5H-benzocycloheptene - Ontology Report

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	5H-benzocycloheptene	go back to main search page
Accession:	CHEBI:37513	browse the term
Definition:	A benzocycloheptene that has formula C11H10.
Synonyms:	exact_synonym:	5H-benzo[7]annulene
	related_synonym:	1,2-benzotropilidene; C11H10; C1C=CC=Cc2ccccc12; InChI=1S/C11H10/c1-2-6-10-8-4-5-9-11(10)7-3-1/h1-6,8-9H,7H2; InChIKey=XHVULKQHRQZNMW-UHFFFAOYSA-N
	xref:	Beilstein:2038514 "Beilstein Registry Number"; Gmelin:28193 "Gmelin Registry Number"

purpurogallin
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	501881
chemical entity	501881
group	456662
polyatomic entity	451021
molecule	371155
cyclic compound	306410
bicyclic compound	63605
carbobicyclic compound	4512
ortho-fused bicyclic hydrocarbon	1199
benzocycloheptene	1
5H-benzocycloheptene	1
purpurogallin	1
Path 2
Term	Annotations
CHEBI ontology	501881
subatomic particle	500845
composite particle	500845
hadron	500845
baryon	500845
nucleon	500845
atomic nucleus	500845
atom	500845
main group element atom	470301
p-block element atom	467779
carbon group element atom	419149
carbon atom	415667
organic molecular entity	415660
organic molecule	365810
organic cyclic compound	304492
carbocyclic compound	73092
carbopolycyclic compound	36814
carbobicyclic compound	4512
ortho-fused bicyclic hydrocarbon	1199
benzocycloheptene	1
5H-benzocycloheptene	1
purpurogallin	1