capsaicin - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	capsaicin	go back to main search page
Accession:	CHEBI:3374	browse the term
Definition:	A capsaicinoid that has formula C18H27NO3.
Synonyms:	exact_synonym:	(6E)-N-(4-hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide
	related_synonym:	(E)-8-Methyl-N-vanillyl-6-nonenamide; C18H27NO3; COc1cc(CNC(=O)CCCC\\C=C\\C(C)C)ccc1O; InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+; InChIKey=YKPUWZUDDOIDPM-SOFGYWHQSA-N; Isodecenoic acid vanillylamide; Zostrix; trans-8-Methyl-N-vanillyl-6-nonenamide
	xref_casrn:	404-86-4
	xref:	Beilstein:2816484 "Beilstein Registry Number"; ChEMBL:191783 "ChEMBL COMPOUND"; ChemIDplus:404-86-4 "CAS Registry Number"; KEGG COMPOUND:404-86-4 "CAS Registry Number"; KEGG COMPOUND:C06866 "KEGG COMPOUND"; KEGG DRUG:D00250 "KEGG DRUG"
	xref_mesh:	MESH:D002211
	xref:	Wikipedia:Capsaicin "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

capsaicin
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		multiple interactions	ISO	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		increases response to substance	ISO	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abca1	ATP-binding cassette, subfamily A (ABC1), member 1		increases expression	ISO	5	70,493,357	70,583,729	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		multiple interactions	ISO	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	ISO	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Abl1	c-abl oncogene 1, non-receptor tyrosine kinase		increases expression	ISO	3	10,804,594	10,907,162	RGD:6480464	CTD
G	Acacb	acetyl-CoA carboxylase beta		decreases expression	EXP	12	43,388,679	43,492,993	RGD:6480464	CTD
G	Acox1	acyl-CoA oxidase 1, palmitoyl		increases expression	ISO	10	106,281,977	106,319,382	RGD:6480464	CTD
G	Acsl3	acyl-CoA synthetase long-chain family member 3		decreases expression	ISO	9	78,083,239	78,106,933	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases expression	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adipoq	adiponectin, C1Q and collagen domain containing		increases secretion	ISO	11	79,908,291	79,911,065	RGD:6480464	CTD
G	Adra2a	adrenoceptor alpha 2A		decreases response to substance	ISO				RGD:6480464	CTD
G	Aga	aspartylglucosaminidase		decreases expression	EXP	16	41,383,536	41,395,394	RGD:6480464	CTD
G	Agtr1a	angiotensin II receptor, type 1a		increases expression	EXP	17	40,629,318	40,684,982	RGD:6480464	CTD
G	Agxt2l2	alanine-glyoxylate aminotransferase 2-like 2		increases expression	EXP	10	37,100,238	37,117,744	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Akirin2	akirin 2		increases expression	EXP	5	51,152,935	51,167,720	RGD:6480464	CTD
G	Akr1a1	aldo-keto reductase family 1, member A1 (aldehyde reductase)		multiple interactions	EXP	5	136,920,561	136,937,422	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		increases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		increases activity	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		increases phosphorylation	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		increases expression	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		increases phosphorylation	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Alb	albumin		increases expression	ISO	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Alb	albumin		increases expression	ISO	14	19,126,935	19,142,214	RGD:6480464	CTD
G	Aldh3a1	aldehyde dehydrogenase 3 family, member A1		decreases expression	EXP	10	47,365,195	47,374,880	RGD:6480464	CTD
G	Alox5	arachidonate 5-lipoxygenase		multiple interactions	EXP	4	152,610,283	152,657,891	RGD:6480464	CTD
G	Alox5	arachidonate 5-lipoxygenase		decreases activity	EXP	4	152,610,283	152,657,891	RGD:6480464	CTD
G	Amhr2	anti-Mullerian hormone receptor, type II		decreases expression	EXP	7	141,203,832	141,212,653	RGD:6480464	CTD
G	Amn	amnion associated transmembrane protein		multiple interactions	EXP	6	136,031,478	136,038,919	RGD:6480464	CTD
G	Amn	amnion associated transmembrane protein		increases expression	EXP	6	136,031,478	136,038,919	RGD:6480464	CTD
G	Amy2a3	amylase 2a3		multiple interactions	EXP	2	209,507,212	209,518,455	RGD:6480464	CTD
G	Angpt1	angiopoietin 1		increases expression	ISO	7	78,195,504	78,451,471	RGD:6480464	CTD
G	Angpt2	angiopoietin 2		increases expression	ISO	16	75,891,757	75,942,255	RGD:6480464	CTD
G	Apaf1	apoptotic peptidase activating factor 1		increases expression	ISO	7	27,932,908	28,020,533	RGD:6480464	CTD
G	Apob	apolipoprotein B		increases expression	EXP	6	31,508,060	31,548,083	RGD:6480464	CTD
G	Apoc1	apolipoprotein C-I		decreases expression	ISO	1	78,996,677	78,999,960	RGD:6480464	CTD
G	Apoe	apolipoprotein E		multiple interactions	ISO	1	79,003,634	79,006,387	RGD:6480464	CTD
G	Aqp1	aquaporin 1		increases response to substance	ISO	4	84,098,346	84,110,524	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Areg	amphiregulin		multiple interactions	ISO	14	18,466,313	18,475,571	RGD:6480464	CTD
G	Arpp19	cAMP-regulated phosphoprotein 19		increases expression	EXP	8	79,824,737	79,846,702	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		multiple interactions	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf4	activating transcription factor 4 (tax-responsive enhancer element B67)		increases expression	ISO	7	118,537,718	118,538,994	RGD:6480464	CTD
G	Atf4	activating transcription factor 4 (tax-responsive enhancer element B67)		increases expression	ISO	7	118,537,718	118,538,994	RGD:6480464	CTD
G	Atf4	activating transcription factor 4 (tax-responsive enhancer element B67)		multiple interactions	ISO	7	118,537,718	118,538,994	RGD:6480464	CTD
G	Atg16l1	autophagy related 16-like 1 (S. cerevisiae)		decreases expression	EXP	9	86,712,122	86,747,370	RGD:6480464	CTD
G	Atg5	autophagy related 5		multiple interactions	ISO	20	48,273,977	48,366,743	RGD:6480464	CTD
G	Atg5	autophagy related 5		increases expression	ISO	20	48,273,977	48,366,743	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		multiple interactions	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		increases activity	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		increases expression	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atm	ataxia telangiectasia mutated		increases phosphorylation	ISO	8	56,894,746	56,996,565	RGD:6480464	CTD
G	Atp2a2	ATPase, Ca++ transporting, cardiac muscle, slow twitch 2		affects metabolic processing	EXP	12	35,266,600	35,316,237	RGD:6480464	CTD
G	Atp2a2	ATPase, Ca++ transporting, cardiac muscle, slow twitch 2		decreases expression	EXP	12	35,266,600	35,316,237	RGD:6480464	CTD
G	Atp6ap1	ATPase, H+ transporting, lysosomal accessory protein 1		decreases expression	EXP	X	160,306,354	160,313,434	RGD:6480464	CTD
G	Bad	BCL2-associated agonist of cell death		increases expression	ISO	1	209,617,373	209,626,292	RGD:6480464	CTD
G	Bag3	Bcl2-associated athanogene 3		increases expression	ISO	1	187,781,147	187,804,835	RGD:6480464	CTD
G	Bak1	BCL2-antagonist/killer 1		increases activity	ISO	20	5,255,954	5,264,593	RGD:6480464	CTD
G	Bak1	BCL2-antagonist/killer 1		increases expression	ISO	20	5,255,954	5,264,593	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		affects localization	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases activity	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bcan	brevican		decreases expression	EXP	2	180,067,864	180,080,942	RGD:6480464	CTD
G	Bcl10	B-cell CLL/lymphoma 10		increases expression	ISO	2	244,116,880	244,126,393	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases response to substance	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		increases expression	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		decreases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bclaf1	BCL2-associated transcription factor 1		increases expression	ISO	1	15,605,220	15,632,005	RGD:6480464	CTD
G	Bdkrb1	bradykinin receptor B1		multiple interactions	EXP	6	129,760,129	129,762,545	RGD:6480464	CTD
G	Bdkrb1	bradykinin receptor B1		increases expression	EXP	6	129,760,129	129,762,545	RGD:6480464	CTD
G	Bdkrb2	bradykinin receptor B2		multiple interactions	EXP	6	129,744,781	129,748,851	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		multiple interactions	EXP				RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		affects expression	EXP				RGD:6480464	CTD
G	Becn1	beclin 1, autophagy related		increases expression	EXP	10	90,317,957	90,333,329	RGD:6480464	CTD
G	Bid	BH3 interacting domain death agonist		multiple interactions	ISO	4	157,296,383	157,318,481	RGD:6480464	CTD
G	Bid	BH3 interacting domain death agonist		increases cleavage	ISO	4	157,296,383	157,318,481	RGD:6480464	CTD
G	Bid	BH3 interacting domain death agonist		increases expression	ISO	4	157,296,383	157,318,481	RGD:6480464	CTD
G	Birc2	baculoviral IAP repeat-containing 2		increases expression	ISO	8	4,649,559	4,667,733	RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		multiple interactions	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		decreases expression	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		decreases expression	ISO				RGD:6480464	CTD
G	Birc5	baculoviral IAP repeat-containing 5		decreases expression	ISO				RGD:6480464	CTD
G	Bnip2	BCL2/adenovirus E1B interacting protein 2		increases expression	ISO	8	74,421,904	74,435,300	RGD:6480464	CTD
G	Bnip3	BCL2/adenovirus E1B interacting protein 3		decreases expression	ISO	1	198,683,009	198,700,075	RGD:6480464	CTD
G	Bnip3l	BCL2/adenovirus E1B interacting protein 3-like		decreases expression	ISO	15	46,516,626	46,539,756	RGD:6480464	CTD
G	Cacng3	calcium channel, voltage-dependent, gamma subunit 3		decreases expression	EXP	1	181,498,716	181,594,090	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases secretion	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		decreases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases secretion	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		decreases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases expression	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases expression	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases secretion	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		affects response to substance	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases secretion	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	ISO	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		decreases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases expression	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		increases secretion	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calca	calcitonin-related polypeptide alpha		multiple interactions	EXP	1	172,686,168	172,691,061	RGD:6480464	CTD
G	Calcb	calcitonin-related polypeptide, beta		decreases activity	ISO	1	172,777,347	172,781,003	RGD:6480464	CTD
G	Calcb	calcitonin-related polypeptide, beta		increases expression	ISO	1	172,777,347	172,781,003	RGD:6480464	CTD
G	Calcb	calcitonin-related polypeptide, beta		increases secretion	ISO	1	172,777,347	172,781,003	RGD:6480464	CTD
G	Calcb	calcitonin-related polypeptide, beta		multiple interactions	ISO	1	172,777,347	172,781,003	RGD:6480464	CTD
G	Calcb	calcitonin-related polypeptide, beta		multiple interactions	EXP	1	172,777,347	172,781,003	RGD:6480464	CTD
G	Camk2a	calcium/calmodulin-dependent protein kinase II alpha		multiple interactions	EXP	18	56,879,247	56,948,537	RGD:6480464	CTD
G	Casp2	caspase 2		multiple interactions	ISO	4	70,029,728	70,047,164	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases expression	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		decreases expression	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases cleavage	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		increases expression	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp3	caspase 3		affects expression	EXP	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		increases expression	EXP	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		multiple interactions	ISO	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		increases activity	ISO	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Casp6	caspase 6		multiple interactions	ISO	2	227,361,538	227,373,844	RGD:6480464	CTD
G	Casp7	caspase 7		increases activity	ISO	1	262,689,300	262,721,591	RGD:6480464	CTD
G	Casp7	caspase 7		multiple interactions	ISO	1	262,689,300	262,721,591	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		decreases expression	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		increases activity	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp8	caspase 8		increases expression	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases activity	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases cleavage	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases activity	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases expression	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		multiple interactions	ISO	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		affects expression	EXP	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Casp9	caspase 9, apoptosis-related cysteine peptidase		increases expression	EXP	5	160,704,234	160,721,796	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cck	cholecystokinin		multiple interactions	ISO	8	126,492,636	126,499,220	RGD:6480464	CTD
G	Cck	cholecystokinin		multiple interactions	EXP	8	126,492,636	126,499,220	RGD:6480464	CTD
G	Ccl19	chemokine (C-C motif) ligand 19		increases expression	EXP	5	59,221,738	59,223,682	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases expression	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases secretion	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases expression	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases expression	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		decreases secretion	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		multiple interactions	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl20	chemokine (C-C motif) ligand 20		increases expression	EXP	9	82,440,965	82,443,542	RGD:6480464	CTD
G	Ccl22	chemokine (C-C motif) ligand 22		multiple interactions	EXP	19	10,697,324	10,704,129	RGD:6480464	CTD
G	Ccl22	chemokine (C-C motif) ligand 22		increases expression	EXP	19	10,697,324	10,704,129	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	ISO	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		increases expression	EXP	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccl3	chemokine (C-C motif) ligand 3		multiple interactions	EXP	10	71,744,559	71,746,109	RGD:6480464	CTD
G	Ccna2	cyclin A2		decreases expression	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccnb1	cyclin B1		decreases expression	ISO	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnl1	cyclin L1		increases expression	EXP	2	155,757,335	155,769,633	RGD:6480464	CTD
G	Ccr4	chemokine (C-C motif) receptor 4		increases expression	EXP	8	118,883,148	118,884,230	RGD:6480464	CTD
G	Ccr4	chemokine (C-C motif) receptor 4		multiple interactions	EXP	8	118,883,148	118,884,230	RGD:6480464	CTD
G	Cd46	CD46 molecule, complement regulatory protein		increases expression	EXP	13	110,972,812	111,003,407	RGD:6480464	CTD
G	Cd68	Cd68 molecule		decreases expression	ISO	10	56,481,701	56,483,580	RGD:6480464	CTD
G	Cd80	Cd80 molecule		increases expression	EXP	11	64,045,358	64,070,072	RGD:6480464	CTD
G	Cd80	Cd80 molecule		multiple interactions	EXP	11	64,045,358	64,070,072	RGD:6480464	CTD
G	Cd8b	CD8b molecule		increases expression	EXP	4	104,536,454	104,552,683	RGD:6480464	CTD
G	Cdc14a	cell division cycle 14A		increases expression	EXP	2	212,495,540	212,652,895	RGD:6480464	CTD
G	Cdk1	cyclin-dependent kinase 1		increases expression	EXP	20	20,018,044	20,044,030	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		decreases expression	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		decreases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		decreases expression	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		increases expression	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		increases expression	ISO	4	171,841,705	171,846,506	RGD:6480464	CTD
G	Cdkn2a	cyclin-dependent kinase inhibitor 2A		increases expression	ISO	5	108,908,749	108,916,380	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	EXP	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		increases activity	ISO	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cebpb	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	3	158,826,021	158,827,848	RGD:6480464	CTD
G	Cfl1	cofilin 1, non-muscle		multiple interactions	ISO	1	208,133,876	208,137,408	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		decreases expression	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Cflar	CASP8 and FADD-like apoptosis regulator		increases expression	ISO	9	57,309,836	57,356,635	RGD:6480464	CTD
G	Cftr	cystic fibrosis transmembrane conductance regulator		increases activity	ISO	4	43,874,852	44,041,870	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		increases expression	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Ciita	class II, major histocompatibility complex, transactivator		multiple interactions	ISO	10	5,087,174	5,133,418	RGD:6480464	CTD
G	Cldn1	claudin 1		increases expression	EXP	11	76,473,654	76,488,809	RGD:6480464	CTD
G	Clk1	CDC-like kinase 1		increases expression	EXP	9	57,070,825	57,082,043	RGD:6480464	CTD
G	Cnr1	cannabinoid receptor 1 (brain)		increases activity	EXP	5	50,427,173	50,445,471	RGD:6480464	CTD
G	Cnr1	cannabinoid receptor 1 (brain)		multiple interactions	ISO	5	50,427,173	50,445,471	RGD:6480464	CTD
G	Cnr1	cannabinoid receptor 1 (brain)		affects response to substance	ISO	5	50,427,173	50,445,471	RGD:6480464	CTD
G	Cntf	ciliary neurotrophic factor		increases expression	EXP	1	215,842,668	215,844,691	RGD:6480464	CTD
G	Cntf	ciliary neurotrophic factor		multiple interactions	EXP	1	215,842,668	215,844,691	RGD:6480464	CTD
G	Cntfr	ciliary neurotrophic factor receptor		multiple interactions	EXP				RGD:6480464	CTD
G	Cntfr	ciliary neurotrophic factor receptor		increases expression	EXP				RGD:6480464	CTD
G	Col18a1	collagen, type XVIII, alpha 1		increases expression	ISO	20	11,920,816	11,982,468	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		increases expression	EXP	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Cox4i1	cytochrome c oxidase subunit IV isoform 1		increases expression	EXP	19	51,023,960	51,030,200	RGD:6480464	CTD
G	Cox5a	cytochrome c oxidase, subunit Va		increases expression	ISO	8	61,264,971	61,276,380	RGD:6480464	CTD
G	Cox6a1	cytochrome c oxidase, subunit VIa, polypeptide 1		increases expression	EXP	12	42,530,091	42,533,144	RGD:6480464	CTD
G	Cpt1a	carnitine palmitoyltransferase 1a, liver		multiple interactions	ISO	1	205,852,800	205,912,972	RGD:6480464	CTD
G	Cpt1a	carnitine palmitoyltransferase 1a, liver		increases expression	ISO	1	205,852,800	205,912,972	RGD:6480464	CTD
G	Cpt1a	carnitine palmitoyltransferase 1a, liver		multiple interactions	EXP	1	205,852,800	205,912,972	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		increases phosphorylation	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		increases phosphorylation	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	EXP	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		increases expression	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	EXP	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csnk2a1	casein kinase 2, alpha 1 polypeptide		increases phosphorylation	ISO	3	142,564,754	142,609,311	RGD:6480464	CTD
G	Csnk2b	casein kinase 2, beta polypeptide		increases phosphorylation	ISO	20	3,764,565	3,768,985	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		increases expression	EXP	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Ctnnb1	catenin (cadherin associated protein), beta 1		multiple interactions	EXP	8	125,978,161	125,987,670	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		affects expression	EXP	19	10,666,940	10,676,424	RGD:6480464	CTD
G	Cx3cl1	chemokine (C-X3-C motif) ligand 1		multiple interactions	EXP	19	10,666,940	10,676,424	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		increases expression	EXP	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl10	chemokine (C-X-C motif) ligand 10		multiple interactions	EXP	14	17,265,986	17,268,183	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		increases expression	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	EXP	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		increases expression	EXP	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		multiple interactions	EXP	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		increases expression	EXP	13	41,308,286	41,312,190	RGD:6480464	CTD
G	Cxcr4	chemokine (C-X-C motif) receptor 4		multiple interactions	EXP	13	41,308,286	41,312,190	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		multiple interactions	ISO	X	25,514,572	25,547,181	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		affects expression	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a1	cytochrome P450, family 1, subfamily a, polypeptide 1		multiple interactions	ISO	8	61,462,207	61,468,237	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases activity	ISO	8	61,439,062	61,447,861	RGD:6480464	CTD
G	Cyp2a2	cytochrome P450, family 2, subfamily a, polypeptide 2		decreases expression	EXP	1	82,039,229	82,064,293	RGD:6480464	CTD
G	Cyp2c11	cytochrome P450, subfamily 2, polypeptide 11		decreases activity	ISO	1	243,281,320	243,320,945	RGD:6480464	CTD
G	Cyp2d3	cytochrome P450, family 2, subfamily d, polypeptide 3		decreases activity	ISO	7	120,778,783	120,783,140	RGD:6480464	CTD
G	Cyp2d4	cytochrome P450, family 2, subfamily d, polypeptide 4		decreases activity	ISO	7	120,742,273	120,752,274	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases expression	EXP	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Dbh	dopamine beta-hydroxylase (dopamine beta-monooxygenase)		decreases expression	EXP	3	6,052,706	6,069,826	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	ISO	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	EXP	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Dffa	DNA fragmentation factor, alpha subunit		decreases expression	ISO	5	166,179,130	166,192,029	RGD:6480464	CTD
G	Dpp3	dipeptidylpeptidase 3		decreases expression	EXP	3	138,286,277	138,288,887	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		multiple interactions	ISO	10	16,942,913	16,945,696	RGD:6480464	CTD
G	E2f1	E2F transcription factor 1		increases expression	ISO	3	145,032,489	145,043,729	RGD:6480464	CTD
G	Edn1	endothelin 1		decreases activity	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Edn1	endothelin 1		multiple interactions	ISO	17	28,303,886	28,309,775	RGD:6480464	CTD
G	Eef2	eukaryotic translation elongation factor 2		multiple interactions	EXP	7	10,017,061	10,022,331	RGD:6480464	CTD
G	Egf	epidermal growth factor		multiple interactions	ISO	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		decreases expression	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egf	epidermal growth factor		decreases activity	EXP	2	227,103,900	227,195,062	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		decreases expression	EXP	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		decreases expression	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		increases phosphorylation	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egfr	epidermal growth factor receptor		multiple interactions	ISO	14	97,617,358	97,788,211	RGD:6480464	CTD
G	Egr1	early growth response 1		increases expression	EXP	18	27,343,919	27,346,117	RGD:6480464	CTD
G	Eif2a	eukaryotic translation initiation factor 2A		increases phosphorylation	ISO	2	147,870,265	147,903,411	RGD:6480464	CTD
G	Eif2a	eukaryotic translation initiation factor 2A		increases phosphorylation	EXP	2	147,870,265	147,903,411	RGD:6480464	CTD
G	Eif2s1	eukaryotic translation initiation factor 2, subunit 1 alpha		increases phosphorylation	ISO	6	101,495,444	101,520,113	RGD:6480464	CTD
G	Eln	elastin		increases expression	EXP	12	23,033,657	23,077,043	RGD:6480464	CTD
G	Eno2	enolase 2, gamma, neuronal		multiple interactions	ISO	4	160,891,003	160,897,723	RGD:6480464	CTD
G	Enox2	ecto-NOX disulfide-thiol exchanger 2		increases response to substance	ISO	X	135,486,042	135,572,216	RGD:6480464	CTD
G	Epor	erythropoietin receptor		increases expression	ISO	8	21,061,310	21,065,886	RGD:6480464	CTD
G	Erbb2	v-erb-b2 erythroblastic leukemia viral oncogene homolog 2, neuro/glioblastoma derived oncogene homolog (avian)		decreases expression	ISO	10	87,219,157	87,242,919	RGD:6480464	CTD
G	Erbb2	v-erb-b2 erythroblastic leukemia viral oncogene homolog 2, neuro/glioblastoma derived oncogene homolog (avian)		affects expression	ISO	10	87,219,157	87,242,919	RGD:6480464	CTD
G	Ern1	endoplasmic reticulum to nucleus signaling 1		increases expression	ISO	10	95,794,488	95,855,895	RGD:6480464	CTD
G	Errfi1	ERBB receptor feedback inhibitor 1		multiple interactions	EXP	5	168,012,683	168,025,963	RGD:6480464	CTD
G	Errfi1	ERBB receptor feedback inhibitor 1		increases expression	EXP	5	168,012,683	168,025,963	RGD:6480464	CTD
G	Etfa	electron-transfer-flavoprotein, alpha polypeptide		multiple interactions	EXP	8	59,013,798	59,072,013	RGD:6480464	CTD
G	Exosc8	exosome component 8		decreases expression	EXP	2	143,954,943	143,961,239	RGD:6480464	CTD
G	F2	coagulation factor II		affects expression	EXP	3	76,005,318	76,018,603	RGD:6480464	CTD
G	F2rl1	coagulation factor II (thrombin) receptor-like 1		multiple interactions	ISO	2	25,886,177	25,899,128	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	EXP	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		decreases expression	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp5	fatty acid binding protein 5, epidermal		decreases expression	ISO				RGD:6480464	CTD
G	Fadd	Fas (TNFRSF6)-associated via death domain		increases expression	EXP	1	205,010,363	205,012,768	RGD:6480464	CTD
G	Fadd	Fas (TNFRSF6)-associated via death domain		multiple interactions	EXP	1	205,010,363	205,012,768	RGD:6480464	CTD
G	Fam162a	family with sequence similarity 162, member A		decreases expression	EXP	11	66,518,103	66,546,302	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		affects expression	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		increases expression	EXP	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	EXP	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		increases expression	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	EXP	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		increases expression	EXP	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fdps	farnesyl diphosphate synthase		increases expression	EXP	2	181,138,474	181,177,903	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		decreases expression	EXP	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgfbp1	fibroblast growth factor binding protein 1		multiple interactions	EXP	14	72,242,271	72,243,353	RGD:6480464	CTD
G	Fgfbp1	fibroblast growth factor binding protein 1		affects expression	EXP	14	72,242,271	72,243,353	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		decreases expression	EXP	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Fgl1	fibrinogen-like 1		multiple interactions	EXP	16	54,434,779	54,465,928	RGD:6480464	CTD
G	Fgl1	fibrinogen-like 1		increases expression	EXP	16	54,434,779	54,465,928	RGD:6480464	CTD
G	Fkbp4	FK506 binding protein 4		decreases expression	EXP	4	165,448,027	165,456,481	RGD:6480464	CTD
G	Fmod	fibromodulin		increases expression	EXP	13	46,987,714	46,998,331	RGD:6480464	CTD
G	Fnta	farnesyltransferase, CAAX box, alpha		increases expression	EXP	16	70,440,340	70,458,433	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		decreases expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fosl1	fos-like antigen 1		multiple interactions	EXP	1	208,090,612	208,099,118	RGD:6480464	CTD
G	Fosl1	fos-like antigen 1		increases expression	EXP	1	208,090,612	208,099,118	RGD:6480464	CTD
G	Foxa1	forkhead box A1		decreases expression	ISO	6	77,976,384	78,009,176	RGD:6480464	CTD
G	Foxe3	forkhead box E3		increases expression	EXP	5	135,285,688	135,286,548	RGD:6480464	CTD
G	Fstl1	follistatin-like 1		multiple interactions	EXP	11	64,681,814	64,735,673	RGD:6480464	CTD
G	Fstl1	follistatin-like 1		increases expression	EXP	11	64,681,814	64,735,673	RGD:6480464	CTD
G	Fxyd6	FXYD domain-containing ion transport regulator 6		increases expression	EXP	8	48,323,818	48,371,958	RGD:6480464	CTD
G	Gabrr3	gamma-aminobutyric acid (GABA) A receptor, rho 3		increases expression	EXP	11	41,667,754	41,720,246	RGD:6480464	CTD
G	Gadd45a	growth arrest and DNA-damage-inducible, alpha		increases expression	ISO	4	96,649,941	96,652,243	RGD:6480464	CTD
G	Gal	galanin/GMAP prepropeptide		increases expression	EXP	1	205,936,352	205,941,215	RGD:6480464	CTD
G	Gal	galanin/GMAP prepropeptide		decreases response to substance	ISO	1	205,936,352	205,941,215	RGD:6480464	CTD
G	Gal	galanin/GMAP prepropeptide		multiple interactions	EXP	1	205,936,352	205,941,215	RGD:6480464	CTD
G	Gal	galanin/GMAP prepropeptide		increases expression	EXP	1	205,936,352	205,941,215	RGD:6480464	CTD
G	Galr2	galanin receptor 2		increases expression	EXP	10	106,394,006	106,396,171	RGD:6480464	CTD
G	Gapdh	glyceraldehyde-3-phosphate dehydrogenase		multiple interactions	EXP	4	161,282,215	161,286,090	RGD:6480464	CTD
G	Gapdh	glyceraldehyde-3-phosphate dehydrogenase		increases expression	ISO	4	161,282,215	161,286,090	RGD:6480464	CTD
G	Gast	gastrin		decreases secretion	EXP	10	89,273,628	89,276,192	RGD:6480464	CTD
G	Gast	gastrin		increases secretion	EXP	10	89,273,628	89,276,192	RGD:6480464	CTD
G	Gast	gastrin		decreases secretion	EXP	10	89,273,628	89,276,192	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		increases expression	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gcg	glucagon		multiple interactions	ISO	3	44,433,180	44,438,004	RGD:6480464	CTD
G	Gch1	GTP cyclohydrolase 1		affects response to substance	ISO	15	23,023,996	23,139,794	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		multiple interactions	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		multiple interactions	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		increases expression	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		increases phosphorylation	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Gfap	glial fibrillary acidic protein		increases expression	ISO	10	92,059,881	92,068,555	RGD:6480464	CTD
G	Gfap	glial fibrillary acidic protein		multiple interactions	EXP	10	92,059,881	92,068,555	RGD:6480464	CTD
G	Gfra1	GDNF family receptor alpha 1		affects expression	EXP	1	264,614,329	264,875,486	RGD:6480464	CTD
G	Gfra1	GDNF family receptor alpha 1		multiple interactions	EXP	1	264,614,329	264,875,486	RGD:6480464	CTD
G	Gfra2	GDNF family receptor alpha 2		affects expression	EXP	15	51,279,770	51,371,053	RGD:6480464	CTD
G	Gfra2	GDNF family receptor alpha 2		multiple interactions	EXP	15	51,279,770	51,371,053	RGD:6480464	CTD
G	Gh1	growth hormone 1		increases expression	EXP	10	95,692,240	95,694,117	RGD:6480464	CTD
G	Gh1	growth hormone 1		multiple interactions	EXP	10	95,692,240	95,694,117	RGD:6480464	CTD
G	Gh1	growth hormone 1		decreases secretion	EXP	10	95,692,240	95,694,117	RGD:6480464	CTD
G	Ghr	growth hormone receptor		increases expression	EXP	2	52,496,517	52,658,066	RGD:6480464	CTD
G	Ghr	growth hormone receptor		multiple interactions	EXP	2	52,496,517	52,658,066	RGD:6480464	CTD
G	Ghrl	ghrelin/obestatin prepropeptide		multiple interactions	EXP	4	149,622,566	149,628,111	RGD:6480464	CTD
G	Ghrl	ghrelin/obestatin prepropeptide		decreases activity	EXP	4	149,622,566	149,628,111	RGD:6480464	CTD
G	Ghrl	ghrelin/obestatin prepropeptide		multiple interactions	ISO	4	149,622,566	149,628,111	RGD:6480464	CTD
G	Gjb6	gap junction protein, beta 6		increases expression	EXP	15	36,177,736	36,186,513	RGD:6480464	CTD
G	Glp1r	glucagon-like peptide 1 receptor		decreases expression	EXP	20	9,225,881	9,264,184	RGD:6480464	CTD
G	Glud1	glutamate dehydrogenase 1		increases expression	ISO	16	9,965,718	9,999,254	RGD:6480464	CTD
G	Got1	glutamic-oxaloacetic transaminase 1, soluble (aspartate aminotransferase 1)		multiple interactions	EXP	1	247,324,285	247,347,553	RGD:6480464	CTD
G	Gpr132	G protein-coupled receptor 132		decreases expression	ISO	6	137,851,214	137,856,343	RGD:6480464	CTD
G	Gpr176	G protein-coupled receptor 176		decreases expression	EXP	3	104,699,853	104,801,217	RGD:6480464	CTD
G	Gpr4	G protein-coupled receptor 4		decreases expression	ISO	1	78,586,541	78,588,029	RGD:6480464	CTD
G	Gpt	glutamic-pyruvate transaminase (alanine aminotransferase)		multiple interactions	EXP	7	114,746,054	114,748,903	RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		multiple interactions	ISO				RGD:6480464	CTD
G	Gpx4	glutathione peroxidase 4		multiple interactions	ISO	7	11,162,521	11,165,318	RGD:6480464	CTD
G	Gria1	glutamate receptor, ionotropic, AMPA 1		increases phosphorylation	EXP	10	42,613,359	42,616,610	RGD:6480464	CTD
G	Gria1	glutamate receptor, ionotropic, AMPA 1		multiple interactions	EXP	10	42,613,359	42,616,610	RGD:6480464	CTD
G	Grin1	glutamate receptor, ionotropic, N-methyl D-aspartate 1		multiple interactions	EXP	3	3,453,784	3,480,381	RGD:6480464	CTD
G	Grin1	glutamate receptor, ionotropic, N-methyl D-aspartate 1		increases expression	EXP	3	3,453,784	3,480,381	RGD:6480464	CTD
G	Grin1	glutamate receptor, ionotropic, N-methyl D-aspartate 1		increases phosphorylation	EXP	3	3,453,784	3,480,381	RGD:6480464	CTD
G	Grin1	glutamate receptor, ionotropic, N-methyl D-aspartate 1		multiple interactions	EXP	3	3,453,784	3,480,381	RGD:6480464	CTD
G	Grin2b	glutamate receptor, ionotropic, N-methyl D-aspartate 2B		increases phosphorylation	EXP	4	172,721,895	173,183,187	RGD:6480464	CTD
G	Grin2b	glutamate receptor, ionotropic, N-methyl D-aspartate 2B		multiple interactions	EXP	4	172,721,895	173,183,187	RGD:6480464	CTD
G	Grk6	G protein-coupled receptor kinase 6		multiple interactions	ISO	17	15,220,992	15,236,617	RGD:6480464	CTD
G	Grk6	G protein-coupled receptor kinase 6		decreases response to substance	ISO	17	15,220,992	15,236,617	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsr	glutathione reductase		multiple interactions	ISO	16	62,255,562	62,298,458	RGD:6480464	CTD
G	Gsr	glutathione reductase		multiple interactions	ISO	16	62,255,562	62,298,458	RGD:6480464	CTD
G	Gstp1	glutathione S-transferase pi 1		multiple interactions	ISO	1	206,627,398	206,629,866	RGD:6480464	CTD
G	Gtf2h2	general transcription factor IIH, polypeptide 2		decreases expression	EXP	2	31,284,753	31,312,475	RGD:6480464	CTD
G	Gzma	granzyme A		multiple interactions	ISO	2	44,488,295	44,500,128	RGD:6480464	CTD
G	Gzma	granzyme A		increases expression	ISO	2	44,488,295	44,500,128	RGD:6480464	CTD
G	H2afx	H2A histone family, member X		increases localization	ISO	8	47,312,609	47,313,938	RGD:6480464	CTD
G	H6pd	hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase)		multiple interactions	ISO	5	167,093,827	167,125,298	RGD:6480464	CTD
G	Hbb-b1	hemoglobin, beta adult major chain		increases expression	ISO	1	161,590,671	161,598,127	RGD:6480464	CTD
G	Hbegf	heparin-binding EGF-like growth factor		multiple interactions	ISO	18	29,143,567	29,153,944	RGD:6480464	CTD
G	Hbg1	hemoglobin, gamma A		multiple interactions	EXP	1	161,640,359	161,641,737	RGD:6480464	CTD
G	Hcrt	hypocretin		multiple interactions	EXP	10	89,699,633	89,700,847	RGD:6480464	CTD
G	Hcrt	hypocretin		increases expression	EXP	10	89,699,633	89,700,847	RGD:6480464	CTD
G	Hdac2	histone deacetylase 2		increases expression	EXP	20	41,162,093	41,186,492	RGD:6480464	CTD
G	Hey2	hairy/enhancer-of-split related with YRPW motif 2		increases expression	EXP	1	27,505,117	27,515,204	RGD:6480464	CTD
G	Hif1a	hypoxia-inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		increases expression	ISO	6	96,419,024	96,463,891	RGD:6480464	CTD
G	Hip1r	huntingtin interacting protein 1 related		decreases expression	EXP	12	33,714,225	33,742,792	RGD:6480464	CTD
G	Hist1h2ba	histone cluster 1, H2ba		decreases expression	EXP	17	48,290,185	48,290,654	RGD:6480464	CTD
G	Hmgb2	high mobility group box 2		increases expression	EXP	16	36,131,304	36,133,878	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		increases expression	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	EXP	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	EXP	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hmox1	heme oxygenase (decycling) 1		multiple interactions	ISO	19	13,963,139	13,969,960	RGD:6480464	CTD
G	Hnrnpa1	heterogeneous nuclear ribonucleoprotein A1		increases expression	EXP	7	142,150,229	142,154,520	RGD:6480464	CTD
G	Hpcal1	hippocalcin-like 1		increases expression	EXP	6	41,458,062	41,576,771	RGD:6480464	CTD
G	Hras	Harvey rat sarcoma virus oncogene		increases expression	ISO	1	201,385,705	201,388,987	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		multiple interactions	EXP	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hsp90b1	heat shock protein 90, beta, member 1		increases expression	ISO	7	23,332,986	23,347,525	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases localization	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Hspa5	heat shock protein 5		increases expression	ISO	3	13,783,825	13,788,022	RGD:6480464	CTD
G	Htr1b	5-hydroxytryptamine (serotonin) receptor 1B, G protein-coupled		multiple interactions	ISO	8	86,700,088	86,701,248	RGD:6480464	CTD
G	Htr1d	5-hydroxytryptamine (serotonin) receptor 1D, G protein-coupled		multiple interactions	ISO	5	155,188,669	155,189,793	RGD:6480464	CTD
G	Htr1f	5-hydroxytryptamine (serotonin) receptor 1F, G protein-coupled		multiple interactions	ISO	11	2,260,587	2,261,687	RGD:6480464	CTD
G	Htr3b	5-hydroxytryptamine (serotonin) receptor 3B, ionotropic		decreases expression	EXP	8	52,198,432	52,228,238	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	EXP	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Ick	intestinal cell kinase		increases expression	EXP	8	83,086,346	83,140,977	RGD:6480464	CTD
G	Ick	intestinal cell kinase		multiple interactions	EXP	8	83,086,346	83,140,977	RGD:6480464	CTD
G	Ide	insulin degrading enzyme		multiple interactions	EXP	1	241,547,869	241,646,052	RGD:6480464	CTD
G	Ide	insulin degrading enzyme		affects expression	EXP	1	241,547,869	241,646,052	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		decreases expression	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		decreases expression	EXP	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	EXP	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	EXP	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	EXP	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1r	insulin-like growth factor 1 receptor		increases expression	ISO	1	122,704,976	122,990,007	RGD:6480464	CTD
G	Igf1r	insulin-like growth factor 1 receptor		multiple interactions	ISO	1	122,704,976	122,990,007	RGD:6480464	CTD
G	Igf2	insulin-like growth factor 2		increases expression	EXP	1	202,906,624	202,915,231	RGD:6480464	CTD
G	Il10	interleukin 10		multiple interactions	ISO	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il10	interleukin 10		increases expression	EXP	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il10	interleukin 10		multiple interactions	EXP	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il10	interleukin 10		increases expression	EXP	13	43,953,900	43,957,766	RGD:6480464	CTD
G	Il12b	interleukin 12B		decreases expression	ISO	10	29,558,955	29,568,331	RGD:6480464	CTD
G	Il13	interleukin 13		multiple interactions	EXP	10	39,093,512	39,096,069	RGD:6480464	CTD
G	Il13	interleukin 13		increases expression	EXP	10	39,093,512	39,096,069	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		multiple interactions	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1a	interleukin 1 alpha		decreases expression	EXP	3	116,913,612	116,924,114	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		affects expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		decreases secretion	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		increases expression	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	EXP	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il2	interleukin 2		decreases expression	ISO	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il2	interleukin 2		increases expression	EXP	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il2	interleukin 2		multiple interactions	EXP	2	123,655,005	123,659,709	RGD:6480464	CTD
G	Il3	interleukin 3		multiple interactions	EXP	10	39,684,691	39,687,041	RGD:6480464	CTD
G	Il3	interleukin 3		affects expression	EXP	10	39,684,691	39,687,041	RGD:6480464	CTD
G	Il4	interleukin 4		decreases expression	ISO	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il4	interleukin 4		multiple interactions	EXP	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il4	interleukin 4		increases expression	EXP	10	39,074,582	39,080,134	RGD:6480464	CTD
G	Il5	interleukin 5		decreases expression	ISO	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il5	interleukin 5		increases expression	EXP	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il5	interleukin 5		multiple interactions	EXP	10	39,177,786	39,180,657	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases secretion	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases secretion	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases secretion	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	EXP	4	456,799	461,376	RGD:6480464	CTD
G	Il7	interleukin 7		decreases expression	EXP	2	96,356,083	96,399,796	RGD:6480464	CTD
G	Inhba	inhibin beta-A		increases expression	EXP	17	57,244,466	57,257,531	RGD:6480464	CTD
G	Inhba	inhibin beta-A		multiple interactions	EXP	17	57,244,466	57,257,531	RGD:6480464	CTD
G	Ins1	insulin 1		affects response to substance	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		increases expression	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		multiple interactions	EXP	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Ins1	insulin 1		decreases expression	ISO	1	258,001,134	258,001,688	RGD:6480464	CTD
G	Irs1	insulin receptor substrate 1		increases expression	ISO	9	81,585,251	81,638,071	RGD:6480464	CTD
G	Itga5	integrin, alpha 5 (fibronectin receptor, alpha polypeptide)		increases expression	EXP	7	142,254,256	142,277,464	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		increases expression	EXP	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jund	jun D proto-oncogene		increases expression	EXP	16	19,239,694	19,241,529	RGD:6480464	CTD
G	Kcnq4	potassium voltage-gated channel, KQT-like subfamily, member 4		increases expression	EXP	5	141,289,211	141,339,803	RGD:6480464	CTD
G	Kif11	kinesin family member 11		increases expression	EXP	1	241,668,938	241,722,847	RGD:6480464	CTD
G	Klf4	Kruppel-like factor 4 (gut)		increases expression	EXP	5	73,446,928	73,451,286	RGD:6480464	CTD
G	Klk6	kallikrein related-peptidase 6		increases expression	EXP	1	94,254,350	94,261,500	RGD:6480464	CTD
G	Kng1	kininogen 1		multiple interactions	EXP	11	80,109,499	80,131,887	RGD:6480464	CTD
G	Kng1	kininogen 1		multiple interactions	EXP	11	80,109,499	80,131,887	RGD:6480464	CTD
G	Kng1	kininogen 1		multiple interactions	EXP	11	80,109,499	80,131,887	RGD:6480464	CTD
G	Kng1	kininogen 1		increases response to substance	EXP	11	80,109,499	80,131,887	RGD:6480464	CTD
G	Lep	leptin		decreases expression	ISO	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		increases expression	EXP	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		increases expression	EXP	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		multiple interactions	EXP	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lep	leptin		multiple interactions	EXP	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lrp1	low density lipoprotein receptor-related protein 1		multiple interactions	ISO	7	67,520,575	67,601,549	RGD:6480464	CTD
G	Lrp1	low density lipoprotein receptor-related protein 1		decreases expression	ISO	7	67,520,575	67,601,549	RGD:6480464	CTD
G	Lrp1	low density lipoprotein receptor-related protein 1		decreases response to substance	ISO	7	67,520,575	67,601,549	RGD:6480464	CTD
G	Ltb4r2	leukotriene B4 receptor 2		decreases expression	EXP	15	33,923,472	33,924,548	RGD:6480464	CTD
G	Map3k7	mitogen activated protein kinase kinase kinase 7		multiple interactions	ISO	5	48,252,637	48,308,820	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		increases phosphorylation	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		increases phosphorylation	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk7	mitogen-activated protein kinase 7		increases phosphorylation	EXP	10	47,649,203	47,654,316	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases activity	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases activity	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases phosphorylation	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		multiple interactions	ISO	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		multiple interactions	ISO	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		increases phosphorylation	ISO	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Marcks	myristoylated alanine rich protein kinase C substrate		increases expression	EXP	20	41,304,058	41,310,104	RGD:6480464	CTD
G	Mcpt1	mast cell protease 1		increases expression	EXP	15	34,270,481	34,273,035	RGD:6480464	CTD
G	Mdh1	malate dehydrogenase 1, NAD (soluble)		multiple interactions	EXP	14	102,259,130	102,273,788	RGD:6480464	CTD
G	Mdm2	p53 E3 ubiquitin protein ligase		multiple interactions	ISO	7	56,996,694	57,020,926	RGD:6480464	CTD
G	Mdm2	p53 E3 ubiquitin protein ligase		decreases expression	ISO	7	56,996,694	57,020,926	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		increases expression	EXP	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		multiple interactions	EXP	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mmp1	matrix metallopeptidase 1 (interstitial collagenase)		increases expression	ISO	8	4,333,773	4,354,284	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		decreases expression	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		increases expression	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp13	matrix metallopeptidase 13		multiple interactions	EXP	8	4,158,887	4,169,166	RGD:6480464	CTD
G	Mmp14	matrix metallopeptidase 14 (membrane-inserted)		multiple interactions	ISO	15	32,493,852	32,503,077	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	ISO	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		multiple interactions	EXP	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp2	matrix metallopeptidase 2		increases expression	EXP	19	15,246,036	15,275,061	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		multiple interactions	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mmp9	matrix metallopeptidase 9		increases expression	ISO	3	155,985,473	155,993,433	RGD:6480464	CTD
G	Mobp	myelin-associated oligodendrocyte basic protein		increases expression	EXP	8	125,118,618	125,144,099	RGD:6480464	CTD
G	Mog	myelin oligodendrocyte glycoprotein		increases expression	EXP	20	1,601,731	1,611,963	RGD:6480464	CTD
G	Mpo	myeloperoxidase		affects activity	EXP	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mpo	myeloperoxidase		multiple interactions	EXP	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mpo	myeloperoxidase		decreases expression	EXP	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mpo	myeloperoxidase		multiple interactions	EXP	10	76,085,872	76,097,012	RGD:6480464	CTD
G	Mrpl3	mitochondrial ribosomal protein L3		decreases expression	EXP	8	110,130,050	110,153,411	RGD:6480464	CTD
G	Mtor	mechanistic target of rapamycin (serine/threonine kinase)		decreases phosphorylation	ISO	5	165,531,402	165,640,899	RGD:6480464	CTD
G	Mtor	mechanistic target of rapamycin (serine/threonine kinase)		multiple interactions	ISO	5	165,531,402	165,640,899	RGD:6480464	CTD
G	Mtor	mechanistic target of rapamycin (serine/threonine kinase)		increases phosphorylation	ISO	5	165,531,402	165,640,899	RGD:6480464	CTD
G	Muc5b	mucin 5B, oligomeric mucus/gel-forming		increases secretion	ISO	1	201,962,340	201,997,147	RGD:6480464	CTD
G	Musk	muscle, skeletal, receptor tyrosine kinase		multiple interactions	EXP	5	76,273,430	76,388,614	RGD:6480464	CTD
G	Musk	muscle, skeletal, receptor tyrosine kinase		increases expression	EXP	5	76,273,430	76,388,614	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		increases expression	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myl1	myosin, light chain 1		multiple interactions	EXP	9	65,717,097	65,737,576	RGD:6480464	CTD
G	Ncr1	natural cytotoxicity triggering receptor 1		increases expression	EXP	1	68,964,774	68,972,654	RGD:6480464	CTD
G	Ndufb4	NADH dehydrogenase (ubiquinone) 1 beta subcomplex 4		decreases expression	EXP	11	64,852,589	64,859,550	RGD:6480464	CTD
G	Nfatc4	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 4		increases localization	EXP	15	33,969,774	33,978,848	RGD:6480464	CTD
G	Nfe2l2	nuclear factor, erythroid derived 2, like 2		multiple interactions	ISO	3	58,366,693	58,394,116	RGD:6480464	CTD
G	Nfe2l2	nuclear factor, erythroid derived 2, like 2		increases localization	ISO	3	58,366,693	58,394,116	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		decreases degradation	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		increases phosphorylation	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		increases localization	ISO	6	75,729,302	75,732,475	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		decreases expression	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		increases expression	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		increases response to substance	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		increases response to substance	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	ISO	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		decreases expression	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		increases expression	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		increases response to substance	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngf	nerve growth factor (beta polypeptide)		multiple interactions	EXP	2	197,621,726	197,632,960	RGD:6480464	CTD
G	Ngfr	nerve growth factor receptor		increases expression	EXP	10	84,262,804	84,281,006	RGD:6480464	CTD
G	Ngfr	nerve growth factor receptor		decreases expression	EXP	10	84,262,804	84,281,006	RGD:6480464	CTD
G	Ngfr	nerve growth factor receptor		multiple interactions	EXP	10	84,262,804	84,281,006	RGD:6480464	CTD
G	Nme2	NME/NM23 nucleoside diphosphate kinase 2		increases expression	ISO	10	82,582,766	82,588,269	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		increases expression	EXP	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		increases expression	ISO	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		multiple interactions	ISO	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		increases expression	EXP	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos1	nitric oxide synthase 1, neuronal		increases expression	EXP	12	39,812,500	39,869,484	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		increases expression	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		multiple interactions	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		increases expression	ISO	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nos3	nitric oxide synthase 3, endothelial cell		decreases expression	EXP	4	6,158,847	6,179,441	RGD:6480464	CTD
G	Nox3	NADPH oxidase 3		multiple interactions	EXP	1	38,641,566	38,707,730	RGD:6480464	CTD
G	Npy1r	neuropeptide Y receptor Y1		multiple interactions	EXP	16	24,747,183	24,756,507	RGD:6480464	CTD
G	Npy1r	neuropeptide Y receptor Y1		increases response to substance	EXP	16	24,747,183	24,756,507	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		decreases expression	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		increases expression	EXP	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo2	NAD(P)H dehydrogenase, quinone 2		multiple interactions	EXP	17	37,255,630	37,283,753	RGD:6480464	CTD
G	Nrp1	neuropilin 1		increases expression	EXP	19	58,332,004	58,487,686	RGD:6480464	CTD
G	Nrp1	neuropilin 1		multiple interactions	EXP	19	58,332,004	58,487,686	RGD:6480464	CTD
G	Ns5atp9	NS5A (hepatitis C virus) transactivated protein 9		increases expression	EXP	8	70,159,283	70,172,116	RGD:6480464	CTD
G	Ntrk1	neurotrophic tyrosine kinase, receptor, type 1		multiple interactions	ISO	2	179,838,740	179,855,545	RGD:6480464	CTD
G	Ntrk1	neurotrophic tyrosine kinase, receptor, type 1		decreases expression	EXP	2	179,838,740	179,855,545	RGD:6480464	CTD
G	Ogdh	oxoglutarate (alpha-ketoglutarate) dehydrogenase (lipoamide)		multiple interactions	ISO	14	87,022,994	87,090,768	RGD:6480464	CTD
G	Olig1	oligodendrocyte transcription factor 1		increases expression	EXP	11	31,244,279	31,246,421	RGD:6480464	CTD
G	Olr1271	olfactory receptor 1271		increases expression	EXP	8	41,166,050	41,170,530	RGD:6480464	CTD
G	Oprl1	opiate receptor-like 1		multiple interactions	EXP	3	170,869,862	170,873,417	RGD:6480464	CTD
G	Oprm1	opioid receptor, mu 1		multiple interactions	ISO	1	37,535,416	37,779,392	RGD:6480464	CTD
G	P22k15	cystatin related protein 2		decreases expression	EXP	3	138,329,673	138,336,731	RGD:6480464	CTD
G	P2ry2	purinergic receptor P2Y, G-protein coupled, 2		affects response to substance	ISO	1	158,440,018	158,454,213	RGD:6480464	CTD
G	P2ry2	purinergic receptor P2Y, G-protein coupled, 2		multiple interactions	ISO	1	158,440,018	158,454,213	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		multiple interactions	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases ADP-ribosylation	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases cleavage	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases expression	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases cleavage	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase 1		increases cleavage	ISO	13	96,309,670	96,341,486	RGD:6480464	CTD
G	Pcolce	procollagen C-endopeptidase enhancer		increases expression	EXP	12	19,672,505	19,678,821	RGD:6480464	CTD
G	Pcsk5	proprotein convertase subtilisin/kexin type 5		decreases expression	EXP	1	220,961,912	221,405,907	RGD:6480464	CTD
G	Pctp	phosphatidylcholine transfer protein		decreases expression	ISO	10	78,400,328	78,420,774	RGD:6480464	CTD
G	Pde2a	phosphodiesterase 2A, cGMP-stimulated		decreases expression	EXP	1	158,921,607	159,013,829	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		increases expression	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		multiple interactions	EXP	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdx1	pancreatic and duodenal homeobox 1		decreases expression	EXP				RGD:6480464	CTD
G	Pdyn	prodynorphin		increases expression	EXP	3	117,291,025	117,303,367	RGD:6480464	CTD
G	Pdyn	prodynorphin		multiple interactions	EXP	3	117,291,025	117,303,367	RGD:6480464	CTD
G	Pdzd2	PDZ domain containing 2		increases expression	EXP	2	61,828,127	61,953,671	RGD:6480464	CTD
G	Pgm1	phosphoglucomutase 1		increases expression	ISO	5	120,595,650	120,655,915	RGD:6480464	CTD
G	Pgm1	phosphoglucomutase 1		decreases expression	EXP	5	120,595,650	120,655,915	RGD:6480464	CTD
G	Phb2	prohibitin 2		multiple interactions	ISO	4	160,835,328	160,839,933	RGD:6480464	CTD
G	Phox2a	paired-like homeobox 2a		increases expression	EXP	1	159,273,524	159,312,136	RGD:6480464	CTD
G	Pik3r1	phosphoinositide-3-kinase, regulatory subunit 1 (alpha)		multiple interactions	ISO	2	32,602,673	32,675,350	RGD:6480464	CTD
G	Pla2g15	phospholipase A2, group XV		decreases expression	EXP	19	35,997,758	36,015,531	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		multiple interactions	ISO	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Pla2g4a	phospholipase A2, group IVA (cytosolic, calcium-dependent)		increases phosphorylation	ISO	13	64,135,729	64,280,815	RGD:6480464	CTD
G	Plau	plasminogen activator, urokinase		increases expression	ISO	15	3,680,072	3,686,232	RGD:6480464	CTD
G	Plaur	plasminogen activator, urokinase receptor		increases expression	ISO	1	79,708,646	79,712,881	RGD:6480464	CTD
G	Plcb3	phospholipase C, beta 3 (phosphatidylinositol-specific)		decreases expression	EXP	1	209,628,425	209,643,694	RGD:6480464	CTD
G	Plin2	perilipin 2		affects expression	EXP	5	105,718,496	105,732,817	RGD:6480464	CTD
G	Plin2	perilipin 2		multiple interactions	EXP	5	105,718,496	105,732,817	RGD:6480464	CTD
G	Plp1	proteolipid protein 1		increases expression	EXP	X	124,488,627	124,503,639	RGD:6480464	CTD
G	Pnisr	PNN-interacting serine/arginine-rich protein		increases expression	EXP	5	36,598,493	36,625,381	RGD:6480464	CTD
G	Polb	polymerase (DNA directed), beta		decreases expression	EXP	16	73,864,702	73,888,011	RGD:6480464	CTD
G	Polr2f	polymerase (RNA) II (DNA directed) polypeptide F		increases expression	EXP	7	117,122,869	117,135,482	RGD:6480464	CTD
G	Pomc	proopiomelanocortin		multiple interactions	EXP	6	26,931,969	26,937,789	RGD:6480464	CTD
G	Pomc	proopiomelanocortin		increases expression	EXP	6	26,931,969	26,937,789	RGD:6480464	CTD
G	Pomc	proopiomelanocortin		multiple interactions	EXP	6	26,931,969	26,937,789	RGD:6480464	CTD
G	Pomc	proopiomelanocortin		increases secretion	EXP	6	26,931,969	26,937,789	RGD:6480464	CTD
G	Pomc	proopiomelanocortin		multiple interactions	EXP	6	26,931,969	26,937,789	RGD:6480464	CTD
G	Por	P450 (cytochrome) oxidoreductase		multiple interactions	ISO	12	22,078,629	22,097,301	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		increases expression	ISO	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		decreases expression	ISO	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		decreases expression	ISO	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	EXP	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases activity	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		increases expression	ISO	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppargc1a	peroxisome proliferator-activated receptor gamma, coactivator 1 alpha		multiple interactions	EXP	14	64,278,115	64,370,912	RGD:6480464	CTD
G	Ppp1r12a	protein phosphatase 1, regulatory subunit 12A		multiple interactions	ISO	7	46,876,552	46,986,022	RGD:6480464	CTD
G	Ppp3ca	protein phosphatase 3, catalytic subunit, alpha isozyme		multiple interactions	EXP	2	234,130,176	234,409,232	RGD:6480464	CTD
G	Ppp5c	protein phosphatase 5, catalytic subunit		increases expression	EXP	1	77,345,194	77,369,417	RGD:6480464	CTD
G	Prdx1l1	peroxiredoxin 1-like 1		multiple interactions	EXP	2	201,373,420	201,374,019	RGD:6480464	CTD
G	Prdx6	peroxiredoxin 6		increases expression	ISO	13	76,824,968	76,835,517	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		increases expression	EXP	2	54,327,821	54,360,462	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		multiple interactions	EXP	2	54,327,821	54,360,462	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		multiple interactions	ISO	2	54,327,821	54,360,462	RGD:6480464	CTD
G	Prkaca	protein kinase, cAMP-dependent, catalytic, alpha		increases phosphorylation	ISO	19	25,840,795	25,864,786	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		multiple interactions	ISO	10	97,367,196	97,638,910	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		increases expression	ISO	10	97,367,196	97,638,910	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		increases expression	EXP	10	97,367,196	97,638,910	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		multiple interactions	EXP	10	97,367,196	97,638,910	RGD:6480464	CTD
G	Prkcd	protein kinase C, delta		increases expression	ISO	16	5,954,218	5,975,743	RGD:6480464	CTD
G	Prkcd	protein kinase C, delta		multiple interactions	ISO	16	5,954,218	5,975,743	RGD:6480464	CTD
G	Prkce	protein kinase C, epsilon		multiple interactions	ISO	6	9,631,234	10,097,311	RGD:6480464	CTD
G	Prkd1	protein kinase D1		multiple interactions	EXP	6	70,364,135	70,682,006	RGD:6480464	CTD
G	Prkd1	protein kinase D1		multiple interactions	ISO	6	70,364,135	70,682,006	RGD:6480464	CTD
G	Prkdc	protein kinase, DNA activated, catalytic polypeptide		increases phosphorylation	ISO	11	86,951,420	87,169,229	RGD:6480464	CTD
G	Prlr	prolactin receptor		increases expression	EXP	2	59,507,966	59,701,221	RGD:6480464	CTD
G	Prlr	prolactin receptor		multiple interactions	EXP	2	59,507,966	59,701,221	RGD:6480464	CTD
G	Prok1	prokineticin 1		multiple interactions	EXP	2	202,707,628	202,712,886	RGD:6480464	CTD
G	Prok1	prokineticin 1		increases expression	EXP	2	202,707,628	202,712,886	RGD:6480464	CTD
G	Prok2	prokineticin 2		increases response to substance	ISO	4	134,561,300	134,574,487	RGD:6480464	CTD
G	Prokr1	prokineticin receptor 1		multiple interactions	ISO	4	121,750,651	121,758,116	RGD:6480464	CTD
G	Prokr1	prokineticin receptor 1		increases response to substance	ISO	4	121,750,651	121,758,116	RGD:6480464	CTD
G	Prokr2	prokineticin receptor 2		decreases expression	EXP	3	120,139,415	120,147,532	RGD:6480464	CTD
G	Ptgir	prostaglandin I2 (prostacyclin) receptor (IP)		increases response to substance	ISO	1	77,234,538	77,236,921	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		increases expression	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		increases expression	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		increases expression	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		decreases expression	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		decreases expression	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	EXP	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Ptk2	protein tyrosine kinase 2		multiple interactions	ISO	7	110,933,298	111,084,554	RGD:6480464	CTD
G	Pvrl1	poliovirus receptor-related 1		increases expression	EXP	8	46,739,657	46,799,051	RGD:6480464	CTD
G	Ranbp3l	RAN binding protein 3-like		increases expression	EXP	2	58,666,640	58,720,647	RGD:6480464	CTD
G	Rarres2	retinoic acid receptor responder (tazarotene induced) 2		multiple interactions	ISO	4	76,659,507	76,662,465	RGD:6480464	CTD
G	Rbm5	RNA binding motif protein 5		increases expression	EXP	8	112,995,731	113,024,356	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		decreases localization	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		decreases activity	ISO	1	208,262,669	208,273,148	RGD:6480464	CTD
G	Retn	resistin		increases expression	EXP	12	2,499,630	2,501,370	RGD:6480464	CTD
G	Retn	resistin		multiple interactions	EXP	12	2,499,630	2,501,370	RGD:6480464	CTD
G	Retnlb	resistin like beta		increases expression	EXP	11	53,226,992	53,228,878	RGD:6480464	CTD
G	Retnlb	resistin like beta		multiple interactions	EXP	11	53,226,992	53,228,878	RGD:6480464	CTD
G	Ripk2	receptor-interacting serine-threonine kinase 2		increases expression	ISO	5	30,714,817	30,745,941	RGD:6480464	CTD
G	Rps6ka3	ribosomal protein S6 kinase polypeptide 3		increases expression	ISO	X	56,722,878	56,825,444	RGD:6480464	CTD
G	Rps6kb1	ribosomal protein S6 kinase, polypeptide 1		decreases phosphorylation	ISO	10	76,657,024	76,698,088	RGD:6480464	CTD
G	RT1-Bb	RT1 class II, locus Bb		multiple interactions	ISO	20	4,730,559	4,736,201	RGD:6480464	CTD
G	Rxra	retinoid X receptor alpha		decreases expression	ISO	3	6,605,782	6,689,224	RGD:6480464	CTD
G	Rxrb	retinoid X receptor beta		decreases expression	ISO	20	4,954,336	4,960,880	RGD:6480464	CTD
G	S100a4	S100 calcium-binding protein A4		increases expression	ISO	2	182,885,070	182,887,380	RGD:6480464	CTD
G	S100b	S100 calcium binding protein B		increases expression	EXP	20	12,791,440	12,824,508	RGD:6480464	CTD
G	S100g	S100 calcium binding protein G		increases expression	EXP	X	52,446,817	52,449,342	RGD:6480464	CTD
G	Scn10a	sodium channel, voltage-gated, type X, alpha subunit		multiple interactions	ISO	8	124,578,222	124,690,458	RGD:6480464	CTD
G	Scn10a	sodium channel, voltage-gated, type X, alpha subunit		increases response to substance	ISO	8	124,578,222	124,690,458	RGD:6480464	CTD
G	Scp2	sterol carrier protein 2		decreases expression	ISO	5	129,152,836	129,230,401	RGD:6480464	CTD
G	Sele	selectin E		increases expression	EXP	13	79,813,455	79,822,845	RGD:6480464	CTD
G	Sele	selectin E		multiple interactions	EXP	13	79,813,455	79,822,845	RGD:6480464	CTD
G	Sell	selectin L		increases expression	EXP	13	79,827,342	79,845,296	RGD:6480464	CTD
G	Sell	selectin L		multiple interactions	EXP	13	79,827,342	79,845,296	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		decreases expression	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Sfpq	splicing factor proline/glutamine-rich		increases expression	EXP	5	146,460,306	146,469,289	RGD:6480464	CTD
G	Sh3bp5	SH3-domain binding protein 5 (BTK-associated)		decreases expression	EXP	16	6,822,512	6,888,922	RGD:6480464	CTD
G	Sh3kbp1	SH3-domain kinase binding protein 1		increases expression	EXP	X	56,075,533	56,422,980	RGD:6480464	CTD
G	Slc12a1	solute carrier family 12 (sodium/potassium/chloride transporters), member 1		multiple interactions	EXP	3	112,455,897	112,534,752	RGD:6480464	CTD
G	Slc12a1	solute carrier family 12 (sodium/potassium/chloride transporters), member 1		increases expression	EXP	3	112,455,897	112,534,752	RGD:6480464	CTD
G	Slc12a2	solute carrier family 12 (sodium/potassium/chloride transporters), member 2		affects response to substance	ISO	18	53,673,215	53,741,352	RGD:6480464	CTD
G	Slc16a10	solute carrier family 16, member 10 (aromatic amino acid transporter)		decreases expression	EXP	20	44,211,651	44,325,332	RGD:6480464	CTD
G	Slc2a4	solute carrier family 2 (facilitated glucose transporter), member 4		increases expression	ISO	10	56,786,705	56,792,209	RGD:6480464	CTD
G	Slc37a1	solute carrier family 37 (glycerol-3-phosphate transporter), member 1		decreases expression	EXP	20	9,689,661	9,745,102	RGD:6480464	CTD
G	Slit1	slit homolog 1 (Drosophila)		increases expression	EXP	1	246,813,909	246,964,408	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		increases expression	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sostdc1	sclerostin domain containing 1		increases expression	EXP	6	55,066,277	55,070,451	RGD:6480464	CTD
G	Sp1	Sp1 transcription factor		increases localization	ISO	7	141,164,180	141,194,509	RGD:6480464	CTD
G	Sp1	Sp1 transcription factor		multiple interactions	ISO	7	141,164,180	141,194,509	RGD:6480464	CTD
G	Spi1	spleen focus forming virus (SFFV) proviral integration oncogene spi1		increases expression	ISO	3	75,456,353	75,475,722	RGD:6480464	CTD
G	Spp1	secreted phosphoprotein 1		increases expression	EXP				RGD:6480464	CTD
G	Spp1	secreted phosphoprotein 1		multiple interactions	EXP				RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		multiple interactions	ISO	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		increases activity	EXP	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		multiple interactions	EXP	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Sst	somatostatin		increases secretion	EXP	11	79,125,031	79,126,216	RGD:6480464	CTD
G	Sst	somatostatin		decreases expression	EXP	11	79,125,031	79,126,216	RGD:6480464	CTD
G	Sst	somatostatin		increases expression	ISO	11	79,125,031	79,126,216	RGD:6480464	CTD
G	Stat1	signal transducer and activator of transcription 1		multiple interactions	ISO	9	46,455,635	46,497,560	RGD:6480464	CTD
G	Steap3	STEAP family member 3, metalloreductase		multiple interactions	EXP				RGD:6480464	CTD
G	Suv39h1	suppressor of variegation 3-9 homolog 1 (Drosophila)		decreases expression	EXP	X	26,451,917	26,464,885	RGD:6480464	CTD
G	Syngap1	synaptic Ras GTPase activating protein 1		affects response to substance	ISO	20	5,178,523	5,208,449	RGD:6480464	CTD
G	Syt7	synaptotagmin VII		increases expression	EXP	1	212,876,675	212,935,373	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		decreases expression	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases expression	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases secretion	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		decreases expression	ISO	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases secretion	ISO	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	ISO	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases expression	ISO	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases secretion	ISO	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		decreases expression	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		decreases expression	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		decreases secretion	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		increases secretion	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac1	tachykinin, precursor 1		multiple interactions	EXP	4	32,649,666	32,657,632	RGD:6480464	CTD
G	Tac3	tachykinin 3		decreases expression	EXP	7	67,717,068	67,723,674	RGD:6480464	CTD
G	Tacr1	tachykinin receptor 1		increases expression	ISO	4	116,610,595	116,780,394	RGD:6480464	CTD
G	Tacr2	tachykinin receptor 2		decreases expression	EXP				RGD:6480464	CTD
G	Tek	TEK tyrosine kinase, endothelial		increases expression	EXP	5	115,047,195	115,196,172	RGD:6480464	CTD
G	Tek	TEK tyrosine kinase, endothelial		increases expression	ISO	5	115,047,195	115,196,172	RGD:6480464	CTD
G	Tek	TEK tyrosine kinase, endothelial		multiple interactions	EXP	5	115,047,195	115,196,172	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		increases expression	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb2	transforming growth factor, beta 2		increases expression	EXP	13	102,718,703	102,818,768	RGD:6480464	CTD
G	Tgfb2	transforming growth factor, beta 2		multiple interactions	EXP	13	102,718,703	102,818,768	RGD:6480464	CTD
G	Tgfb3	transforming growth factor, beta 3		multiple interactions	EXP	6	110,173,443	110,195,215	RGD:6480464	CTD
G	Tgfb3	transforming growth factor, beta 3		increases expression	EXP	6	110,173,443	110,195,215	RGD:6480464	CTD
G	Thop1	thimet oligopeptidase 1		increases expression	EXP	7	10,116,822	10,129,162	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		increases expression	ISO	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		multiple interactions	EXP	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		increases expression	EXP	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		increases expression	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		increases expression	ISO	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		multiple interactions	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Timp3	TIMP metallopeptidase inhibitor 3		increases expression	EXP	7	19,677,144	19,727,072	RGD:6480464	CTD
G	Tlr4	toll-like receptor 4		increases expression	EXP	5	83,564,100	83,577,735	RGD:6480464	CTD
G	Tlr4	toll-like receptor 4		multiple interactions	EXP	5	83,564,100	83,577,735	RGD:6480464	CTD
G	Tmem37	transmembrane protein 37		increases expression	EXP				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		increases expression	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		increases secretion	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		increases expression	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf10b	tumor necrosis factor receptor superfamily, member 10b		increases expression	ISO	15	50,138,439	50,163,254	RGD:6480464	CTD
G	Tnfrsf10b	tumor necrosis factor receptor superfamily, member 10b		increases expression	ISO	15	50,138,439	50,163,254	RGD:6480464	CTD
G	Tnfrsf10b	tumor necrosis factor receptor superfamily, member 10b		multiple interactions	ISO	15	50,138,439	50,163,254	RGD:6480464	CTD
G	Tnfrsf19	tumor necrosis factor receptor superfamily, member 19		affects expression	EXP	15	40,051,695	40,117,968	RGD:6480464	CTD
G	Tnfrsf19	tumor necrosis factor receptor superfamily, member 19		multiple interactions	EXP	15	40,051,695	40,117,968	RGD:6480464	CTD
G	Tnfrsf1a	tumor necrosis factor receptor superfamily, member 1a		increases expression	ISO	4	162,172,563	162,185,252	RGD:6480464	CTD
G	Tnfrsf1a	tumor necrosis factor receptor superfamily, member 1a		increases expression	ISO	4	162,172,563	162,185,252	RGD:6480464	CTD
G	Tnfrsf1a	tumor necrosis factor receptor superfamily, member 1a		multiple interactions	ISO	4	162,172,563	162,185,252	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		multiple interactions	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		multiple interactions	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		increases activity	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		increases expression	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		increases response to substance	ISO	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		increases expression	EXP	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tnfsf10	tumor necrosis factor (ligand) superfamily, member 10		multiple interactions	EXP	2	113,204,303	113,221,550	RGD:6480464	CTD
G	Tom1	target of myb1 (chicken)		decreases expression	EXP	19	13,890,549	13,925,393	RGD:6480464	CTD
G	Tp53	tumor protein p53		increases expression	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		increases expression	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		increases phosphorylation	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		affects response to substance	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		multiple interactions	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tp53	tumor protein p53		increases degradation	ISO	10	56,399,721	56,411,150	RGD:6480464	CTD
G	Tpi1	triosephosphate isomerase 1		increases expression	ISO	4	160,933,341	160,936,871	RGD:6480464	CTD
G	Trafd1	TRAF type zinc finger domain containing 1		increases expression	EXP	12	36,301,824	36,315,741	RGD:6480464	CTD
G	Trpc5	transient receptor potential cation channel, subfamily C, member 5		increases expression	EXP	X	33,989,907	34,126,175	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases activity	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases activity	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases activity	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		affects response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		decreases response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		affects response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases activity	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		affects response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases response to substance	ISO	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		affects binding	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		decreases expression	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		decreases expression	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases expression	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		increases activity	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD
G	Trpv1	transient receptor potential cation channel, subfamily V, member 1		multiple interactions	EXP	10	60,109,656	60,134,939	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492507
role	482196
biological role	480389
pharmacological role	122965
analgesic	22628
non-narcotic analgesic	19692
capsaicin	1421
Path 2
Term	Annotations
CHEBI ontology	492507
subatomic particle	491470
composite particle	491470
hadron	491470
baryon	491470
nucleon	491470
atomic nucleus	491470
atom	491470
main group element atom	461139
p-block element atom	458635
carbon group element atom	410624
carbon atom	407181
organic molecular entity	407174
organic group	167657
organic divalent group	166492
organodiyl group	166492
carbonyl group	166182
carbonyl compound	166182
carboxylic acid	121381
carboacyl group	40896
univalent carboacyl group	40896
carbamoyl group	37115
carboxamide	37106
monocarboxylic acid amide	24326
fatty amide	1615
capsaicinoid	1448
capsaicin	1421