butyric acid - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	butyric acid	go back to main search page
Accession:	CHEBI:30772	browse the term
Definition:	A four-carbon straight-chain saturated fatty acid.
Synonyms:	related_synonym:	1-butanoic acid; 1-butyric acid; 1-propanecarboxylic acid; 4:0; BUTANOIC ACID; Butanoic acid; Buttersaeure; C4:0; C4H8O2; CCCC(O)=O; CH3-[CH2]2-COOH; InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6); InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-N; acide butanoique; acide butyrique; butanic acid; butanoic acid; butoic acid; ethylacetic acid; n-butanoic acid; n-butyric acid; propanecarboxylic acid; propylformic acid
	alt_id:	CHEBI:113450; CHEBI:22948; CHEBI:3234; CHEBI:41208
	xref_casrn:	107-92-6
	xref:	Beilstein:906770 "Beilstein Registry Number"; ChEMBL:10956204 "PubMed citation"; ChEMBL:113450 "ChEMBL COMPOUND"; ChEMBL:1542095 "PubMed citation"; ChemIDplus:107-92-6 "CAS Registry Number"; CiteXplore:10736622 "PubMed citation"; CiteXplore:11201044 "PubMed citation"; CiteXplore:11208715 "PubMed citation"; CiteXplore:11238216 "PubMed citation"; CiteXplore:11305323 "PubMed citation"; CiteXplore:12068484 "PubMed citation"; CiteXplore:13678314 "PubMed citation"; CiteXplore:14962641 "PubMed citation"; CiteXplore:15809727 "PubMed citation"; CiteXplore:15810631 "PubMed citation"; CiteXplore:15938880 "PubMed citation"; CiteXplore:19318247 "PubMed citation"; CiteXplore:19366864 "PubMed citation"; CiteXplore:19703412 "PubMed citation"; CiteXplore:21699495 "PubMed citation"; CiteXplore:22038864 "PubMed citation"; CiteXplore:22194341 "PubMed citation"; CiteXplore:22322557 "PubMed citation"; CiteXplore:22339023 "PubMed citation"; CiteXplore:22466881 "PubMed citation"; DrugBank:DB03568 "DrugBank"; Gmelin:26242 "Gmelin Registry Number"; HMDB:HMDB00039 "HMDB"; KEGG COMPOUND:107-92-6 "CAS Registry Number"; KEGG COMPOUND:C00246 "KEGG COMPOUND"; LIPID MAPS:LMFA01010004 "LIPID MAPS instance"
	xref_mesh:	MESH:D020148
	xref:	MetaCyc:BUTYRIC_ACID "MetaCyc"; NIST Chemistry WebBook:107-92-6 "CAS Registry Number"; PDBeChem:BUA "PDBeChem"; Reaxys:906770 "Reaxys Registry Number"; Wikipedia:Butyric_acid "Wikipedia"
	cyclic_relationship:	is_conjugate_acid_of CHEBI:17968

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

butyric acid
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Abcb1a	ATP-binding cassette, sub-family B (MDR/TAP), member 1A		increases expression	ISO	4	21,709,855	21,796,628	RGD:6480464	CTD
G	Adam17	ADAM metallopeptidase domain 17		increases expression	EXP	6	41,882,432	41,930,755	RGD:6480464	CTD
G	Aimp2	aminoacyl tRNA synthetase complex-interacting multifunctional protein 2		decreases expression	EXP	12	11,028,968	11,038,458	RGD:6480464	CTD
G	Alas1	aminolevulinate, delta-, synthase 1		increases expression	EXP				RGD:6480464	CTD
G	B2m	beta-2 microglobulin		decreases stability	ISO	3	108,927,919	108,932,718	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	ISO	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bin1	bridging integrator 1		increases expression	EXP	18	24,813,407	24,872,852	RGD:6480464	CTD
G	Bmyc	brain expressed myelocytomatosis oncogene		increases expression	EXP	3	3,864,740	3,865,499	RGD:6480464	CTD
G	Btg1	B-cell translocation gene 1, anti-proliferative		increases expression	EXP	7	34,029,300	34,031,557	RGD:6480464	CTD
G	Casp6	caspase 6		increases expression	EXP	2	227,361,538	227,373,844	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		decreases expression	EXP	4	42,956,102	42,989,057	RGD:6480464	CTD
G	Cck	cholecystokinin		increases expression	ISO	8	126,492,636	126,499,220	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		increases expression	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	EXP	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd3	cyclin D3		increases expression	EXP				RGD:6480464	CTD
G	Ccne1	cyclin E1		decreases expression	EXP	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Cd44	Cd44 molecule		affects expression	EXP	3	88,022,962	88,110,352	RGD:6480464	CTD
G	Cd55	Cd55 molecule		increases expression	EXP	13	43,322,246	43,348,334	RGD:6480464	CTD
G	Cdk4	cyclin-dependent kinase 4		decreases expression	EXP				RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		increases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cds1	CDP-diacylglycerol synthase 1		increases expression	EXP	14	9,074,826	9,135,391	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		decreases stability	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		increases expression	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		multiple interactions	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		multiple interactions	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		multiple interactions	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		increases expression	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		increases expression	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha polypeptide		multiple interactions	ISO	5	51,538,259	51,550,324	RGD:6480464	CTD
G	Clec7a	C-type lectin domain family 7, member A		increases expression	ISO	4	166,723,515	166,734,681	RGD:6480464	CTD
G	Cnbp	CCHC-type zinc finger, nucleic acid binding protein		decreases expression	EXP	4	122,033,037	122,041,891	RGD:6480464	CTD
G	Ddit3	DNA-damage inducible transcript 3		increases expression	EXP	7	67,247,749	67,252,571	RGD:6480464	CTD
G	Ddx39a	DEAD (Asp-Glu-Ala-Asp) box polypeptide 39A		decreases expression	EXP	19	26,109,094	26,117,042	RGD:6480464	CTD
G	Dusp1	dual specificity phosphatase 1		affects expression	EXP	10	16,942,913	16,945,696	RGD:6480464	CTD
G	Egr1	early growth response 1		increases expression	EXP	18	27,343,919	27,346,117	RGD:6480464	CTD
G	Elk1	ELK1, member of ETS oncogene family		increases activity	ISO	X	12,597,863	12,604,248	RGD:6480464	CTD
G	Elk1	ELK1, member of ETS oncogene family		multiple interactions	ISO	X	12,597,863	12,604,248	RGD:6480464	CTD
G	Enpp2	ectonucleotide pyrophosphatase/phosphodiesterase 2		decreases expression	EXP	7	91,295,824	91,377,850	RGD:6480464	CTD
G	Entpd2	ectonucleoside triphosphate diphosphohydrolase 2		increases expression	EXP	3	3,564,380	3,569,801	RGD:6480464	CTD
G	Epx	eosinophil peroxidase		increases expression	ISO	10	76,160,005	76,171,089	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		multiple interactions	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	EXP	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fosl1	fos-like antigen 1		decreases expression	EXP	1	208,090,612	208,099,118	RGD:6480464	CTD
G	Fosl2	fos-like antigen 2		increases expression	EXP				RGD:6480464	CTD
G	Fst	follistatin		decreases expression	EXP	2	46,542,246	46,550,678	RGD:6480464	CTD
G	G0s2	G0/G1switch 2		decreases expression	EXP	13	109,121,297	109,122,209	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		multiple interactions	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		multiple interactions	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		increases expression	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		multiple interactions	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gata1	GATA binding protein 1		increases expression	ISO	X	26,564,259	26,572,081	RGD:6480464	CTD
G	Gata2	GATA binding protein 2		multiple interactions	ISO	4	122,279,753	122,288,528	RGD:6480464	CTD
G	Gata2	GATA binding protein 2		increases expression	ISO	4	122,279,753	122,288,528	RGD:6480464	CTD
G	Gata2	GATA binding protein 2		multiple interactions	ISO	4	122,279,753	122,288,528	RGD:6480464	CTD
G	Gja1	gap junction protein, alpha 1		decreases expression	EXP	20	35,409,815	35,422,262	RGD:6480464	CTD
G	Grn	granulin		increases expression	EXP	10	91,536,135	91,542,239	RGD:6480464	CTD
G	Gstm1	glutathione S-transferase mu 1		increases expression	EXP	2	203,575,444	203,580,821	RGD:6480464	CTD
G	H2afx	H2A histone family, member X		decreases expression	EXP	8	47,312,609	47,313,938	RGD:6480464	CTD
G	Hdac6	histone deacetylase 6		multiple interactions	ISO	X	26,585,852	26,606,999	RGD:6480464	CTD
G	Hist3h3	histone cluster 3, H3		increases acetylation	ISO	10	45,252,993	45,253,403	RGD:6480464	CTD
G	Hmbs	hydroxymethylbilane synthase		multiple interactions	ISO	8	47,314,235	47,321,604	RGD:6480464	CTD
G	Hmbs	hydroxymethylbilane synthase		multiple interactions	ISO	8	47,314,235	47,321,604	RGD:6480464	CTD
G	Hmbs	hydroxymethylbilane synthase		increases expression	ISO	8	47,314,235	47,321,604	RGD:6480464	CTD
G	Hmbs	hydroxymethylbilane synthase		multiple interactions	ISO	8	47,314,235	47,321,604	RGD:6480464	CTD
G	Hmbs	hydroxymethylbilane synthase		increases expression	ISO	8	47,314,235	47,321,604	RGD:6480464	CTD
G	Hnf1a	HNF1 homeobox A		affects expression	EXP	12	42,919,574	42,945,670	RGD:6480464	CTD
G	Hnrnpa1	heterogeneous nuclear ribonucleoprotein A1		decreases expression	EXP	7	142,150,229	142,154,520	RGD:6480464	CTD
G	Hnrnpc	heterogeneous nuclear ribonucleoprotein C (C1/C2)		decreases expression	EXP	15	27,516,839	27,546,646	RGD:6480464	CTD
G	Hspa13	heat shock protein 13		increases expression	EXP	11	14,521,734	14,535,915	RGD:6480464	CTD
G	Hspb1	heat shock protein 1		increases expression	EXP	12	21,911,223	21,912,784	RGD:6480464	CTD
G	Hspd1	heat shock protein 1 (chaperonin)		decreases expression	EXP	9	53,884,193	53,895,043	RGD:6480464	CTD
G	Id2	inhibitor of DNA binding 2		increases expression	EXP	6	42,781,476	42,783,307	RGD:6480464	CTD
G	Il18	interleukin 18		increases expression	ISO	8	53,936,584	53,943,228	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Insig1	insulin induced gene 1		increases expression	EXP	4	2,577,468	2,585,682	RGD:6480464	CTD
G	Jun	jun proto-oncogene		decreases expression	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Junb	jun B proto-oncogene		increases expression	EXP	19	24,831,536	24,833,320	RGD:6480464	CTD
G	Kat5	K(lysine) acetyltransferase 5		multiple interactions	ISO	1	208,233,434	208,240,738	RGD:6480464	CTD
G	Kat5	K(lysine) acetyltransferase 5		increases expression	ISO	1	208,233,434	208,240,738	RGD:6480464	CTD
G	Kctd13	potassium channel tetramerisation domain containing 13		increases expression	EXP	1	186,104,306	186,122,853	RGD:6480464	CTD
G	Kitlg	KIT ligand		increases expression	ISO	7	37,714,157	37,795,722	RGD:6480464	CTD
G	Lepr	leptin receptor		affects abundance	ISO	5	122,320,075	122,503,449	RGD:6480464	CTD
G	Lgals9	lectin, galactoside-binding, soluble, 9		increases expression	EXP	10	65,129,006	65,152,052	RGD:6480464	CTD
G	Mcm5	minichromosome maintenance complex component 5		decreases expression	EXP	19	13,978,940	14,000,641	RGD:6480464	CTD
G	Mmp7	matrix metallopeptidase 7		increases expression	EXP	8	4,526,018	4,533,730	RGD:6480464	CTD
G	Mpzl1	myelin protein zero-like 1		increases expression	EXP	13	81,321,155	81,357,929	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	EXP	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Naa15	N(alpha)-acetyltransferase 15, NatA auxiliary subunit		decreases expression	EXP	2	140,308,955	140,371,869	RGD:6480464	CTD
G	Nfe2	nuclear factor, erythroid derived 2		multiple interactions	ISO	7	142,157,045	142,164,122	RGD:6480464	CTD
G	Nfe2	nuclear factor, erythroid derived 2		increases expression	ISO	7	142,157,045	142,164,122	RGD:6480464	CTD
G	Nfe2	nuclear factor, erythroid derived 2		multiple interactions	ISO	7	142,157,045	142,164,122	RGD:6480464	CTD
G	Nfe2	nuclear factor, erythroid derived 2		multiple interactions	ISO	7	142,157,045	142,164,122	RGD:6480464	CTD
G	Nfe2	nuclear factor, erythroid derived 2		increases expression	ISO	7	142,157,045	142,164,122	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		decreases expression	EXP	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Ngfr	nerve growth factor receptor		increases expression	EXP	10	84,262,804	84,281,006	RGD:6480464	CTD
G	Nkx2-1	NK2 homeobox 1		decreases expression	EXP	6	76,916,943	76,920,133	RGD:6480464	CTD
G	Nolc1	nucleolar and coiled-body phosphoprotein 1		decreases expression	EXP	1	251,297,417	251,308,127	RGD:6480464	CTD
G	Npm1	nucleophosmin (nucleolar phosphoprotein B23, numatrin)		decreases expression	EXP	10	18,051,990	18,062,714	RGD:6480464	CTD
G	Nppb	natriuretic peptide B		increases expression	EXP	5	165,062,348	165,063,650	RGD:6480464	CTD
G	Odc1	ornithine decarboxylase 1		increases expression	EXP	6	41,309,211	41,315,796	RGD:6480464	CTD
G	Park7	parkinson protein 7		increases expression	ISO	5	168,050,149	168,061,616	RGD:6480464	CTD
G	Park7	parkinson protein 7		increases expression	ISO	5	168,050,149	168,061,616	RGD:6480464	CTD
G	Park7	parkinson protein 7		increases expression	EXP	5	168,050,149	168,061,616	RGD:6480464	CTD
G	Pip4k2c	phosphatidylinositol-5-phosphate 4-kinase, type II, gamma		increases expression	EXP	7	67,151,468	67,166,564	RGD:6480464	CTD
G	Plaur	plasminogen activator, urokinase receptor		affects expression	EXP	1	79,708,646	79,712,881	RGD:6480464	CTD
G	Ppard	peroxisome proliferator-activated receptor delta		increases expression	EXP	20	6,479,108	6,544,255	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Prg2	proteoglycan 2, bone marrow		increases expression	ISO	3	68,209,731	68,213,293	RGD:6480464	CTD
G	Prkag1	protein kinase, AMP-activated, gamma 1 non-catalytic subunit		increases expression	EXP	7	137,582,341	137,599,762	RGD:6480464	CTD
G	Prkcd	protein kinase C, delta		increases expression	EXP	16	5,954,218	5,975,743	RGD:6480464	CTD
G	Prnp	prion protein		increases expression	EXP	3	119,676,137	119,691,507	RGD:6480464	CTD
G	Psat1	phosphoserine aminotransferase 1		decreases expression	EXP	1	219,268,419	219,290,273	RGD:6480464	CTD
G	Ptgs1	prostaglandin-endoperoxide synthase 1		increases expression	ISO	3	15,343,832	15,365,412	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		increases expression	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Pura	purine rich element binding protein A		increases expression	EXP	18	28,916,722	28,925,008	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		increases expression	EXP	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Sfpq	splicing factor proline/glutamine-rich		decreases expression	EXP	5	146,460,306	146,469,289	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		affects activity	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		decreases activity	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Spp1	secreted phosphoprotein 1		increases expression	EXP				RGD:6480464	CTD
G	Srpk1	SRSF protein kinase 1		affects localization	ISO	20	6,829,410	6,870,877	RGD:6480464	CTD
G	Srpk2	SRSF protein kinase 2		affects localization	ISO	4	6,918,521	7,039,871	RGD:6480464	CTD
G	Srsf2	serine/arginine-rich splicing factor 2		multiple interactions	ISO	10	106,954,365	106,956,807	RGD:6480464	CTD
G	Srsf2	serine/arginine-rich splicing factor 2		decreases phosphorylation	ISO	10	106,954,365	106,956,807	RGD:6480464	CTD
G	Srsf2	serine/arginine-rich splicing factor 2		increases expression	ISO	10	106,954,365	106,956,807	RGD:6480464	CTD
G	Stxbp1	syntaxin binding protein 1		increases expression	EXP	3	11,762,105	11,825,531	RGD:6480464	CTD
G	Tfrc	transferrin receptor		decreases expression	EXP	11	69,976,258	69,998,098	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		increases expression	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb3	transforming growth factor, beta 3		increases expression	ISO	6	110,173,443	110,195,215	RGD:6480464	CTD
G	Tlr1	toll-like receptor 1		increases expression	ISO				RGD:6480464	CTD
G	Tlr6	toll-like receptor 6		increases expression	ISO	14	46,089,365	46,100,687	RGD:6480464	CTD
G	Tmem205	transmembrane protein 205		increases expression	EXP	8	21,024,232	21,029,968	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		increases expression	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Txnip	thioredoxin interacting protein		increases expression	EXP	2	191,356,954	191,360,757	RGD:6480464	CTD
G	Ube2b	ubiquitin-conjugating enzyme E2B		increases expression	EXP	10	37,509,322	37,523,900	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		affects expression	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
3-methyl-2-oxobutanoic acid
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Lepr	leptin receptor		affects abundance	ISO	5	122,320,075	122,503,449	RGD:6480464	CTD
G	Slco1a4	solute carrier organic anion transporter family, member 1a4		affects abundance	ISO				RGD:6480464	CTD
L-methionine
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Aard	alanine and arginine rich domain containing protein		multiple interactions	ISO	7	88,346,189	88,351,030	RGD:6480464	CTD
G	Abat	4-aminobutyrate aminotransferase		multiple interactions	ISO	10	7,040,725	7,137,154	RGD:6480464	CTD
G	Abca5	ATP-binding cassette, subfamily A (ABC1), member 5		multiple interactions	ISO	10	99,724,778	99,793,593	RGD:6480464	CTD
G	Abca8a	ATP-binding cassette, subfamily A (ABC1), member 8a		multiple interactions	ISO	10	99,477,700	99,544,364	RGD:6480464	CTD
G	Abcb10	ATP-binding cassette, subfamily B (MDR/TAP), member 10		multiple interactions	ISO	19	54,151,400	54,181,495	RGD:6480464	CTD
G	Abcb11	ATP-binding cassette, subfamily B (MDR/TAP), member 11		multiple interactions	ISO				RGD:6480464	CTD
G	Abcb1b	ATP-binding cassette, subfamily B (MDR/TAP), member 1B		multiple interactions	ISO	4	21,829,489	21,912,239	RGD:6480464	CTD
G	Abcc1	ATP-binding cassette, subfamily C (CFTR/MRP), member 1		multiple interactions	ISO	10	452,239	575,705	RGD:6480464	CTD
G	Abcc2	ATP-binding cassette, subfamily C (CFTR/MRP), member 2		multiple interactions	EXP				RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		multiple interactions	EXP	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc3	ATP-binding cassette, subfamily C (CFTR/MRP), member 3		multiple interactions	ISO	10	82,986,552	83,030,799	RGD:6480464	CTD
G	Abcc4	ATP-binding cassette, subfamily C (CFTR/MRP), member 4		multiple interactions	EXP	15	103,384,848	103,611,238	RGD:6480464	CTD
G	Abcc4	ATP-binding cassette, subfamily C (CFTR/MRP), member 4		multiple interactions	ISO	15	103,384,848	103,611,238	RGD:6480464	CTD
G	Abcc4	ATP-binding cassette, subfamily C (CFTR/MRP), member 4		multiple interactions	ISO	15	103,384,848	103,611,238	RGD:6480464	CTD
G	Abcc5	ATP-binding cassette, subfamily C (CFTR/MRP), member 5		multiple interactions	ISO	11	82,714,334	82,809,354	RGD:6480464	CTD
G	Abcg2	ATP-binding cassette, subfamily G (WHITE), member 2		multiple interactions	EXP	4	87,502,584	87,560,017	RGD:6480464	CTD
G	Abcg2	ATP-binding cassette, subfamily G (WHITE), member 2		multiple interactions	ISO	4	87,502,584	87,560,017	RGD:6480464	CTD
G	Abhd11	abhydrolase domain containing 11		multiple interactions	ISO				RGD:6480464	CTD
G	Abhd12	abhydrolase domain containing 12		multiple interactions	ISO	3	141,468,888	141,530,219	RGD:6480464	CTD
G	Abhd2	abhydrolase domain containing 2		multiple interactions	ISO	1	135,025,144	135,111,792	RGD:6480464	CTD
G	Ablim3	actin binding LIM protein family, member 3		multiple interactions	ISO	18	57,781,588	57,900,968	RGD:6480464	CTD
G	Abp1	amiloride binding protein 1 (amine oxidase, copper-containing)		multiple interactions	ISO	4	76,957,477	76,977,643	RGD:6480464	CTD
G	Abr	active BCR-related		multiple interactions	ISO	10	67,617,776	67,760,961	RGD:6480464	CTD
G	Abtb1	ankyrin repeat and BTB (POZ) domain containing 1		multiple interactions	ISO	4	122,930,404	122,936,631	RGD:6480464	CTD
G	Acaca	acetyl-CoA carboxylase alpha		multiple interactions	ISO	10	72,483,772	72,677,134	RGD:6480464	CTD
G	Acad9	acyl-CoA dehydrogenase family, member 9		multiple interactions	ISO	2	122,562,974	122,585,953	RGD:6480464	CTD
G	Acbd5	acyl-CoA binding domain containing 5		multiple interactions	ISO	17	96,677,365	96,716,091	RGD:6480464	CTD
G	Acbd6	acyl-CoA binding domain containing 6		multiple interactions	ISO	13	70,519,376	70,654,968	RGD:6480464	CTD
G	Acer2	alkaline ceramidase 2		multiple interactions	ISO	5	106,185,779	106,237,588	RGD:6480464	CTD
G	Acly	ATP citrate lyase		multiple interactions	ISO	10	89,420,934	89,471,398	RGD:6480464	CTD
G	Aco2	aconitase 2, mitochondrial		multiple interactions	ISO	7	120,223,788	120,266,944	RGD:6480464	CTD
G	Acot2	acyl-CoA thioesterase 2		multiple interactions	ISO	6	108,017,574	108,024,387	RGD:6480464	CTD
G	Acot5	acyl-CoA thioesterase 5		multiple interactions	ISO	6	108,114,686	108,122,769	RGD:6480464	CTD
G	Acot9	acyl-CoA thioesterase 9		multiple interactions	ISO	X	61,548,318	61,600,120	RGD:6480464	CTD
G	Acox1	acyl-CoA oxidase 1, palmitoyl		multiple interactions	ISO	10	106,281,977	106,319,382	RGD:6480464	CTD
G	Acox1	acyl-CoA oxidase 1, palmitoyl		multiple interactions	ISO	10	106,281,977	106,319,382	RGD:6480464	CTD
G	Acsl4	acyl-CoA synthetase long-chain family member 4		multiple interactions	ISO	X	36,168,547	36,232,162	RGD:6480464	CTD
G	Acss1	acyl-CoA synthetase short-chain family member 1		multiple interactions	ISO	3	141,259,016	141,308,871	RGD:6480464	CTD
G	Acta1	actin, alpha 1, skeletal muscle		multiple interactions	ISO	19	54,081,496	54,084,508	RGD:6480464	CTD
G	Actc1	actin, alpha, cardiac muscle 1		multiple interactions	ISO	3	99,901,022	99,906,558	RGD:6480464	CTD
G	Actr1a	ARP1 actin-related protein 1 homolog A, centractin alpha (yeast)		multiple interactions	ISO	1	251,592,429	251,611,097	RGD:6480464	CTD
G	Actr5	ARP5 actin-related protein 5 homolog (yeast)		multiple interactions	ISO	3	149,357,984	149,371,469	RGD:6480464	CTD
G	Acvr1c	activin A receptor, type IC		multiple interactions	ISO	3	40,027,228	40,102,303	RGD:6480464	CTD
G	Acvr2b	activin A receptor, type IIB		multiple interactions	ISO	8	124,364,330	124,395,748	RGD:6480464	CTD
G	Adam11	ADAM metallopeptidase domain 11		multiple interactions	ISO	10	91,881,174	91,896,961	RGD:6480464	CTD
G	Adam12	ADAM metallopeptidase domain 12		multiple interactions	ISO	1	193,384,457	193,650,892	RGD:6480464	CTD
G	Adam15	ADAM metallopeptidase domain 15		multiple interactions	ISO	2	181,527,175	181,537,640	RGD:6480464	CTD
G	Adam19	ADAM metallopeptidase domain 19		multiple interactions	ISO	10	31,190,242	31,282,773	RGD:6480464	CTD
G	Adam8	ADAM metallopeptidase domain 8		multiple interactions	ISO	1	199,780,772	199,791,855	RGD:6480464	CTD
G	Adamts15	ADAM metallopeptidase with thrombospondin type 1 motif, 15		multiple interactions	ISO	8	30,683,281	30,706,659	RGD:6480464	CTD
G	Adamts16	ADAM metallopeptidase with thrombospondin type 1 motif, 16		multiple interactions	ISO	17	2,559,771	2,690,663	RGD:6480464	CTD
G	Adamts2	ADAM metallopeptidase with thrombospondin type 1 motif, 2		multiple interactions	ISO	10	36,168,655	36,377,640	RGD:6480464	CTD
G	Adamts7	ADAM metallopeptidase with thrombospondin type 1 motif, 7		multiple interactions	ISO	8	95,068,562	95,108,273	RGD:6480464	CTD
G	Adamts9	ADAM metallopeptidase with thrombospondin type 1 motif, 9		multiple interactions	ISO	4	126,996,604	127,198,909	RGD:6480464	CTD
G	Adamtsl2	ADAMTS-like 2		multiple interactions	ISO	3	5,976,490	6,004,532	RGD:6480464	CTD
G	Adamtsl5	ADAMTS-like 5		multiple interactions	ISO	7	10,874,586	10,879,783	RGD:6480464	CTD
G	Adap2	ArfGAP with dual PH domains 2		multiple interactions	ISO	10	68,360,450	68,390,279	RGD:6480464	CTD
G	Adc	arginine decarboxylase		multiple interactions	ISO	5	148,100,546	148,110,453	RGD:6480464	CTD
G	Adcy2	adenylate cyclase 2 (brain)		multiple interactions	ISO	17	4,543,466	5,040,433	RGD:6480464	CTD
G	Adcy3	adenylate cyclase 3		multiple interactions	ISO	6	27,118,325	27,202,275	RGD:6480464	CTD
G	Adcy7	adenylate cyclase 7		multiple interactions	ISO	19	20,051,639	20,073,861	RGD:6480464	CTD
G	Add3	adducin 3 (gamma)		multiple interactions	ISO	1	259,347,673	259,455,407	RGD:6480464	CTD
G	Adh5	alcohol dehydrogenase 5 (class III), chi polypeptide		multiple interactions	ISO	2	235,979,108	235,991,515	RGD:6480464	CTD
G	Adh7	alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide		multiple interactions	ISO	2	235,749,346	235,765,063	RGD:6480464	CTD
G	Adhfe1	alcohol dehydrogenase, iron containing, 1		multiple interactions	ISO	5	9,276,929	9,303,483	RGD:6480464	CTD
G	Adipor2	adiponectin receptor 2		multiple interactions	ISO	4	155,664,035	155,677,627	RGD:6480464	CTD
G	Adnp2	ADNP homeobox 2		multiple interactions	ISO	18	77,017,502	77,041,570	RGD:6480464	CTD
G	Adora2b	adenosine A2B receptor		multiple interactions	ISO	10	48,421,592	48,437,967	RGD:6480464	CTD
G	Adprh	ADP-ribosylarginine hydrolase		multiple interactions	ISO	11	64,079,175	64,085,514	RGD:6480464	CTD
G	Adra2a	adrenoceptor alpha 2A		multiple interactions	ISO				RGD:6480464	CTD
G	Adrb2	adrenoceptor beta 2, surface		multiple interactions	ISO	18	58,174,958	58,177,000	RGD:6480464	CTD
G	Adrb3	adrenoceptor beta 3		multiple interactions	ISO	16	69,163,620	69,166,384	RGD:6480464	CTD
G	Adssl1	adenylosuccinate synthase like 1		multiple interactions	ISO				RGD:6480464	CTD
G	Aen	apoptosis enhancing nuclease		multiple interactions	ISO	1	134,615,998	134,625,367	RGD:6480464	CTD
G	Afg3l1	AFG3(ATPase family gene 3)-like 1 (S. cerevisiae)		multiple interactions	ISO	19	53,794,261	53,821,667	RGD:6480464	CTD
G	Afp	alpha-fetoprotein		multiple interactions	ISO	14	19,092,563	19,110,728	RGD:6480464	CTD
G	Agap2	ArfGAP with GTPase domain, ankyrin repeat and PH domain 2		multiple interactions	ISO	7	67,031,300	67,043,909	RGD:6480464	CTD
G	Agpat4	1-acylglycerol-3-phosphate O-acyltransferase 4		multiple interactions	ISO	1	42,986,809	43,096,390	RGD:6480464	CTD
G	Agtpbp1	ATP/GTP binding protein 1		multiple interactions	ISO	17	11,040,339	11,155,923	RGD:6480464	CTD
G	Ahcy	adenosylhomocysteinase		multiple interactions	ISO	3	145,544,834	145,560,058	RGD:6480464	CTD
G	Ahnak	AHNAK nucleoprotein		multiple interactions	ISO	1	211,662,523	211,692,558	RGD:6480464	CTD
G	Ahrr	aryl-hydrocarbon receptor repressor		multiple interactions	ISO	1	29,797,025	29,894,912	RGD:6480464	CTD
G	Aig1	androgen-induced 1		multiple interactions	ISO	1	8,456,587	8,688,694	RGD:6480464	CTD
G	Ak1	adenylate kinase 1		multiple interactions	ISO	2	19,821,482	19,822,544	RGD:6480464	CTD
G	Ak2	adenylate kinase 2		multiple interactions	ISO	5	148,156,751	148,176,195	RGD:6480464	CTD
G	Ak7	adenylate kinase 7		multiple interactions	ISO	6	129,861,499	129,933,903	RGD:6480464	CTD
G	Akap1	A kinase (PRKA) anchor protein 1		multiple interactions	ISO	10	77,262,592	77,276,832	RGD:6480464	CTD
G	Akap5	A kinase (PRKA) anchor protein 5		multiple interactions	ISO	6	98,923,105	98,928,505	RGD:6480464	CTD
G	Akna	AT-hook transcription factor		multiple interactions	ISO	5	80,329,462	80,368,061	RGD:6480464	CTD
G	Akr1b1	aldo-keto reductase family 1, member B1 (aldose reductase)		multiple interactions	ISO	4	61,645,438	61,659,530	RGD:6480464	CTD
G	Akr1b7	aldo-keto reductase family 1, member B7		multiple interactions	ISO	4	61,794,352	61,806,916	RGD:6480464	CTD
G	Akr1b8	aldo-keto reductase family 1, member B8		multiple interactions	ISO	4	61,714,282	61,726,856	RGD:6480464	CTD
G	Akr1c3	aldo-keto reductase family 1, member C3		multiple interactions	ISO	17	77,269,626	77,286,521	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		multiple interactions	EXP	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Aktip	AKT interacting protein		multiple interactions	ISO	19	17,035,220	17,045,096	RGD:6480464	CTD
G	Aldh18a1	aldehyde dehydrogenase 18 family, member A1		multiple interactions	ISO	1	245,685,979	245,718,198	RGD:6480464	CTD
G	Aldh1a3	aldehyde dehydrogenase 1 family, member A3		multiple interactions	ISO	1	120,847,746	120,881,883	RGD:6480464	CTD
G	Aldh1l2	aldehyde dehydrogenase 1 family, member L2		multiple interactions	ISO	7	22,398,067	22,450,381	RGD:6480464	CTD
G	Aldh2	aldehyde dehydrogenase 2 family (mitochondrial)		multiple interactions	ISO	12	36,081,778	36,116,445	RGD:6480464	CTD
G	Aldh2	aldehyde dehydrogenase 2 family (mitochondrial)		multiple interactions	ISO	12	36,081,778	36,116,445	RGD:6480464	CTD
G	Aldh3b1	aldehyde dehydrogenase 3 family, member B1		multiple interactions	ISO	1	206,438,325	206,455,477	RGD:6480464	CTD
G	Aldh3b2	aldehyde dehydrogenase 3 family, member B2		multiple interactions	ISO	1	206,549,529	206,553,424	RGD:6480464	CTD
G	Aldh4a1	aldehyde dehydrogenase 4 family, member A1		multiple interactions	ISO	5	158,437,691	158,453,827	RGD:6480464	CTD
G	Aldh7a1	aldehyde dehydrogenase 7 family, member A1		multiple interactions	ISO	18	52,300,899	52,333,149	RGD:6480464	CTD
G	Aldh9a1	aldehyde dehydrogenase 9 family, member A1		multiple interactions	ISO	13	83,017,312	83,034,047	RGD:6480464	CTD
G	Alk	anaplastic lymphoma receptor tyrosine kinase		multiple interactions	ISO	6	23,009,061	23,730,939	RGD:6480464	CTD
G	Alox5	arachidonate 5-lipoxygenase		multiple interactions	ISO	4	152,610,283	152,657,891	RGD:6480464	CTD
G	Alox5ap	arachidonate 5-lipoxygenase activating protein		multiple interactions	ISO	12	6,245,808	6,269,796	RGD:6480464	CTD
G	Alx3	ALX homeobox 3		multiple interactions	ISO	2	203,156,009	203,157,503	RGD:6480464	CTD
G	Amn	amnion associated transmembrane protein		multiple interactions	ISO	6	136,031,478	136,038,919	RGD:6480464	CTD
G	Amotl1	angiomotin-like 1		multiple interactions	ISO	8	11,296,503	11,392,970	RGD:6480464	CTD
G	Anapc5	anaphase-promoting complex subunit 5		multiple interactions	ISO	12	34,850,485	34,884,726	RGD:6480464	CTD
G	Angptl6	angiopoietin-like 6		multiple interactions	ISO	8	19,899,121	19,905,696	RGD:6480464	CTD
G	Ank2	ankyrin 2, neuronal		multiple interactions	ISO	2	224,182,431	224,501,751	RGD:6480464	CTD
G	Ankhd1	ankyrin repeat and KH domain containing 1		multiple interactions	ISO				RGD:6480464	CTD
G	Ankle1	ankyrin repeat and LEM domain containing 1		multiple interactions	ISO	16	18,565,676	18,569,219	RGD:6480464	CTD
G	Ankrd1	ankyrin repeat domain 1		multiple interactions	ISO	1	240,316,123	240,324,804	RGD:6480464	CTD
G	Ankrd12	ankyrin repeat domain 12		multiple interactions	ISO	9	104,746,476	104,823,263	RGD:6480464	CTD
G	Ankrd13b	ankyrin repeat domain 13B		multiple interactions	ISO	10	66,628,069	66,646,674	RGD:6480464	CTD
G	Ankrd16	ankyrin repeat domain 16		multiple interactions	ISO	17	77,930,658	77,943,867	RGD:6480464	CTD
G	Ankrd27	ankyrin repeat domain 27 (VPS9 domain)		multiple interactions	ISO	1	88,117,683	88,139,762	RGD:6480464	CTD
G	Ankrd34a	ankyrin repeat domain 34A		multiple interactions	ISO	2	191,395,509	191,398,939	RGD:6480464	CTD
G	Ankrd34b	ankyrin repeat domain 34B		multiple interactions	ISO	2	22,663,047	22,678,969	RGD:6480464	CTD
G	Anks3	ankyrin repeat and sterile alpha motif domain containing 3		multiple interactions	ISO	10	10,732,109	10,752,778	RGD:6480464	CTD
G	Anks6	ankyrin repeat and sterile alpha motif domain containing 6		multiple interactions	ISO	5	63,633,540	63,674,953	RGD:6480464	CTD
G	Ano1	anoctamin 1, calcium activated chloride channel		multiple interactions	ISO	1	205,018,529	205,166,049	RGD:6480464	CTD
G	Ano10	anoctamin 10		multiple interactions	ISO	8	121,978,317	122,095,649	RGD:6480464	CTD
G	Ano2	anoctamin 2		multiple interactions	ISO	4	161,859,827	162,057,876	RGD:6480464	CTD
G	Ano6	anoctamin 6		multiple interactions	ISO	7	134,434,775	134,624,126	RGD:6480464	CTD
G	Ano7	anoctamin 7		multiple interactions	ISO	9	92,655,567	92,683,022	RGD:6480464	CTD
G	Anp32b	acidic (leucine-rich) nuclear phosphoprotein 32 family, member B		multiple interactions	ISO	5	63,044,718	63,058,038	RGD:6480464	CTD
G	Antxr1	anthrax toxin receptor 1		multiple interactions	ISO	4	121,297,955	121,483,876	RGD:6480464	CTD
G	Antxr2	anthrax toxin receptor 2		multiple interactions	ISO	14	12,875,632	13,107,975	RGD:6480464	CTD
G	Anxa1	annexin A1		multiple interactions	ISO	1	223,478,436	223,494,455	RGD:6480464	CTD
G	Anxa11	annexin A11		multiple interactions	ISO	16	1,449,907	1,496,053	RGD:6480464	CTD
G	Anxa13	annexin A13		multiple interactions	ISO	7	95,071,045	95,123,201	RGD:6480464	CTD
G	Anxa2	annexin A2		multiple interactions	ISO	8	73,897,618	73,934,041	RGD:6480464	CTD
G	Anxa3	annexin A3		multiple interactions	ISO	14	14,245,112	14,297,100	RGD:6480464	CTD
G	Anxa5	annexin A5		multiple interactions	ISO	2	122,949,210	122,979,757	RGD:6480464	CTD
G	Aoah	acyloxyacyl hydrolase (neutrophil)		multiple interactions	ISO	17	51,475,254	51,722,447	RGD:6480464	CTD
G	Ap1g1	adaptor-related protein complex 1, gamma 1 subunit		multiple interactions	ISO	19	39,676,021	39,734,854	RGD:6480464	CTD
G	Ap1m2	adaptor-related protein complex 1, mu 2 subunit		multiple interactions	ISO	8	20,385,982	20,396,146	RGD:6480464	CTD
G	Ap1s2	adaptor-related protein complex 1, sigma 2 subunit		multiple interactions	ISO	X	51,329,574	51,356,406	RGD:6480464	CTD
G	Ap3b1	adaptor-related protein complex 3, beta 1 subunit		multiple interactions	ISO	2	24,670,078	24,872,770	RGD:6480464	CTD
G	Ap3m2	adaptor-related protein complex 3, mu 2 subunit		multiple interactions	ISO	16	73,687,443	73,704,278	RGD:6480464	CTD
G	Ap4e1	adaptor-related protein complex 4, epsilon 1 subunit		multiple interactions	ISO	3	114,550,205	114,615,150	RGD:6480464	CTD
G	Apaf1	apoptotic peptidase activating factor 1		multiple interactions	ISO	7	27,932,908	28,020,533	RGD:6480464	CTD
G	Apbb1ip	amyloid beta (A4) precursor protein-binding, family B, member 1 interacting protein		multiple interactions	ISO	17	96,476,962	96,527,635	RGD:6480464	CTD
G	Apcdd1	adenomatosis polyposis coli down-regulated 1		multiple interactions	ISO	18	59,088,709	59,091,205	RGD:6480464	CTD
G	Apcs	amyloid P component, serum		multiple interactions	ISO	13	89,112,845	89,113,641	RGD:6480464	CTD
G	Aph1a	anterior pharynx defective 1 homolog A (C. elegans)		multiple interactions	ISO	2	190,679,692	190,683,202	RGD:6480464	CTD
G	Aph1b	anterior pharynx defective 1 homolog B (C. elegans)		multiple interactions	ISO	8	71,122,681	71,143,726	RGD:6480464	CTD
G	Apoa4	apolipoprotein A-IV		multiple interactions	ISO	8	49,233,142	49,233,431	RGD:6480464	CTD
G	Apobr	apolipoprotein B receptor		multiple interactions	ISO	1	185,726,047	185,730,550	RGD:6480464	CTD
G	App	amyloid beta (A4) precursor protein		multiple interactions	ISO	11	24,457,855	24,693,851	RGD:6480464	CTD
G	Appl2	adaptor protein, phosphotyrosine interaction, PH domain and leucine zipper containing 2		multiple interactions	ISO	7	22,279,273	22,328,427	RGD:6480464	CTD
G	Aqp3	aquaporin 3		multiple interactions	ISO	5	58,501,642	58,507,159	RGD:6480464	CTD
G	Aqp4	aquaporin 4		multiple interactions	ISO	18	6,626,313	6,642,766	RGD:6480464	CTD
G	Aqp5	aquaporin 5		multiple interactions	ISO	7	138,337,725	138,341,257	RGD:6480464	CTD
G	Aqp7	aquaporin 7		multiple interactions	ISO	5	58,433,731	58,447,853	RGD:6480464	CTD
G	Aqp9	aquaporin 9		multiple interactions	ISO	8	75,611,485	75,651,646	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Arc	activity-regulated cytoskeleton-associated protein		multiple interactions	ISO	7	112,771,937	112,775,381	RGD:6480464	CTD
G	Areg	amphiregulin		multiple interactions	ISO	14	18,466,313	18,475,571	RGD:6480464	CTD
G	Arf1	ADP-ribosylation factor 1		multiple interactions	ISO	10	45,516,609	45,532,091	RGD:6480464	CTD
G	Arg1	arginase, liver		multiple interactions	ISO	1	20,998,894	21,011,275	RGD:6480464	CTD
G	Arhgap10	Rho GTPase activating protein 10		multiple interactions	ISO	19	32,261,771	32,521,913	RGD:6480464	CTD
G	Arhgap15	Rho GTPase activating protein 15		multiple interactions	ISO	3	24,256,620	24,389,618	RGD:6480464	CTD
G	Arhgap22	Rho GTPase activating protein 22		multiple interactions	ISO	16	8,863,537	8,913,459	RGD:6480464	CTD
G	Arhgap25	Rho GTPase activating protein 25		multiple interactions	ISO	4	121,620,926	121,700,835	RGD:6480464	CTD
G	Arhgap26	Rho GTPase activating protein 26		multiple interactions	ISO	18	31,934,753	32,327,551	RGD:6480464	CTD
G	Arhgap30	Rho GTPase activating protein 30		multiple interactions	ISO	13	87,295,074	87,335,018	RGD:6480464	CTD
G	Arhgap31	Rho GTPase activating protein 31		multiple interactions	ISO	11	63,814,916	63,929,011	RGD:6480464	CTD
G	Arhgap9	Rho GTPase activating protein 9		multiple interactions	ISO	7	67,280,267	67,288,390	RGD:6480464	CTD
G	Arhgdia	Rho GDP dissociation inhibitor (GDI) alpha		multiple interactions	ISO	10	109,967,771	109,971,260	RGD:6480464	CTD
G	Arhgdia	Rho GDP dissociation inhibitor (GDI) alpha		multiple interactions	ISO	10	109,967,771	109,971,260	RGD:6480464	CTD
G	Arhgef2	rho/rac guanine nucleotide exchange factor (GEF) 2		multiple interactions	ISO	2	180,748,313	180,775,656	RGD:6480464	CTD
G	Arhgef6	Rac/Cdc42 guanine nucleotide exchange factor (GEF) 6		multiple interactions	ISO	X	141,946,362	142,068,557	RGD:6480464	CTD
G	Arhgef7	Rho guanine nucleotide exchange factor (GEF) 7		multiple interactions	ISO	16	82,521,224	82,603,338	RGD:6480464	CTD
G	Arid1a	AT rich interactive domain 1A (SWI-like)		multiple interactions	ISO	5	151,355,617	151,398,647	RGD:6480464	CTD
G	Arid1b	AT rich interactive domain 1B (Swi1 like)		multiple interactions	ISO	1	40,012,872	40,324,266	RGD:6480464	CTD
G	Arid3a	AT rich interactive domain 3A (Bright like)		multiple interactions	ISO	7	11,269,055	11,290,551	RGD:6480464	CTD
G	Arid4a	AT rich interactive domain 4A (Rbp1 like)		multiple interactions	ISO	6	93,130,856	93,201,927	RGD:6480464	CTD
G	Arl10	ADP-ribosylation factor-like 10		multiple interactions	ISO	17	16,094,098	16,100,342	RGD:6480464	CTD
G	Arl11	ADP-ribosylation factor-like 11		multiple interactions	ISO	15	40,458,780	40,460,926	RGD:6480464	CTD
G	Arl2	ADP-ribosylation factor-like 2		multiple interactions	ISO	1	208,909,458	208,921,401	RGD:6480464	CTD
G	Arl4a	ADP-ribosylation factor-like 4A		multiple interactions	ISO	6	59,212,599	59,214,609	RGD:6480464	CTD
G	Arl5c	ADP-ribosylation factor-like 5C		multiple interactions	ISO	10	86,751,321	86,758,083	RGD:6480464	CTD
G	Arl6ip4	ADP-ribosylation-like factor 6 interacting protein 4		multiple interactions	ISO	12	33,603,784	33,605,929	RGD:6480464	CTD
G	Arl8a	ADP-ribosylation factor-like 8A		multiple interactions	ISO	13	48,108,242	48,117,244	RGD:6480464	CTD
G	Armc1	armadillo repeat containing 1		multiple interactions	ISO	2	104,228,985	104,273,611	RGD:6480464	CTD
G	Armcx3	armadillo repeat containing, X-linked 3		multiple interactions	ISO	X	122,217,524	122,221,077	RGD:6480464	CTD
G	Arnt2	aryl hydrocarbon receptor nuclear translocator 2		multiple interactions	ISO	1	140,535,823	140,646,838	RGD:6480464	CTD
G	Arpc5l	actin related protein 2/3 complex, subunit 5-like		multiple interactions	ISO	3	18,798,930	18,801,987	RGD:6480464	CTD
G	Arsg	arylsulfatase G		multiple interactions	ISO	10	98,754,633	98,833,808	RGD:6480464	CTD
G	Art4	ADP-ribosyltransferase 4 (Dombrock blood group)		multiple interactions	ISO	4	173,884,317	173,893,756	RGD:6480464	CTD
G	Arvcf	armadillo repeat gene deleted in velo-cardio-facial syndrome		multiple interactions	ISO	11	84,582,208	84,639,874	RGD:6480464	CTD
G	Asah2	N-acylsphingosine amidohydrolase (non-lysosomal ceramidase) 2		multiple interactions	ISO	1	236,000,768	236,072,477	RGD:6480464	CTD
G	Asb11	ankyrin repeat and SOCS box-containing 11		multiple interactions	ISO	X	50,771,241	50,793,101	RGD:6480464	CTD
G	Asb13	ankyrin repeat and SOCS box-containing 13		multiple interactions	ISO	17	77,759,058	77,777,760	RGD:6480464	CTD
G	Asb18	ankyrin repeat and SOCS box-containing 18		multiple interactions	ISO	9	89,056,520	89,122,413	RGD:6480464	CTD
G	Asb4	ankyrin repeat and SOCS box-containing 4		multiple interactions	ISO	4	30,150,502	30,188,132	RGD:6480464	CTD
G	Ash2l	ash2 (absent, small, or homeotic)-like (Drosophila)		multiple interactions	ISO	16	70,617,717	70,639,166	RGD:6480464	CTD
G	Asic2	acid-sensing (proton-gated) ion channel 2		multiple interactions	ISO	10	69,103,244	70,190,305	RGD:6480464	CTD
G	Asns	asparagine synthetase (glutamine-hydrolyzing)		multiple interactions	ISO	4	32,758,866	32,776,220	RGD:6480464	CTD
G	Asph	aspartate-beta-hydroxylase		multiple interactions	ISO	5	23,495,780	23,520,672	RGD:6480464	CTD
G	Asrgl1	asparaginase like 1		multiple interactions	ISO	1	211,788,145	211,808,943	RGD:6480464	CTD
G	Ass1	argininosuccinate synthase 1		multiple interactions	ISO	3	10,578,717	10,622,332	RGD:6480464	CTD
G	Asxl1	additional sex combs like 1		multiple interactions	ISO	3	143,703,295	143,767,523	RGD:6480464	CTD
G	Asxl2	additional sex combs like 2 (Drosophila)		multiple interactions	ISO	6	26,400,855	26,482,465	RGD:6480464	CTD
G	Ate1	arginyltransferase 1		multiple interactions	ISO	1	189,718,854	189,835,976	RGD:6480464	CTD
G	Atf2	activating transcription factor 2		multiple interactions	ISO	3	56,403,676	56,496,473	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		multiple interactions	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atf5	activating transcription factor 5		multiple interactions	ISO	1	95,284,505	95,286,786	RGD:6480464	CTD
G	Atf6b	activating transcription factor 6 beta		multiple interactions	ISO	20	4,192,185	4,200,036	RGD:6480464	CTD
G	Atg3	autophagy related 3		multiple interactions	ISO	11	57,162,205	57,190,568	RGD:6480464	CTD
G	Atn1	atrophin 1		multiple interactions	ISO	4	160,872,360	160,886,205	RGD:6480464	CTD
G	Atp10a	ATPase, class V, type 10A		multiple interactions	ISO	1	110,175,554	110,360,215	RGD:6480464	CTD
G	Atp11b	ATPase, class VI, type 11B		multiple interactions	ISO	2	122,139,635	122,306,306	RGD:6480464	CTD
G	Atp1a2	ATPase, Na+/K+ transporting, alpha 2 polypeptide		multiple interactions	ISO	13	88,258,993	88,283,918	RGD:6480464	CTD
G	Atp1a3	ATPase, Na+/K+ transporting, alpha 3 polypeptide		multiple interactions	ISO	1	80,280,714	80,309,834	RGD:6480464	CTD
G	Atp1b1	ATPase, Na+/K+ transporting, beta 1 polypeptide		multiple interactions	ISO	13	80,214,056	80,234,576	RGD:6480464	CTD
G	Atp2a2	ATPase, Ca++ transporting, cardiac muscle, slow twitch 2		multiple interactions	ISO	12	35,266,600	35,316,237	RGD:6480464	CTD
G	Atp2b2	ATPase, Ca++ transporting, plasma membrane 2		multiple interactions	ISO	4	149,655,651	149,907,813	RGD:6480464	CTD
G	Atp5b	ATP synthase, H+ transporting, mitochondrial F1 complex, beta polypeptide		multiple interactions	ISO	7	1,376,552	1,383,228	RGD:6480464	CTD
G	Atp5d	ATP synthase, H+ transporting, mitochondrial F1 complex, delta subunit		multiple interactions	ISO	7	11,072,820	11,075,906	RGD:6480464	CTD
G	Atp6v0a1	ATPase, H+ transporting, lysosomal V0 subunit A1		multiple interactions	ISO	10	89,948,286	90,072,304	RGD:6480464	CTD
G	Atp6v0c	ATPase, H+ transporting, lysosomal V0 subunit C		multiple interactions	ISO	10	13,415,671	13,420,715	RGD:6480464	CTD
G	Atp6v0d2	ATPase, H+ transporting, lysosomal V0 subunit D2		multiple interactions	ISO	5	34,476,045	34,524,995	RGD:6480464	CTD
G	Atp6v0e2	ATPase, H+ transporting V0 subunit e2		multiple interactions	ISO	4	76,621,828	76,624,976	RGD:6480464	CTD
G	Atp6v1c2	ATPase, H+ transporting, lysosomal V1 subunit C2		multiple interactions	ISO				RGD:6480464	CTD
G	Atp8b1	ATPase, aminophospholipid transporter, class I, type 8B, member 1		multiple interactions	ISO	18	60,748,738	60,829,650	RGD:6480464	CTD
G	Atpif1	ATPase inhibitory factor 1		multiple interactions	ISO	5	152,618,307	152,622,024	RGD:6480464	CTD
G	Atrnl1	attractin like 1		multiple interactions	ISO	1	263,919,358	264,486,579	RGD:6480464	CTD
G	Atxn7l2	ataxin 7-like 2		multiple interactions	ISO	2	203,767,580	203,776,399	RGD:6480464	CTD
G	Aurkb	aurora kinase B		multiple interactions	ISO	10	55,798,710	55,804,367	RGD:6480464	CTD
G	Avpi1	arginine vasopressin-induced 1		multiple interactions	ISO	1	248,727,385	248,733,112	RGD:6480464	CTD
G	Axin2	axin 2		multiple interactions	ISO	10	98,294,466	98,321,830	RGD:6480464	CTD
G	Azin1	antizyme inhibitor 1		multiple interactions	ISO	7	74,159,130	74,189,447	RGD:6480464	CTD
G	B3galnt1	beta-1,3-N-acetylgalactosaminyltransferase 1 (globoside blood group)		multiple interactions	ISO	2	159,670,705	159,701,464	RGD:6480464	CTD
G	B3galt4	UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 4		multiple interactions	ISO	20	5,087,855	5,089,430	RGD:6480464	CTD
G	B3galt6	UDP-Gal:betaGal beta 1,3-galactosyltransferase, polypeptide 6		multiple interactions	ISO	5	172,833,647	172,835,783	RGD:6480464	CTD
G	B3gnt2	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 2		multiple interactions	ISO	14	103,499,471	103,524,296	RGD:6480464	CTD
G	B3gnt8	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 8		multiple interactions	ISO	1	80,834,562	80,837,461	RGD:6480464	CTD
G	B4galnt1	beta-1,4-N-acetyl-galactosaminyl transferase 1		multiple interactions	ISO	7	67,120,782	67,127,697	RGD:6480464	CTD
G	B4galnt4	beta-1,4-N-acetyl-galactosaminyl transferase 4		multiple interactions	ISO	1	201,260,278	201,271,175	RGD:6480464	CTD
G	B4galt2	UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 2		multiple interactions	ISO	5	138,338,706	138,347,177	RGD:6480464	CTD
G	B4galt6	UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 6		multiple interactions	ISO	18	12,421,062	12,478,276	RGD:6480464	CTD
G	B9d1	B9 protein domain 1		multiple interactions	ISO	10	47,665,630	47,673,227	RGD:6480464	CTD
G	Bace1	beta-site APP cleaving enzyme 1		multiple interactions	ISO	8	48,817,824	48,839,681	RGD:6480464	CTD
G	Bach2	BTB and CNC homology 1, basic leucine zipper transcription factor 2		multiple interactions	ISO	5	48,611,805	48,881,943	RGD:6480464	CTD
G	Bag6	BCL2-associated athanogene 6		multiple interactions	ISO	20	3,739,593	3,752,311	RGD:6480464	CTD
G	Bahcc1	BAH domain and coiled-coil containing 1		multiple interactions	ISO	10	109,726,243	109,735,724	RGD:6480464	CTD
G	Bahd1	bromo adjacent homology domain containing 1		multiple interactions	ISO	3	105,429,028	105,437,536	RGD:6480464	CTD
G	Bai1	brain-specific angiogenesis inhibitor 1		multiple interactions	ISO	7	112,622,235	112,682,897	RGD:6480464	CTD
G	Bai2	brain-specific angiogenesis inhibitor 2		multiple interactions	ISO	5	149,014,053	149,046,244	RGD:6480464	CTD
G	Baiap2	BAI1-associated protein 2		multiple interactions	ISO	10	109,351,201	109,413,703	RGD:6480464	CTD
G	Bambi	BMP and activin membrane-bound inhibitor, homolog (Xenopus laevis)		multiple interactions	ISO	17	62,654,385	62,658,641	RGD:6480464	CTD
G	Bap1	BRCA1 associated protein-1 (ubiquitin carboxy-terminal hydrolase)		multiple interactions	ISO	16	6,684,470	6,693,296	RGD:6480464	CTD
G	Barhl2	BarH-like homeobox 2		multiple interactions	ISO	14	3,888,153	3,893,050	RGD:6480464	CTD
G	Barx1	BARX homeobox 1		multiple interactions	ISO	17	21,993,765	21,997,240	RGD:6480464	CTD
G	Barx2	BARX homeobox 2		multiple interactions	ISO	8	31,572,341	31,659,306	RGD:6480464	CTD
G	Batf	basic leucine zipper transcription factor, ATF-like		multiple interactions	ISO	6	109,793,076	109,817,614	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		increases expression	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Baz1b	bromodomain adjacent to zinc finger domain, 1B		multiple interactions	ISO	12	22,586,411	22,644,378	RGD:6480464	CTD
G	Baz2a	bromodomain adjacent to zinc finger domain, 2A		multiple interactions	ISO	7	1,389,681	1,421,170	RGD:6480464	CTD
G	Bbc3	Bcl-2 binding component 3		multiple interactions	ISO				RGD:6480464	CTD
G	Bbs4	Bardet-Biedl syndrome 4		multiple interactions	ISO	8	63,153,456	63,189,904	RGD:6480464	CTD
G	Bcam	basal cell adhesion molecule (Lutheran blood group)		multiple interactions	ISO	1	79,067,352	79,081,739	RGD:6480464	CTD
G	Bcan	brevican		multiple interactions	ISO	2	180,067,864	180,080,942	RGD:6480464	CTD
G	Bcar1	breast cancer anti-estrogen resistance 1		multiple interactions	ISO	19	41,646,190	41,669,234	RGD:6480464	CTD
G	Bcar3	breast cancer anti-estrogen resistance 3		multiple interactions	ISO	2	219,075,206	219,188,344	RGD:6480464	CTD
G	Bcdin3d	BCDIN3 domain containing		multiple interactions	ISO	7	138,218,542	138,223,136	RGD:6480464	CTD
G	Bcl11a	B-cell CLL/lymphoma 11A (zinc finger protein)		multiple interactions	ISO	14	105,002,744	105,088,365	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		decreases expression	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	ISO	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2a1	BCL2-related protein A1		multiple interactions	ISO	8	94,045,109	94,053,777	RGD:6480464	CTD
G	Bcl2l14	Bcl2-like 14 (apoptosis facilitator)		multiple interactions	ISO	4	171,283,106	171,325,345	RGD:6480464	CTD
G	Bcl2l2	Bcl2-like 2		multiple interactions	ISO	15	32,983,165	32,988,018	RGD:6480464	CTD
G	Bclaf1	BCL2-associated transcription factor 1		multiple interactions	ISO	1	15,605,220	15,632,005	RGD:6480464	CTD
G	Bcor	BCL6 co-repressor		multiple interactions	ISO	X	22,699,778	22,820,234	RGD:6480464	CTD
G	Bcorl1	BCL6 co-repressor-like 1		multiple interactions	ISO	X	134,755,840	134,802,339	RGD:6480464	CTD
G	Bdnf	brain-derived neurotrophic factor		multiple interactions	ISO				RGD:6480464	CTD
G	Becn1	beclin 1, autophagy related		multiple interactions	ISO	10	90,317,957	90,333,329	RGD:6480464	CTD
G	Best1	bestrophin 1		multiple interactions	ISO	1	212,432,811	212,449,374	RGD:6480464	CTD
G	Bex1	brain expressed, X-linked 1		multiple interactions	ISO	X	123,527,737	123,529,133	RGD:6480464	CTD
G	Bex2	brain expressed X-linked 2		multiple interactions	ISO	X	123,322,594	123,324,122	RGD:6480464	CTD
G	Bex4	brain expressed, X-linked 4		multiple interactions	ISO	X	123,442,511	123,443,772	RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		multiple interactions	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bhlha15	basic helix-loop-helix family, member a15		multiple interactions	ISO	12	10,747,865	10,752,041	RGD:6480464	CTD
G	Bhlhb9	basic helix-loop-helix domain containing, class B, 9		multiple interactions	ISO	X	123,149,086	123,151,846	RGD:6480464	CTD
G	Bhlhe41	basic helix-loop-helix family, member e41		multiple interactions	ISO				RGD:6480464	CTD
G	Bhmt	betaine-homocysteine S-methyltransferase		multiple interactions	ISO	2	23,923,651	23,943,320	RGD:6480464	CTD
G	Bhmt2	betaine-homocysteine S-methyltransferase 2		multiple interactions	ISO	2	23,958,062	23,976,438	RGD:6480464	CTD
G	Bicc1	bicaudal C homolog 1 (Drosophila)		multiple interactions	ISO	20	18,288,079	18,477,016	RGD:6480464	CTD
G	Bin1	bridging integrator 1		multiple interactions	ISO	18	24,813,407	24,872,852	RGD:6480464	CTD
G	Blnk	B-cell linker		multiple interactions	ISO	1	246,091,335	246,165,075	RGD:6480464	CTD
G	Bmp4	bone morphogenetic protein 4		multiple interactions	ISO	15	22,283,171	22,286,757	RGD:6480464	CTD
G	Bmper	BMP-binding endothelial regulator		multiple interactions	ISO	8	22,975,570	23,096,066	RGD:6480464	CTD
G	Bmpr2	bone morphogenetic protein receptor, type II (serine/threonine kinase)		multiple interactions	ISO	9	58,327,587	58,436,057	RGD:6480464	CTD
G	Bms1	BMS1 homolog, ribosome assembly protein (yeast)		multiple interactions	ISO	4	154,687,169	154,721,783	RGD:6480464	CTD
G	Bnc1	basonuclin 1		multiple interactions	ISO	1	138,189,334	138,201,795	RGD:6480464	CTD
G	Bnip1	BCL2/adenovirus E1B interacting protein 1		multiple interactions	ISO	10	16,648,619	16,660,896	RGD:6480464	CTD
G	Bphl	biphenyl hydrolase-like (serine hydrolase)		multiple interactions	ISO	17	37,143,275	37,181,166	RGD:6480464	CTD
G	Brca1	breast cancer 1, early onset		multiple interactions	ISO	10	90,513,630	90,572,676	RGD:6480464	CTD
G	Brca2	breast cancer 2, early onset		multiple interactions	ISO	12	4,282,952	4,323,693	RGD:6480464	CTD
G	Brd3	bromodomain containing 3		multiple interactions	ISO	3	6,369,903	6,390,116	RGD:6480464	CTD
G	Brms1	breast cancer metastasis-suppressor 1		multiple interactions	ISO	1	207,661,537	207,670,801	RGD:6480464	CTD
G	Brsk2	BR serine/threonine kinase 2		multiple interactions	ISO	1	202,083,095	202,133,268	RGD:6480464	CTD
G	Bspry	B-box and SPRY domain containing		multiple interactions	ISO	5	79,471,061	79,493,239	RGD:6480464	CTD
G	Btg2	BTG family, member 2		multiple interactions	ISO	13	47,026,986	47,030,745	RGD:6480464	CTD
G	Btg3	BTG family, member 3		multiple interactions	ISO	11	17,241,627	17,257,740	RGD:6480464	CTD
G	Btk	Bruton agammaglobulinemia tyrosine kinase		multiple interactions	ISO	X	121,998,935	122,030,289	RGD:6480464	CTD
G	Btn1a1	butyrophilin, subfamily 1, member A1		multiple interactions	ISO	17	48,856,129	48,863,883	RGD:6480464	CTD
G	Bub1	BUB1 mitotic checkpoint serine/threonine kinase		multiple interactions	ISO	3	115,323,510	115,354,906	RGD:6480464	CTD
G	Bub1b	BUB1 mitotic checkpoint serine/threonine kinase B		multiple interactions	ISO	3	105,063,018	105,116,145	RGD:6480464	CTD
G	Bves	blood vessel epicardial substance		multiple interactions	ISO	20	49,671,174	49,671,683	RGD:6480464	CTD
G	Bzw1	basic leucine zipper and W2 domains 1		multiple interactions	ISO	9	57,053,423	57,065,699	RGD:6480464	CTD
G	Bzw2	basic leucine zipper and W2 domains 2		multiple interactions	ISO	6	54,817,673	54,881,310	RGD:6480464	CTD
G	C1qb	complement component 1, q subcomponent, B chain		multiple interactions	ISO	5	155,647,524	155,653,074	RGD:6480464	CTD
G	C1qtnf4	C1q and tumor necrosis factor related protein 4		multiple interactions	ISO	3	75,248,277	75,252,715	RGD:6480464	CTD
G	C1qtnf6	C1q and tumor necrosis factor related protein 6		multiple interactions	ISO	7	116,479,791	116,486,309	RGD:6480464	CTD
G	C1qtnf7	C1q and tumor necrosis factor related protein 7		multiple interactions	ISO	14	72,631,465	72,645,084	RGD:6480464	CTD
G	C1r	complement component 1, r subcomponent		multiple interactions	ISO	4	160,712,582	160,729,362	RGD:6480464	CTD
G	C1s	complement component 1, s subcomponent		multiple interactions	ISO	4	160,736,133	160,748,133	RGD:6480464	CTD
G	C3ar1	complement component 3a receptor 1		multiple interactions	ISO	4	159,326,402	159,333,433	RGD:6480464	CTD
G	C4b	complement component 4B (Chido blood group)		multiple interactions	ISO	20	4,300,687	4,315,882	RGD:6480464	CTD
G	Ca10	carbonic anhydrase 10		multiple interactions	ISO	10	81,756,486	82,238,335	RGD:6480464	CTD
G	Ca2	carbonic anhydrase 2		multiple interactions	ISO	2	88,077,095	88,092,223	RGD:6480464	CTD
G	Cabin1	calcineurin binding protein 1		multiple interactions	ISO	20	13,444,801	13,569,453	RGD:6480464	CTD
G	Cables2	Cdk5 and Abl enzyme substrate 2		multiple interactions	ISO	3	169,312,295	169,327,016	RGD:6480464	CTD
G	Cacna1a	calcium channel, voltage-dependent, P/Q type, alpha 1A subunit		multiple interactions	ISO	19	25,188,170	25,424,495	RGD:6480464	CTD
G	Cacna1b	calcium channel, voltage-dependent, N type, alpha 1B subunit		multiple interactions	ISO	3	2,842,948	3,039,747	RGD:6480464	CTD
G	Cacna1g	calcium channel, voltage-dependent, T type, alpha 1G subunit		multiple interactions	ISO	10	83,043,636	83,112,886	RGD:6480464	CTD
G	Cacna2d1	calcium channel, voltage-dependent, alpha2/delta subunit 1		multiple interactions	ISO	4	15,139,881	15,566,740	RGD:6480464	CTD
G	Cacnb2	calcium channel, voltage-dependent, beta 2 subunit		multiple interactions	ISO	17	88,832,905	89,078,870	RGD:6480464	CTD
G	Cacnb3	calcium channel, voltage-dependent, beta 3 subunit		multiple interactions	ISO	7	137,384,752	137,394,283	RGD:6480464	CTD
G	Cadps	Ca++-dependent secretion activator		multiple interactions	ISO	15	13,859,286	14,319,814	RGD:6480464	CTD
G	Cadps2	Ca++-dependent secretion activator 2		multiple interactions	ISO	4	49,658,535	50,206,014	RGD:6480464	CTD
G	Calml4	calmodulin-like 4		multiple interactions	ISO	8	67,007,122	67,018,886	RGD:6480464	CTD
G	Caln1	calneuron 1		multiple interactions	ISO	12	26,860,409	27,287,503	RGD:6480464	CTD
G	Calr	calreticulin		multiple interactions	ISO	19	24,964,775	24,969,670	RGD:6480464	CTD
G	Caly	calcyon neuron-specific vesicular protein		multiple interactions	ISO	1	199,869,223	199,880,102	RGD:6480464	CTD
G	Camk2d	calcium/calmodulin-dependent protein kinase II delta		multiple interactions	ISO	2	223,840,650	224,108,082	RGD:6480464	CTD
G	Camk2n1	calcium/calmodulin-dependent protein kinase II inhibitor 1		multiple interactions	ISO	5	157,235,534	157,237,314	RGD:6480464	CTD
G	Camkk1	calcium/calmodulin-dependent protein kinase kinase 1, alpha		multiple interactions	ISO	10	59,908,749	59,932,276	RGD:6480464	CTD
G	Camsap1	calmodulin regulated spectrin-associated protein 1		multiple interactions	ISO	3	4,098,538	4,159,591	RGD:6480464	CTD
G	Camta1	calmodulin binding transcription activator 1		multiple interactions	ISO	5	168,201,249	169,046,038	RGD:6480464	CTD
G	Cand2	cullin-associated and neddylation-dissociated 2 (putative)		multiple interactions	ISO	4	151,912,174	151,940,734	RGD:6480464	CTD
G	Cant1	calcium activated nucleotidase 1		multiple interactions	ISO	10	108,405,355	108,420,225	RGD:6480464	CTD
G	Capg	capping protein (actin filament), gelsolin-like		multiple interactions	ISO	4	105,850,321	105,862,109	RGD:6480464	CTD
G	Capn6	calpain 6		multiple interactions	ISO	X	34,697,658	34,722,369	RGD:6480464	CTD
G	Capsl	calcyphosine-like		multiple interactions	ISO	2	59,043,383	59,066,371	RGD:6480464	CTD
G	Capzb	capping protein (actin filament) muscle Z-line, beta		multiple interactions	ISO	5	157,980,877	158,080,682	RGD:6480464	CTD
G	Card10	caspase recruitment domain family, member 10		multiple interactions	ISO	7	116,737,928	116,766,959	RGD:6480464	CTD
G	Carhsp1	calcium regulated heat stable protein 1		multiple interactions	ISO	10	6,986,583	7,000,181	RGD:6480464	CTD
G	Casc5	cancer susceptibility candidate 5		multiple interactions	ISO	3	105,561,365	105,615,047	RGD:6480464	CTD
G	Casp12	caspase 12		multiple interactions	ISO	8	2,082,933	2,110,511	RGD:6480464	CTD
G	Casp3	caspase 3		multiple interactions	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp4	caspase 4, apoptosis-related cysteine peptidase		multiple interactions	ISO	8	2,038,626	2,075,722	RGD:6480464	CTD
G	Casp7	caspase 7		multiple interactions	ISO	1	262,689,300	262,721,591	RGD:6480464	CTD
G	Casp8	caspase 8		multiple interactions	ISO	9	57,389,353	57,437,803	RGD:6480464	CTD
G	Casz1	castor zinc finger 1		multiple interactions	ISO	5	165,979,472	166,030,420	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cbfa2t2	core-binding factor, runt domain, alpha subunit 2; translocated to, 2		multiple interactions	ISO	3	144,904,533	145,007,851	RGD:6480464	CTD
G	Cbln2	cerebellin 2 precursor		multiple interactions	ISO	18	83,306,945	83,313,398	RGD:6480464	CTD
G	Cbr3	carbonyl reductase 3		multiple interactions	ISO	11	33,913,961	33,922,221	RGD:6480464	CTD
G	Cbx1	chromobox homolog 1		multiple interactions	ISO	10	85,544,537	85,564,903	RGD:6480464	CTD
G	Cbx6	chromobox homolog 6		multiple interactions	ISO	7	118,062,267	118,070,004	RGD:6480464	CTD
G	Cc2d1b	coiled-coil and C2 domain containing 1B		multiple interactions	ISO	5	129,906,965	129,920,984	RGD:6480464	CTD
G	Ccbl1	cysteine conjugate-beta lyase, cytoplasmic		increases amination	ISO	3	9,195,737	9,209,545	RGD:6480464	CTD
G	Ccdc103	coiled-coil domain containing 103		multiple interactions	ISO	10	92,053,347	92,056,747	RGD:6480464	CTD
G	Ccdc106	coiled-coil domain containing 106		multiple interactions	ISO	1	67,518,530	67,521,713	RGD:6480464	CTD
G	Ccdc107	coiled-coil domain containing 107		multiple interactions	ISO	5	59,973,255	59,975,669	RGD:6480464	CTD
G	Ccdc109b	coiled-coil domain containing 109B		multiple interactions	ISO	2	227,374,643	227,378,517	RGD:6480464	CTD
G	Ccdc116	coiled-coil domain containing 116		multiple interactions	ISO	11	85,849,737	85,852,819	RGD:6480464	CTD
G	Ccdc117	coiled-coil domain containing 117		multiple interactions	ISO	14	86,161,551	86,170,917	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cd36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	4	13,471,878	13,525,620	RGD:6480464	CTD
G	Cenpn	centromere protein N		multiple interactions	ISO	19	47,029,240	47,051,557	RGD:6480464	CTD
G	Cep170	centrosomal protein 170		multiple interactions	ISO	13	92,502,346	92,611,568	RGD:6480464	CTD
G	Cep55	centrosomal protein 55		multiple interactions	ISO	1	242,382,809	242,398,281	RGD:6480464	CTD
G	Cerkl	ceramide kinase-like		multiple interactions	ISO	3	62,103,856	62,204,116	RGD:6480464	CTD
G	Cetn3	centrin, EF-hand protein, 3		multiple interactions	ISO	2	9,909,950	9,922,361	RGD:6480464	CTD
G	Cetn4	centrin 4		multiple interactions	ISO	2	123,857,012	123,860,943	RGD:6480464	CTD
G	Cfdp1	craniofacial development protein 1		multiple interactions	ISO	19	41,703,586	41,792,613	RGD:6480464	CTD
G	Cggbp1	CGG triplet repeat binding protein 1		multiple interactions	ISO	11	2,182,858	2,190,461	RGD:6480464	CTD
G	Cgnl1	cingulin-like 1		multiple interactions	ISO	8	76,088,865	76,241,145	RGD:6480464	CTD
G	Cgref1	cell growth regulator with EF hand domain 1		multiple interactions	ISO	6	25,414,812	25,426,818	RGD:6480464	CTD
G	Chac1	ChaC, cation transport regulator homolog 1 (E. coli)		multiple interactions	ISO	3	105,869,762	105,873,332	RGD:6480464	CTD
G	Chd1l	chromodomain helicase DNA binding protein 1-like		multiple interactions	ISO	2	192,382,644	192,438,157	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		multiple interactions	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Chgb	chromogranin B (secretogranin 1)		multiple interactions	ISO	3	120,571,736	120,584,874	RGD:6480464	CTD
G	Chi3l3	chitinase 3-like 3		multiple interactions	ISO	2	201,588,788	201,605,075	RGD:6480464	CTD
G	Chmp4bl1	chromatin modifying protein 4B-like 1		multiple interactions	ISO				RGD:6480464	CTD
G	Cilp2	cartilage intermediate layer protein 2		multiple interactions	ISO	16	20,024,989	20,031,984	RGD:6480464	CTD
G	Cited1	Cbp/p300-interacting transactivator with Glu/Asp-rich carboxy-terminal domain 1		multiple interactions	ISO	X	90,301,067	90,305,762	RGD:6480464	CTD
G	Cited4	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4		multiple interactions	ISO	5	141,258,564	141,259,455	RGD:6480464	CTD
G	Ckap2	cytoskeleton associated protein 2		multiple interactions	ISO	16	74,492,221	74,518,743	RGD:6480464	CTD
G	Ckap2l	cytoskeleton associated protein 2-like		multiple interactions	ISO	3	116,885,189	116,911,173	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		multiple interactions	ISO	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Cklf	chemokine-like factor		multiple interactions	ISO	19	655,880	665,215	RGD:6480464	CTD
G	Clca2	chloride channel accessory 2		multiple interactions	ISO	2	243,114,775	243,142,349	RGD:6480464	CTD
G	Clca2	chloride channel accessory 2		multiple interactions	ISO	2	243,114,775	243,142,349	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	EXP	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col2a1	collagen, type II, alpha 1		multiple interactions	EXP	7	136,679,219	136,707,976	RGD:6480464	CTD
G	Cox5b	cytochrome c oxidase subunit Vb		multiple interactions	ISO	9	35,625,478	35,627,304	RGD:6480464	CTD
G	Cpt1a	carnitine palmitoyltransferase 1a, liver		multiple interactions	ISO	1	205,852,800	205,912,972	RGD:6480464	CTD
G	Creg2	cellular repressor of E1A-stimulated genes 2		multiple interactions	ISO	9	38,698,544	38,830,140	RGD:6480464	CTD
G	Crk	v-crk sarcoma virus CT10 oncogene homolog (avian)		multiple interactions	ISO	10	63,017,662	63,040,420	RGD:6480464	CTD
G	Csrnp2	cysteine-serine-rich nuclear protein 2		multiple interactions	ISO	7	139,182,243	139,198,084	RGD:6480464	CTD
G	Ctgf	connective tissue growth factor		multiple interactions	ISO	1	21,327,099	21,330,215	RGD:6480464	CTD
G	Ctsb	cathepsin B		multiple interactions	ISO	15	42,402,829	42,423,701	RGD:6480464	CTD
G	Cul1	cullin 1		multiple interactions	ISO	4	75,636,914	75,705,724	RGD:6480464	CTD
G	Cul4a	cullin 4A		multiple interactions	ISO	16	81,242,293	81,279,498	RGD:6480464	CTD
G	Cxcl16	chemokine (C-X-C motif) ligand 16		multiple interactions	ISO	10	57,296,126	57,300,721	RGD:6480464	CTD
G	Cxcl2	chemokine (C-X-C motif) ligand 2		multiple interactions	ISO	14	18,677,129	18,679,175	RGD:6480464	CTD
G	Cxcl5	chemokine (C-X-C motif) ligand 5		multiple interactions	ISO	14	18,825,357	18,826,269	RGD:6480464	CTD
G	Cyb5r3	cytochrome b5 reductase 3		multiple interactions	ISO	7	121,187,821	121,205,382	RGD:6480464	CTD
G	Cyba	cytochrome b-245, alpha polypeptide		multiple interactions	ISO	19	52,713,150	52,721,609	RGD:6480464	CTD
G	Cybb	cytochrome b-245, beta polypeptide		multiple interactions	ISO	X	25,514,572	25,547,181	RGD:6480464	CTD
G	Cygb	cytoglobin		multiple interactions	EXP	10	106,759,885	106,769,651	RGD:6480464	CTD
G	Cyp1b1	cytochrome P450, family 1, subfamily b, polypeptide 1		multiple interactions	ISO	6	2,548,224	2,553,767	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		multiple interactions	ISO	1	200,918,521	200,928,919	RGD:6480464	CTD
G	Cyp4a1	cytochrome P450, family 4, subfamily a, polypeptide 1		multiple interactions	ISO	5	135,901,653	135,915,754	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		multiple interactions	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		multiple interactions	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		multiple interactions	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp4a3	cytochrome P450, family 4, subfamily a, polypeptide 3		multiple interactions	ISO	5	135,876,140	135,893,753	RGD:6480464	CTD
G	Cyp8b1	cytochrome P450, family 8, subfamily b, polypeptide 1		multiple interactions	ISO	8	127,018,908	127,020,878	RGD:6480464	CTD
G	Dnmt1	DNA (cytosine-5-)-methyltransferase 1		multiple interactions	ISO	8	19,926,995	19,973,256	RGD:6480464	CTD
G	Dnmt3a	DNA (cytosine-5-)-methyltransferase 3 alpha		multiple interactions	ISO	6	26,802,612	26,878,878	RGD:6480464	CTD
G	Dusp4	dual specificity phosphatase 4		multiple interactions	ISO	16	61,109,626	61,119,981	RGD:6480464	CTD
G	Dvl2	dishevelled, dsh homolog 2 (Drosophila)		multiple interactions	ISO				RGD:6480464	CTD
G	Dym	dymeclin		multiple interactions	ISO	18	71,889,053	72,188,251	RGD:6480464	CTD
G	Dynll1	dynein light chain LC8-type 1		multiple interactions	ISO	12	42,580,542	42,582,915	RGD:6480464	CTD
G	Dynll2	dynein light chain LC8-type 2		multiple interactions	ISO	10	76,263,883	76,271,908	RGD:6480464	CTD
G	Dynlt1	dynein light chain Tctex-type 1		multiple interactions	ISO	1	41,097,174	41,103,997	RGD:6480464	CTD
G	Dyrk1a	dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1A		multiple interactions	ISO	11	34,879,733	34,970,998	RGD:6480464	CTD
G	Dyrk3	dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3		multiple interactions	ISO	13	44,077,971	44,089,140	RGD:6480464	CTD
G	Dzip1l	DAZ interacting protein 1-like		multiple interactions	ISO	8	104,507,601	104,542,280	RGD:6480464	CTD
G	E2f1	E2F transcription factor 1		multiple interactions	ISO	3	145,032,489	145,043,729	RGD:6480464	CTD
G	Eaf2	ELL associated factor 2		multiple interactions	ISO	11	65,763,410	65,809,967	RGD:6480464	CTD
G	Ebf1	early B-cell factor 1		multiple interactions	ISO	10	29,770,047	30,163,200	RGD:6480464	CTD
G	Ebf2	early B-cell factor 2		multiple interactions	ISO	15	46,779,220	46,977,125	RGD:6480464	CTD
G	Ebi3	Epstein-Barr virus induced 3		multiple interactions	ISO				RGD:6480464	CTD
G	Ebpl	emopamil binding protein-like		multiple interactions	ISO	15	40,484,464	40,506,451	RGD:6480464	CTD
G	Ece1	endothelin converting enzyme 1		multiple interactions	ISO	5	156,635,656	156,735,783	RGD:6480464	CTD
G	Ece2	endothelin-converting enzyme 2		multiple interactions	ISO	11	82,492,975	82,507,876	RGD:6480464	CTD
G	Ech1	enoyl CoA hydratase 1, peroxisomal		multiple interactions	ISO	1	83,932,720	83,938,918	RGD:6480464	CTD
G	Echdc1	enoyl CoA hydratase domain containing 1		multiple interactions	ISO	1	29,266,332	29,296,530	RGD:6480464	CTD
G	Ednrb	endothelin receptor type B		multiple interactions	ISO	15	87,893,141	87,898,700	RGD:6480464	CTD
G	Eef1a1	eukaryotic translation elongation factor 1 alpha 1		multiple interactions	ISO	8	83,463,591	83,466,813	RGD:6480464	CTD
G	Eef1g	eukaryotic translation elongation factor 1 gamma		multiple interactions	ISO	1	211,640,954	211,651,560	RGD:6480464	CTD
G	Eef2k	eukaryotic elongation factor-2 kinase		multiple interactions	ISO	1	179,712,404	179,754,345	RGD:6480464	CTD
G	Efhc1	EF-hand domain (C-terminal) containing 1		multiple interactions	ISO	9	19,695,815	19,750,261	RGD:6480464	CTD
G	Efhd1	EF-hand domain family, member D1		multiple interactions	ISO	9	86,076,009	86,124,552	RGD:6480464	CTD
G	Efna1	ephrin A1		multiple interactions	ISO	2	181,444,599	181,451,944	RGD:6480464	CTD
G	Efna2	ephrin A2		multiple interactions	ISO	7	11,028,432	11,039,064	RGD:6480464	CTD
G	Eif4ebp1	eukaryotic translation initiation factor 4E binding protein 1		multiple interactions	EXP	16	69,110,522	69,123,895	RGD:6480464	CTD
G	Ercc6	excision repair cross-complementing rodent repair deficiency, complementation group 6		multiple interactions	ISO	16	8,024,881	8,091,587	RGD:6480464	CTD
G	Ercc6l	excision repair cross-complementing rodent repair deficiency complementation group 6 - like		multiple interactions	ISO	X	90,195,080	90,212,006	RGD:6480464	CTD
G	Evi2a	ecotropic viral integration site 2A		multiple interactions	ISO	10	65,713,406	65,717,306	RGD:6480464	CTD
G	Evl	Enah/Vasp-like		multiple interactions	ISO	6	132,952,804	133,019,870	RGD:6480464	CTD
G	Evpl	envoplakin		multiple interactions	ISO	10	106,336,953	106,353,217	RGD:6480464	CTD
G	Evx1	even-skipped homeobox 1		multiple interactions	ISO	4	80,616,465	80,620,842	RGD:6480464	CTD
G	Exd1	exonuclease 3'-5' domain containing 1		multiple interactions	ISO	3	106,038,460	106,066,302	RGD:6480464	CTD
G	Exo1	exonuclease 1		multiple interactions	ISO	13	91,619,024	91,644,366	RGD:6480464	CTD
G	Exoc7	exocyst complex component 7		multiple interactions	ISO	10	106,400,889	106,419,793	RGD:6480464	CTD
G	Exoc8	exocyst complex component 8		multiple interactions	ISO	19	55,066,272	55,068,761	RGD:6480464	CTD
G	Exosc4	exosome component 4		multiple interactions	ISO	7	114,374,913	114,377,655	RGD:6480464	CTD
G	Exosc8	exosome component 8		multiple interactions	ISO	2	143,954,943	143,961,239	RGD:6480464	CTD
G	Exph5	exophilin 5		multiple interactions	ISO	8	56,762,507	56,835,516	RGD:6480464	CTD
G	Ezr	ezrin		multiple interactions	ISO	1	41,178,195	41,221,735	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		multiple interactions	ISO	2	25,985,800	25,989,072	RGD:6480464	CTD
G	Fa2h	fatty acid 2-hydroxylase		multiple interactions	ISO	19	41,268,120	41,319,682	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		multiple interactions	ISO	4	104,412,200	104,415,981	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Fas	Fas (TNF receptor superfamily, member 6)		multiple interactions	ISO	1	238,259,443	238,274,745	RGD:6480464	CTD
G	Faslg	Fas ligand (TNF superfamily, member 6)		multiple interactions	ISO	13	77,472,950	77,480,210	RGD:6480464	CTD
G	Fgf21	fibroblast growth factor 21		multiple interactions	ISO	1	96,082,475	96,083,718	RGD:6480464	CTD
G	Foxc2	forkhead box C2		multiple interactions	ISO				RGD:6480464	CTD
G	Foxp4	forkhead box P4		multiple interactions	ISO	9	8,509,028	8,579,597	RGD:6480464	CTD
G	Gad1	glutamate decarboxylase 1		decreases expression	ISO	3	52,789,370	52,830,038	RGD:6480464	CTD
G	Gad1	glutamate decarboxylase 1		multiple interactions	ISO	3	52,789,370	52,830,038	RGD:6480464	CTD
G	Gad1	glutamate decarboxylase 1		decreases expression	ISO	3	52,789,370	52,830,038	RGD:6480464	CTD
G	Gad1	glutamate decarboxylase 1		decreases expression	ISO	3	52,789,370	52,830,038	RGD:6480464	CTD
G	Gad1	glutamate decarboxylase 1		multiple interactions	ISO	3	52,789,370	52,830,038	RGD:6480464	CTD
G	Gclc	glutamate-cysteine ligase, catalytic subunit		multiple interactions	ISO	8	82,724,429	82,762,848	RGD:6480464	CTD
G	Gli3	GLI family zinc finger 3		multiple interactions	ISO	17	57,594,102	57,867,710	RGD:6480464	CTD
G	Glo1	glyoxalase 1		multiple interactions	ISO	20	8,900,984	8,919,001	RGD:6480464	CTD
G	Gltp	glycolipid transfer protein		multiple interactions	ISO	12	43,195,541	43,215,694	RGD:6480464	CTD
G	Gpc1	glypican 1		multiple interactions	ISO				RGD:6480464	CTD
G	Gpr126	G protein-coupled receptor 126		multiple interactions	ISO	1	9,290,306	9,402,175	RGD:6480464	CTD
G	Gpr155	G protein-coupled receptor 155		multiple interactions	ISO	3	55,846,337	55,900,086	RGD:6480464	CTD
G	Gpr160	G protein-coupled receptor 160		multiple interactions	ISO	2	116,904,283	116,961,732	RGD:6480464	CTD
G	Gpr176	G protein-coupled receptor 176		multiple interactions	ISO	3	104,699,853	104,801,217	RGD:6480464	CTD
G	Gpr180	G protein-coupled receptor 180		multiple interactions	ISO	15	102,931,713	102,955,239	RGD:6480464	CTD
G	Gpr50	G protein-coupled receptor 50		multiple interactions	ISO	X	157,101,726	157,106,312	RGD:6480464	CTD
G	Gpr6	G protein-coupled receptor 6		multiple interactions	ISO				RGD:6480464	CTD
G	Gpr64	G protein-coupled receptor 64		multiple interactions	ISO	X	55,585,378	55,658,340	RGD:6480464	CTD
G	Gpr65	G-protein coupled receptor 65		multiple interactions	ISO	6	122,432,615	122,433,628	RGD:6480464	CTD
G	Gpr84	G protein-coupled receptor 84		multiple interactions	ISO	7	142,217,811	142,220,004	RGD:6480464	CTD
G	Gpr98	G protein-coupled receptor 98		multiple interactions	ISO	2	8,851,539	8,915,885	RGD:6480464	CTD
G	Gpsm3	G-protein signaling modulator 3		multiple interactions	ISO	20	4,259,883	4,261,744	RGD:6480464	CTD
G	Gpt	glutamic-pyruvate transaminase (alanine aminotransferase)		multiple interactions	ISO	7	114,746,054	114,748,903	RGD:6480464	CTD
G	Gpx2	glutathione peroxidase 2		multiple interactions	ISO	6	99,372,418	99,376,230	RGD:6480464	CTD
G	Gpx3	glutathione peroxidase 3		multiple interactions	ISO	10	40,311,094	40,319,382	RGD:6480464	CTD
G	Gpx4	glutathione peroxidase 4		multiple interactions	ISO	7	11,162,521	11,165,318	RGD:6480464	CTD
G	Gpx6	glutathione peroxidase 6		multiple interactions	ISO	17	51,063,379	51,068,058	RGD:6480464	CTD
G	Gramd1b	GRAM domain containing 1B		multiple interactions	ISO	8	43,260,379	43,429,258	RGD:6480464	CTD
G	Grb10	growth factor receptor bound protein 10		multiple interactions	ISO	14	92,814,797	92,911,442	RGD:6480464	CTD
G	Grhl1	grainyhead-like 1 (Drosophila)		multiple interactions	ISO	6	42,217,279	42,260,621	RGD:6480464	CTD
G	Grid1	glutamate receptor, ionotropic, delta 1		multiple interactions	ISO	16	10,473,353	11,202,161	RGD:6480464	CTD
G	Grid2ip	glutamate receptor, ionotropic, delta 2 (Grid2) interacting protein		multiple interactions	ISO	12	11,525,112	11,554,837	RGD:6480464	CTD
G	Grik3	glutamate receptor, ionotropic, kainate 3		multiple interactions	ISO	5	144,842,374	145,058,047	RGD:6480464	CTD
G	Grin1	glutamate receptor, ionotropic, N-methyl D-aspartate 1		multiple interactions	ISO	3	3,453,784	3,480,381	RGD:6480464	CTD
G	Grin2c	glutamate receptor, ionotropic, N-methyl D-aspartate 2C		multiple interactions	ISO	10	105,323,371	105,340,976	RGD:6480464	CTD
G	Grin3a	glutamate receptor, ionotropic, N-methyl-D-aspartate 3A		multiple interactions	ISO	5	66,406,451	66,602,353	RGD:6480464	CTD
G	Gripap1	GRIP1 associated protein 1		multiple interactions	ISO	X	26,713,439	26,743,461	RGD:6480464	CTD
G	Grm4	glutamate receptor, metabotropic 4		multiple interactions	ISO	20	5,627,733	5,727,274	RGD:6480464	CTD
G	Gsk3b	glycogen synthase kinase 3 beta		multiple interactions	ISO	11	64,284,731	64,428,698	RGD:6480464	CTD
G	Gsta4	glutathione S-transferase alpha 4		multiple interactions	ISO	8	83,165,139	83,183,055	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase mu 3		multiple interactions	ISO	2	203,532,363	203,537,135	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase mu 3		multiple interactions	ISO	2	203,532,363	203,537,135	RGD:6480464	CTD
G	Gsto1	glutathione S-transferase omega 1		multiple interactions	ISO	1	253,228,547	253,238,531	RGD:6480464	CTD
G	Gtf2h5	general transcription factor IIH, polypeptide 5		multiple interactions	ISO	1	40,858,997	40,865,571	RGD:6480464	CTD
G	Havcr2	hepatitis A virus cellular receptor 2		multiple interactions	ISO	10	31,585,703	31,610,825	RGD:6480464	CTD
G	Hbegf	heparin-binding EGF-like growth factor		multiple interactions	ISO	18	29,143,567	29,153,944	RGD:6480464	CTD
G	Hbp1	HMG-box transcription factor 1		multiple interactions	ISO	6	50,201,281	50,227,095	RGD:6480464	CTD
G	Hcfc1	host cell factor C1		multiple interactions	ISO	X	159,875,671	159,900,536	RGD:6480464	CTD
G	Hcn4	hyperpolarization activated cyclic nucleotide-gated potassium channel 4		multiple interactions	ISO	8	62,629,828	62,667,248	RGD:6480464	CTD
G	Hcrtr1	hypocretin (orexin) receptor 1		multiple interactions	ISO	5	149,160,739	149,170,736	RGD:6480464	CTD
G	Hcst	hematopoietic cell signal transducer		multiple interactions	ISO	1	85,369,349	85,371,383	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		multiple interactions	ISO	5	148,672,515	148,699,810	RGD:6480464	CTD
G	Hdac2	histone deacetylase 2		multiple interactions	ISO	20	41,162,093	41,186,492	RGD:6480464	CTD
G	Helb	helicase (DNA) B		multiple interactions	ISO	7	59,311,833	59,338,961	RGD:6480464	CTD
G	Helq	helicase, POLQ-like		multiple interactions	ISO	14	10,102,501	10,137,153	RGD:6480464	CTD
G	Hes1	hairy and enhancer of split 1 (Drosophila)		multiple interactions	ISO	11	72,603,482	72,605,673	RGD:6480464	CTD
G	Hexb	hexosaminidase B		multiple interactions	ISO	2	27,649,188	27,672,231	RGD:6480464	CTD
G	Hexim2	hexamethylene bis-acetamide inducible 2		multiple interactions	ISO	10	92,306,494	92,312,256	RGD:6480464	CTD
G	Hey1	hairy/enhancer-of-split related with YRPW motif 1		multiple interactions	ISO	2	95,174,030	95,176,430	RGD:6480464	CTD
G	Hey2	hairy/enhancer-of-split related with YRPW motif 2		multiple interactions	ISO	1	27,505,117	27,515,204	RGD:6480464	CTD
G	Heyl	hairy/enhancer-of-split related with YRPW motif-like		multiple interactions	ISO	5	142,544,185	142,561,176	RGD:6480464	CTD
G	Hgf	hepatocyte growth factor		multiple interactions	ISO	4	14,864,357	14,932,513	RGD:6480464	CTD
G	Hmgcr	3-hydroxy-3-methylglutaryl-CoA reductase		multiple interactions	ISO	2	27,127,504	27,149,580	RGD:6480464	CTD
G	Hnmt	histamine N-methyltransferase		multiple interactions	ISO	3	2,057,938	2,089,955	RGD:6480464	CTD
G	Ifng	interferon gamma		multiple interactions	ISO	7	57,621,756	57,625,792	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		decreases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	3	116,964,422	116,970,867	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Jun	jun proto-oncogene		multiple interactions	ISO	5	115,358,166	115,361,259	RGD:6480464	CTD
G	Keap1	Kelch-like ECH-associated protein 1		multiple interactions	ISO	8	20,259,178	20,266,351	RGD:6480464	CTD
G	Lepr	leptin receptor		affects abundance	ISO	5	122,320,075	122,503,449	RGD:6480464	CTD
G	LOC100362819	autism susceptibility candidate 2-like		multiple interactions	ISO	12	26,069,494	26,166,764	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	EXP	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		multiple interactions	EXP	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	EXP	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		increases activity	ISO	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk8	mitogen-activated protein kinase 8		multiple interactions	EXP	16	8,925,133	9,004,897	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		multiple interactions	EXP	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Mcu	mitochondrial calcium uniporter		multiple interactions	ISO				RGD:6480464	CTD
G	Mecp2	methyl CpG binding protein 2		multiple interactions	ISO	X	159,980,599	160,035,260	RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		multiple interactions	ISO				RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		increases expression	ISO	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mtrr	5-methyltetrahydrofolate-homocysteine methyltransferase reductase		affects abundance	ISO	17	5,086,219	5,118,086	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		multiple interactions	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		multiple interactions	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Nebl	nebulette		multiple interactions	ISO	17	91,518,949	91,626,869	RGD:6480464	CTD
G	Neurl1a	neuralized homolog 1A (Drosophila)		multiple interactions	ISO	1	252,502,664	252,573,249	RGD:6480464	CTD
G	Nfe2l2	nuclear factor, erythroid derived 2, like 2		multiple interactions	ISO	3	58,366,693	58,394,116	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		multiple interactions	ISO	2	233,091,013	233,187,501	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nqo1	NAD(P)H dehydrogenase, quinone 1		multiple interactions	ISO	19	37,251,147	37,266,040	RGD:6480464	CTD
G	Nr0b2	nuclear receptor subfamily 0, group B, member 2		multiple interactions	ISO	5	151,524,685	151,528,000	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	ISO	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr3c1	nuclear receptor subfamily 3, group C, member 1		multiple interactions	ISO	18	32,371,496	32,459,145	RGD:6480464	CTD
G	Pcca	propionyl CoA carboxylase, alpha polypeptide		multiple interactions	ISO	15	107,659,723	108,028,929	RGD:6480464	CTD
G	Pde10a	phosphodiesterase 10A		multiple interactions	ISO	1	46,392,900	46,589,076	RGD:6480464	CTD
G	Pde1b	phosphodiesterase 1B, calmodulin-dependent		multiple interactions	ISO	7	142,401,489	142,427,626	RGD:6480464	CTD
G	Pde4dip	phosphodiesterase 4D interacting protein		multiple interactions	ISO	2	192,534,747	192,671,053	RGD:6480464	CTD
G	Pdgfa	platelet-derived growth factor alpha polypeptide		multiple interactions	ISO	12	16,151,045	16,172,412	RGD:6480464	CTD
G	Pdgfb	platelet-derived growth factor beta polypeptide		multiple interactions	EXP	7	118,244,385	118,262,021	RGD:6480464	CTD
G	Pdgfb	platelet-derived growth factor beta polypeptide		multiple interactions	ISO	7	118,244,385	118,262,021	RGD:6480464	CTD
G	Pdgfc	platelet derived growth factor C		multiple interactions	ISO	2	172,635,732	172,811,004	RGD:6480464	CTD
G	Pdgfd	platelet derived growth factor D		multiple interactions	ISO	8	3,326,218	3,341,300	RGD:6480464	CTD
G	Pdgfra	platelet derived growth factor receptor, alpha polypeptide		multiple interactions	ISO	14	35,369,422	35,418,126	RGD:6480464	CTD
G	Pdgfrb	platelet derived growth factor receptor, beta polypeptide		multiple interactions	EXP	18	57,014,475	57,053,581	RGD:6480464	CTD
G	Pdgfrb	platelet derived growth factor receptor, beta polypeptide		decreases expression	EXP	18	57,014,475	57,053,581	RGD:6480464	CTD
G	Pdgfrb	platelet derived growth factor receptor, beta polypeptide		multiple interactions	ISO	18	57,014,475	57,053,581	RGD:6480464	CTD
G	Pdhx	pyruvate dehydrogenase complex, component X		multiple interactions	ISO	3	88,240,250	88,270,914	RGD:6480464	CTD
G	Pdhx	pyruvate dehydrogenase complex, component X		multiple interactions	ISO	3	88,240,250	88,270,914	RGD:6480464	CTD
G	Pdia6	protein disulfide isomerase family A, member 6		multiple interactions	ISO				RGD:6480464	CTD
G	Pdk3	pyruvate dehydrogenase kinase, isozyme 3		multiple interactions	ISO	X	81,104,667	81,171,536	RGD:6480464	CTD
G	Pdk4	pyruvate dehydrogenase kinase, isozyme 4		multiple interactions	ISO	4	30,235,296	30,245,298	RGD:6480464	CTD
G	Pdlim3	PDZ and LIM domain 3		multiple interactions	ISO	16	49,637,068	49,668,802	RGD:6480464	CTD
G	Pdlim7	PDZ and LIM domain 7		multiple interactions	ISO	17	15,168,835	15,183,983	RGD:6480464	CTD
G	Pdp1	pyruvate dehyrogenase phosphatase catalytic subunit 1		multiple interactions	ISO	5	26,234,414	26,240,301	RGD:6480464	CTD
G	Pdx1	pancreatic and duodenal homeobox 1		multiple interactions	ISO				RGD:6480464	CTD
G	Pdxk	pyridoxal (pyridoxine, vitamin B6) kinase		multiple interactions	ISO	20	10,541,656	10,563,199	RGD:6480464	CTD
G	Pdzd4	PDZ domain containing 4		multiple interactions	ISO	X	159,716,489	159,746,210	RGD:6480464	CTD
G	Pdzrn3	PDZ domain containing RING finger 3		multiple interactions	ISO	4	136,044,210	136,254,969	RGD:6480464	CTD
G	Pea15	phosphoprotein enriched in astrocytes 15		multiple interactions	ISO	13	88,187,674	88,197,296	RGD:6480464	CTD
G	Pebp1	phosphatidylethanolamine binding protein 1		multiple interactions	ISO	12	40,491,393	40,495,593	RGD:6480464	CTD
G	Peli1	pellino E3 ubiquitin protein ligase 1		multiple interactions	ISO	14	101,870,272	101,924,228	RGD:6480464	CTD
G	Peli3	pellino E3 ubiquitin protein ligase family member 3		multiple interactions	ISO	1	207,548,086	207,558,715	RGD:6480464	CTD
G	Per3	period circadian clock 3		multiple interactions	ISO	5	168,152,693	168,187,442	RGD:6480464	CTD
G	Pes1	pescadillo ribosomal biogenesis factor 1		multiple interactions	ISO	14	84,616,451	84,632,831	RGD:6480464	CTD
G	Pex11g	peroxisomal biogenesis factor 11 gamma		multiple interactions	ISO	12	2,702,761	2,709,897	RGD:6480464	CTD
G	Pex12	peroxisomal biogenesis factor 12		multiple interactions	ISO	10	71,378,818	71,382,448	RGD:6480464	CTD
G	Pf4	platelet factor 4		multiple interactions	ISO	14	18,812,550	18,813,259	RGD:6480464	CTD
G	Pfkfb2	6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 2		multiple interactions	ISO	13	43,624,838	43,652,660	RGD:6480464	CTD
G	Pfkfb4	6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4		multiple interactions	ISO	8	114,012,543	114,050,534	RGD:6480464	CTD
G	Pfkp	phosphofructokinase, platelet		multiple interactions	ISO	17	74,760,912	74,823,046	RGD:6480464	CTD
G	Pfn4	profilin family, member 4		multiple interactions	ISO				RGD:6480464	CTD
G	Pgam5	phosphoglycerate mutase family member 5		multiple interactions	ISO	12	46,555,416	46,562,477	RGD:6480464	CTD
G	Pgbd5	piggyBac transposable element derived 5		multiple interactions	ISO	19	54,542,070	54,608,511	RGD:6480464	CTD
G	Pgc	progastricsin (pepsinogen C)		multiple interactions	ISO	9	8,723,620	8,731,837	RGD:6480464	CTD
G	Pgd	phosphogluconate dehydrogenase		multiple interactions	ISO				RGD:6480464	CTD
G	Pgf	placental growth factor		multiple interactions	ISO	6	109,215,540	109,226,122	RGD:6480464	CTD
G	Pgls	6-phosphogluconolactonase		multiple interactions	ISO	16	18,791,241	18,796,727	RGD:6480464	CTD
G	Pglyrp1	peptidoglycan recognition protein 1		multiple interactions	ISO	1	78,235,474	78,240,665	RGD:6480464	CTD
G	Pgm2l1	phosphoglucomutase 2-like 1		multiple interactions	ISO	1	157,605,906	157,655,227	RGD:6480464	CTD
G	Pgm3	phosphoglucomutase 3		multiple interactions	ISO	8	91,810,223	91,827,293	RGD:6480464	CTD
G	Pgm5	phosphoglucomutase 5		multiple interactions	ISO	1	228,107,411	228,300,939	RGD:6480464	CTD
G	Pgpep1	pyroglutamyl-peptidase I		multiple interactions	ISO	16	19,276,650	19,285,828	RGD:6480464	CTD
G	Phb2	prohibitin 2		multiple interactions	ISO	4	160,835,328	160,839,933	RGD:6480464	CTD
G	Phc1	polyhomeotic homolog 1 (Drosophila)		multiple interactions	ISO	4	158,736,736	158,759,429	RGD:6480464	CTD
G	Phc3	polyhomeotic homolog 3 (Drosophila)		multiple interactions	ISO	2	116,831,190	116,895,396	RGD:6480464	CTD
G	Phf8	PHD finger protein 8		multiple interactions	ISO	X	40,869,942	40,970,244	RGD:6480464	CTD
G	Phgdh	phosphoglycerate dehydrogenase		multiple interactions	ISO	2	193,147,943	193,177,137	RGD:6480464	CTD
G	Phka1	phosphorylase kinase, alpha 1		multiple interactions	ISO	X	90,553,527	90,692,073	RGD:6480464	CTD
G	Phlda3	pleckstrin homology-like domain, family A, member 3		multiple interactions	ISO	13	48,789,678	48,793,999	RGD:6480464	CTD
G	Phldb1	pleckstrin homology-like domain, family B, member 1		multiple interactions	ISO	8	47,645,164	47,686,143	RGD:6480464	CTD
G	Phldb3	pleckstrin homology-like domain, family B, member 3		multiple interactions	ISO	1	79,893,173	79,910,727	RGD:6480464	CTD
G	Plcd1	phospholipase C, delta 1		multiple interactions	ISO	8	124,023,090	124,052,193	RGD:6480464	CTD
G	Plod2	procollagen lysine, 2-oxoglutarate 5-dioxygenase 2		multiple interactions	ISO	8	97,525,279	97,623,152	RGD:6480464	CTD
G	Plscr1	phospholipid scramblase 1		multiple interactions	ISO	8	97,206,388	97,226,725	RGD:6480464	CTD
G	Plxdc2	plexin domain containing 2		multiple interactions	ISO	17	90,572,391	90,982,074	RGD:6480464	CTD
G	Plxna3	plexin A3		multiple interactions	ISO	X	160,261,781	160,277,570	RGD:6480464	CTD
G	Pmaip1	phorbol-12-myristate-13-acetate-induced protein 1		multiple interactions	ISO	18	62,914,845	62,918,832	RGD:6480464	CTD
G	Pmf1	polyamine-modulated factor 1		multiple interactions	ISO	2	180,492,380	180,511,936	RGD:6480464	CTD
G	Pmm2	phosphomannomutase 2		multiple interactions	ISO	10	7,001,340	7,022,517	RGD:6480464	CTD
G	Pmp22	peripheral myelin protein 22		multiple interactions	ISO	10	49,305,835	49,335,864	RGD:6480464	CTD
G	Pnck	pregnancy upregulated non-ubiquitously expressed CaM kinase		multiple interactions	ISO	X	45,741,127	45,741,920	RGD:6480464	CTD
G	Pnkd	paroxysmal nonkinesigenic dyskinesia		multiple interactions	ISO	9	73,611,610	73,697,690	RGD:6480464	CTD
G	Pnpla2	patatin-like phospholipase domain containing 2		multiple interactions	ISO	1	201,641,939	201,647,021	RGD:6480464	CTD
G	Pnpla8	patatin-like phospholipase domain containing 8		multiple interactions	ISO	6	63,644,462	63,676,544	RGD:6480464	CTD
G	Pnrc1	proline-rich nuclear receptor coactivator 1		multiple interactions	ISO	5	49,544,328	49,547,367	RGD:6480464	CTD
G	Podxl2	podocalyxin-like 2		multiple interactions	ISO	4	122,937,318	122,969,158	RGD:6480464	CTD
G	Pogz	pogo transposable element with ZNF domain		multiple interactions	ISO	2	189,748,657	189,776,355	RGD:6480464	CTD
G	Pola1	polymerase (DNA directed), alpha 1, catalytic subunit		multiple interactions	ISO	X	80,650,454	80,965,833	RGD:6480464	CTD
G	Pole2	polymerase (DNA directed), epsilon 2, accessory subunit		multiple interactions	ISO	6	91,155,518	91,180,121	RGD:6480464	CTD
G	Pole3	polymerase (DNA directed), epsilon 3, accessory subunit		multiple interactions	ISO	5	79,517,590	79,520,825	RGD:6480464	CTD
G	Poli	polymerase (DNA directed), iota		multiple interactions	ISO	18	67,212,984	67,230,580	RGD:6480464	CTD
G	Polr1a	polymerase (RNA) I polypeptide A		multiple interactions	ISO	4	105,187,426	105,251,385	RGD:6480464	CTD
G	Polr2a	polymerase (RNA) II (DNA directed) polypeptide A		multiple interactions	ISO	10	56,552,872	56,579,172	RGD:6480464	CTD
G	Polr2e	polymerase (RNA) II (DNA directed) polypeptide E		multiple interactions	ISO	7	11,179,283	11,183,205	RGD:6480464	CTD
G	Polr3b	polymerase (RNA) III (DNA directed) polypeptide B		multiple interactions	ISO	7	21,167,374	21,271,601	RGD:6480464	CTD
G	Polr3d	polymerase (RNA) III (DNA directed) polypeptide D		multiple interactions	ISO	15	50,838,153	50,842,822	RGD:6480464	CTD
G	Pomgnt1	protein O-linked mannose beta1,2-N-acetylglucosaminyltransferase		multiple interactions	ISO	5	136,429,379	136,439,254	RGD:6480464	CTD
G	Postn	periostin, osteoblast specific factor		multiple interactions	ISO	2	143,537,099	143,568,341	RGD:6480464	CTD
G	Pot1b	protection of telomeres 1B		multiple interactions	ISO				RGD:6480464	CTD
G	Pou2f2	POU class 2 homeobox 2		multiple interactions	ISO	1	80,405,061	80,442,677	RGD:6480464	CTD
G	Pou3f1	POU class 3 homeobox 1		multiple interactions	ISO	5	143,981,547	143,984,527	RGD:6480464	CTD
G	Pou4f2	POU class 4 homeobox 2		multiple interactions	ISO	19	31,388,907	31,392,548	RGD:6480464	CTD
G	Ppap2b	phosphatidic acid phosphatase type 2B		multiple interactions	ISO	5	126,121,416	126,197,099	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		multiple interactions	ISO	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		multiple interactions	ISO	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		multiple interactions	ISO	7	123,729,774	123,807,090	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		multiple interactions	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppif	peptidylprolyl isomerase F		multiple interactions	ISO	16	1,292,835	1,299,556	RGD:6480464	CTD
G	Ppl	periplakin		multiple interactions	ISO	10	10,566,823	10,612,474	RGD:6480464	CTD
G	Ppm1a	protein phosphatase, Mg2+/Mn2+ dependent, 1A		multiple interactions	ISO	6	95,162,067	95,198,936	RGD:6480464	CTD
G	Ppm1d	protein phosphatase, Mg2+/Mn2+ dependent, 1D		multiple interactions	ISO	10	73,575,506	73,612,063	RGD:6480464	CTD
G	Ppm1l	protein phosphatase, Mg2+/Mn2+ dependent, 1L		multiple interactions	ISO	2	159,385,829	159,662,846	RGD:6480464	CTD
G	Ppp1ca	protein phosphatase 1, catalytic subunit, alpha isozyme		multiple interactions	ISO	1	206,774,719	206,778,336	RGD:6480464	CTD
G	Ppp1r10	protein phosphatase 1, regulatory subunit 10		multiple interactions	ISO	20	2,940,605	2,984,636	RGD:6480464	CTD
G	Ppp1r14a	protein phosphatase 1, regulatory (inhibitor) subunit 14A		multiple interactions	ISO	1	84,421,638	84,427,235	RGD:6480464	CTD
G	Ppp1r15b	protein phosphatase 1, regulatory subunit 15B		multiple interactions	ISO	13	46,039,831	46,047,636	RGD:6480464	CTD
G	Ppp1r16b	protein phosphatase 1, regulatory subunit 16B		multiple interactions	ISO	3	149,404,662	149,496,290	RGD:6480464	CTD
G	Ppp1r3c	protein phosphatase 1, regulatory subunit 3C		multiple interactions	ISO	1	240,991,884	240,996,887	RGD:6480464	CTD
G	Ppp1r9a	protein phosphatase 1, regulatory subunit 9A		multiple interactions	ISO	4	29,654,468	29,928,476	RGD:6480464	CTD
G	Ppp1r9b	protein phosphatase 1, regulatory subunit 9B		multiple interactions	ISO	10	83,674,797	83,690,639	RGD:6480464	CTD
G	Ppp2ca	protein phosphatase 2, catalytic subunit, alpha isozyme		multiple interactions	ISO	10	37,621,256	37,641,008	RGD:6480464	CTD
G	Ppp2r2c	protein phosphatase 2, regulatory subunit B, gamma		multiple interactions	ISO	14	79,417,924	79,460,075	RGD:6480464	CTD
G	Ppp2r5a	protein phosphatase 2, regulatory subunit B', alpha		multiple interactions	ISO	13	107,413,761	107,458,156	RGD:6480464	CTD
G	Ppp2r5e	protein phosphatase 2, regulatory subunit B', epsilon isoform		multiple interactions	ISO	6	98,047,316	98,197,549	RGD:6480464	CTD
G	Ppp3cc	protein phosphatase 3, catalytic subunit, gamma isozyme		multiple interactions	ISO	15	50,616,635	50,688,593	RGD:6480464	CTD
G	Prdx6	peroxiredoxin 6		multiple interactions	ISO	13	76,824,968	76,835,517	RGD:6480464	CTD
G	Rab1b	RAB1B, member RAS oncogene family		multiple interactions	ISO	1	207,720,833	207,727,458	RGD:6480464	CTD
G	Rab1b-ps1	RAB1B, member RAS oncogene family, pseudogene 1		multiple interactions	ISO	X	73,108,011	73,109,857	RGD:6480464	CTD
G	Rab9a	RAB9A, member RAS oncogene family		multiple interactions	ISO	X	48,663,349	48,686,805	RGD:6480464	CTD
G	Reln	reelin		multiple interactions	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		increases methylation	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		multiple interactions	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		multiple interactions	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		increases methylation	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	Reln	reelin		decreases expression	ISO	4	8,150,873	8,609,141	RGD:6480464	CTD
G	RGD1561778	similar to dendritic cell-derived immunoglobulin(Ig)-like receptor 1, DIgR1 - mouse		multiple interactions	ISO	10	105,084,608	105,089,307	RGD:6480464	CTD
G	Rxra	retinoid X receptor alpha		multiple interactions	ISO	3	6,605,782	6,689,224	RGD:6480464	CTD
G	Sema3b	sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3B		multiple interactions	ISO	8	112,845,709	112,852,565	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		multiple interactions	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Shank3	SH3 and multiple ankyrin repeat domains 3		decreases expression	EXP	7	127,817,026	127,877,875	RGD:6480464	CTD
G	Sla	src-like adaptor		multiple interactions	ISO	7	104,153,028	104,202,272	RGD:6480464	CTD
G	Slamf7	SLAM family member 7		multiple interactions	ISO	13	87,637,105	87,653,930	RGD:6480464	CTD
G	Slc10a2	solute carrier family 10 (sodium/bile acid cotransporter family), member 2		multiple interactions	ISO	16	89,939,295	89,961,444	RGD:6480464	CTD
G	Slc12a2	solute carrier family 12 (sodium/potassium/chloride transporters), member 2		multiple interactions	ISO	18	53,673,215	53,741,352	RGD:6480464	CTD
G	Slc12a4	solute carrier family 12 (potassium/chloride transporters), member 4		multiple interactions	ISO	19	35,785,181	35,807,024	RGD:6480464	CTD
G	Slc12a5	solute carrier family 12 (potassium-chloride transporter), member 5		multiple interactions	ISO	3	156,006,017	156,037,915	RGD:6480464	CTD
G	Slc12a8	solute carrier family 12 (potassium/chloride transporters), member 8		multiple interactions	ISO	11	68,934,104	69,087,168	RGD:6480464	CTD
G	Slc13a3	solute carrier family 13 (sodium-dependent dicarboxylate transporter), member 3		multiple interactions	ISO	3	156,447,900	156,510,620	RGD:6480464	CTD
G	Slc16a1	solute carrier family 16, member 1 (monocarboxylic acid transporter 1)		multiple interactions	ISO	2	199,860,341	199,879,856	RGD:6480464	CTD
G	Slc16a10	solute carrier family 16, member 10 (aromatic amino acid transporter)		multiple interactions	ISO	20	44,211,651	44,325,332	RGD:6480464	CTD
G	Slc16a3	solute carrier family 16, member 3 (monocarboxylic acid transporter 4)		multiple interactions	ISO	10	110,159,679	110,163,182	RGD:6480464	CTD
G	Slc16a6	solute carrier family 16, member 6 (monocarboxylic acid transporter 7)		multiple interactions	ISO	10	98,853,289	98,875,189	RGD:6480464	CTD
G	Slc16a8	solute carrier family 16, member 8 (monocarboxylic acid transporter 3)		multiple interactions	ISO	7	117,234,094	117,237,887	RGD:6480464	CTD
G	Slc17a3	solute carrier family 17 (sodium phosphate), member 3		multiple interactions	ISO	17	48,599,049	48,620,786	RGD:6480464	CTD
G	Slc17a8	solute carrier family 17 (sodium-dependent inorganic phosphate cotransporter), member 8		multiple interactions	ISO	7	26,361,488	26,413,820	RGD:6480464	CTD
G	Slc18a2	solute carrier family 18 (vesicular monoamine), member 2		multiple interactions	ISO	1	265,789,917	265,824,551	RGD:6480464	CTD
G	Slc19a1	solute carrier family 19 (folate transporter), member 1		multiple interactions	ISO	20	11,984,283	12,001,865	RGD:6480464	CTD
G	Slc19a2	solute carrier family 19 (thiamine transporter), member 2		multiple interactions	ISO	13	80,017,780	80,031,777	RGD:6480464	CTD
G	Slc1a5	solute carrier family 1 (neutral amino acid transporter), member 5		multiple interactions	ISO	1	77,111,082	77,125,166	RGD:6480464	CTD
G	Slc20a1	solute carrier family 20 (phosphate transporter), member 1		multiple interactions	ISO	3	116,813,990	116,828,049	RGD:6480464	CTD
G	Slc22a17	solute carrier family 22, member 17		multiple interactions	ISO	15	33,008,690	33,015,184	RGD:6480464	CTD
G	Slc22a7	solute carrier family 22 (organic anion transporter), member 7		multiple interactions	ISO	9	9,934,309	9,940,107	RGD:6480464	CTD
G	Slc24a3	solute carrier family 24 (sodium/potassium/calcium exchanger), member 3		multiple interactions	ISO	3	133,734,890	134,249,326	RGD:6480464	CTD
G	Slc25a1	solute carrier family 25 (mitochondrial carrier, citrate transporter), member 1		multiple interactions	ISO	11	85,043,902	85,046,919	RGD:6480464	CTD
G	Slc25a23	solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 23		multiple interactions	ISO				RGD:6480464	CTD
G	Slc25a24	solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 24		multiple interactions	ISO	2	204,721,524	204,760,766	RGD:6480464	CTD
G	Slc25a25	solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25		multiple interactions	ISO	3	11,539,415	11,549,538	RGD:6480464	CTD
G	Slc25a27	solute carrier family 25, member 27		multiple interactions	ISO	9	13,002,823	13,028,534	RGD:6480464	CTD
G	Slc25a29	solute carrier family 25 (mitochondrial carnitine/acylcarnitine carrier), member 29		multiple interactions	ISO	6	133,166,812	133,177,600	RGD:6480464	CTD
G	Slc25a36	solute carrier family 25 (pyrimidine nucleotide carrier ), member 36		multiple interactions	ISO	8	102,160,470	102,191,368	RGD:6480464	CTD
G	Slc25a4	solute carrier family 25 (mitochondrial carrier; adenine nucleotide translocator), member 4		multiple interactions	ISO	16	49,353,476	49,357,271	RGD:6480464	CTD
G	Slc2a2	solute carrier family 2 (facilitated glucose transporter), member 2		multiple interactions	ISO	2	116,036,501	116,065,834	RGD:6480464	CTD
G	Slc30a9	solute carrier family 30 (zinc transporter), member 9		multiple interactions	ISO	14	43,423,677	43,477,106	RGD:6480464	CTD
G	Slc32a1	solute carrier family 32 (GABA vesicular transporter), member 1		multiple interactions	ISO	3	149,342,399	149,347,124	RGD:6480464	CTD
G	Slc35a3	solute carrier family 35 (UDP-N-acetylglucosamine (UDP-GlcNAc) transporter), member A3		multiple interactions	ISO	2	212,902,953	212,939,222	RGD:6480464	CTD
G	Slc35b3	solute carrier family 35, member B3		multiple interactions	ISO	17	31,910,886	31,938,409	RGD:6480464	CTD
G	Slc35d1	solute carrier family 35 (UDP-glucuronic acid/UDP-N-acetylgalactosamine dual transporter), member D1		multiple interactions	ISO	5	124,107,948	124,154,018	RGD:6480464	CTD
G	Slc35d3	solute carrier family 35, member D3		multiple interactions	ISO	1	15,086,254	15,089,726	RGD:6480464	CTD
G	Slc35e1	solute carrier family 35, member E1		multiple interactions	ISO	16	17,769,201	17,781,444	RGD:6480464	CTD
G	Slc35e4	solute carrier family 35, member E4		multiple interactions	ISO	14	84,569,021	84,575,885	RGD:6480464	CTD
G	Slc35f1	solute carrier family 35, member F1		multiple interactions	ISO	20	31,621,873	31,770,094	RGD:6480464	CTD
G	Slc37a2	solute carrier family 37 (glycerol-3-phosphate transporter), member 2		multiple interactions	ISO	8	38,484,390	38,506,032	RGD:6480464	CTD
G	Slc38a1	solute carrier family 38, member 1		multiple interactions	ISO	7	135,252,257	135,316,256	RGD:6480464	CTD
G	Slc3a1	solute carrier family 3, member 1		increases uptake	ISO	6	8,385,186	8,419,465	RGD:6480464	CTD
G	Slc6a19	solute carrier family 6 (neutral amino acid transporter), member 19		increases uptake	ISO	1	30,393,331	30,412,094	RGD:6480464	CTD
G	Slco1b3	solute carrier organic anion transporter family, member 1b3		multiple interactions	ISO	4	179,045,586	179,118,680	RGD:6480464	CTD
G	Snrpg	small nuclear ribonucleoprotein polypeptide G		multiple interactions	ISO	4	120,549,595	120,557,144	RGD:6480464	CTD
G	Sod1	superoxide dismutase 1, soluble		multiple interactions	ISO	11	29,810,766	29,816,342	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sox9	SRY (sex determining region Y)-box 9		multiple interactions	ISO	10	102,392,187	102,394,256	RGD:6480464	CTD
G	Spag9	sperm associated antigen 9		multiple interactions	ISO	10	82,649,289	82,762,795	RGD:6480464	CTD
G	Spag9	sperm associated antigen 9		multiple interactions	ISO	10	82,649,289	82,762,795	RGD:6480464	CTD
G	Sptbn1	spectrin, beta, non-erythrocytic 1		multiple interactions	ISO	14	111,076,741	111,246,286	RGD:6480464	CTD
G	Sptbn2	spectrin, beta, non-erythrocytic 2		multiple interactions	ISO	1	207,318,258	207,358,896	RGD:6480464	CTD
G	Srebf1	sterol regulatory element binding transcription factor 1		multiple interactions	ISO	10	46,461,684	46,483,646	RGD:6480464	CTD
G	Srebf2	sterol regulatory element binding transcription factor 2		multiple interactions	ISO	7	120,522,511	120,580,212	RGD:6480464	CTD
G	Srm	spermidine synthase		multiple interactions	ISO	5	165,672,516	165,675,673	RGD:6480464	CTD
G	Ssr4	signal sequence receptor, delta		multiple interactions	ISO	X	159,710,430	159,714,302	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	EXP	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Tgfb2	transforming growth factor, beta 2		multiple interactions	EXP	13	102,718,703	102,818,768	RGD:6480464	CTD
G	Tgfbr2	transforming growth factor, beta receptor II		decreases expression	EXP	8	120,593,595	120,680,453	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		multiple interactions	ISO	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		multiple interactions	EXP	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp1	TIMP metallopeptidase inhibitor 1		multiple interactions	ISO	X	12,542,496	12,547,094	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	EXP	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Timp2	TIMP metallopeptidase inhibitor 2		multiple interactions	ISO	10	108,310,473	108,358,821	RGD:6480464	CTD
G	Tmprss2	transmembrane protease, serine 2		multiple interactions	ISO	11	37,577,051	37,617,258	RGD:6480464	CTD
G	Tmsb4x	thymosin beta 4, X-linked		multiple interactions	ISO				RGD:6480464	CTD
G	Tmtc2	transmembrane and tetratricopeptide repeat containing 2		multiple interactions	ISO	7	43,667,983	44,133,854	RGD:6480464	CTD
G	Tmub1	transmembrane and ubiquitin-like domain containing 1		multiple interactions	ISO	4	6,093,852	6,096,418	RGD:6480464	CTD
G	Tmx4	thioredoxin-related transmembrane protein 4		multiple interactions	ISO	3	122,591,543	122,634,935	RGD:6480464	CTD
G	Tnc	tenascin C		multiple interactions	ISO				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	EXP	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf12a	tumor necrosis factor receptor superfamily, member 12a		multiple interactions	ISO	10	12,940,334	12,942,343	RGD:6480464	CTD
G	Tnfrsf21	tumor necrosis factor receptor superfamily, member 21		multiple interactions	ISO	9	13,587,961	13,666,380	RGD:6480464	CTD
G	Tnfrsf25	tumor necrosis factor receptor superfamily, member 25		multiple interactions	ISO	5	169,344,695	169,348,961	RGD:6480464	CTD
G	Tnfrsf26	tumor necrosis factor receptor superfamily, member 26		multiple interactions	ISO	1	203,984,072	204,004,029	RGD:6480464	CTD
G	Tnfsf13	tumor necrosis factor (ligand) superfamily, member 13		multiple interactions	ISO	10	56,499,945	56,502,928	RGD:6480464	CTD
G	Tnip1	TNFAIP3 interacting protein 1		multiple interactions	ISO	10	40,319,735	40,366,764	RGD:6480464	CTD
G	Tnip2	TNFAIP3 interacting protein 2		multiple interactions	ISO	14	81,870,935	81,888,169	RGD:6480464	CTD
G	Tnk1	tyrosine kinase, non-receptor, 1		multiple interactions	ISO	10	56,692,319	56,698,602	RGD:6480464	CTD
G	Tnk2	tyrosine kinase, non-receptor, 2		multiple interactions	ISO	11	69,927,509	69,966,854	RGD:6480464	CTD
G	Tnks1bp1	tankyrase 1 binding protein 1		multiple interactions	ISO	3	68,286,407	68,308,256	RGD:6480464	CTD
G	Tnnc1	troponin C type 1 (slow)		multiple interactions	ISO	16	6,639,357	6,642,331	RGD:6480464	CTD
G	Top1	topoisomerase (DNA) I		multiple interactions	ISO	3	151,428,931	151,512,884	RGD:6480464	CTD
G	Tpd52l1	tumor protein D52-like 1		multiple interactions	ISO	1	26,788,964	26,951,930	RGD:6480464	CTD
G	Tpm4	tropomyosin 4		multiple interactions	ISO	16	18,108,914	18,122,956	RGD:6480464	CTD
G	Trim6	tripartite motif containing 6		multiple interactions	ISO	1	162,059,220	162,094,672	RGD:6480464	CTD
G	Trim6	tripartite motif containing 6		multiple interactions	ISO	1	162,059,220	162,094,672	RGD:6480464	CTD
G	Ttc21a	tetratricopeptide repeat domain 21A		multiple interactions	ISO	8	124,895,329	124,929,673	RGD:6480464	CTD
G	Ttc21a	tetratricopeptide repeat domain 21A		multiple interactions	ISO	8	124,895,329	124,929,673	RGD:6480464	CTD
G	Ttc26	tetratricopeptide repeat domain 26		multiple interactions	ISO	4	65,922,943	65,981,026	RGD:6480464	CTD
G	Ttc34	tetratricopeptide repeat domain 34		multiple interactions	ISO	5	171,658,968	171,668,759	RGD:6480464	CTD
G	Ttk	Ttk protein kinase		multiple interactions	ISO	8	88,906,665	88,944,613	RGD:6480464	CTD
G	Tuba4a	tubulin, alpha 4A		multiple interactions	ISO	9	74,496,508	74,500,192	RGD:6480464	CTD
G	Twf1	twinfilin actin-binding protein 1		multiple interactions	ISO	7	133,089,255	133,101,150	RGD:6480464	CTD
G	Txnl1	thioredoxin-like 1		multiple interactions	ISO	18	59,823,127	59,849,853	RGD:6480464	CTD
G	Txnrd3	thioredoxin reductase 3		multiple interactions	ISO	4	123,730,278	123,771,572	RGD:6480464	CTD
G	Tyrobp	Tyro protein tyrosine kinase binding protein		multiple interactions	ISO	1	85,365,371	85,369,224	RGD:6480464	CTD
G	Uap1l1	UDP-N-acteylglucosamine pyrophosphorylase 1-like 1		multiple interactions	ISO	3	3,526,396	3,531,669	RGD:6480464	CTD
G	Ubd	ubiquitin D		multiple interactions	ISO	20	1,475,944	1,477,895	RGD:6480464	CTD
G	Ube2h	ubiquitin-conjugating enzyme E2H		multiple interactions	ISO	4	57,121,159	57,216,956	RGD:6480464	CTD
G	Uhrf1bp1	UHRF1 binding protein 1		multiple interactions	ISO	20	6,067,567	6,108,468	RGD:6480464	CTD
G	Unc13a	unc-13 homolog A (C. elegans)		multiple interactions	ISO	16	18,827,405	18,872,461	RGD:6480464	CTD
G	Unc13b	unc-13 homolog B (C. elegans)		multiple interactions	ISO	5	59,551,928	59,768,901	RGD:6480464	CTD
G	Unc5b	unc-5 homolog B (C. elegans)		multiple interactions	ISO	20	28,095,243	28,162,204	RGD:6480464	CTD
G	Usf2	upstream transcription factor 2, c-fos interacting		multiple interactions	ISO	1	85,981,897	85,993,346	RGD:6480464	CTD
G	Usp21	ubiquitin specific peptidase 21		multiple interactions	ISO	13	87,175,527	87,181,024	RGD:6480464	CTD
G	Usp43	ubiquitin specific peptidase 43		multiple interactions	ISO	10	54,591,669	54,653,842	RGD:6480464	CTD
G	Usp8	ubiquitin specific peptidase 8		multiple interactions	ISO	3	114,237,065	114,284,543	RGD:6480464	CTD
G	Uspl1	ubiquitin specific peptidase like 1		multiple interactions	ISO	12	6,318,581	6,345,858	RGD:6480464	CTD
G	Utp15	UTP15, U3 small nucleolar ribonucleoprotein, homolog (S. cerevisiae)		multiple interactions	ISO	2	28,837,115	28,853,532	RGD:6480464	CTD
G	Uts2b	urotensin 2B		multiple interactions	ISO	11	75,389,855	75,424,944	RGD:6480464	CTD
G	Vamp1	vesicle-associated membrane protein 1		multiple interactions	ISO	4	161,333,661	161,340,447	RGD:6480464	CTD
G	Vezf1	vascular endothelial zinc finger 1		multiple interactions	ISO	10	76,364,360	76,374,956	RGD:6480464	CTD
G	Vgf	VGF nerve growth factor inducible		multiple interactions	ISO	12	20,903,304	20,906,327	RGD:6480464	CTD
G	Vps29	vacuolar protein sorting 29 homolog (S. cerevisiae)		multiple interactions	ISO	12	35,403,351	35,412,395	RGD:6480464	CTD
G	Vwf	von Willebrand factor		increases degradation	ISO	4	161,723,415	161,854,766	RGD:6480464	CTD
G	Xdh	xanthine dehydrogenase		multiple interactions	EXP	6	21,417,685	21,590,015	RGD:6480464	CTD
G	Zfp90	zinc finger protein 90		multiple interactions	ISO	19	36,271,854	36,282,995	RGD:6480464	CTD
G	Zfp91	zinc finger protein 91		multiple interactions	ISO	1	215,846,158	215,882,704	RGD:6480464	CTD
G	Zic1	Zic family member 1		multiple interactions	ISO	8	96,314,692	96,318,130	RGD:6480464	CTD
G	Zic3	Zic family member 3		multiple interactions	ISO	X	143,128,118	143,139,155	RGD:6480464	CTD
G	Zmiz1	zinc finger, MIZ-type containing 1		multiple interactions	ISO	16	1,037,882	1,245,259	RGD:6480464	CTD
G	Zmym6	zinc finger, MYM-type 6		multiple interactions	ISO	5	146,519,228	146,566,665	RGD:6480464	CTD
G	Znrf1	zinc and ring finger 1, E3 ubiquitin protein ligase		multiple interactions	ISO	19	41,455,386	41,537,955	RGD:6480464	CTD
G	Zpbp	zona pellucida binding protein		multiple interactions	ISO				RGD:6480464	CTD
G	Zscan12	zinc finger and SCAN domain containing 12		multiple interactions	ISO	17	50,892,885	50,894,616	RGD:6480464	CTD
G	Zswim4	zinc finger, SWIM-type containing 4		multiple interactions	ISO	19	25,611,610	25,636,717	RGD:6480464	CTD
G	Zswim5	zinc finger, SWIM-type containing 5		multiple interactions	ISO	5	137,177,583	137,293,556	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492574
chemical entity	492574
atom	491537
nonmetal atom	450591
carbon atom	407233
organic molecular entity	407226
lipid	84867
fatty acid	25073
short-chain fatty acid	17543
butyric acid	4097
(2S)-2-[(\{4-[2-(2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]phenyl\}carbonyl)amino]-4-(2H-tetrazol-5-yl)butanoic acid	0
(2S)-3-methyl-2-((2R,3S)-3-[(methylsulfonyl)amino]-1-\{[2-(pyrrolidin-1-ylmethyl)-1,3-oxazol-4-yl]carbonyl\}pyrrolidin-2-yl)butanoic acid	0
(2S,3R)-2-[(3S,6R)-3-amino-6-hydroxy-2-oxopiperidinyl]-3-hydroxybutanoic acid	0
(R)-2-hydroxy-4-(hydroxymethylphosphinyl)butyric acid	0
(R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid	0
(R)-3-hydroxy-2-oxo-4-phosphonooxybutanoic acid	0
(S)-2-acetyl-2-hydroxybutanoic acid	0
2,3-dihydroxy-3-methylbutanoic acid +	0
2,4-diaminobutyric acid +	0
2-(hydroxymethyl)-4-oxobutanoic acid	0
2-acetyllactic acid +	0
2-amino-2-methylbutanoic acid	0
2-amino-3-oxobutanoic acid +	0
2-hydroxybutyric acid +	0
2-methylacetoacetic acid	0
2-oxobutanoic acid	1
3-(indol-3-yl)-2-oxobutyric acid +	0
3-aminobutanoic acid +	0
3-hydroxy-2-methylbutanoic acid +	0
3-hydroxybutyric acid +	8
3-hydroxyisovaleric acid +	0
3-methyl-2-oxobutanoic acid	2
4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoic acid	0
4-(2-amino-5-hydroxyphenyl)-2,4-dioxobutanoic acid	0
4-(2-aminophenyl)-2,4-dioxobutanoic acid	0
4-(2-thienyl)butyric acid	0
4-(5-ethyl-2-thienyl)-4-oxobutyric acid	0
4-(hydroxymethylphosphinyl)-2-oxobutyric acid	0
4-(methylamino)butyric acid	0
4-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]butanoic acid	0
4-[4-(2,5-dioxopyrrolidin-1-yl)phenylamino]-4-hydroxybutyric acid	0
4-[4-(3,5-dioxohexyl)phenylcarbamoyl]butyric acid	0
4-acetamidobutanoic acid	0
4-guanidinobutanoic acid	0
4-hydroxybutyric acid +	3
4-methylthio-2-oxobutanoic acid +	2
4-oxo-4-(2-thienyl)butyric acid	0
4-oxo-4-phenylbutyric acid	0
4-phenylbutyric acid	125
L-2,4-diaminobutyric acid +	0
L-2-amino-4-(hydroxymethylphosphinoyl)butanoic acid	0
acetoacetic acid +	0
alpha-amino-gamma-cyanobutanoic acid	0
alpha-aminobutyric acid +	0
butanoate ester +	164
butyryl group	0
butyryl-CoA +	0
dimethylbutyric acid +	0
discadenine	0
gamma-amino-beta-hydroxybutyric acid +	0
gamma-amino-gamma-cyanobutanoic acid +	0
gamma-aminobutyric acid +	193
heptafluorobutyric anhydride	0
indole-3-butyric acid	4
methionine +	3239
methylbutyric acid +	197
perfluorobutyric acid	22