N-nitrosodiethylamine - Ontology Report

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	N-nitrosodiethylamine	go back to main search page
Accession:	CHEBI:34873	browse the term
Definition:	A nitrosamine that has formula C4H10N2O.
Synonyms:	exact_synonym:	N-ethyl-N-nitrosoethanamine
	related_synonym:	1,1-diethyl-2-oxohydrazine; C4H10N2O; CCN(CC)N=O; DANA; DEN; Diethylnitrosamine; InChI=1S/C4H10N2O/c1-3-6(4-2)5-7/h3-4H2,1-2H3; InChIKey=WBNQDOYYEUMPFS-UHFFFAOYSA-N; N,N-diethylnitrosamine; N,N-diethylnitrosoamine; NDEA; diethylnitrosoamine
	xref_casrn:	55-18-5
	xref:	Beilstein:1744991 "Beilstein Registry Number"; ChEMBL:374889 "ChEMBL COMPOUND"; ChemIDplus:55-18-5 "CAS Registry Number"; KEGG COMPOUND:55-18-5 "CAS Registry Number"; KEGG COMPOUND:C14422 "KEGG COMPOUND"
	xref_mesh:	MESH:D004052
	xref:	NIST Chemistry WebBook:55-18-5 "CAS Registry Number"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

N-nitrosodiethylamine
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Ass1	argininosuccinate synthase 1		increases expression	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		multiple interactions	EXP	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Atf2	activating transcription factor 2		multiple interactions	ISO	3	56,403,676	56,496,473	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		affects expression	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		multiple interactions	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		multiple interactions	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf4	activating transcription factor 4 (tax-responsive enhancer element B67)		multiple interactions	EXP	7	118,537,718	118,538,994	RGD:6480464	CTD
G	Atf5	activating transcription factor 5		multiple interactions	EXP	1	95,284,505	95,286,786	RGD:6480464	CTD
G	Atic	5-aminoimidazole-4-carboxamide ribonucleotide formyltransferase/IMP cyclohydrolase		multiple interactions	EXP	9	70,676,744	70,696,865	RGD:6480464	CTD
G	Atl2	atlastin GTPase 2		multiple interactions	EXP	6	2,728,722	2,771,082	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		increases expression	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		increases phosphorylation	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	EXP	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		decreases activity	EXP	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		decreases expression	EXP	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atox1	ATX1 antioxidant protein 1 homolog (yeast)		increases expression	EXP	10	40,858,190	40,873,226	RGD:6480464	CTD
G	Atox1	ATX1 antioxidant protein 1 homolog (yeast)		multiple interactions	EXP	10	40,858,190	40,873,226	RGD:6480464	CTD
G	Atp11c	ATPase, class VI, type 11C		increases expression	ISO	X	145,746,536	145,861,055	RGD:6480464	CTD
G	Atp11c	ATPase, class VI, type 11C		multiple interactions	ISO	X	145,746,536	145,861,055	RGD:6480464	CTD
G	Atp13a1	ATPase type 13A1		multiple interactions	EXP	16	20,100,481	20,116,536	RGD:6480464	CTD
G	Atp13a4	ATPase type 13A4		decreases expression	ISO	11	73,163,802	73,251,192	RGD:6480464	CTD
G	Atp13a4	ATPase type 13A4		multiple interactions	ISO	11	73,163,802	73,251,192	RGD:6480464	CTD
G	Atp1a1	ATPase, Na+/K+ transporting, alpha 1 polypeptide		multiple interactions	EXP	2	196,657,749	196,687,242	RGD:6480464	CTD
G	Atp1a4	ATPase, Na+/K+ transporting, alpha 4 polypeptide		decreases expression	EXP	13	88,213,848	88,249,075	RGD:6480464	CTD
G	Atp1b1	ATPase, Na+/K+ transporting, beta 1 polypeptide		multiple interactions	EXP	13	80,214,056	80,234,576	RGD:6480464	CTD
G	Atp1b1	ATPase, Na+/K+ transporting, beta 1 polypeptide		increases expression	EXP	13	80,214,056	80,234,576	RGD:6480464	CTD
G	Atp1b3	ATPase, Na+/K+ transporting, beta 3 polypeptide		decreases expression	EXP	8	101,405,877	101,437,757	RGD:6480464	CTD
G	Atp2a1	ATPase, Ca++ transporting, cardiac muscle, fast twitch 1		multiple interactions	ISO				RGD:6480464	CTD
G	Atp2a1	ATPase, Ca++ transporting, cardiac muscle, fast twitch 1		decreases expression	ISO				RGD:6480464	CTD
G	Atp2b2	ATPase, Ca++ transporting, plasma membrane 2		multiple interactions	EXP	4	149,655,651	149,907,813	RGD:6480464	CTD
G	Atp2c1	ATPase, Ca++ transporting, type 2C, member 1		multiple interactions	EXP	8	110,516,092	110,603,620	RGD:6480464	CTD
G	Atr	ataxia telangiectasia and Rad3 related		multiple interactions	ISO	8	100,936,342	101,014,881	RGD:6480464	CTD
G	Bcl2l2	Bcl2-like 2		multiple interactions	ISO	15	32,983,165	32,988,018	RGD:6480464	CTD
G	Bcs1l	BC1 (ubiquinol-cytochrome c reductase) synthesis-like		multiple interactions	EXP	9	73,939,024	73,943,055	RGD:6480464	CTD
G	Bdh1	3-hydroxybutyrate dehydrogenase, type 1		decreases expression	EXP	11	71,130,561	71,165,695	RGD:6480464	CTD
G	Bdh2	3-hydroxybutyrate dehydrogenase, type 2		multiple interactions	EXP	2	232,765,049	232,785,694	RGD:6480464	CTD
G	Bend5	BEN domain containing 5		increases expression	EXP	5	132,955,337	133,001,386	RGD:6480464	CTD
G	Bex1	brain expressed, X-linked 1		increases expression	EXP	X	123,527,737	123,529,133	RGD:6480464	CTD
G	Bex4	brain expressed, X-linked 4		increases expression	EXP	X	123,442,511	123,443,772	RGD:6480464	CTD
G	Bex4	brain expressed, X-linked 4		multiple interactions	EXP	X	123,442,511	123,443,772	RGD:6480464	CTD
G	Bgn	biglycan		multiple interactions	EXP	X	159,380,557	159,393,409	RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		multiple interactions	EXP				RGD:6480464	CTD
G	Bid	BH3 interacting domain death agonist		affects response to substance	ISO	4	157,296,383	157,318,481	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		increases expression	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	EXP				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		increases expression	EXP				RGD:6480464	CTD
G	Blnk	B-cell linker		multiple interactions	EXP	1	246,091,335	246,165,075	RGD:6480464	CTD
G	Bloc1s2	biogenesis of lysosomal organelles complex-1, subunit 2		multiple interactions	EXP	1	249,086,242	249,093,298	RGD:6480464	CTD
G	Bmp1	bone morphogenetic protein 1		multiple interactions	EXP	15	50,878,144	50,922,313	RGD:6480464	CTD
G	Bmp1	bone morphogenetic protein 1		increases expression	EXP	15	50,878,144	50,922,313	RGD:6480464	CTD
G	Bmp2	bone morphogenetic protein 2		multiple interactions	EXP	3	121,372,692	121,381,236	RGD:6480464	CTD
G	Bok	BCL2-related ovarian killer		multiple interactions	EXP	9	92,970,069	92,980,974	RGD:6480464	CTD
G	Bphl	biphenyl hydrolase-like (serine hydrolase)		multiple interactions	EXP	17	37,143,275	37,181,166	RGD:6480464	CTD
G	Braf	v-raf murine sarcoma viral oncogene homolog B1		increases mutagenesis	ISO	4	67,117,759	67,243,058	RGD:6480464	CTD
G	Brca1	breast cancer 1, early onset		increases expression	ISO	10	90,513,630	90,572,676	RGD:6480464	CTD
G	Brca1	breast cancer 1, early onset		multiple interactions	ISO	10	90,513,630	90,572,676	RGD:6480464	CTD
G	Brca2	breast cancer 2, early onset		increases expression	ISO	12	4,282,952	4,323,693	RGD:6480464	CTD
G	Brca2	breast cancer 2, early onset		multiple interactions	ISO	12	4,282,952	4,323,693	RGD:6480464	CTD
G	Bri3	brain protein I3		decreases expression	EXP	12	10,670,023	10,678,698	RGD:6480464	CTD
G	Bspry	B-box and SPRY domain containing		multiple interactions	EXP	5	79,471,061	79,493,239	RGD:6480464	CTD
G	Bst2	bone marrow stromal cell antigen 2		increases expression	ISO	16	18,698,545	18,701,768	RGD:6480464	CTD
G	Bst2	bone marrow stromal cell antigen 2		multiple interactions	ISO	16	18,698,545	18,701,768	RGD:6480464	CTD
G	Btf3	basic transcription factor 3		multiple interactions	EXP	2	28,900,451	28,907,561	RGD:6480464	CTD
G	Btg2	BTG family, member 2		decreases response to substance	ISO	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg2	BTG family, member 2		increases expression	ISO	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg2	BTG family, member 2		multiple interactions	EXP	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg2	BTG family, member 2		increases expression	EXP	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg2	BTG family, member 2		decreases expression	ISO	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg3	BTG family, member 3		multiple interactions	EXP	11	17,241,627	17,257,740	RGD:6480464	CTD
G	Bub1	BUB1 mitotic checkpoint serine/threonine kinase		multiple interactions	ISO	3	115,323,510	115,354,906	RGD:6480464	CTD
G	Bub1	BUB1 mitotic checkpoint serine/threonine kinase		increases expression	ISO	3	115,323,510	115,354,906	RGD:6480464	CTD
G	C1galt1	core 1 synthase, glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase, 1		multiple interactions	EXP	4	32,903,434	32,933,953	RGD:6480464	CTD
G	C1qc	complement component 1, q subcomponent, C chain		multiple interactions	ISO	5	155,656,104	155,659,430	RGD:6480464	CTD
G	C1qc	complement component 1, q subcomponent, C chain		increases expression	EXP	5	155,656,104	155,659,430	RGD:6480464	CTD
G	C1qc	complement component 1, q subcomponent, C chain		increases expression	ISO	5	155,656,104	155,659,430	RGD:6480464	CTD
G	C1s	complement component 1, s subcomponent		decreases expression	EXP	4	160,736,133	160,748,133	RGD:6480464	CTD
G	C4bpa	complement component 4 binding protein, alpha		decreases expression	ISO	13	43,552,947	43,588,565	RGD:6480464	CTD
G	C4bpb	complement component 4 binding protein, beta		decreases expression	EXP	13	43,598,158	43,608,875	RGD:6480464	CTD
G	C5	complement component 5		decreases expression	EXP	3	14,011,115	14,102,744	RGD:6480464	CTD
G	C6	complement component 6		decreases expression	EXP	2	53,691,290	53,764,539	RGD:6480464	CTD
G	C9	complement component 9		decreases expression	ISO	2	55,743,084	55,791,148	RGD:6480464	CTD
G	Ca2	carbonic anhydrase 2		increases expression	EXP	2	88,077,095	88,092,223	RGD:6480464	CTD
G	Ca2	carbonic anhydrase 2		multiple interactions	EXP	2	88,077,095	88,092,223	RGD:6480464	CTD
G	Cab39l	calcium binding protein 39-like		multiple interactions	EXP	15	38,552,234	38,640,594	RGD:6480464	CTD
G	Cables1	Cdk5 and Abl enzyme substrate 1		decreases expression	ISO	18	3,425,890	3,529,998	RGD:6480464	CTD
G	Cacna1a	calcium channel, voltage-dependent, P/Q type, alpha 1A subunit		multiple interactions	EXP	19	25,188,170	25,424,495	RGD:6480464	CTD
G	Cacna2d1	calcium channel, voltage-dependent, alpha2/delta subunit 1		multiple interactions	EXP	4	15,139,881	15,566,740	RGD:6480464	CTD
G	Cacnb1	calcium channel, voltage-dependent, beta 1 subunit		decreases expression	EXP	10	86,764,283	86,784,791	RGD:6480464	CTD
G	Cacng5	calcium channel, voltage-dependent, gamma subunit 5		multiple interactions	EXP	10	97,300,594	97,309,023	RGD:6480464	CTD
G	Car3	carbonic anhydrase 3		multiple interactions	EXP	2	88,106,727	88,114,686	RGD:6480464	CTD
G	Car3	carbonic anhydrase 3		decreases expression	EXP	2	88,106,727	88,114,686	RGD:6480464	CTD
G	Car5a	carbonic anhydrase 5a, mitochondrial		decreases expression	ISO	19	52,158,607	52,188,664	RGD:6480464	CTD
G	Car5a	carbonic anhydrase 5a, mitochondrial		decreases expression	EXP	19	52,158,607	52,188,664	RGD:6480464	CTD
G	Cblc	Cbl proto-oncogene, E3 ubiquitin protein ligase C		multiple interactions	EXP	1	79,091,412	79,108,189	RGD:6480464	CTD
G	Cbr1	carbonyl reductase 1		increases expression	ISO	11	33,787,957	33,790,320	RGD:6480464	CTD
G	Cbr1	carbonyl reductase 1		increases expression	EXP	11	33,787,957	33,790,320	RGD:6480464	CTD
G	Cbs	cystathionine beta synthase		multiple interactions	EXP	20	10,047,478	10,075,520	RGD:6480464	CTD
G	Cbs	cystathionine beta synthase		decreases expression	EXP	20	10,047,478	10,075,520	RGD:6480464	CTD
G	Cbx3	chromobox homolog 3		increases expression	EXP	4	79,707,325	79,720,100	RGD:6480464	CTD
G	Cbx5	chromobox homolog 5		multiple interactions	ISO	7	142,107,922	142,125,543	RGD:6480464	CTD
G	Cbx5	chromobox homolog 5		increases expression	ISO	7	142,107,922	142,125,543	RGD:6480464	CTD
G	Cbx6	chromobox homolog 6		multiple interactions	EXP	7	118,062,267	118,070,004	RGD:6480464	CTD
G	Ccdc136	coiled-coil domain containing 136		increases expression	ISO	4	56,277,389	56,302,052	RGD:6480464	CTD
G	Ccdc19	coiled-coil domain containing 19		multiple interactions	EXP	13	88,527,708	88,551,091	RGD:6480464	CTD
G	Cckbr	cholecystokinin B receptor		multiple interactions	EXP	1	163,156,914	163,166,969	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl21	chemokine (C-C motif) ligand 21		increases expression	EXP	5	59,238,897	59,240,001	RGD:6480464	CTD
G	Ccl21	chemokine (C-C motif) ligand 21		multiple interactions	EXP	5	59,238,897	59,240,001	RGD:6480464	CTD
G	Ccl28	chemokine (C-C motif) ligand 28		decreases expression	EXP	2	51,688,294	51,712,931	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	10	71,605,791	71,610,330	RGD:6480464	CTD
G	Ccl6	chemokine (C-C motif) ligand 6		multiple interactions	EXP	10	71,660,623	71,665,255	RGD:6480464	CTD
G	Ccl6	chemokine (C-C motif) ligand 6		multiple interactions	EXP	10	71,660,623	71,665,255	RGD:6480464	CTD
G	Ccna2	cyclin A2		increases expression	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccna2	cyclin A2		multiple interactions	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccna2	cyclin A2		multiple interactions	EXP	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccna2	cyclin A2		increases expression	EXP	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccnb1	cyclin B1		increases expression	ISO	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb1	cyclin B1		multiple interactions	ISO	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb1	cyclin B1		multiple interactions	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb1	cyclin B1		multiple interactions	EXP	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb2	cyclin B2		increases expression	ISO	8	74,892,108	74,906,181	RGD:6480464	CTD
G	Ccnb2	cyclin B2		multiple interactions	ISO	8	74,892,108	74,906,181	RGD:6480464	CTD
G	Ccnc	cyclin C		multiple interactions	ISO	5	36,465,490	36,483,538	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccndbp1	cyclin D-type binding-protein 1		decreases response to substance	ISO	3	107,787,374	107,800,798	RGD:6480464	CTD
G	Ccne1	cyclin E1		multiple interactions	EXP	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Ccne1	cyclin E1		increases expression	EXP	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Ccne1	cyclin E1		multiple interactions	EXP	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Ccnf	cyclin F		increases expression	ISO	10	13,474,659	13,500,979	RGD:6480464	CTD
G	Ccnf	cyclin F		multiple interactions	ISO	10	13,474,659	13,500,979	RGD:6480464	CTD
G	Ccng1	cyclin G1		increases expression	ISO	10	25,776,380	25,782,754	RGD:6480464	CTD
G	Cdc6	cell division cycle 6		multiple interactions	ISO	10	87,684,493	87,697,865	RGD:6480464	CTD
G	Cdc6	cell division cycle 6		increases expression	ISO	10	87,684,493	87,697,865	RGD:6480464	CTD
G	Cdca3	cell division cycle associated 3		multiple interactions	ISO	4	160,952,986	160,956,574	RGD:6480464	CTD
G	Cdca3	cell division cycle associated 3		increases expression	ISO	4	160,952,986	160,956,574	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		increases expression	ISO	3	54,948,493	54,959,128	RGD:6480464	CTD
G	Cdca7	cell division cycle associated 7		multiple interactions	ISO	3	54,948,493	54,959,128	RGD:6480464	CTD
G	Cdca8	cell division cycle associated 8		increases expression	ISO	5	144,251,164	144,276,352	RGD:6480464	CTD
G	Cdca8	cell division cycle associated 8		multiple interactions	ISO	5	144,251,164	144,276,352	RGD:6480464	CTD
G	Cdca8	cell division cycle associated 8		multiple interactions	EXP	5	144,251,164	144,276,352	RGD:6480464	CTD
G	Cdh11	cadherin 11		multiple interactions	EXP	19	2,225,209	2,382,805	RGD:6480464	CTD
G	Cdh13	cadherin 13		multiple interactions	EXP	19	48,507,173	49,575,123	RGD:6480464	CTD
G	Cdh17	cadherin 17		multiple interactions	EXP	5	26,047,222	26,099,173	RGD:6480464	CTD
G	Cdh2	cadherin 2		multiple interactions	EXP	18	8,048,920	8,267,974	RGD:6480464	CTD
G	Cdh3	cadherin 3		multiple interactions	EXP	19	36,343,823	36,393,819	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		increases expression	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		increases expression	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		multiple interactions	ISO	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		multiple interactions	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		multiple interactions	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		increases expression	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		multiple interactions	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		increases expression	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		increases expression	EXP	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		multiple interactions	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk2ap2	cyclin-dependent kinase 2 associated protein 2		multiple interactions	ISO	1	206,681,430	206,683,098	RGD:6480464	CTD
G	Cdk2ap2	cyclin-dependent kinase 2 associated protein 2		increases expression	ISO	1	206,681,430	206,683,098	RGD:6480464	CTD
G	Cdk4	cyclin-dependent kinase 4		multiple interactions	EXP				RGD:6480464	CTD
G	Cdk4	cyclin-dependent kinase 4		multiple interactions	EXP				RGD:6480464	CTD
G	Cdk4	cyclin-dependent kinase 4		increases expression	EXP				RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		decreases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		decreases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		multiple interactions	EXP	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		decreases expression	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	EXP	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1c	cyclin-dependent kinase inhibitor 1C		increases expression	ISO	1	203,835,215	203,837,844	RGD:6480464	CTD
G	Cdkn1c	cyclin-dependent kinase inhibitor 1C		multiple interactions	ISO	1	203,835,215	203,837,844	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		multiple interactions	ISO	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		multiple interactions	EXP	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		multiple interactions	ISO	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		increases expression	ISO	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		multiple interactions	EXP	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Chrnb1	cholinergic receptor, nicotinic, beta 1 (muscle)		multiple interactions	EXP	10	56,604,907	56,617,423	RGD:6480464	CTD
G	Chrne	cholinergic receptor, nicotinic, epsilon (muscle)		multiple interactions	EXP	10	57,497,192	57,501,511	RGD:6480464	CTD
G	Chst13	carbohydrate (chondroitin 4) sulfotransferase 13		decreases expression	ISO	4	124,571,623	124,584,842	RGD:6480464	CTD
G	Chst4	carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 4		multiple interactions	ISO	19	39,900,812	39,909,464	RGD:6480464	CTD
G	Chst8	carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 8		multiple interactions	EXP	1	87,152,490	87,311,536	RGD:6480464	CTD
G	Chuk	conserved helix-loop-helix ubiquitous kinase		increases activity	ISO	1	249,122,845	249,158,369	RGD:6480464	CTD
G	Cib3	calcium and integrin binding family member 3		increases expression	ISO	16	18,046,964	18,055,850	RGD:6480464	CTD
G	Cib3	calcium and integrin binding family member 3		multiple interactions	ISO	16	18,046,964	18,055,850	RGD:6480464	CTD
G	Cirh1a	cirrhosis, autosomal recessive 1A (cirhin)		multiple interactions	EXP	19	36,742,206	36,770,285	RGD:6480464	CTD
G	Cited2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		increases expression	ISO	1	12,721,500	12,723,943	RGD:6480464	CTD
G	Cited2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	ISO	1	12,721,500	12,723,943	RGD:6480464	CTD
G	Cited2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	EXP	1	12,721,500	12,723,943	RGD:6480464	CTD
G	Cited4	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4		decreases expression	ISO	5	141,258,564	141,259,455	RGD:6480464	CTD
G	Ckap2	cytoskeleton associated protein 2		increases expression	ISO	16	74,492,221	74,518,743	RGD:6480464	CTD
G	Ckap2	cytoskeleton associated protein 2		multiple interactions	ISO	16	74,492,221	74,518,743	RGD:6480464	CTD
G	Cks2	CDC28 protein kinase regulatory subunit 2		increases expression	ISO	17	19,423,502	19,429,451	RGD:6480464	CTD
G	Cks2	CDC28 protein kinase regulatory subunit 2		multiple interactions	ISO	17	19,423,502	19,429,451	RGD:6480464	CTD
G	Clcn1	chloride channel, voltage-sensitive 1		multiple interactions	EXP	4	70,052,319	70,081,449	RGD:6480464	CTD
G	Clcn1	chloride channel, voltage-sensitive 1		increases expression	EXP	4	70,052,319	70,081,449	RGD:6480464	CTD
G	Clcn5	chloride channel, voltage-sensitive 5		multiple interactions	EXP	X	27,383,769	27,409,877	RGD:6480464	CTD
G	Cldn1	claudin 1		multiple interactions	EXP	11	76,473,654	76,488,809	RGD:6480464	CTD
G	Cldn1	claudin 1		multiple interactions	EXP	11	76,473,654	76,488,809	RGD:6480464	CTD
G	Cldn16	claudin 16		increases expression	ISO	11	76,313,985	76,334,074	RGD:6480464	CTD
G	Cldn7	claudin 7		multiple interactions	EXP	10	56,810,947	56,813,134	RGD:6480464	CTD
G	Cldn7	claudin 7		multiple interactions	EXP	10	56,810,947	56,813,134	RGD:6480464	CTD
G	Clec4a3	C-type lectin domain family 4, member A3		increases expression	EXP	4	159,464,410	159,474,023	RGD:6480464	CTD
G	Clic2	chloride intracellular channel 2		increases expression	EXP	20	66,518	81,543	RGD:6480464	CTD
G	Clic5	chloride intracellular channel 5		multiple interactions	EXP	9	12,370,341	12,472,969	RGD:6480464	CTD
G	Clns1a	chloride channel, nucleotide-sensitive, 1A		multiple interactions	EXP	1	154,946,713	154,966,947	RGD:6480464	CTD
G	Clock	clock circadian regulator		multiple interactions	ISO	14	34,218,472	34,258,054	RGD:6480464	CTD
G	Clock	clock circadian regulator		increases response to substance	ISO	14	34,218,472	34,258,054	RGD:6480464	CTD
G	Clock	clock circadian regulator		increases expression	ISO	14	34,218,472	34,258,054	RGD:6480464	CTD
G	Clock	clock circadian regulator		multiple interactions	ISO	14	34,218,472	34,258,054	RGD:6480464	CTD
G	Clock	clock circadian regulator		multiple interactions	EXP	14	34,218,472	34,258,054	RGD:6480464	CTD
G	Clpx	ClpX caseinolytic peptidase X homolog (E. coli)		multiple interactions	EXP	8	69,530,991	69,572,018	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	EXP	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	EXP	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	EXP	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Clybl	citrate lyase beta like		multiple interactions	EXP	15	107,313,924	107,539,458	RGD:6480464	CTD
G	Clybl	citrate lyase beta like		multiple interactions	EXP	15	107,313,924	107,539,458	RGD:6480464	CTD
G	Cml3	camello-like 3		multiple interactions	EXP	4	119,964,411	119,966,307	RGD:6480464	CTD
G	Cml5	camello-like 5		increases expression	ISO	4	119,981,266	120,006,794	RGD:6480464	CTD
G	Cml5	camello-like 5		multiple interactions	ISO	4	119,981,266	120,006,794	RGD:6480464	CTD
G	Cnn3	calponin 3, acidic		multiple interactions	EXP	2	218,044,803	218,075,914	RGD:6480464	CTD
G	Col16a1	collagen, type XVI, alpha 1		multiple interactions	EXP	5	149,072,905	149,126,350	RGD:6480464	CTD
G	Col18a1	collagen, type XVIII, alpha 1		multiple interactions	EXP	20	11,920,816	11,982,468	RGD:6480464	CTD
G	Col18a1	collagen, type XVIII, alpha 1		multiple interactions	EXP	20	11,920,816	11,982,468	RGD:6480464	CTD
G	Col18a1	collagen, type XVIII, alpha 1		decreases expression	EXP	20	11,920,816	11,982,468	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	EXP	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		increases expression	EXP	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a2	collagen, type I, alpha 2		increases expression	EXP	4	29,393,645	29,428,572	RGD:6480464	CTD
G	Col27a1	collagen, type XXVII, alpha 1		multiple interactions	EXP	5	80,198,078	80,316,354	RGD:6480464	CTD
G	Col4a1	collagen, type IV, alpha 1		multiple interactions	EXP	16	83,045,183	83,157,835	RGD:6480464	CTD
G	Col4a1	collagen, type IV, alpha 1		increases expression	EXP	16	83,045,183	83,157,835	RGD:6480464	CTD
G	Col4a2	collagen, type IV, alpha 2		increases expression	ISO	16	82,899,206	83,045,102	RGD:6480464	CTD
G	Col5a2	collagen, type V, alpha 2		increases expression	EXP	9	44,374,113	44,525,086	RGD:6480464	CTD
G	Col6a1	collagen, type VI, alpha 1		multiple interactions	ISO	20	12,320,102	12,338,500	RGD:6480464	CTD
G	Col6a1	collagen, type VI, alpha 1		increases expression	ISO	20	12,320,102	12,338,500	RGD:6480464	CTD
G	Col6a2	collagen, type VI, alpha 2		multiple interactions	EXP	20	12,436,783	12,464,512	RGD:6480464	CTD
G	Colec12	collectin sub-family member 12		multiple interactions	EXP	18	996,297	1,188,288	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		multiple interactions	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		decreases response to substance	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		increases expression	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		increases mutagenesis	EXP	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		multiple interactions	ISO	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctrb1	chymotrypsinogen B1		increases expression	EXP	19	41,611,382	41,616,058	RGD:6480464	CTD
G	Ctsb	cathepsin B		increases expression	ISO	15	42,402,829	42,423,701	RGD:6480464	CTD
G	Ctsb	cathepsin B		multiple interactions	EXP	15	42,402,829	42,423,701	RGD:6480464	CTD
G	Ctsc	cathepsin C		decreases expression	ISO	1	144,629,802	144,661,183	RGD:6480464	CTD
G	Ctsc	cathepsin C		multiple interactions	ISO	1	144,629,802	144,661,183	RGD:6480464	CTD
G	Ctsc	cathepsin C		multiple interactions	EXP	1	144,629,802	144,661,183	RGD:6480464	CTD
G	Ctsc	cathepsin C		multiple interactions	EXP	1	144,629,802	144,661,183	RGD:6480464	CTD
G	Ctse	cathepsin E		increases expression	EXP	13	44,582,911	44,605,241	RGD:6480464	CTD
G	Ctsk	cathepsin K		multiple interactions	EXP	2	190,394,854	190,405,668	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		increases expression	ISO	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		increases expression	EXP	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Ctsm	cathepsin M		multiple interactions	EXP	17	8,931,468	8,936,876	RGD:6480464	CTD
G	Ctsr	cathepsin R		increases expression	EXP	17	9,235,486	9,244,251	RGD:6480464	CTD
G	Ctsr	cathepsin R		multiple interactions	EXP	17	9,235,486	9,244,251	RGD:6480464	CTD
G	Ctss	cathepsin S		increases expression	ISO	2	190,425,290	190,466,877	RGD:6480464	CTD
G	Ctss	cathepsin S		multiple interactions	ISO	2	190,425,290	190,466,877	RGD:6480464	CTD
G	Ctxn1	cortexin 1		decreases expression	EXP	12	1,531,822	1,533,433	RGD:6480464	CTD
G	Cul5	cullin 5		multiple interactions	EXP	8	57,080,787	57,132,486	RGD:6480464	CTD
G	Cuta	cutA divalent cation tolerance homolog (E. coli)		multiple interactions	EXP	20	5,175,113	5,176,689	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		multiple interactions	EXP	19	10,666,940	10,676,424	RGD:6480464	CTD
G	Cxadr	coxsackie virus and adenovirus receptor		increases expression	EXP	11	17,193,505	17,241,549	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		increases expression	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl11	chemokine (C-X-C motif) ligand 11		multiple interactions	EXP	14	17,250,648	17,253,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		multiple interactions	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases expression	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases expression	EXP	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cxcl16	chemokine (C-X-C motif) ligand 16		multiple interactions	EXP	10	57,296,126	57,300,721	RGD:6480464	CTD
G	Cxcr3	chemokine (C-X-C motif) receptor 3		multiple interactions	EXP	X	89,794,276	89,796,927	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		multiple interactions	ISO	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		increases expression	ISO	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		multiple interactions	EXP	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		multiple interactions	ISO	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		decreases expression	EXP	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		multiple interactions	EXP	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5a	cytochrome b5 type A (microsomal)		multiple interactions	EXP	18	81,415,972	81,452,606	RGD:6480464	CTD
G	Cyb5b	cytochrome b5 type B (outer mitochondrial membrane)		multiple interactions	ISO	19	37,016,959	37,050,722	RGD:6480464	CTD
G	Cyb5r3	cytochrome b5 reductase 3		multiple interactions	EXP	7	121,187,821	121,205,382	RGD:6480464	CTD
G	Cyb5r4	cytochrome b5 reductase 4		decreases expression	EXP	8	92,278,453	92,343,490	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		multiple interactions	EXP	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		increases expression	EXP	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cygb	cytoglobin		multiple interactions	EXP	10	106,759,885	106,769,651	RGD:6480464	CTD
G	Cyp11a1	cytochrome P450, family 11, subfamily a, polypeptide 1		decreases activity	EXP	8	61,793,976	61,805,308	RGD:6480464	CTD
G	Cyp11a1	cytochrome P450, family 11, subfamily a, polypeptide 1		multiple interactions	EXP	8	61,793,976	61,805,308	RGD:6480464	CTD
G	Cyp17a1	cytochrome P450, family 17, subfamily a, polypeptide 1		multiple interactions	EXP	1	251,965,458	251,971,449	RGD:6480464	CTD
G	Cyp17a1	cytochrome P450, family 17, subfamily a, polypeptide 1		decreases activity	EXP	1	251,965,458	251,971,449	RGD:6480464	CTD
G	Cyp17a1	cytochrome P450, family 17, subfamily a, polypeptide 1		multiple interactions	EXP	1	251,965,458	251,971,449	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp2c22	cytochrome P450, family 2, subfamily c, polypeptide 22		multiple interactions	EXP	1	245,298,381	245,339,035	RGD:6480464	CTD
G	Cyp2c6v1	cytochrome P450, family 2, subfamily C, polypeptide 6, variant 1		decreases expression	ISO	1	243,859,015	243,896,003	RGD:6480464	CTD
G	Cyp2c7	cytochrome P450, family 2, subfamily c, polypeptide 7		decreases expression	ISO				RGD:6480464	CTD
G	Cyp2c7	cytochrome P450, family 2, subfamily c, polypeptide 7		multiple interactions	EXP				RGD:6480464	CTD
G	Cyp2c7	cytochrome P450, family 2, subfamily c, polypeptide 7		multiple interactions	EXP				RGD:6480464	CTD
G	Cyp2c7	cytochrome P450, family 2, subfamily c, polypeptide 7		decreases expression	EXP				RGD:6480464	CTD
G	Cyp2c7	cytochrome P450, family 2, subfamily c, polypeptide 7		multiple interactions	EXP				RGD:6480464	CTD
G	Cyp2c80	cytochrome P450, family 2, subfamily c, polypeptide 80		decreases expression	EXP	1	244,517,262	244,536,426	RGD:6480464	CTD
G	Cyp2d2	cytochrome P450, family 2, subfamily d, polypeptide 2		decreases expression	EXP	7	120,796,210	120,800,279	RGD:6480464	CTD
G	Cyp2d2	cytochrome P450, family 2, subfamily d, polypeptide 2		decreases expression	EXP	7	120,796,210	120,800,279	RGD:6480464	CTD
G	Cyp2d4	cytochrome P450, family 2, subfamily d, polypeptide 4		increases expression	ISO	7	120,742,273	120,752,274	RGD:6480464	CTD
G	Cyp2d4	cytochrome P450, family 2, subfamily d, polypeptide 4		multiple interactions	ISO	7	120,742,273	120,752,274	RGD:6480464	CTD
G	Cyp2d4	cytochrome P450, family 2, subfamily d, polypeptide 4		multiple interactions	EXP	7	120,742,273	120,752,274	RGD:6480464	CTD
G	Cyp2d4	cytochrome P450, family 2, subfamily d, polypeptide 4		multiple interactions	EXP	7	120,742,273	120,752,274	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects metabolic processing	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases activity	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases response to substance	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases response to substance	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		decreases expression	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2f4	cytochrome P450, family 2, subfamily f, polypeptide 4		multiple interactions	EXP	1	82,191,741	82,204,629	RGD:6480464	CTD
G	Cyp2f4	cytochrome P450, family 2, subfamily f, polypeptide 4		multiple interactions	EXP	1	82,191,741	82,204,629	RGD:6480464	CTD
G	Cyp2j3	cytochrome P450, family 2, subfamily j, polypeptide 3		decreases expression	EXP	5	116,744,337	116,766,822	RGD:6480464	CTD
G	Cyp2u1	cytochrome P450, family 2, subfamily u, polypeptide 1		multiple interactions	EXP	2	228,771,187	228,788,636	RGD:6480464	CTD
G	Cyp3a18	cytochrome P450, family 3, subfamily a, polypeptide 18		decreases expression	EXP	12	9,086,752	9,136,606	RGD:6480464	CTD
G	Cyp3a18	cytochrome P450, family 3, subfamily a, polypeptide 18		multiple interactions	EXP	12	9,086,752	9,136,606	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a2	cytochrome P450, family 3, subfamily a, polypeptide 2		multiple interactions	EXP	12	9,517,016	9,541,000	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		decreases expression	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a23/3a1	cytochrome P450, family 3, subfamily a, polypeptide 23/polypeptide 1		multiple interactions	EXP	12	9,567,120	9,595,974	RGD:6480464	CTD
G	Cyp3a62	cytochrome P450, family 3, subfamily a, polypeptide 62		multiple interactions	EXP				RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		multiple interactions	ISO	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		multiple interactions	EXP	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		decreases expression	ISO	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		multiple interactions	EXP	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		increases expression	ISO	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		increases expression	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		decreases expression	EXP	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp4a8	cytochrome P450, family 4, subfamily a, polypeptide 8		multiple interactions	EXP	5	135,546,858	135,578,199	RGD:6480464	CTD
G	Cyp4a8	cytochrome P450, family 4, subfamily a, polypeptide 8		multiple interactions	EXP	5	135,546,858	135,578,199	RGD:6480464	CTD
G	Cyp4a8	cytochrome P450, family 4, subfamily a, polypeptide 8		multiple interactions	EXP	5	135,546,858	135,578,199	RGD:6480464	CTD
G	Cyp4b1	cytochrome P450, family 4, subfamily b, polypeptide 1		multiple interactions	ISO	5	135,917,327	135,934,636	RGD:6480464	CTD
G	Ddx56	DEAD (Asp-Glu-Ala-Asp) box helicase 56		multiple interactions	EXP	14	86,985,893	86,994,552	RGD:6480464	CTD
G	Deaf1	DEAF1 transcription factor		multiple interactions	EXP	1	201,491,091	201,524,767	RGD:6480464	CTD
G	Defb1	defensin beta 1		increases expression	EXP	16	74,980,054	74,995,445	RGD:6480464	CTD
G	Degs1	delta(4)-desaturase, sphingolipid 1		multiple interactions	EXP	13	98,242,981	98,249,638	RGD:6480464	CTD
G	Dek	DEK oncogene		multiple interactions	ISO	17	23,633,551	23,655,507	RGD:6480464	CTD
G	Dek	DEK oncogene		increases expression	ISO	17	23,633,551	23,655,507	RGD:6480464	CTD
G	Dgkb	diacylglycerol kinase, beta		multiple interactions	EXP	6	56,715,327	57,479,656	RGD:6480464	CTD
G	Dguok	deoxyguanosine kinase		increases expression	ISO	4	117,697,251	117,725,383	RGD:6480464	CTD
G	Dguok	deoxyguanosine kinase		multiple interactions	ISO	4	117,697,251	117,725,383	RGD:6480464	CTD
G	Dhfr	dihydrofolate reductase		multiple interactions	EXP	2	22,607,093	22,828,487	RGD:6480464	CTD
G	Dhodh	dihydroorotate dehydrogenase (quinone)		multiple interactions	EXP	19	39,463,111	39,477,184	RGD:6480464	CTD
G	Dhrs2	dehydrogenase/reductase (SDR family) member 2		decreases expression	ISO	15	33,286,599	33,337,467	RGD:6480464	CTD
G	Dhrs3	dehydrogenase/reductase (SDR family) member 3		decreases expression	ISO	5	163,341,856	163,375,604	RGD:6480464	CTD
G	Dhrs7	dehydrogenase/reductase (SDR family) member 7		decreases expression	EXP	6	95,005,675	95,029,519	RGD:6480464	CTD
G	Diablo	diablo, IAP-binding mitochondrial protein		multiple interactions	EXP	12	34,196,347	34,209,633	RGD:6480464	CTD
G	Dio1	deiodinase, iodothyronine, type I		multiple interactions	EXP	5	128,385,702	128,404,015	RGD:6480464	CTD
G	Dio2	deiodinase, iodothyronine, type II		multiple interactions	EXP	6	114,307,758	114,317,563	RGD:6480464	CTD
G	Disc1	disrupted in schizophrenia 1		increases expression	EXP	19	55,265,116	55,449,375	RGD:6480464	CTD
G	Disc1	disrupted in schizophrenia 1		multiple interactions	EXP	19	55,265,116	55,449,375	RGD:6480464	CTD
G	Dmbt1	deleted in malignant brain tumors 1		increases expression	EXP	1	190,378,428	190,470,536	RGD:6480464	CTD
G	Dmbt1	deleted in malignant brain tumors 1		multiple interactions	EXP	1	190,378,428	190,470,536	RGD:6480464	CTD
G	Dmgdh	dimethylglycine dehydrogenase		decreases expression	EXP	2	23,976,563	24,052,766	RGD:6480464	CTD
G	Dmgdh	dimethylglycine dehydrogenase		multiple interactions	EXP	2	23,976,563	24,052,766	RGD:6480464	CTD
G	Dmrt1	doublesex and mab-3 related transcription factor 1		multiple interactions	EXP	1	228,936,606	229,036,885	RGD:6480464	CTD
G	Dnah3	dynein, axonemal, heavy chain 3		multiple interactions	EXP	1	178,234,649	178,311,979	RGD:6480464	CTD
G	Dnah5	dynein, axonemal, heavy chain 5		multiple interactions	EXP	2	80,126,196	80,390,674	RGD:6480464	CTD
G	Dnaja1	DnaJ (Hsp40) homolog, subfamily A, member 1		multiple interactions	EXP	5	58,100,794	58,111,705	RGD:6480464	CTD
G	Dnaja1	DnaJ (Hsp40) homolog, subfamily A, member 1		multiple interactions	EXP	5	58,100,794	58,111,705	RGD:6480464	CTD
G	Dnaja2	DnaJ (Hsp40) homolog, subfamily A, member 2		multiple interactions	EXP	19	22,853,702	22,871,846	RGD:6480464	CTD
G	Dnaja2	DnaJ (Hsp40) homolog, subfamily A, member 2		multiple interactions	EXP	19	22,853,702	22,871,846	RGD:6480464	CTD
G	Dnajb1	DnaJ (Hsp40) homolog, subfamily B, member 1		multiple interactions	ISO	19	26,213,739	26,217,480	RGD:6480464	CTD
G	Dnajb1	DnaJ (Hsp40) homolog, subfamily B, member 1		decreases expression	ISO	19	26,213,739	26,217,480	RGD:6480464	CTD
G	Dnajb1	DnaJ (Hsp40) homolog, subfamily B, member 1		multiple interactions	EXP	19	26,213,739	26,217,480	RGD:6480464	CTD
G	Dnajc9	DnaJ (Hsp40) homolog, subfamily C, member 9		increases expression	ISO	15	4,152,480	4,156,756	RGD:6480464	CTD
G	Dnajc9	DnaJ (Hsp40) homolog, subfamily C, member 9		multiple interactions	ISO	15	4,152,480	4,156,756	RGD:6480464	CTD
G	Dnm1	dynamin 1		multiple interactions	ISO	3	11,434,778	11,478,452	RGD:6480464	CTD
G	Dnm1	dynamin 1		increases expression	ISO	3	11,434,778	11,478,452	RGD:6480464	CTD
G	Dnm1	dynamin 1		multiple interactions	EXP	3	11,434,778	11,478,452	RGD:6480464	CTD
G	Dnm1l	dynamin 1-like		multiple interactions	EXP	11	86,617,236	86,665,861	RGD:6480464	CTD
G	Dnmt1	DNA (cytosine-5-)-methyltransferase 1		multiple interactions	ISO	8	19,926,995	19,973,256	RGD:6480464	CTD
G	Dnmt1	DNA (cytosine-5-)-methyltransferase 1		decreases expression	ISO	8	19,926,995	19,973,256	RGD:6480464	CTD
G	Dnmt1	DNA (cytosine-5-)-methyltransferase 1		multiple interactions	ISO	8	19,926,995	19,973,256	RGD:6480464	CTD
G	Dnmt1	DNA (cytosine-5-)-methyltransferase 1		increases expression	ISO	8	19,926,995	19,973,256	RGD:6480464	CTD
G	Dock9	dedicator of cytokinesis 9		multiple interactions	EXP	15	106,629,808	106,787,895	RGD:6480464	CTD
G	Dok1	docking protein 1		increases expression	ISO	4	117,242,746	117,245,209	RGD:6480464	CTD
G	Dok1	docking protein 1		multiple interactions	ISO	4	117,242,746	117,245,209	RGD:6480464	CTD
G	Dom3z	DOM-3 homolog Z (C. elegans)		multiple interactions	EXP	20	4,093,718	4,095,802	RGD:6480464	CTD
G	Dpep1	dipeptidase 1 (renal)		multiple interactions	EXP	19	53,503,467	53,518,440	RGD:6480464	CTD
G	Dpp4	dipeptidylpeptidase 4		multiple interactions	EXP	3	44,279,255	44,360,283	RGD:6480464	CTD
G	Dpp7	dipeptidylpeptidase 7		multiple interactions	EXP	3	3,514,968	3,519,220	RGD:6480464	CTD
G	Dpp7	dipeptidylpeptidase 7		increases expression	EXP	3	3,514,968	3,519,220	RGD:6480464	CTD
G	Dpt	dermatopontin		multiple interactions	EXP	13	80,562,890	80,591,361	RGD:6480464	CTD
G	Dpy30	dpy-30 homolog (C. elegans)		multiple interactions	EXP	6	21,084,031	21,104,731	RGD:6480464	CTD
G	Dpyd	dihydropyrimidine dehydrogenase		multiple interactions	EXP	2	214,931,901	215,818,809	RGD:6480464	CTD
G	Dpyd	dihydropyrimidine dehydrogenase		multiple interactions	EXP	2	214,931,901	215,818,809	RGD:6480464	CTD
G	Dpyd	dihydropyrimidine dehydrogenase		decreases expression	EXP	2	214,931,901	215,818,809	RGD:6480464	CTD
G	Dpys	dihydropyrimidinase		multiple interactions	EXP	7	75,368,238	75,446,160	RGD:6480464	CTD
G	Dpys	dihydropyrimidinase		multiple interactions	EXP	7	75,368,238	75,446,160	RGD:6480464	CTD
G	Dpys	dihydropyrimidinase		decreases expression	EXP	7	75,368,238	75,446,160	RGD:6480464	CTD
G	Dpysl2	dihydropyrimidinase-like 2		increases expression	EXP	15	46,346,413	46,413,786	RGD:6480464	CTD
G	Dtnb	dystrobrevin, beta		multiple interactions	EXP	6	26,542,148	26,742,199	RGD:6480464	CTD
G	Dtymk	deoxythymidylate kinase (thymidylate kinase)		increases expression	ISO	9	93,065,333	93,074,168	RGD:6480464	CTD
G	Dtymk	deoxythymidylate kinase (thymidylate kinase)		multiple interactions	ISO	9	93,065,333	93,074,168	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		multiple interactions	ISO	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		increases expression	ISO	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		multiple interactions	EXP	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Dusp4	dual specificity phosphatase 4		decreases expression	ISO	16	61,109,626	61,119,981	RGD:6480464	CTD
G	Eif3k	eukaryotic translation initiation factor 3, subunit K		multiple interactions	EXP	1	84,083,646	84,088,799	RGD:6480464	CTD
G	Eif5a	eukaryotic translation initiation factor 5A		multiple interactions	EXP	10	56,760,289	56,764,689	RGD:6480464	CTD
G	Elac2	elaC homolog 2 (E. coli)		increases expression	EXP	10	51,290,317	51,313,106	RGD:6480464	CTD
G	Elf1	E74-like factor 1		increases expression	ISO	15	60,793,794	60,835,189	RGD:6480464	CTD
G	Eln	elastin		multiple interactions	EXP	12	23,033,657	23,077,043	RGD:6480464	CTD
G	Elovl3	ELOVL fatty acid elongase 3		decreases expression	ISO	1	251,351,908	251,355,736	RGD:6480464	CTD
G	Emp1	epithelial membrane protein 1		decreases expression	ISO	4	172,315,122	172,335,536	RGD:6480464	CTD
G	Emp1	epithelial membrane protein 1		multiple interactions	EXP	4	172,315,122	172,335,536	RGD:6480464	CTD
G	Emp1	epithelial membrane protein 1		increases expression	EXP	4	172,315,122	172,335,536	RGD:6480464	CTD
G	Enc1	ectodermal-neural cortex 1		multiple interactions	EXP	2	27,720,805	27,733,168	RGD:6480464	CTD
G	Enc1	ectodermal-neural cortex 1		increases expression	EXP	2	27,720,805	27,733,168	RGD:6480464	CTD
G	Eng	endoglin		multiple interactions	EXP				RGD:6480464	CTD
G	Eno1	enolase 1, (alpha)		multiple interactions	EXP	5	167,394,131	167,405,516	RGD:6480464	CTD
G	Eno1	enolase 1, (alpha)		multiple interactions	EXP	5	167,394,131	167,405,516	RGD:6480464	CTD
G	Enpp1	ectonucleotide pyrophosphatase/phosphodiesterase 1		increases expression	EXP	1	21,223,678	21,287,411	RGD:6480464	CTD
G	Enpp2	ectonucleotide pyrophosphatase/phosphodiesterase 2		decreases expression	EXP	7	91,295,824	91,377,850	RGD:6480464	CTD
G	Enpp5	ectonucleotide pyrophosphatase/phosphodiesterase 5		multiple interactions	EXP	9	12,574,480	12,581,130	RGD:6480464	CTD
G	Entpd2	ectonucleoside triphosphate diphosphohydrolase 2		multiple interactions	EXP	3	3,564,380	3,569,801	RGD:6480464	CTD
G	Entpd5	ectonucleoside triphosphate diphosphohydrolase 5		increases expression	EXP	6	108,439,822	108,469,756	RGD:6480464	CTD
G	Epb41l3	erythrocyte membrane protein band 4.1-like 3		affects expression	EXP	9	108,303,607	108,426,942	RGD:6480464	CTD
G	Epcam	epithelial cell adhesion molecule		multiple interactions	EXP	6	11,176,664	11,192,628	RGD:6480464	CTD
G	Epcam	epithelial cell adhesion molecule		increases expression	EXP	6	11,176,664	11,192,628	RGD:6480464	CTD
G	Epdr1	ependymin related protein 1 (zebrafish)		multiple interactions	EXP	17	53,135,000	53,160,954	RGD:6480464	CTD
G	Epdr1	ependymin related protein 1 (zebrafish)		increases expression	EXP	17	53,135,000	53,160,954	RGD:6480464	CTD
G	Ephx1	epoxide hydrolase 1, microsomal (xenobiotic)		increases expression	ISO	13	96,722,973	96,752,940	RGD:6480464	CTD
G	Ephx1	epoxide hydrolase 1, microsomal (xenobiotic)		multiple interactions	EXP	13	96,722,973	96,752,940	RGD:6480464	CTD
G	Ephx1	epoxide hydrolase 1, microsomal (xenobiotic)		increases expression	EXP	13	96,722,973	96,752,940	RGD:6480464	CTD
G	Ephx1	epoxide hydrolase 1, microsomal (xenobiotic)		multiple interactions	ISO	13	96,722,973	96,752,940	RGD:6480464	CTD
G	Ephx1	epoxide hydrolase 1, microsomal (xenobiotic)		multiple interactions	EXP	13	96,722,973	96,752,940	RGD:6480464	CTD
G	Ephx2	epoxide hydrolase 2, cytoplasmic		multiple interactions	EXP	15	45,497,660	45,556,101	RGD:6480464	CTD
G	Epor	erythropoietin receptor		increases expression	ISO	8	21,061,310	21,065,886	RGD:6480464	CTD
G	Epor	erythropoietin receptor		multiple interactions	ISO	8	21,061,310	21,065,886	RGD:6480464	CTD
G	Eps15	epidermal growth factor receptor pathway substrate 15		multiple interactions	EXP	5	130,639,805	130,739,014	RGD:6480464	CTD
G	Erc1	ELKS/RAB6-interacting/CAST family member 1		increases expression	EXP	4	155,931,377	156,221,104	RGD:6480464	CTD
G	Ercc2	excision repair cross-complementing rodent repair deficiency, complementation group 2		multiple interactions	ISO				RGD:6480464	CTD
G	Ercc2	excision repair cross-complementing rodent repair deficiency, complementation group 2		multiple interactions	ISO				RGD:6480464	CTD
G	Ercc3	excision repair cross-complementing rodent repair deficiency, complementation group 3		multiple interactions	EXP	18	24,684,912	24,716,143	RGD:6480464	CTD
G	Ercc3	excision repair cross-complementing rodent repair deficiency, complementation group 3		multiple interactions	EXP	18	24,684,912	24,716,143	RGD:6480464	CTD
G	Ercc4	excision repair cross-complementing rodent repair deficiency, complementation group 4		multiple interactions	ISO	10	2,144,262	2,177,554	RGD:6480464	CTD
G	Ercc5	excision repair cross-complementing rodent repair deficiency, complementation group 5		multiple interactions	ISO	9	43,248,023	43,293,196	RGD:6480464	CTD
G	Ercc5	excision repair cross-complementing rodent repair deficiency, complementation group 5		increases expression	ISO	9	43,248,023	43,293,196	RGD:6480464	CTD
G	Ercc5	excision repair cross-complementing rodent repair deficiency, complementation group 5		multiple interactions	ISO	9	43,248,023	43,293,196	RGD:6480464	CTD
G	Erp27	endoplasmic reticulum protein 27		decreases expression	ISO	4	173,948,853	173,966,545	RGD:6480464	CTD
G	Erp29	endoplasmic reticulum protein 29		multiple interactions	EXP	12	36,225,110	36,231,363	RGD:6480464	CTD
G	Esm1	endothelial cell-specific molecule 1		multiple interactions	EXP	2	44,626,010	44,634,748	RGD:6480464	CTD
G	Espn	espin		decreases expression	ISO	5	169,349,723	169,382,076	RGD:6480464	CTD
G	Etnk1	ethanolamine kinase 1		multiple interactions	EXP	4	181,060,600	181,104,724	RGD:6480464	CTD
G	Ets1	v-ets erythroblastosis virus E26 oncogene homolog 1 (avian)		multiple interactions	EXP	8	32,481,694	32,545,237	RGD:6480464	CTD
G	Ets2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		affects expression	ISO	11	36,014,047	36,030,833	RGD:6480464	CTD
G	Ets2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		increases expression	ISO	11	36,014,047	36,030,833	RGD:6480464	CTD
G	Etv4	ets variant 4		increases expression	ISO	10	90,808,439	90,824,019	RGD:6480464	CTD
G	Etv4	ets variant 4		multiple interactions	ISO	10	90,808,439	90,824,019	RGD:6480464	CTD
G	Exoc8	exocyst complex component 8		increases expression	ISO	19	55,066,272	55,068,761	RGD:6480464	CTD
G	Exoc8	exocyst complex component 8		multiple interactions	ISO	19	55,066,272	55,068,761	RGD:6480464	CTD
G	Exosc5	exosome component 5		multiple interactions	EXP	1	80,871,353	80,876,329	RGD:6480464	CTD
G	Exosc7	exosome component 7		multiple interactions	EXP	8	127,868,051	127,893,391	RGD:6480464	CTD
G	Ezh2	enhancer of zeste homolog 2 (Drosophila)		increases expression	ISO	4	75,709,959	75,773,279	RGD:6480464	CTD
G	Ezh2	enhancer of zeste homolog 2 (Drosophila)		multiple interactions	ISO	4	75,709,959	75,773,279	RGD:6480464	CTD
G	Ezr	ezrin		multiple interactions	EXP	1	41,178,195	41,221,735	RGD:6480464	CTD
G	Ezr	ezrin		multiple interactions	EXP	1	41,178,195	41,221,735	RGD:6480464	CTD
G	Ezr	ezrin		increases expression	EXP	1	41,178,195	41,221,735	RGD:6480464	CTD
G	F10	coagulation factor X		decreases expression	EXP	16	81,327,237	81,346,544	RGD:6480464	CTD
G	F5	coagulation factor V (proaccelerin, labile factor)		multiple interactions	EXP	13	79,934,956	79,997,285	RGD:6480464	CTD
G	Faah	fatty acid amide hydrolase		decreases expression	EXP	5	136,310,965	136,329,817	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		decreases expression	EXP	4	104,412,200	104,415,981	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		multiple interactions	EXP	4	104,412,200	104,415,981	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		increases expression	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fkbp11	FK506 binding protein 11		increases expression	EXP	7	137,490,985	137,494,418	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		multiple interactions	EXP	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Flt1	FMS-related tyrosine kinase 1		decreases expression	EXP	12	7,858,092	8,035,966	RGD:6480464	CTD
G	Flt1	FMS-related tyrosine kinase 1		increases expression	EXP	12	7,858,092	8,035,966	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		multiple interactions	EXP	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		multiple interactions	EXP	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		multiple interactions	EXP	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo1	flavin containing monooxygenase 1		decreases expression	EXP	13	78,503,770	78,536,359	RGD:6480464	CTD
G	Fmo2	flavin containing monooxygenase 2		multiple interactions	EXP	13	78,546,315	78,592,870	RGD:6480464	CTD
G	Fmo2	flavin containing monooxygenase 2		multiple interactions	EXP	13	78,546,315	78,592,870	RGD:6480464	CTD
G	Fmo3	flavin containing monooxygenase 3		increases expression	ISO	13	78,659,513	78,678,524	RGD:6480464	CTD
G	Fmo3	flavin containing monooxygenase 3		multiple interactions	ISO	13	78,659,513	78,678,524	RGD:6480464	CTD
G	Fmo3	flavin containing monooxygenase 3		multiple interactions	EXP	13	78,659,513	78,678,524	RGD:6480464	CTD
G	Fmo5	flavin containing monooxygenase 5		multiple interactions	EXP	2	192,463,087	192,489,803	RGD:6480464	CTD
G	Fmo5	flavin containing monooxygenase 5		multiple interactions	EXP	2	192,463,087	192,489,803	RGD:6480464	CTD
G	Fn1	fibronectin 1		multiple interactions	EXP	9	70,702,181	70,771,155	RGD:6480464	CTD
G	Fndc1	fibronectin type III domain containing 1		multiple interactions	EXP	1	41,522,019	41,583,357	RGD:6480464	CTD
G	Fndc3b	fibronectin type III domain containing 3B		multiple interactions	EXP	2	113,315,670	113,558,806	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		affects expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fosl1	fos-like antigen 1		multiple interactions	EXP	1	208,090,612	208,099,118	RGD:6480464	CTD
G	Foxd1	forkhead box D1		multiple interactions	EXP	2	28,944,067	28,945,665	RGD:6480464	CTD
G	Foxj1	forkhead box J1		decreases expression	ISO				RGD:6480464	CTD
G	Foxm1	forkhead box M1		multiple interactions	ISO	4	165,383,666	165,394,688	RGD:6480464	CTD
G	Foxm1	forkhead box M1		increases expression	ISO	4	165,383,666	165,394,688	RGD:6480464	CTD
G	Foxm1	forkhead box M1		increases phosphorylation	ISO	4	165,383,666	165,394,688	RGD:6480464	CTD
G	Foxm1	forkhead box M1		multiple interactions	ISO	4	165,383,666	165,394,688	RGD:6480464	CTD
G	Foxm1	forkhead box M1		multiple interactions	ISO	4	165,383,666	165,394,688	RGD:6480464	CTD
G	Foxq1	forkhead box Q1		multiple interactions	EXP	17	39,332,906	39,334,655	RGD:6480464	CTD
G	Frmd6	FERM domain containing 6		multiple interactions	EXP	6	92,953,340	93,027,451	RGD:6480464	CTD
G	Frzb	frizzled-related protein		multiple interactions	EXP	3	63,350,504	63,383,436	RGD:6480464	CTD
G	Fstl1	follistatin-like 1		multiple interactions	EXP	11	64,681,814	64,735,673	RGD:6480464	CTD
G	Fth1	ferritin, heavy polypeptide 1		decreases expression	ISO	1	212,430,453	212,432,741	RGD:6480464	CTD
G	Ftl	ferritin, light polypeptide		multiple interactions	EXP	1	95,929,248	95,931,092	RGD:6480464	CTD
G	Ftl	ferritin, light polypeptide		multiple interactions	EXP	1	95,929,248	95,931,092	RGD:6480464	CTD
G	Ftl	ferritin, light polypeptide		decreases expression	ISO	1	95,929,248	95,931,092	RGD:6480464	CTD
G	Ftl	ferritin, light polypeptide		multiple interactions	ISO	1	95,929,248	95,931,092	RGD:6480464	CTD
G	Fut2	fucosyltransferase 2 (secretor status included)		multiple interactions	EXP	1	96,118,530	96,137,450	RGD:6480464	CTD
G	Fut8	fucosyltransferase 8 (alpha (1,6) fucosyltransferase)		decreases expression	ISO	6	99,871,195	100,010,833	RGD:6480464	CTD
G	Fxyd1	FXYD domain-containing ion transport regulator 1		decreases expression	EXP	1	86,095,551	86,098,079	RGD:6480464	CTD
G	G0s2	G0/G1switch 2		multiple interactions	EXP	13	109,121,297	109,122,209	RGD:6480464	CTD
G	G0s2	G0/G1switch 2		multiple interactions	EXP	13	109,121,297	109,122,209	RGD:6480464	CTD
G	G0s2	G0/G1switch 2		decreases expression	EXP	13	109,121,297	109,122,209	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		increases expression	ISO	10	90,393,531	90,403,485	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		multiple interactions	ISO	10	90,393,531	90,403,485	RGD:6480464	CTD
G	G6pc	glucose-6-phosphatase, catalytic subunit		multiple interactions	EXP	10	90,393,531	90,403,485	RGD:6480464	CTD
G	G6pd	glucose-6-phosphate dehydrogenase		multiple interactions	EXP	X	160,186,450	160,192,316	RGD:6480464	CTD
G	G6pd	glucose-6-phosphate dehydrogenase		increases expression	EXP	X	160,186,450	160,192,316	RGD:6480464	CTD
G	Gabrb1	gamma-aminobutyric acid (GABA) A receptor, beta 1		decreases expression	EXP	14	38,530,259	39,005,615	RGD:6480464	CTD
G	Gabrg1	gamma-aminobutyric acid (GABA) A receptor, gamma 1		multiple interactions	EXP	14	39,878,182	39,951,391	RGD:6480464	CTD
G	Gad2	glutamate decarboxylase 2		decreases expression	EXP	17	96,259,430	96,321,857	RGD:6480464	CTD
G	Gadd45a	growth arrest and DNA-damage-inducible, alpha		multiple interactions	EXP	4	96,649,941	96,652,243	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		decreases expression	ISO	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		multiple interactions	ISO	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		multiple interactions	ISO	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		increases expression	ISO	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		multiple interactions	EXP	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		multiple interactions	EXP	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45b	growth arrest and DNA-damage-inducible, beta		multiple interactions	EXP	7	10,289,073	10,291,102	RGD:6480464	CTD
G	Gadd45g	growth arrest and DNA-damage-inducible, gamma		increases expression	ISO	17	19,230,896	19,232,641	RGD:6480464	CTD
G	Gadd45g	growth arrest and DNA-damage-inducible, gamma		multiple interactions	ISO	17	19,230,896	19,232,641	RGD:6480464	CTD
G	Gale	UDP-galactose-4-epimerase		increases expression	EXP	5	154,745,853	154,750,357	RGD:6480464	CTD
G	Gjb1	gap junction protein, beta 1		decreases expression	EXP	X	89,448,873	89,456,812	RGD:6480464	CTD
G	Gjb1	gap junction protein, beta 1		affects response to substance	EXP	X	89,448,873	89,456,812	RGD:6480464	CTD
G	Gjb2	gap junction protein, beta 2		increases expression	EXP	15	36,153,526	36,159,490	RGD:6480464	CTD
G	Gjc2	gap junction protein, gamma 2		multiple interactions	EXP	10	45,480,937	45,488,651	RGD:6480464	CTD
G	Gkn1	gastrokine 1		multiple interactions	EXP	4	121,496,151	121,501,439	RGD:6480464	CTD
G	Gkn3	gastrokine 3		decreases expression	ISO	4	121,535,051	121,540,818	RGD:6480464	CTD
G	Gkn3	gastrokine 3		multiple interactions	ISO	4	121,535,051	121,540,818	RGD:6480464	CTD
G	Glo1	glyoxalase 1		increases expression	ISO	20	8,900,984	8,919,001	RGD:6480464	CTD
G	Glo1	glyoxalase 1		multiple interactions	ISO	20	8,900,984	8,919,001	RGD:6480464	CTD
G	Glrx3	glutaredoxin 3		multiple interactions	EXP	1	197,176,020	197,206,249	RGD:6480464	CTD
G	Gls	glutaminase		multiple interactions	EXP	9	46,380,165	46,452,974	RGD:6480464	CTD
G	Gls2	glutaminase 2 (liver, mitochondrial)		multiple interactions	EXP	7	1,484,397	1,495,283	RGD:6480464	CTD
G	Glul	glutamate-ammonia ligase		multiple interactions	EXP				RGD:6480464	CTD
G	Glul	glutamate-ammonia ligase		increases expression	EXP				RGD:6480464	CTD
G	Glyat	glycine-N-acyltransferase		decreases expression	EXP	1	215,653,254	215,666,991	RGD:6480464	CTD
G	Gmds	GDP-mannose 4, 6-dehydratase		multiple interactions	EXP	17	38,461,733	39,016,771	RGD:6480464	CTD
G	Gmnn	geminin		multiple interactions	ISO	17	47,372,316	47,380,559	RGD:6480464	CTD
G	Gmnn	geminin		increases expression	ISO	17	47,372,316	47,380,559	RGD:6480464	CTD
G	Gnal	guanine nucleotide binding protein, alpha stimulating, olfactory type		multiple interactions	EXP	18	63,595,606	63,735,803	RGD:6480464	CTD
G	Gne	glucosamine (UDP-N-acetyl)-2-epimerase/N-acetylmannosamine kinase		multiple interactions	EXP	5	60,506,171	60,536,403	RGD:6480464	CTD
G	Gng8	guanine nucleotide binding protein (G protein), gamma 8		multiple interactions	EXP	1	77,221,378	77,223,313	RGD:6480464	CTD
G	Gnl3	guanine nucleotide binding protein-like 3 (nucleolar)		multiple interactions	EXP	16	6,444,437	6,450,375	RGD:6480464	CTD
G	Gnmt	glycine N-methyltransferase		decreases expression	EXP	9	10,127,092	10,130,444	RGD:6480464	CTD
G	Golga2	golgin A2		multiple interactions	EXP	3	11,412,088	11,434,260	RGD:6480464	CTD
G	Got1	glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1)		increases activity	EXP	1	247,324,285	247,347,553	RGD:6480464	CTD
G	Got1	glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1)		multiple interactions	ISO	1	247,324,285	247,347,553	RGD:6480464	CTD
G	Got1	glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1)		multiple interactions	EXP	1	247,324,285	247,347,553	RGD:6480464	CTD
G	Gpam	glycerol-3-phosphate acyltransferase, mitochondrial		multiple interactions	EXP	1	261,370,264	261,431,434	RGD:6480464	CTD
G	Gpbar1	G protein-coupled bile acid receptor 1		multiple interactions	EXP	9	73,605,141	73,606,130	RGD:6480464	CTD
G	Gpc3	glypican 3		multiple interactions	EXP	X	139,192,115	139,560,649	RGD:6480464	CTD
G	Gphn	gephyrin		multiple interactions	EXP	6	100,833,004	101,302,957	RGD:6480464	CTD
G	Gphn	gephyrin		decreases expression	EXP	6	100,833,004	101,302,957	RGD:6480464	CTD
G	Gpi	glucose-6-phosphate isomerase		multiple interactions	EXP	1	86,658,836	86,686,712	RGD:6480464	CTD
G	Gpld1	glycosylphosphatidylinositol specific phospholipase D1		decreases expression	EXP	17	47,145,567	47,188,345	RGD:6480464	CTD
G	Gpm6a	glycoprotein m6a		multiple interactions	EXP	16	39,670,748	39,783,384	RGD:6480464	CTD
G	Gpm6b	glycoprotein m6b		multiple interactions	EXP	X	48,746,584	48,788,414	RGD:6480464	CTD
G	Gpnmb	glycoprotein (transmembrane) nmb		increases expression	EXP	4	77,161,352	77,182,624	RGD:6480464	CTD
G	Gpr19	G protein-coupled receptor 19		multiple interactions	EXP	4	171,791,727	171,809,215	RGD:6480464	CTD
G	Gpr56	G protein-coupled receptor 56		multiple interactions	EXP	19	10,438,332	10,475,607	RGD:6480464	CTD
G	Gpr64	G protein-coupled receptor 64		multiple interactions	EXP	X	55,585,378	55,658,340	RGD:6480464	CTD
G	Gpr64	G protein-coupled receptor 64		decreases expression	EXP	X	55,585,378	55,658,340	RGD:6480464	CTD
G	Gpt	glutamic-pyruvate transaminase (alanine aminotransferase)		multiple interactions	EXP	7	114,746,054	114,748,903	RGD:6480464	CTD
G	Gpt	glutamic-pyruvate transaminase (alanine aminotransferase)		increases activity	EXP	7	114,746,054	114,748,903	RGD:6480464	CTD
G	Gpt	glutamic-pyruvate transaminase (alanine aminotransferase)		multiple interactions	EXP	7	114,746,054	114,748,903	RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		decreases expression	ISO				RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		multiple interactions	EXP				RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		multiple interactions	EXP				RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		multiple interactions	ISO				RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		multiple interactions	EXP				RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		decreases expression	EXP				RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	ISO	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		increases expression	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	EXP	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx3	glutathione peroxidase 3		multiple interactions	EXP	10	40,311,094	40,319,382	RGD:6480464	CTD
G	Gpx3	glutathione peroxidase 3		increases expression	EXP	10	40,311,094	40,319,382	RGD:6480464	CTD
G	Gpx6	glutathione peroxidase 6		multiple interactions	EXP	17	51,063,379	51,068,058	RGD:6480464	CTD
G	Grb14	growth factor receptor bound protein 14		multiple interactions	EXP	3	46,832,380	46,952,670	RGD:6480464	CTD
G	Gria1	glutamate receptor, ionotropic, AMPA 1		multiple interactions	EXP	10	42,613,359	42,616,610	RGD:6480464	CTD
G	Grik2	glutamate receptor, ionotropic, kainate 2		multiple interactions	EXP	20	53,231,473	53,713,131	RGD:6480464	CTD
G	Grik5	glutamate receptor, ionotropic, kainate 5		multiple interactions	EXP	1	80,313,801	80,384,390	RGD:6480464	CTD
G	Grm7	glutamate receptor, metabotropic 7		multiple interactions	EXP	4	146,952,340	147,270,225	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase mu 3		increases expression	EXP	2	203,532,363	203,537,135	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase mu 3		decreases expression	EXP	2	203,532,363	203,537,135	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase mu 3		multiple interactions	EXP	2	203,532,363	203,537,135	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		increases expression	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		increases expression	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	EXP	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gstt2	glutathione S-transferase, theta 2		multiple interactions	EXP	20	13,221,696	13,225,367	RGD:6480464	CTD
G	Gstt2	glutathione S-transferase, theta 2		increases expression	EXP	20	13,221,696	13,225,367	RGD:6480464	CTD
G	Gtf2h1	general transcription factor IIH, polypeptide 1		multiple interactions	EXP	1	97,352,251	97,380,298	RGD:6480464	CTD
G	Gucy2c	guanylate cyclase 2C		multiple interactions	EXP	4	173,740,202	173,791,116	RGD:6480464	CTD
G	Gulo	gulonolactone (L-) oxidase		decreases expression	EXP	15	45,410,685	45,434,014	RGD:6480464	CTD
G	Gulo	gulonolactone (L-) oxidase		multiple interactions	EXP	15	45,410,685	45,434,014	RGD:6480464	CTD
G	Gyg1	glycogenin 1		multiple interactions	EXP	2	105,264,657	105,307,070	RGD:6480464	CTD
G	Gys2	glycogen synthase 2		decreases expression	EXP	4	179,984,036	180,018,819	RGD:6480464	CTD
G	H19	H19, imprinted maternally expressed transcript (non-protein coding)		increases expression	ISO	1	202,822,925	202,825,601	RGD:6480464	CTD
G	H19	H19, imprinted maternally expressed transcript (non-protein coding)		multiple interactions	ISO	1	202,822,925	202,825,601	RGD:6480464	CTD
G	Haao	3-hydroxyanthranilate 3,4-dioxygenase		decreases expression	EXP	6	7,197,352	7,210,456	RGD:6480464	CTD
G	Hadha	hydroxyacyl-CoA dehydrogenase/3-ketoacyl-CoA thiolase/enoyl-CoA hydratase (trifunctional protein), alpha subunit		multiple interactions	EXP	6	26,173,798	26,191,433	RGD:6480464	CTD
G	Hagh	hydroxyacyl glutathione hydrolase		decreases expression	EXP	10	14,106,047	14,117,459	RGD:6480464	CTD
G	Hal	histidine ammonia lyase		multiple interactions	EXP	7	30,520,913	30,551,145	RGD:6480464	CTD
G	Hal	histidine ammonia lyase		multiple interactions	EXP	7	30,520,913	30,551,145	RGD:6480464	CTD
G	Hal	histidine ammonia lyase		decreases expression	EXP	7	30,520,913	30,551,145	RGD:6480464	CTD
G	Hamp	hepcidin antimicrobial peptide		decreases expression	ISO	1	85,978,120	85,980,059	RGD:6480464	CTD
G	Hamp	hepcidin antimicrobial peptide		multiple interactions	ISO	1	85,978,120	85,980,059	RGD:6480464	CTD
G	Hamp	hepcidin antimicrobial peptide		multiple interactions	EXP	1	85,978,120	85,980,059	RGD:6480464	CTD
G	Hamp	hepcidin antimicrobial peptide		multiple interactions	EXP	1	85,978,120	85,980,059	RGD:6480464	CTD
G	Hao1	hydroxyacid oxidase (glycolate oxidase) 1		decreases expression	EXP	3	122,506,916	122,564,012	RGD:6480464	CTD
G	Hao2	hydroxyacid oxidase 2 (long chain)		multiple interactions	EXP	2	193,532,833	193,557,229	RGD:6480464	CTD
G	Hao2	hydroxyacid oxidase 2 (long chain)		decreases expression	EXP	2	193,532,833	193,557,229	RGD:6480464	CTD
G	Hapln4	hyaluronan and proteoglycan link protein 4		increases expression	ISO	16	19,816,321	19,824,506	RGD:6480464	CTD
G	Hat1	histone acetyltransferase 1		increases expression	ISO	3	53,696,664	53,744,333	RGD:6480464	CTD
G	Hat1	histone acetyltransferase 1		multiple interactions	ISO	3	53,696,664	53,744,333	RGD:6480464	CTD
G	Hba1	hemoglobin, alpha 1		increases expression	ISO	10	15,584,360	15,585,215	RGD:6480464	CTD
G	Hbb	hemoglobin, beta		multiple interactions	EXP	1	161,618,782	161,620,193	RGD:6480464	CTD
G	Hcn4	hyperpolarization activated cyclic nucleotide-gated potassium channel 4		multiple interactions	EXP	8	62,629,828	62,667,248	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		multiple interactions	ISO	5	148,672,515	148,699,810	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		decreases expression	ISO	5	148,672,515	148,699,810	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		increases expression	ISO	5	148,672,515	148,699,810	RGD:6480464	CTD
G	Hdac10	histone deacetylase 10		multiple interactions	EXP	7	127,423,736	127,428,838	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		multiple interactions	EXP	3	114,119,316	114,138,107	RGD:6480464	CTD
G	Hddc3	HD domain containing 3		multiple interactions	EXP	1	136,161,425	136,163,710	RGD:6480464	CTD
G	Hdgf	hepatoma-derived growth factor		multiple interactions	EXP	2	179,981,346	179,991,892	RGD:6480464	CTD
G	Heph	hephaestin		increases expression	EXP	X	84,033,540	84,138,728	RGD:6480464	CTD
G	Herpud1	homocysteine-inducible, endoplasmic reticulum stress-inducible, ubiquitin-like domain member 1		decreases expression	EXP	19	11,036,567	11,046,914	RGD:6480464	CTD
G	Hes6	hairy and enhancer of split 6 (Drosophila)		decreases expression	EXP	9	90,639,890	90,641,596	RGD:6480464	CTD
G	Hexb	hexosaminidase B		multiple interactions	EXP	2	27,649,188	27,672,231	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		multiple interactions	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		decreases expression	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		increases expression	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		multiple interactions	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hgfac	HGF activator		multiple interactions	ISO	14	81,348,282	81,354,836	RGD:6480464	CTD
G	Hgfac	HGF activator		decreases expression	ISO	14	81,348,282	81,354,836	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	EXP	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		multiple interactions	EXP	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Higd2a	HIG1 hypoxia inducible domain family, member 2A		multiple interactions	EXP	17	16,083,853	16,084,777	RGD:6480464	CTD
G	Hm13	histocompatibility 13		multiple interactions	EXP	3	143,020,648	143,059,566	RGD:6480464	CTD
G	Hsd11b1	hydroxysteroid 11-beta dehydrogenase 1		multiple interactions	EXP	13	109,063,491	109,089,468	RGD:6480464	CTD
G	Hsd17b11	hydroxysteroid (17-beta) dehydrogenase 11		increases expression	ISO	14	6,859,573	6,891,511	RGD:6480464	CTD
G	Hsd17b11	hydroxysteroid (17-beta) dehydrogenase 11		multiple interactions	ISO	14	6,859,573	6,891,511	RGD:6480464	CTD
G	Hsd17b13	hydroxysteroid (17-beta) dehydrogenase 13		multiple interactions	EXP	14	6,901,197	6,915,871	RGD:6480464	CTD
G	Hsd17b2	hydroxysteroid (17-beta) dehydrogenase 2		decreases expression	EXP	19	47,729,519	47,802,933	RGD:6480464	CTD
G	Hsd17b2	hydroxysteroid (17-beta) dehydrogenase 2		multiple interactions	EXP	19	47,729,519	47,802,933	RGD:6480464	CTD
G	Hsd17b6	hydroxysteroid (17-beta) dehydrogenase 6		multiple interactions	EXP	7	1,118,183	1,137,670	RGD:6480464	CTD
G	Hsd3b	3 beta-hydroxysteroid dehydrogenase/delta-5-delta-4 isomerase type II		decreases expression	EXP	2	193,387,391	193,388,559	RGD:6480464	CTD
G	Hsd3b	3 beta-hydroxysteroid dehydrogenase/delta-5-delta-4 isomerase type II		multiple interactions	EXP	2	193,387,391	193,388,559	RGD:6480464	CTD
G	Hsf1	heat shock transcription factor 1		multiple interactions	EXP	7	114,524,211	114,551,166	RGD:6480464	CTD
G	Hsp90aa1	heat shock protein 90, alpha (cytosolic), class A member 1		multiple interactions	EXP	6	135,413,616	135,419,147	RGD:6480464	CTD
G	Hsp90aa1	heat shock protein 90, alpha (cytosolic), class A member 1		increases expression	EXP	6	135,413,616	135,419,147	RGD:6480464	CTD
G	Hsp90ab1	heat shock protein 90 alpha (cytosolic), class B member 1		increases expression	EXP	9	11,033,496	11,038,868	RGD:6480464	CTD
G	Hspa1a	heat shock protein 1A		multiple interactions	EXP	20	3,945,716	3,959,552	RGD:6480464	CTD
G	Hspa1a	heat shock protein 1A		multiple interactions	EXP	20	3,945,716	3,959,552	RGD:6480464	CTD
G	Hspa1b	heat shock protein 1B		increases expression	ISO	20	3,955,274	3,957,748	RGD:6480464	CTD
G	Hspa1b	heat shock protein 1B		increases expression	ISO	20	3,955,274	3,957,748	RGD:6480464	CTD
G	Hspa1b	heat shock protein 1B		multiple interactions	ISO	20	3,955,274	3,957,748	RGD:6480464	CTD
G	Hspa2	heat shock protein 2		increases expression	ISO	6	99,000,541	99,003,041	RGD:6480464	CTD
G	Hspa2	heat shock protein 2		multiple interactions	EXP	6	99,000,541	99,003,041	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		multiple interactions	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		decreases expression	EXP	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspb1	heat shock protein 1		multiple interactions	ISO	12	21,911,223	21,912,784	RGD:6480464	CTD
G	Hspb1	heat shock protein 1		increases expression	ISO	12	21,911,223	21,912,784	RGD:6480464	CTD
G	Hspb1	heat shock protein 1		multiple interactions	EXP	12	21,911,223	21,912,784	RGD:6480464	CTD
G	Hspb1	heat shock protein 1		multiple interactions	EXP	12	21,911,223	21,912,784	RGD:6480464	CTD
G	Hspb2	heat shock protein beta 2		multiple interactions	EXP	8	54,105,807	54,106,778	RGD:6480464	CTD
G	Hspb2	heat shock protein beta 2		multiple interactions	EXP	8	54,105,807	54,106,778	RGD:6480464	CTD
G	Hspbap1	Hspb associated protein 1		multiple interactions	EXP	11	66,774,152	66,828,789	RGD:6480464	CTD
G	Hspd1	heat shock protein 1 (chaperonin)		increases expression	ISO	9	53,884,193	53,895,043	RGD:6480464	CTD
G	Hspd1	heat shock protein 1 (chaperonin)		multiple interactions	ISO	9	53,884,193	53,895,043	RGD:6480464	CTD
G	Hspd1	heat shock protein 1 (chaperonin)		multiple interactions	EXP	9	53,884,193	53,895,043	RGD:6480464	CTD
G	Hspd1	heat shock protein 1 (chaperonin)		decreases response to substance	ISO	9	53,884,193	53,895,043	RGD:6480464	CTD
G	Hspe1	heat shock protein 1 (chaperonin 10)		multiple interactions	ISO	9	53,895,333	53,898,421	RGD:6480464	CTD
G	Hspe1	heat shock protein 1 (chaperonin 10)		multiple interactions	EXP	9	53,895,333	53,898,421	RGD:6480464	CTD
G	Hspe1	heat shock protein 1 (chaperonin 10)		multiple interactions	EXP	9	53,895,333	53,898,421	RGD:6480464	CTD
G	Hsph1	heat shock 105/110 protein 1		increases expression	ISO	12	5,794,645	5,811,453	RGD:6480464	CTD
G	Htatip2	HIV-1 Tat interactive protein 2		multiple interactions	EXP	1	99,563,187	99,577,802	RGD:6480464	CTD
G	Htr2a	5-hydroxytryptamine (serotonin) receptor 2A, G protein-coupled		increases expression	ISO	15	55,463,743	55,532,293	RGD:6480464	CTD
G	Htr2a	5-hydroxytryptamine (serotonin) receptor 2A, G protein-coupled		multiple interactions	ISO	15	55,463,743	55,532,293	RGD:6480464	CTD
G	Htra2	HtrA serine peptidase 2		multiple interactions	EXP	4	117,262,206	117,265,368	RGD:6480464	CTD
G	Hyou1	hypoxia up-regulated 1		multiple interactions	EXP	8	47,346,753	47,358,869	RGD:6480464	CTD
G	Ica1	islet cell autoantigen 1		multiple interactions	EXP	4	33,680,878	33,830,443	RGD:6480464	CTD
G	Id3	inhibitor of DNA binding 3		multiple interactions	ISO	5	154,934,138	154,935,707	RGD:6480464	CTD
G	Id3	inhibitor of DNA binding 3		increases expression	ISO	5	154,934,138	154,935,707	RGD:6480464	CTD
G	Id4	inhibitor of DNA binding 4		multiple interactions	EXP	17	22,525,292	22,527,861	RGD:6480464	CTD
G	Id4	inhibitor of DNA binding 4		decreases expression	EXP	17	22,525,292	22,527,861	RGD:6480464	CTD
G	Idh2	isocitrate dehydrogenase 2 (NADP+), mitochondrial		multiple interactions	ISO	1	135,876,052	135,895,373	RGD:6480464	CTD
G	Idh2	isocitrate dehydrogenase 2 (NADP+), mitochondrial		increases expression	ISO	1	135,876,052	135,895,373	RGD:6480464	CTD
G	Idi1	isopentenyl-diphosphate delta isomerase 1		multiple interactions	EXP	17	72,557,196	72,563,149	RGD:6480464	CTD
G	Idi1	isopentenyl-diphosphate delta isomerase 1		decreases expression	EXP	17	72,557,196	72,563,149	RGD:6480464	CTD
G	Ido1	indoleamine 2,3-dioxygenase 1		multiple interactions	EXP	16	71,866,340	71,878,373	RGD:6480464	CTD
G	Ier5	immediate early response 5		multiple interactions	EXP	13	70,058,818	70,060,910	RGD:6480464	CTD
G	Ifna1	interferon, alpha 1		multiple interactions	EXP				RGD:6480464	CTD
G	Ifna1	interferon, alpha 1		multiple interactions	EXP				RGD:6480464	CTD
G	Ifnb1	interferon beta 1, fibroblast		increases expression	ISO	5	107,837,628	107,838,182	RGD:6480464	CTD
G	Ifng	interferon gamma		increases expression	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		affects response to substance	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	EXP	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifngr1	interferon gamma receptor 1		increases expression	EXP	1	14,846,369	14,864,804	RGD:6480464	CTD
G	Ift88	intraflagellar transport 88 homolog (Chlamydomonas)		increases response to substance	ISO	15	36,468,007	36,560,959	RGD:6480464	CTD
G	Igbp1	immunoglobulin (CD79A) binding protein 1		multiple interactions	EXP	X	88,490,498	88,507,054	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		affects expression	EXP	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1r1	interleukin 1 receptor, type I		multiple interactions	EXP	9	39,434,910	39,473,552	RGD:6480464	CTD
G	Il1r2	interleukin 1 receptor, type II		increases expression	ISO	9	39,279,397	39,319,672	RGD:6480464	CTD
G	Il1rap	interleukin 1 receptor accessory protein		decreases expression	ISO	11	76,092,252	76,222,576	RGD:6480464	CTD
G	Il2	interleukin 2		multiple interactions	EXP	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il2rb	interleukin 2 receptor, beta		multiple interactions	EXP				RGD:6480464	CTD
G	Il4r	interleukin 4 receptor		decreases expression	EXP	1	184,612,903	184,637,863	RGD:6480464	CTD
G	Il4r	interleukin 4 receptor		increases expression	EXP	1	184,612,903	184,637,863	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		affects expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases response to substance	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Imp4	IMP4, U3 small nucleolar ribonucleoprotein, homolog (yeast)		multiple interactions	EXP	9	33,179,406	33,184,544	RGD:6480464	CTD
G	Incenp	inner centromere protein		increases expression	ISO	1	212,326,516	212,352,859	RGD:6480464	CTD
G	Incenp	inner centromere protein		multiple interactions	ISO	1	212,326,516	212,352,859	RGD:6480464	CTD
G	Inhbb	inhibin beta-B		multiple interactions	EXP	13	32,170,987	32,176,689	RGD:6480464	CTD
G	Inhbc	inhibin beta C		multiple interactions	EXP	7	67,315,295	67,328,764	RGD:6480464	CTD
G	Inhbe	inhibin beta E		decreases expression	EXP	7	67,308,713	67,310,138	RGD:6480464	CTD
G	Inpp5a	inositol polyphosphate-5-phosphatase A		multiple interactions	EXP	1	199,187,936	199,395,997	RGD:6480464	CTD
G	Ins1	insulin 1		decreases expression	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Insig2	insulin induced gene 2		multiple interactions	EXP	13	33,331,951	33,345,132	RGD:6480464	CTD
G	Insig2	insulin induced gene 2		multiple interactions	EXP	13	33,331,951	33,345,132	RGD:6480464	CTD
G	Insr	insulin receptor		affects expression	EXP	12	2,934,967	3,087,691	RGD:6480464	CTD
G	Insr	insulin receptor		decreases expression	EXP	12	2,934,967	3,087,691	RGD:6480464	CTD
G	Insrr	insulin receptor-related receptor		multiple interactions	EXP	2	179,857,189	179,876,572	RGD:6480464	CTD
G	Ip6k2	inositol hexakisphosphate kinase 2		increases expression	EXP	8	113,836,756	113,861,895	RGD:6480464	CTD
G	Ip6k2	inositol hexakisphosphate kinase 2		multiple interactions	EXP	8	113,836,756	113,861,895	RGD:6480464	CTD
G	Irak2	interleukin-1 receptor-associated kinase 2		decreases expression	ISO	4	149,543,029	149,599,463	RGD:6480464	CTD
G	Irak2	interleukin-1 receptor-associated kinase 2		multiple interactions	ISO	4	149,543,029	149,599,463	RGD:6480464	CTD
G	Irf1	interferon regulatory factor 1		increases expression	ISO	10	39,220,600	39,227,602	RGD:6480464	CTD
G	Irf1	interferon regulatory factor 1		multiple interactions	EXP	10	39,220,600	39,227,602	RGD:6480464	CTD
G	Irf1	interferon regulatory factor 1		multiple interactions	ISO	10	39,220,600	39,227,602	RGD:6480464	CTD
G	Irf7	interferon regulatory factor 7		multiple interactions	EXP	1	201,456,689	201,459,756	RGD:6480464	CTD
G	Irs1	insulin receptor substrate 1		affects expression	EXP	9	81,585,251	81,638,071	RGD:6480464	CTD
G	Irs2	insulin receptor substrate 2		affects expression	EXP	16	83,379,987	83,404,220	RGD:6480464	CTD
G	Irs2	insulin receptor substrate 2		multiple interactions	EXP	16	83,379,987	83,404,220	RGD:6480464	CTD
G	Irs3	insulin receptor substrate 3		multiple interactions	EXP	12	19,709,141	19,711,279	RGD:6480464	CTD
G	Isg20	interferon stimulated exonuclease gene 20		multiple interactions	EXP	1	134,631,524	134,637,868	RGD:6480464	CTD
G	Isg20	interferon stimulated exonuclease gene 20		increases expression	EXP	1	134,631,524	134,637,868	RGD:6480464	CTD
G	Itga3	integrin, alpha 3		increases expression	ISO	10	83,728,710	83,759,576	RGD:6480464	CTD
G	Itga6	integrin, alpha 6		increases expression	EXP	3	54,202,931	54,272,803	RGD:6480464	CTD
G	Itga8	integrin, alpha 8		multiple interactions	EXP	17	86,427,191	86,649,268	RGD:6480464	CTD
G	Itgb6	integrin, beta 6		multiple interactions	EXP	3	42,286,140	42,360,793	RGD:6480464	CTD
G	Itih3	inter-alpha trypsin inhibitor, heavy chain 3		decreases expression	EXP	16	6,341,043	6,358,767	RGD:6480464	CTD
G	Itln1	intelectin 1 (galactofuranose binding)		increases expression	ISO	13	87,445,119	87,455,226	RGD:6480464	CTD
G	Itm2c	integral membrane protein 2C		increases expression	EXP	9	84,611,756	84,625,391	RGD:6480464	CTD
G	Itpkb	inositol-trisphosphate 3-kinase B		decreases expression	ISO	13	96,044,260	96,138,456	RGD:6480464	CTD
G	Itpkb	inositol-trisphosphate 3-kinase B		multiple interactions	EXP	13	96,044,260	96,138,456	RGD:6480464	CTD
G	Itpkb	inositol-trisphosphate 3-kinase B		multiple interactions	ISO	13	96,044,260	96,138,456	RGD:6480464	CTD
G	Ivd	isovaleryl-CoA dehydrogenase		decreases expression	EXP	3	105,374,429	105,394,861	RGD:6480464	CTD
G	Jam2	junctional adhesion molecule 2		multiple interactions	EXP	11	24,310,704	24,315,219	RGD:6480464	CTD
G	Jun	jun proto-oncogene		affects expression	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		increases expression	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Klf12	Kruppel-like factor 12		increases expression	ISO	15	83,686,143	84,046,291	RGD:6480464	CTD
G	Klf12	Kruppel-like factor 12		multiple interactions	ISO	15	83,686,143	84,046,291	RGD:6480464	CTD
G	Klf3	Kruppel-like factor 3 (basic)		multiple interactions	EXP	14	46,203,638	46,226,077	RGD:6480464	CTD
G	Klhl17	kelch-like family member 17		multiple interactions	EXP	5	173,064,739	173,069,548	RGD:6480464	CTD
G	Klkb1	kallikrein B, plasma 1		decreases expression	EXP	16	50,248,935	50,272,279	RGD:6480464	CTD
G	Klre1	killer cell lectin-like receptor, family E, member 1		multiple interactions	EXP	4	166,857,685	166,864,221	RGD:6480464	CTD
G	Kmo	kynurenine 3-monooxygenase (kynurenine 3-hydroxylase)		decreases expression	EXP	13	91,363,517	91,394,174	RGD:6480464	CTD
G	Kpna2	karyopherin alpha 2		multiple interactions	EXP	10	96,342,214	96,352,613	RGD:6480464	CTD
G	Kras	v-Ki-ras2 Kirsten rat sarcoma viral oncogene homolog		increases expression	EXP	4	182,869,242	182,895,106	RGD:6480464	CTD
G	Krt13	keratin 13		increases expression	ISO	10	89,057,240	89,061,150	RGD:6480464	CTD
G	Krt13	keratin 13		decreases expression	ISO	10	89,057,240	89,061,150	RGD:6480464	CTD
G	Krt13	keratin 13		multiple interactions	ISO	10	89,057,240	89,061,150	RGD:6480464	CTD
G	Krt13	keratin 13		multiple interactions	EXP	10	89,057,240	89,061,150	RGD:6480464	CTD
G	Krt14	keratin 14		multiple interactions	EXP	10	89,144,357	89,148,415	RGD:6480464	CTD
G	Krt14	keratin 14		multiple interactions	EXP	10	89,144,357	89,148,415	RGD:6480464	CTD
G	Krt17	keratin 17		multiple interactions	EXP	10	89,185,097	89,189,816	RGD:6480464	CTD
G	Krt17	keratin 17		increases expression	ISO	10	89,185,097	89,189,816	RGD:6480464	CTD
G	Krt18	keratin 18		multiple interactions	ISO				RGD:6480464	CTD
G	Krt18	keratin 18		multiple interactions	ISO				RGD:6480464	CTD
G	Krt18	keratin 18		multiple interactions	EXP				RGD:6480464	CTD
G	Krt18	keratin 18		increases expression	EXP				RGD:6480464	CTD
G	Krt18	keratin 18		multiple interactions	EXP				RGD:6480464	CTD
G	Krt19	keratin 19		multiple interactions	EXP	10	89,080,953	89,085,670	RGD:6480464	CTD
G	Krt19	keratin 19		increases expression	EXP	10	89,080,953	89,085,670	RGD:6480464	CTD
G	Krt19	keratin 19		multiple interactions	EXP	10	89,080,953	89,085,670	RGD:6480464	CTD
G	Krt19	keratin 19		increases expression	EXP	10	89,080,953	89,085,670	RGD:6480464	CTD
G	Krt20	keratin 20		multiple interactions	EXP	10	88,335,894	88,379,899	RGD:6480464	CTD
G	Krt23	keratin 23 (histone deacetylase inducible)		multiple interactions	EXP	10	88,420,780	88,436,791	RGD:6480464	CTD
G	Krt5	keratin 5		multiple interactions	EXP				RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	ISO	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		increases expression	ISO	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	ISO	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	EXP	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	EXP	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	EXP	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		increases expression	EXP	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt8	keratin 8		multiple interactions	EXP	7	140,713,902	140,721,199	RGD:6480464	CTD
G	Krt80	keratin 80		increases expression	ISO	7	140,096,091	140,115,890	RGD:6480464	CTD
G	Krtcap2	keratinocyte associated protein 2		multiple interactions	EXP	2	181,417,284	181,421,280	RGD:6480464	CTD
G	Kynu	kynureninase		multiple interactions	EXP	3	24,046,242	24,195,898	RGD:6480464	CTD
G	Lactb2	lactamase, beta 2		multiple interactions	EXP	5	4,770,321	4,793,420	RGD:6480464	CTD
G	Lalba	lactalbumin, alpha		multiple interactions	EXP	7	137,220,916	137,223,614	RGD:6480464	CTD
G	Lama3	laminin, alpha 3		increases expression	ISO	18	4,030,463	4,121,355	RGD:6480464	CTD
G	Lama5	laminin, alpha 5		multiple interactions	EXP	3	169,233,897	169,282,410	RGD:6480464	CTD
G	Lamc1	laminin, gamma 1		increases expression	EXP	13	68,241,453	68,369,419	RGD:6480464	CTD
G	Lamc2	laminin, gamma 2		increases expression	ISO	13	68,151,074	68,211,117	RGD:6480464	CTD
G	Lamp2	lysosomal-associated membrane protein 2		multiple interactions	EXP	X	6,908,285	6,951,772	RGD:6480464	CTD
G	Lancl1	LanC lantibiotic synthetase component C-like 1 (bacterial)		decreases expression	ISO	9	65,799,079	65,828,986	RGD:6480464	CTD
G	Lancl1	LanC lantibiotic synthetase component C-like 1 (bacterial)		multiple interactions	ISO	9	65,799,079	65,828,986	RGD:6480464	CTD
G	Lancl1	LanC lantibiotic synthetase component C-like 1 (bacterial)		multiple interactions	EXP	9	65,799,079	65,828,986	RGD:6480464	CTD
G	Lat	linker for activation of T cells		increases expression	EXP	1	185,450,155	185,455,180	RGD:6480464	CTD
G	Lbp	lipopolysaccharide binding protein		multiple interactions	EXP	3	149,016,605	149,043,530	RGD:6480464	CTD
G	Lcat	lecithin cholesterol acyltransferase		decreases expression	EXP	19	35,781,507	35,784,966	RGD:6480464	CTD
G	Lcn2	lipocalin 2		increases expression	ISO	3	11,511,402	11,514,747	RGD:6480464	CTD
G	Ldha	lactate dehydrogenase A		increases expression	EXP	1	97,403,077	97,412,547	RGD:6480464	CTD
G	Ldhb	lactate dehydrogenase B		increases expression	EXP	4	180,061,567	180,079,473	RGD:6480464	CTD
G	Lepr	leptin receptor		multiple interactions	EXP	5	122,320,075	122,503,449	RGD:6480464	CTD
G	Lepr	leptin receptor		multiple interactions	EXP	5	122,320,075	122,503,449	RGD:6480464	CTD
G	Leprel1	leprecan-like 1		increases expression	ISO	11	76,687,437	76,828,785	RGD:6480464	CTD
G	Leprot	leptin receptor overlapping transcript		multiple interactions	EXP	5	122,315,510	122,327,920	RGD:6480464	CTD
G	Lgals1	lectin, galactoside-binding, soluble, 1		multiple interactions	EXP	7	116,893,662	116,896,768	RGD:6480464	CTD
G	Lgals2	lectin, galactoside-binding, soluble, 2		multiple interactions	EXP	7	116,811,332	116,817,822	RGD:6480464	CTD
G	Lgals2	lectin, galactoside-binding, soluble, 2		increases expression	EXP	7	116,811,332	116,817,822	RGD:6480464	CTD
G	Lgals3	lectin, galactoside-binding, soluble, 3		increases expression	EXP	15	23,327,071	23,339,006	RGD:6480464	CTD
G	Lgals3bp	lectin, galactoside-binding, soluble, 3 binding protein		increases expression	ISO	10	108,388,185	108,397,523	RGD:6480464	CTD
G	Lgals3bp	lectin, galactoside-binding, soluble, 3 binding protein		multiple interactions	EXP	10	108,388,185	108,397,523	RGD:6480464	CTD
G	Lgals3bp	lectin, galactoside-binding, soluble, 3 binding protein		increases expression	EXP	10	108,388,185	108,397,523	RGD:6480464	CTD
G	Lgals7	lectin, galactoside-binding, soluble, 7		increases expression	ISO	1	83,968,263	83,970,018	RGD:6480464	CTD
G	Lgi1	leucine-rich, glioma inactivated 1		multiple interactions	EXP	1	242,593,236	242,634,141	RGD:6480464	CTD
G	Lgmn	legumain		increases expression	EXP	6	126,668,905	126,694,866	RGD:6480464	CTD
G	Lhfpl4	lipoma HMGIC fusion partner-like 4		increases expression	EXP	4	149,049,668	149,072,608	RGD:6480464	CTD
G	Man1a1	mannosidase, alpha, class 1A, member 1		multiple interactions	EXP	20	32,582,507	32,766,761	RGD:6480464	CTD
G	Man2c1	mannosidase, alpha, class 2C, member 1		multiple interactions	EXP	8	60,887,362	60,898,465	RGD:6480464	CTD
G	Maoa	monoamine oxidase A		multiple interactions	EXP	X	17,678,960	17,745,908	RGD:6480464	CTD
G	Maob	monoamine oxidase B		multiple interactions	EXP	X	17,553,529	17,657,852	RGD:6480464	CTD
G	Maob	monoamine oxidase B		multiple interactions	EXP	X	17,553,529	17,657,852	RGD:6480464	CTD
G	Map1lc3a	microtubule-associated protein 1 light chain 3 alpha		multiple interactions	EXP	3	145,758,939	145,760,532	RGD:6480464	CTD
G	Map2k3	mitogen activated protein kinase kinase 3		multiple interactions	EXP	10	47,075,270	47,096,617	RGD:6480464	CTD
G	Map2k4	mitogen activated protein kinase kinase 4		multiple interactions	ISO	10	52,009,149	52,041,599	RGD:6480464	CTD
G	Map2k5	mitogen activated protein kinase kinase 5		multiple interactions	EXP	8	67,313,472	67,542,723	RGD:6480464	CTD
G	Map2k7	mitogen activated protein kinase kinase 7		multiple interactions	ISO	12	1,545,407	1,552,353	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases expression	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		decreases response to substance	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		decreases expression	EXP	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	EXP	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	EXP	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases expression	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk6	mitogen-activated protein kinase 6		decreases expression	EXP	8	80,212,726	80,236,362	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases activity	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases response to substance	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		multiple interactions	EXP	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Mapkapk3	mitogen-activated protein kinase-activated protein kinase 3		multiple interactions	EXP	8	112,497,626	112,531,778	RGD:6480464	CTD
G	Mapre1	microtubule-associated protein, RP/EB family, member 1		increases expression	EXP	3	144,120,532	144,148,856	RGD:6480464	CTD
G	Mapt	microtubule-associated protein tau		multiple interactions	EXP	10	93,411,098	93,508,762	RGD:6480464	CTD
G	Mapt	microtubule-associated protein tau		multiple interactions	EXP	10	93,411,098	93,508,762	RGD:6480464	CTD
G	Mbd1	methyl-CpG binding domain protein 1		increases expression	ISO	18	71,068,257	71,082,734	RGD:6480464	CTD
G	Mbl1	mannose-binding lectin (protein A) 1		multiple interactions	EXP	16	17,591,820	17,597,859	RGD:6480464	CTD
G	Mbl2	mannose-binding lectin (protein C) 2		decreases expression	EXP	1	233,978,931	233,983,824	RGD:6480464	CTD
G	Mbp	myelin basic protein		multiple interactions	EXP	18	78,943,608	79,057,329	RGD:6480464	CTD
G	Mcm2	minichromosome maintenance complex component 2		multiple interactions	ISO	4	122,977,522	122,991,934	RGD:6480464	CTD
G	Mgp	matrix Gla protein		multiple interactions	EXP	4	173,910,595	173,913,917	RGD:6480464	CTD
G	Mgp	matrix Gla protein		increases expression	EXP	4	173,910,595	173,913,917	RGD:6480464	CTD
G	Mgst1	microsomal glutathione S-transferase 1		multiple interactions	EXP	4	175,248,654	175,263,881	RGD:6480464	CTD
G	Mgst1	microsomal glutathione S-transferase 1		multiple interactions	EXP	4	175,248,654	175,263,881	RGD:6480464	CTD
G	Mgst2	microsomal glutathione S-transferase 2		multiple interactions	EXP	2	140,546,939	140,568,616	RGD:6480464	CTD
G	Mgst2	microsomal glutathione S-transferase 2		multiple interactions	EXP	2	140,546,939	140,568,616	RGD:6480464	CTD
G	Mid1ip1	MID1 interacting protein 1		multiple interactions	EXP	X	24,205,679	24,207,860	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		multiple interactions	EXP	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		multiple interactions	EXP	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mipep	mitochondrial intermediate peptidase		multiple interactions	EXP	15	39,871,329	39,990,743	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		increases expression	ISO	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		increases expression	ISO	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		multiple interactions	ISO	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		multiple interactions	ISO	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		multiple interactions	EXP	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mki67	antigen identified by monoclonal antibody Ki-67		multiple interactions	EXP	1	195,310,027	195,336,224	RGD:6480464	CTD
G	Mknk2	MAP kinase-interacting serine/threonine kinase 2		multiple interactions	EXP	7	10,550,040	10,561,100	RGD:6480464	CTD
G	Mlec	malectin		multiple interactions	EXP	12	42,729,870	42,740,346	RGD:6480464	CTD
G	Mlh1	mutL homolog 1, colon cancer, nonpolyposis type 2 (E. coli)		multiple interactions	EXP	8	115,616,396	115,653,471	RGD:6480464	CTD
G	Mlph	melanophilin		decreases expression	ISO	9	90,113,308	90,149,114	RGD:6480464	CTD
G	Mmd	monocyte to macrophage differentiation-associated		multiple interactions	EXP	10	78,664,115	78,692,402	RGD:6480464	CTD
G	Mme	membrane metallo-endopeptidase		multiple interactions	EXP	2	153,031,724	153,114,515	RGD:6480464	CTD
G	Rpl17	ribosomal protein L17		increases expression	ISO	18	71,863,062	71,866,168	RGD:6480464	CTD
G	Rpl17	ribosomal protein L17		multiple interactions	ISO	18	71,863,062	71,866,168	RGD:6480464	CTD
G	Rps27l	ribosomal protein S27-like		increases expression	EXP				RGD:6480464	CTD
G	RT1-CE7	RT1 class I, locus CE7		decreases expression	ISO	20	3,410,094	3,413,041	RGD:6480464	CTD
G	RT1-CE7	RT1 class I, locus CE7		multiple interactions	ISO	20	3,410,094	3,413,041	RGD:6480464	CTD
G	Timm10b	translocase of inner mitochondrial membrane 10 homolog B		multiple interactions	EXP	1	163,369,731	163,372,577	RGD:6480464	CTD
G	Tpm3	tropomyosin 3		increases expression	EXP	2	182,303,994	182,324,994	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
role	482262
biological role	480454
aetiopathogenetic role	109798
mutagen	18553
N-nitrosodiethylamine	4514
Path 2
Term	Annotations
CHEBI ontology	492574
subatomic particle	491537
composite particle	491537
hadron	491537
baryon	491537
nucleon	491537
atomic nucleus	491537
atom	491537
main group element atom	461203
main group molecular entity	456122
p-block molecular entity	455185
pnictogen molecular entity	179820
nitrogen molecular entity	170096
nitroso compound	6331
nitrosamine	5626
N-nitrosodiethylamine	4514