| Term: | clomipramine hydrochloride |
|
| Accession: | CHEBI:3755
|
 browse the term
|
| Definition: | A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
| Synonyms: | exact_synonym: | 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
| | related_synonym: | 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride; 3-chloroimipramine hydrochloride; Anafranil; C19H24Cl2N2; Cl.CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12; InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H; InChIKey=WIMWMKZEIBHDTH-UHFFFAOYSA-N; chloroimipramine monohydrochloride; clomipramine HCl; clomipramine monohydrochloride |
| | xref_casrn: | 17321-77-6 |
| | xref: | ChEMBL:774661 "ChEMBL COMPOUND"; ChemIDplus:17321-77-6 "CAS Registry Number"; DrugBank:DB01242 "DrugBank"; KEGG DRUG:17321-77-6 "CAS Registry Number"; KEGG DRUG:D00811 "KEGG DRUG"; Reaxys:4168494 "Reaxys Registry Number" |
|
|
