytochrome P450, family 2, subfamily c, polypeptide 79		increases expression	ISO	1	244,400,004	244,493,624	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases expression	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		decreases expression	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases expression	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp3a18	cytochrome P450, family 3, subfamily a, polypeptide 18		affects expression	EXP	12	9,086,752	9,136,606	RGD:6480464	CTD
G	Cyp3a18	cytochrome P450, family 3, subfamily a, polypeptide 18		increases expression	EXP	12	9,086,752	9,136,606	RGD:6480464	CTD
G	Cyp3a18	cytochrome P450, family 3, subfamily a, polypeptide 18		increases expression	ISO	12	9,086,752	9,136,606	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases activity	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases activity	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		affects expression	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		affects metabolic processing	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases activity	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		increases expression	ISO	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		increases expression	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		increases expression	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a9	cytochrome P450, family 3, subfamily a, polypeptide 9		increases expression	ISO	12	17,164,384	17,204,589	RGD:6480464	CTD
G	Cyp3a9	cytochrome P450, family 3, subfamily a, polypeptide 9		increases expression	ISO	12	17,164,384	17,204,589	RGD:6480464	CTD
G	Cyp3a9	cytochrome P450, family 3, subfamily a, polypeptide 9		decreases expression	EXP	12	17,164,384	17,204,589	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		increases expression	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp51	cytochrome P450, family 51		decreases expression	ISO	4	26,752,677	26,771,131	RGD:6480464	CTD
G	Cyp51	cytochrome P450, family 51		affects expression	EXP	4	26,752,677	26,771,131	RGD:6480464	CTD
G	Cyp7a1	cytochrome P450, family 7, subfamily a, polypeptide 1		increases expression	EXP	5	19,707,159	19,716,856	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		multiple interactions	EXP	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		increases expression	EXP	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		multiple interactions	EXP	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		decreases expression	EXP	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Dbp	D site of albumin promoter (albumin D-box) binding protein		decreases expression	EXP	1	96,173,573	96,178,485	RGD:6480464	CTD
G	Dbp	D site of albumin promoter (albumin D-box) binding protein		increases expression	EXP	1	96,173,573	96,178,485	RGD:6480464	CTD
G	Dcn	decorin		multiple interactions	ISO	7	35,004,234	35,045,191	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		increases expression	ISO	20	27,252,273	27,254,371	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		multiple interactions	EXP	20	27,252,273	27,254,371	RGD:6480464	CTD
G	Ddit4	DNA-damage-inducible transcript 4		increases expression	EXP	20	27,252,273	27,254,371	RGD:6480464	CTD
G	Decr1	2,4-dienoyl CoA reductase 1, mitochondrial		increases expression	EXP	5	30,492,196	30,520,172	RGD:6480464	CTD
G	Degs1	delta(4)-desaturase, sphingolipid 1		decreases expression	EXP	13	98,242,981	98,249,638	RGD:6480464	CTD
G	Degs1	delta(4)-desaturase, sphingolipid 1		multiple interactions	EXP	13	98,242,981	98,249,638	RGD:6480464	CTD
G	Dfna5	deafness, autosomal dominant 5 (human)		increases expression	ISO	4	78,431,841	78,492,217	RGD:6480464	CTD
G	Dgat1	diacylglycerol O-acyltransferase 1		multiple interactions	ISO	7	114,552,051	114,562,423	RGD:6480464	CTD
G	Dgat2	diacylglycerol O-acyltransferase 2		increases expression	EXP	1	156,447,588	156,478,740	RGD:6480464	CTD
G	Dgat2	diacylglycerol O-acyltransferase 2		multiple interactions	EXP	1	156,447,588	156,478,740	RGD:6480464	CTD
G	Diablo	diablo, IAP-binding mitochondrial protein		affects localization	ISO	12	34,196,347	34,209,633	RGD:6480464	CTD
G	Diablo	diablo, IAP-binding mitochondrial protein		multiple interactions	ISO	12	34,196,347	34,209,633	RGD:6480464	CTD
G	Dio3	deiodinase, iodothyronine, type III		decreases activity	ISO				RGD:6480464	CTD
G	Dnaja1	DnaJ (Hsp40) homolog, subfamily A, member 1		increases expression	ISO	5	58,100,794	58,111,705	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		multiple interactions	ISO	6	63,583,033	63,587,247	RGD:6480464	CTD
G	Dnajb9	DnaJ (Hsp40) homolog, subfamily B, member 9		increases expression	ISO	6	63,583,033	63,587,247	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		increases expression	ISO	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		multiple interactions	ISO	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Edn1	endothelin 1		decreases expression	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Ednrb	endothelin receptor type B		multiple interactions	EXP	15	87,893,141	87,898,700	RGD:6480464	CTD
G	Eef1a2	eukaryotic translation elongation factor 1 alpha 2		increases expression	ISO	3	170,295,327	170,304,505	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	EXP	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egr1	early growth response 1		multiple interactions	EXP	18	27,343,919	27,346,117	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		increases expression	EXP	16	69,110,522	69,123,895	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	EXP	16	69,110,522	69,123,895	RGD:6480464	CTD
G	Eif4g3	eukaryotic translation initiation factor 4 gamma, 3		increases expression	EXP	5	156,809,618	156,979,249	RGD:6480464	CTD
G	Eif4g3	eukaryotic translation initiation factor 4 gamma, 3		multiple interactions	EXP	5	156,809,618	156,979,249	RGD:6480464	CTD
G	Elovl3	ELOVL fatty acid elongase 3		multiple interactions	ISO	1	251,351,908	251,355,736	RGD:6480464	CTD
G	Elovl6	ELOVL fatty acid elongase 6		multiple interactions	ISO	2	226,946,573	227,054,321	RGD:6480464	CTD
G	Emb	embigin		multiple interactions	ISO	2	49,098,743	49,155,221	RGD:6480464	CTD
G	Emp1	epithelial membrane protein 1		multiple interactions	ISO	4	172,315,122	172,335,536	RGD:6480464	CTD
G	Emp2	epithelial membrane protein 2		multiple interactions	ISO	10	5,311,157	5,348,038	RGD:6480464	CTD
G	Enpp2	ectonucleotide pyrophosphatase/phosphodiesterase 2		multiple interactions	ISO	7	91,295,824	91,377,850	RGD:6480464	CTD
G	Ep300	E1A binding protein p300		multiple interactions	EXP	7	119,938,507	120,008,886	RGD:6480464	CTD
G	Epha7	Eph receptor A7		multiple interactions	EXP	5	44,728,037	44,878,332	RGD:6480464	CTD
G	Epha7	Eph receptor A7		decreases expression	EXP	5	44,728,037	44,878,332	RGD:6480464	CTD
G	Ephx2	epoxide hydrolase 2, cytoplasmic		multiple interactions	ISO	15	45,497,660	45,556,101	RGD:6480464	CTD
G	Ephx2	epoxide hydrolase 2, cytoplasmic		increases expression	EXP	15	45,497,660	45,556,101	RGD:6480464	CTD
G	Erbb4	v-erb-a erythroblastic leukemia viral oncogene homolog 4 (avian)		increases expression	ISO	9	66,843,898	67,967,970	RGD:6480464	CTD
G	Ereg	epiregulin		increases expression	ISO	14	18,521,069	18,534,844	RGD:6480464	CTD
G	Erp29	endoplasmic reticulum protein 29		decreases expression	EXP	12	36,225,110	36,231,363	RGD:6480464	CTD
G	Errfi1	ERBB receptor feedback inhibitor 1		increases expression	EXP	5	168,012,683	168,025,963	RGD:6480464	CTD
G	Espl1	extra spindle pole bodies homolog 1 (S. cerevisiae)		multiple interactions	EXP	7	141,048,197	141,074,383	RGD:6480464	CTD
G	Espl1	extra spindle pole bodies homolog 1 (S. cerevisiae)		decreases expression	EXP	7	141,048,197	141,074,383	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		decreases expression	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Ets1	v-ets erythroblastosis virus E26 oncogene homolog 1 (avian)		decreases expression	EXP	8	32,481,694	32,545,237	RGD:6480464	CTD
G	Ets2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		increases expression	ISO	11	36,014,047	36,030,833	RGD:6480464	CTD
G	Evl	Enah/Vasp-like		multiple interactions	EXP	6	132,952,804	133,019,870	RGD:6480464	CTD
G	Evl	Enah/Vasp-like		decreases expression	EXP	6	132,952,804	133,019,870	RGD:6480464	CTD
G	Exoc2	exocyst complex component 2		decreases expression	EXP	17	39,951,129	40,125,385	RGD:6480464	CTD
G	F2	coagulation factor II		multiple interactions	ISO	3	76,005,318	76,018,603	RGD:6480464	CTD
G	F2	coagulation factor II		multiple interactions	EXP	3	76,005,318	76,018,603	RGD:6480464	CTD
G	F2	coagulation factor II		affects expression	EXP	3	76,005,318	76,018,603	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		increases expression	ISO	2	25,985,800	25,989,072	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		affects expression	EXP	2	25,985,800	25,989,072	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		increases expression	EXP	2	25,985,800	25,989,072	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		multiple interactions	EXP	2	25,985,800	25,989,072	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	2	218,371,050	218,382,645	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	ISO	2	218,371,050	218,382,645	RGD:6480464	CTD
G	F3	coagulation factor III (thromboplastin, tissue factor)		multiple interactions	EXP	2	218,371,050	218,382,645	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		decreases expression	EXP	4	104,412,200	104,415,981	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fads1	fatty acid desaturase 1		decreases expression	EXP	1	212,670,792	212,685,718	RGD:6480464	CTD
G	Fah	fumarylacetoacetate hydrolase		increases expression	EXP	1	140,851,975	140,876,187	RGD:6480464	CTD
G	Fah	fumarylacetoacetate hydrolase		multiple interactions	EXP	1	140,851,975	140,876,187	RGD:6480464	CTD
G	Fam216a	family with sequence similarity 216, member A		decreases expression	ISO	12	35,392,970	35,402,113	RGD:6480464	CTD
G	Fam65b	family with sequence similarity 65, member B		increases expression	ISO	17	47,394,370	47,492,203	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		increases expression	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		decreases expression	EXP	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		decreases expression	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		decreases secretion	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		decreases expression	EXP	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fasn	fatty acid synthase		increases expression	EXP				RGD:6480464	CTD
G	Fbp2	fructose-1,6-bisphosphatase 2		decreases expression	EXP	17	7,824,298	7,841,661	RGD:6480464	CTD
G	Fbp2	fructose-1,6-bisphosphatase 2		multiple interactions	EXP	17	7,824,298	7,841,661	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		multiple interactions	ISO	7	94,909,568	94,942,444	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		increases expression	ISO	7	94,909,568	94,942,444	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		increases expression	EXP	7	94,909,568	94,942,444	RGD:6480464	CTD
G	Fbxo32	F-box protein 32		multiple interactions	EXP	7	94,909,568	94,942,444	RGD:6480464	CTD
G	Fdft1	farnesyl diphosphate farnesyl transferase 1		increases expression	EXP	15	42,425,336	42,453,390	RGD:6480464	CTD
G	Fdps	farnesyl diphosphate synthase		multiple interactions	ISO	2	181,138,474	181,177,903	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		multiple interactions	ISO	8	55,291,396	55,310,507	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		decreases expression	EXP	8	55,291,396	55,310,507	RGD:6480464	CTD
G	Fdx1	ferredoxin 1		multiple interactions	EXP	8	55,291,396	55,310,507	RGD:6480464	CTD
G	Fgb	fibrinogen beta chain		decreases expression	EXP	2	174,768,193	174,775,102	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		multiple interactions	EXP	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgf7	fibroblast growth factor 7		multiple interactions	ISO	3	113,468,427	113,517,538	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		multiple interactions	ISO	1	189,482,975	189,589,279	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		decreases expression	EXP	1	189,482,975	189,589,279	RGD:6480464	CTD
G	Fgfr2	fibroblast growth factor receptor 2		multiple interactions	EXP	1	189,482,975	189,589,279	RGD:6480464	CTD
G	Fgfr3	fibroblast growth factor receptor 3		decreases response to substance	ISO	14	82,683,191	82,697,229	RGD:6480464	CTD
G	Fhl1	four and a half LIM domains 1		increases expression	ISO	X	141,315,765	141,329,278	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		multiple interactions	ISO	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Fkbp4	FK506 binding protein 4		increases expression	ISO	4	165,448,027	165,456,481	RGD:6480464	CTD
G	Fkbp4	FK506 binding protein 4		multiple interactions	ISO	4	165,448,027	165,456,481	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	EXP	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	EXP	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Flot1	flotillin 1		multiple interactions	ISO	20	3,065,792	3,076,166	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		affects expression	EXP	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		multiple interactions	ISO	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo3	flavin containing monooxygenase 3		multiple interactions	ISO	13	78,659,513	78,678,524	RGD:6480464	CTD
G	Fn1	fibronectin 1		multiple interactions	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fn1	fibronectin 1		decreases expression	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		decreases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fosl2	fos-like antigen 2		increases expression	ISO				RGD:6480464	CTD
G	Foxg1	forkhead box G1		decreases expression	EXP	6	69,217,672	69,220,482	RGD:6480464	CTD
G	Foxg1	forkhead box G1		multiple interactions	EXP	6	69,217,672	69,220,482	RGD:6480464	CTD
G	Foxo1	forkhead box O1		increases expression	EXP	2	141,127,345	141,203,446	RGD:6480464	CTD
G	Foxo1	forkhead box O1		increases expression	EXP	2	141,127,345	141,203,446	RGD:6480464	CTD
G	Foxo1	forkhead box O1		multiple interactions	EXP	2	141,127,345	141,203,446	RGD:6480464	CTD
G	Foxq1	forkhead box Q1		multiple interactions	EXP	17	39,332,906	39,334,655	RGD:6480464	CTD
G	Fpr1	formyl peptide receptor 1		increases expression	ISO	1	56,587,183	56,588,390	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		increases expression	ISO	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		multiple interactions	ISO	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fzd2	frizzled family receptor 2		multiple interactions	ISO	10	91,709,222	91,711,132	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		multiple interactions	EXP	10	90,393,531	90,403,485	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		increases expression	EXP	10	90,393,531	90,403,485	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		increases expression	EXP	10	90,393,531	90,403,485	RGD:6480464	CTD
G	Hao1	hydroxyacid oxidase (glycolate oxidase) 1		multiple interactions	EXP	3	122,506,916	122,564,012	RGD:6480464	CTD
G	Has2	hyaluronan synthase 2		decreases expression	ISO	7	93,230,135	93,256,139	RGD:6480464	CTD
G	Hbegf	heparin-binding EGF-like growth factor		decreases expression	EXP	18	29,143,567	29,153,944	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		multiple interactions	EXP	5	148,672,515	148,699,810	RGD:6480464	CTD
G	Hdac4	histone deacetylase 4		increases expression	ISO	9	91,147,435	91,389,810	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		decreases activity	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		decreases expression	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hes1	hairy and enhancer of split 1 (Drosophila)		decreases expression	ISO	11	72,603,482	72,605,673	RGD:6480464	CTD
G	Hibadh	3-hydroxyisobutyrate dehydrogenase		increases expression	EXP	4	80,850,300	80,948,361	RGD:6480464	CTD
G	Hk2	hexokinase 2		multiple interactions	ISO	4	116,925,725	116,975,211	RGD:6480464	CTD
G	Hk2	hexokinase 2		decreases expression	EXP	4	116,925,725	116,975,211	RGD:6480464	CTD
G	Hmgb2	high mobility group box 2		decreases expression	EXP	16	36,131,304	36,133,878	RGD:6480464	CTD
G	Hmgcr	3-hydroxy-3-methylglutaryl-CoA reductase		multiple interactions	ISO	2	27,127,504	27,149,580	RGD:6480464	CTD
G	Hmgcr	3-hydroxy-3-methylglutaryl-CoA reductase		increases expression	EXP	2	27,127,504	27,149,580	RGD:6480464	CTD
G	Hmgcs1	3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble)		decreases expression	ISO	2	51,737,090	51,754,583	RGD:6480464	CTD
G	Hmgcs1	3-hydroxy-3-methylglutaryl-CoA synthase 1 (soluble)		increases expression	EXP	2	51,737,090	51,754,583	RGD:6480464	CTD
G	Hmgcs2	3-hydroxy-3-methylglutaryl-CoA synthase 2 (mitochondrial)		increases expression	EXP	2	193,128,736	193,143,106	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox2	heme oxygenase (decycling) 2		multiple interactions	ISO	10	10,914,157	10,929,448	RGD:6480464	CTD
G	Hnf4a	hepatocyte nuclear factor 4, alpha		multiple interactions	ISO	3	154,459,863	154,482,825	RGD:6480464	CTD
G	Hnf4a	hepatocyte nuclear factor 4, alpha		increases activity	ISO	3	154,459,863	154,482,825	RGD:6480464	CTD
G	Hnf4a	hepatocyte nuclear factor 4, alpha		increases expression	ISO	3	154,459,863	154,482,825	RGD:6480464	CTD
G	Il10rb	interleukin 10 receptor, beta		multiple interactions	ISO	11	31,381,317	31,397,079	RGD:6480464	CTD
G	Il12b	interleukin 12B		multiple interactions	ISO	10	29,558,955	29,568,331	RGD:6480464	CTD
G	Il12b	interleukin 12B		multiple interactions	EXP	10	29,558,955	29,568,331	RGD:6480464	CTD
G	Il12rb2	interleukin 12 receptor, beta 2		decreases expression	ISO	4	96,929,755	96,995,733	RGD:6480464	CTD
G	Il13	interleukin 13		multiple interactions	ISO	10	39,093,512	39,096,069	RGD:6480464	CTD
G	Il13	interleukin 13		decreases expression	ISO	10	39,093,512	39,096,069	RGD:6480464	CTD
G	Il13ra1	interleukin 13 receptor, alpha 1		increases expression	ISO	X	8,758,662	8,820,545	RGD:6480464	CTD
G	Il15	interleukin 15		increases expression	ISO	19	27,487,268	27,498,973	RGD:6480464	CTD
G	Il15	interleukin 15		decreases expression	EXP	19	27,487,268	27,498,973	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	ISO	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Ins2	insulin 2		multiple interactions	ISO	1	202,935,548	202,936,379	RGD:6480464	CTD
G	Insr	insulin receptor		multiple interactions	ISO	12	2,934,967	3,087,691	RGD:6480464	CTD
G	Irs1	insulin receptor substrate 1		multiple interactions	ISO	9	81,585,251	81,638,071	RGD:6480464	CTD
G	Itgam	integrin, alpha M		multiple interactions	ISO	1	187,334,413	187,385,583	RGD:6480464	CTD
G	Itsn1	intersectin 1 (SH3 domain protein)		decreases expression	EXP	11	31,721,528	31,901,963	RGD:6480464	CTD
G	Itsn1	intersectin 1 (SH3 domain protein)		multiple interactions	EXP	11	31,721,528	31,901,963	RGD:6480464	CTD
G	Jag1	jagged 1		multiple interactions	EXP	3	125,181,063	125,216,481	RGD:6480464	CTD
G	Jam3	junctional adhesion molecule 3		increases expression	ISO	8	26,697,127	26,758,579	RGD:6480464	CTD
G	Jun	jun proto-oncogene		decreases expression	EXP	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Kcna2	potassium voltage-gated channel, shaker-related subfamily, member 2		multiple interactions	EXP	2	202,560,152	202,564,305	RGD:6480464	CTD
G	Kcna5	potassium voltage-gated channel, shaker-related subfamily, member 5		increases expression	EXP	4	162,896,283	162,898,091	RGD:6480464	CTD
G	Kcna5	potassium voltage-gated channel, shaker-related subfamily, member 5		multiple interactions	EXP	4	162,896,283	162,898,091	RGD:6480464	CTD
G	Kcnab1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		decreases expression	EXP	2	154,837,841	155,145,882	RGD:6480464	CTD
G	Kcnab1	potassium voltage-gated channel, shaker-related subfamily, beta member 1		multiple interactions	EXP	2	154,837,841	155,145,882	RGD:6480464	CTD
G	Kcnb1	potassium voltage gated channel, Shab-related subfamily, member 1		multiple interactions	EXP	3	158,250,001	158,345,927	RGD:6480464	CTD
G	Kcnk1	potassium channel, subfamily K, member 1		increases expression	ISO	19	56,216,600	56,255,299	RGD:6480464	CTD
G	Kcnma1	potassium large conductance calcium-activated channel, subfamily M, alpha member 1		multiple interactions	EXP	15	575,136	950,275	RGD:6480464	CTD
G	Kcnn4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		decreases expression	EXP	1	79,613,736	79,628,887	RGD:6480464	CTD
G	Kcnn4	potassium intermediate/small conductance calcium-activated channel, subfamily N, member 4		multiple interactions	EXP	1	79,613,736	79,628,887	RGD:6480464	CTD
G	Kctd12	potassium channel tetramerisation domain containing 12		multiple interactions	ISO	15	86,986,827	86,987,810	RGD:6480464	CTD
G	Kit	v-kit Hardy-Zuckerman 4 feline sarcoma viral oncogene homolog		decreases expression	ISO	14	34,906,043	34,984,819	RGD:6480464	CTD
G	Kitlg	KIT ligand		multiple interactions	ISO	7	37,714,157	37,795,722	RGD:6480464	CTD
G	Mapk4	mitogen-activated protein kinase 4		multiple interactions	ISO	18	70,707,645	70,755,517	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		affects phosphorylation	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Marcks	myristoylated alanine rich protein kinase C substrate		multiple interactions	ISO	20	41,304,058	41,310,104	RGD:6480464	CTD
G	Mbl2	mannose-binding lectin (protein C) 2		decreases expression	EXP	1	233,978,931	233,983,824	RGD:6480464	CTD
G	Mbl2	mannose-binding lectin (protein C) 2		multiple interactions	EXP	1	233,978,931	233,983,824	RGD:6480464	CTD
G	Mbnl1	muscleblind-like splicing regulator 1		increases expression	EXP	2	149,891,873	150,004,089	RGD:6480464	CTD
G	Mbnl1	muscleblind-like splicing regulator 1		multiple interactions	EXP	2	149,891,873	150,004,089	RGD:6480464	CTD
G	Mc5r	melanocortin 5 receptor		increases expression	EXP	18	64,679,384	64,680,417	RGD:6480464	CTD
G	Mc5r	melanocortin 5 receptor		multiple interactions	EXP	18	64,679,384	64,680,417	RGD:6480464	CTD
G	Mcam	melanoma cell adhesion molecule		decreases expression	EXP	8	47,105,632	47,127,936	RGD:6480464	CTD
G	Mcam	melanoma cell adhesion molecule		multiple interactions	EXP	8	47,105,632	47,127,936	RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		increases expression	ISO				RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		multiple interactions	EXP				RGD:6480464	CTD
G	Mcl1	myeloid cell leukemia sequence 1		increases expression	EXP				RGD:6480464	CTD
G	Mcoln2	mucolipin 2		decreases expression	EXP	2	244,323,411	244,385,583	RGD:6480464	CTD
G	Mcoln2	mucolipin 2		multiple interactions	EXP	2	244,323,411	244,385,583	RGD:6480464	CTD
G	Me1	malic enzyme 1, NADP(+)-dependent, cytosolic		multiple interactions	EXP	8	91,839,845	91,955,917	RGD:6480464	CTD
G	Me1	malic enzyme 1, NADP(+)-dependent, cytosolic		decreases expression	EXP	8	91,839,845	91,955,917	RGD:6480464	CTD
G	Med1	mediator complex subunit 1		affects response to substance	ISO	10	86,917,525	86,959,080	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mt-co1	mitochondrially encoded cytochrome c oxidase I		increases expression	EXP	MT	5,323	6,867	RGD:6480464	CTD
G	Mt-co2	mitochondrially encoded cytochrome c oxidase II		increases expression	EXP	MT	7,006	7,689	RGD:6480464	CTD
G	Mt-co3	mitochondrially encoded cytochrome c oxidase III		increases expression	EXP	MT	8,599	9,382	RGD:6480464	CTD
G	Mt1a	metallothionein 1a		multiple interactions	EXP	19	11,261,631	11,262,647	RGD:6480464	CTD
G	Mt1a	metallothionein 1a		increases expression	EXP	19	11,261,631	11,262,647	RGD:6480464	CTD
G	Mt1a	metallothionein 1a		multiple interactions	EXP	19	11,261,631	11,262,647	RGD:6480464	CTD
G	Nelfa	negative elongation factor complex member A		increases expression	ISO	14	82,502,840	82,526,916	RGD:6480464	CTD
G	Noc3l	nucleolar complex associated 3 homolog (S. cerevisiae)		increases expression	ISO	1	243,108,787	243,137,316	RGD:6480464	CTD
G	Nol3	nucleolar protein 3 (apoptosis repressor with CARD domain)		multiple interactions	EXP	19	35,094,345	35,096,012	RGD:6480464	CTD
G	Nol3	nucleolar protein 3 (apoptosis repressor with CARD domain)		increases expression	EXP	19	35,094,345	35,096,012	RGD:6480464	CTD
G	Nop16	NOP16 nucleolar protein		decreases expression	ISO	17	16,084,950	16,089,867	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		decreases expression	ISO	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		multiple interactions	ISO	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		decreases expression	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		affects expression	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		affects response to substance	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		affects localization	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases expression	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases activity	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		increases expression	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	EXP	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Nr3c2	nuclear receptor subfamily 3, group C, member 2		increases expression	ISO	19	32,527,752	32,875,369	RGD:6480464	CTD
G	Nr4a1	nuclear receptor subfamily 4, group A, member 1		multiple interactions	ISO	7	140,012,807	140,020,590	RGD:6480464	CTD
G	Nr4a1	nuclear receptor subfamily 4, group A, member 1		affects localization	EXP	7	140,012,807	140,020,590	RGD:6480464	CTD
G	Nr6a1	nuclear receptor subfamily 6, group A, member 1		increases expression	ISO	3	18,533,072	18,564,668	RGD:6480464	CTD
G	Nrxn2	neurexin 2		multiple interactions	EXP	1	209,211,740	209,318,064	RGD:6480464	CTD
G	Nrxn2	neurexin 2		increases expression	EXP	1	209,211,740	209,318,064	RGD:6480464	CTD
G	Nudt21	nudix (nucleoside diphosphate linked moiety X)-type motif 21		increases expression	ISO	19	11,412,732	11,428,838	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase 1		decreases expression	EXP	6	41,309,211	41,315,796	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase 1		increases expression	EXP	6	41,309,211	41,315,796	RGD:6480464	CTD
G	Ogn	osteoglycin		multiple interactions	ISO	17	20,987,029	21,007,525	RGD:6480464	CTD
G	Olfm4	olfactomedin 4		increases expression	ISO	15	61,267,802	61,290,288	RGD:6480464	CTD
G	Omd	osteomodulin		multiple interactions	ISO	17	21,015,178	21,023,126	RGD:6480464	CTD
G	Onecut1	one cut homeobox 1		increases expression	EXP	8	79,644,305	79,672,772	RGD:6480464	CTD
G	Orm1	orosomucoid 1		multiple interactions	ISO	5	80,325,042	80,328,194	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Por	P450 (cytochrome) oxidoreductase		increases expression	EXP	12	22,078,629	22,097,301	RGD:6480464	CTD
G	Pou5f1	POU class 5 homeobox 1		multiple interactions	EXP				RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		increases expression	ISO	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		increases expression	ISO	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		decreases expression	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		increases expression	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppat	phosphoribosyl pyrophosphate amidotransferase		decreases expression	ISO	14	33,509,364	33,543,743	RGD:6480464	CTD
G	Ppib	peptidylprolyl isomerase B		increases expression	EXP	8	70,343,463	70,349,320	RGD:6480464	CTD
G	Ppib	peptidylprolyl isomerase B		multiple interactions	EXP	8	70,343,463	70,349,320	RGD:6480464	CTD
G	Ppp2r5a	protein phosphatase 2, regulatory subunit B', alpha		decreases expression	ISO	13	107,413,761	107,458,156	RGD:6480464	CTD
G	Ppp3cb	protein phosphatase 3, catalytic subunit, beta isozyme		decreases expression	ISO	15	3,986,290	4,030,352	RGD:6480464	CTD
G	Prim2	primase, DNA, polypeptide 2		decreases expression	EXP	9	32,206,274	32,424,970	RGD:6480464	CTD
G	Prim2	primase, DNA, polypeptide 2		multiple interactions	EXP	9	32,206,274	32,424,970	RGD:6480464	CTD
G	Prkacb	protein kinase, cAMP dependent, catalytic, beta		decreases phosphorylation	EXP	2	244,949,303	245,035,266	RGD:6480464	CTD
G	Rasa3	RAS p21 protein activator 3		multiple interactions	ISO	16	80,710,463	80,824,220	RGD:6480464	CTD
G	Rora	RAR-related orphan receptor A		multiple interactions	ISO	8	73,052,282	73,817,764	RGD:6480464	CTD
G	RT1-Ba	RT1 class II, locus Ba		increases expression	ISO	20	4,697,971	4,702,564	RGD:6480464	CTD
G	RT1-Bb	RT1 class II, locus Bb		affects expression	ISO	20	4,730,559	4,736,201	RGD:6480464	CTD
G	RT1-DMb	RT1 class II, locus DMb		decreases expression	ISO	20	4,829,535	4,836,772	RGD:6480464	CTD
G	Rxra	retinoid X receptor alpha		increases expression	ISO	3	6,605,782	6,689,224	RGD:6480464	CTD
G	Ryk	receptor-like tyrosine kinase		multiple interactions	EXP	8	107,822,823	107,894,331	RGD:6480464	CTD
G	S100a8	S100 calcium binding protein A8		increases expression	ISO	2	182,961,994	182,962,513	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9		increases expression	ISO	2	182,985,466	182,988,147	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9		decreases expression	EXP	2	182,985,466	182,988,147	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9		increases expression	EXP	2	182,985,466	182,988,147	RGD:6480464	CTD
G	S100a9	S100 calcium binding protein A9		multiple interactions	EXP	2	182,985,466	182,988,147	RGD:6480464	CTD
G	Scarb1	scavenger receptor class B, member 1		decreases expression	EXP	12	32,390,183	32,457,661	RGD:6480464	CTD
G	Scd	stearoyl-CoA desaturase (delta-9-desaturase)		decreases expression	EXP	1	249,358,105	249,371,164	RGD:6480464	CTD
G	Scd	stearoyl-CoA desaturase (delta-9-desaturase)		affects expression	EXP	1	249,358,105	249,371,164	RGD:6480464	CTD
G	Scd1	stearoyl-Coenzyme A desaturase 1		multiple interactions	ISO	1	249,458,860	249,471,460	RGD:6480464	CTD
G	Scd1	stearoyl-Coenzyme A desaturase 1		decreases expression	EXP	1	249,458,860	249,471,460	RGD:6480464	CTD
G	Scel	sciellin		increases expression	ISO	15	87,547,770	87,678,387	RGD:6480464	CTD
G	Scn8a	sodium channel, voltage gated, type VIII, alpha subunit		decreases expression	EXP	7	139,686,180	139,794,282	RGD:6480464	CTD
G	Scn8a	sodium channel, voltage gated, type VIII, alpha subunit		multiple interactions	EXP	7	139,686,180	139,794,282	RGD:6480464	CTD
G	Scnn1a	sodium channel, nonvoltage-gated 1 alpha		increases expression	ISO	4	161,445,936	161,469,267	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1, beta		multiple interactions	ISO	1	180,682,622	180,748,068	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1, beta		increases expression	ISO	1	180,682,622	180,748,068	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1, beta		increases expression	ISO	1	180,682,622	180,748,068	RGD:6480464	CTD
G	Scnn1b	sodium channel, nonvoltage-gated 1, beta		increases expression	EXP	1	180,682,622	180,748,068	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1, gamma		multiple interactions	ISO	1	180,555,660	180,589,534	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1, gamma		increases expression	ISO	1	180,555,660	180,589,534	RGD:6480464	CTD
G	Scnn1g	sodium channel, nonvoltage-gated 1, gamma		increases expression	EXP	1	180,555,660	180,589,534	RGD:6480464	CTD
G	Sdc1	syndecan 1		decreases expression	ISO	6	32,253,352	32,275,812	RGD:6480464	CTD
G	Sdc2	syndecan 2		multiple interactions	ISO	7	68,290,558	68,405,183	RGD:6480464	CTD
G	Sdc4	syndecan 4		increases expression	EXP	3	155,446,138	155,464,825	RGD:6480464	CTD
G	Sdc4	syndecan 4		multiple interactions	EXP	3	155,446,138	155,464,825	RGD:6480464	CTD
G	Sdcbp	syndecan binding protein		increases expression	ISO	5	19,822,440	19,849,223	RGD:6480464	CTD
G	Sephs2	selenophosphate synthetase 2		increases expression	EXP	1	186,535,717	186,538,035	RGD:6480464	CTD
G	Sephs2	selenophosphate synthetase 2		multiple interactions	EXP	1	186,535,717	186,538,035	RGD:6480464	CTD
G	Sepp1	selenoprotein P, plasma, 1		increases expression	EXP	2	52,451,883	52,462,263	RGD:6480464	CTD
G	Sepp1	selenoprotein P, plasma, 1		increases secretion	EXP	2	52,451,883	52,462,263	RGD:6480464	CTD
G	Slc6a4	solute carrier family 6 (neurotransmitter transporter, serotonin), member 4		increases expression	EXP	10	67,134,790	67,155,891	RGD:6480464	CTD
G	Slc7a6	solute carrier family 7 (amino acid transporter light chain, y+L system), member 6		increases expression	EXP	19	36,032,750	36,049,384	RGD:6480464	CTD
G	Slc7a6	solute carrier family 7 (amino acid transporter light chain, y+L system), member 6		multiple interactions	EXP	19	36,032,750	36,049,384	RGD:6480464	CTD
G	Slc9a3	solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3		increases expression	EXP	1	29,930,908	29,973,686	RGD:6480464	CTD
G	Slc9a3	solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3		increases expression	ISO	1	29,930,908	29,973,686	RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		decreases expression	ISO				RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		multiple interactions	EXP				RGD:6480464	CTD
G	Slco1a1	solute carrier organic anion transporter family, member 1a1		decreases expression	EXP				RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		multiple interactions	EXP				RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		affects expression	EXP				RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		increases expression	EXP				RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		increases expression	EXP				RGD:6480464	CTD
G	Slco1b3	solute carrier organic anion transporter family, member 1b3		decreases expression	ISO	4	179,045,586	179,118,680	RGD:6480464	CTD
G	Slco1b3	solute carrier organic anion transporter family, member 1b3		decreases expression	EXP	4	179,045,586	179,118,680	RGD:6480464	CTD
G	Slco1b3	solute carrier organic anion transporter family, member 1b3		multiple interactions	EXP	4	179,045,586	179,118,680	RGD:6480464	CTD
G	Slco2a1	solute carrier organic anion transporter family, member 2a1		decreases expression	ISO	8	108,012,829	108,098,561	RGD:6480464	CTD
G	Slco2b1	solute carrier organic anion transporter family, member 2b1		decreases expression	ISO	1	156,992,492	157,028,887	RGD:6480464	CTD
G	Slco4c1	solute carrier organic anion transporter family, member 4C1		multiple interactions	ISO	9	96,042,701	96,092,537	RGD:6480464	CTD
G	Smad3	SMAD family member 3		affects expression	ISO	8	67,803,909	67,952,056	RGD:6480464	CTD
G	Smoc2	SPARC related modular calcium binding 2		decreases expression	EXP	1	53,165,792	53,295,145	RGD:6480464	CTD
G	Smoc2	SPARC related modular calcium binding 2		multiple interactions	EXP	1	53,165,792	53,295,145	RGD:6480464	CTD
G	Socs1	suppressor of cytokine signaling 1		increases expression	ISO	10	4,819,971	4,820,609	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	EXP	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	EXP	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod3	superoxide dismutase 3, extracellular		multiple interactions	ISO	14	63,381,447	63,387,180	RGD:6480464	CTD
G	Sost	sclerostin		multiple interactions	ISO	10	91,023,712	91,026,759	RGD:6480464	CTD
G	Sox11	SRY (sex determining region Y)-box 11		decreases expression	EXP	6	45,141,366	45,143,387	RGD:6480464	CTD
G	Tjap1	tight junction associated protein 1		decreases expression	EXP	9	10,264,023	10,288,320	RGD:6480464	CTD
G	Tjap1	tight junction associated protein 1		multiple interactions	EXP	9	10,264,023	10,288,320	RGD:6480464	CTD
G	Tle4	transducin-like enhancer of split 4 (E(sp1) homolog, Drosophila)		decreases expression	ISO	1	217,636,135	217,770,594	RGD:6480464	CTD
G	Tlr3	toll-like receptor 3		decreases expression	ISO	16	50,112,910	50,126,371	RGD:6480464	CTD
G	Tmc5	transmembrane channel-like 5		multiple interactions	ISO	1	176,854,487	176,865,156	RGD:6480464	CTD
G	Tnc	tenascin C		multiple interactions	ISO				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases activity	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Ugt2a1	UDP glucuronosyltransferase 2 family, polypeptide A1		affects expression	EXP	14	22,047,612	22,071,582	RGD:6480464	CTD
G	Ugt2b17	UDP glucuronosyltransferase 2 family, polypeptide B17		affects expression	EXP	14	22,639,182	22,650,931	RGD:6480464	CTD
G	Ugt2b17	UDP glucuronosyltransferase 2 family, polypeptide B17		increases expression	EXP	14	22,639,182	22,650,931	RGD:6480464	CTD
G	Usp3	ubiquitin specific peptidase 3		increases expression	EXP	8	70,821,429	70,897,119	RGD:6480464	CTD
G	Vangl1	VANGL planar cell polarity protein 1		decreases expression	EXP	2	197,248,680	197,296,021	RGD:6480464	CTD
G	Vangl1	VANGL planar cell polarity protein 1		multiple interactions	EXP	2	197,248,680	197,296,021	RGD:6480464	CTD
G	Vasp	vasodilator-stimulated phosphoprotein		decreases expression	EXP	1	78,621,494	78,636,762	RGD:6480464	CTD
G	Vasp	vasodilator-stimulated phosphoprotein		multiple interactions	EXP	1	78,621,494	78,636,762	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		decreases expression	ISO	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	EXP	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vcan	versican		multiple interactions	ISO	2	19,712,629	19,801,443	RGD:6480464	CTD
G	Vdr	vitamin D (1,25- dihydroxyvitamin D3) receptor		increases expression	ISO	7	136,567,614	136,617,280	RGD:6480464	CTD
G	Vdr	vitamin D (1,25- dihydroxyvitamin D3) receptor		multiple interactions	ISO	7	136,567,614	136,617,280	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases secretion	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		decreases expression	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Wfdc1	WAP four-disulfide core domain 1		decreases expression	EXP	19	49,924,440	49,943,113	RGD:6480464	CTD
G	Wfs1	Wolfram syndrome 1 (wolframin)		increases expression	ISO	14	79,379,680	79,404,003	RGD:6480464	CTD
G	Wif1	Wnt inhibitory factor 1		multiple interactions	ISO	7	60,330,517	60,400,697	RGD:6480464	CTD
G	Wisp2	WNT1 inducible signaling pathway protein 2		multiple interactions	ISO	3	154,748,977	154,760,324	RGD:6480464	CTD
G	Wnk4	WNK lysine deficient protein kinase 4		increases expression	ISO	10	90,289,273	90,306,225	RGD:6480464	CTD
G	Wnt3a	wingless-type MMTV integration site family, member 3A		multiple interactions	ISO	10	45,553,682	45,594,983	RGD:6480464	CTD
G	Wnt4	wingless-type MMTV integration site family, member 4		decreases expression	EXP	5	156,064,371	156,083,198	RGD:6480464	CTD
G	Wnt4	wingless-type MMTV integration site family, member 4		multiple interactions	EXP	5	156,064,371	156,083,198	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
role	482262
application	245197
anti-inflammatory agent	34323
anti-inflammatory drug	21950
dexamethasone	2908
dexamethasone phosphate	5
dexamethasone sodium m-sulfobenzoate	0
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
p-block element atom	458699
carbon group element atom	410677
carbon atom	407233
organic molecular entity	407226
organic group	167766
organic divalent group	166601
organodiyl group	166601
carbonyl group	166291
carbonyl compound	166291
ketone	31433
oxo steroid	13480
20-oxo steroid	6938
dexamethasone	2908
dexamethasone phosphate	5
dexamethasone sodium m-sulfobenzoate	0