theophylline - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	theophylline	go back to main search page
Accession:	CHEBI:28177	browse the term
Definition:	A dimethylxanthine having the two methyl groups located at positions 1 and 3.
Synonyms:	exact_synonym:	1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
	related_synonym:	1,3-Dimethylxanthine; 1,3-dimethyl-7H-purine-2,6-dione; C7H8N4O2; Cn1c2nc[nH]c2c(=O)n(C)c1=O; Elixophyllin; InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9); InChIKey=ZFXYFBGIUFBOJW-UHFFFAOYSA-N; Respbid; Theo-Dur; Theolair; Theophyllin; Uniphyl; theophylline anhydrous
	alt_id:	CHEBI:26940; CHEBI:45950; CHEBI:9523
	xref_casrn:	58-55-9
	xref:	Beilstein:13463 "Beilstein Registry Number"; ChEMBL:481693 "ChEMBL COMPOUND"; ChemIDplus:58-55-9 "CAS Registry Number"; CiteXplore:10796631 "PubMed citation"; CiteXplore:10836323 "PubMed citation"; CiteXplore:10893702 "PubMed citation"; CiteXplore:10921764 "PubMed citation"; CiteXplore:11126990 "PubMed citation"; CiteXplore:11170036 "PubMed citation"; CiteXplore:11200776 "PubMed citation"; CiteXplore:11261527 "PubMed citation"; CiteXplore:11408152 "PubMed citation"; CiteXplore:11826912 "PubMed citation"; CiteXplore:11848250 "PubMed citation"; CiteXplore:11941393 "PubMed citation"; CiteXplore:11949272 "PubMed citation"; CiteXplore:11950649 "PubMed citation"; CiteXplore:12531775 "PubMed citation"; CiteXplore:12836095 "PubMed citation"; CiteXplore:14517178 "PubMed citation"; CiteXplore:14713563 "PubMed citation"; CiteXplore:14988770 "PubMed citation"; CiteXplore:15005370 "PubMed citation"; CiteXplore:15042504 "PubMed citation"; CiteXplore:15202575 "PubMed citation"; CiteXplore:15317832 "PubMed citation"; CiteXplore:15356646 "PubMed citation"; CiteXplore:15483348 "PubMed citation"; CiteXplore:15739418 "PubMed citation"; CiteXplore:15829161 "PubMed citation"; CiteXplore:15902964 "PubMed citation"; CiteXplore:15908149 "PubMed citation"; CiteXplore:16083514 "PubMed citation"; CiteXplore:16651698 "PubMed citation"; CiteXplore:16930490 "PubMed citation"; CiteXplore:17130682 "PubMed citation"; CiteXplore:17207928 "PubMed citation"; CiteXplore:18307508 "PubMed citation"; CiteXplore:18800032 "PubMed citation"; CiteXplore:19559058 "PubMed citation"; CiteXplore:19727789 "PubMed citation"; CiteXplore:19845735 "PubMed citation"; CiteXplore:19888960 "PubMed citation"; CiteXplore:21467671 "PubMed citation"; CiteXplore:21796703 "PubMed citation"; CiteXplore:21834615 "PubMed citation"; CiteXplore:22377744 "PubMed citation"; CiteXplore:22541679 "PubMed citation"; CiteXplore:22541837 "PubMed citation"; CiteXplore:22702215 "PubMed citation"; CiteXplore:22770225 "PubMed citation"; CiteXplore:22771369 "PubMed citation"; CiteXplore:22836872 "PubMed citation"; CiteXplore:22909172 "PubMed citation"; CiteXplore:22915350 "PubMed citation"; CiteXplore:22981724 "PubMed citation"; CiteXplore:7302609 "PubMed citation"; CiteXplore:7389811 "PubMed citation"; CiteXplore:7656958 "PubMed citation"; CiteXplore:7767539 "PubMed citation"; CiteXplore:8730732 "PubMed citation"; CiteXplore:8960878 "PubMed citation"; CiteXplore:9256615 "PubMed citation"; DrugBank:DB00277 "DrugBank"; Gmelin:51226 "Gmelin Registry Number"; HMDB:HMDB01889 "HMDB"; KEGG COMPOUND:58-55-9 "CAS Registry Number"; KEGG COMPOUND:C07130 "KEGG COMPOUND"; KEGG DRUG:D00371 "KEGG DRUG"
	xref_mesh:	MESH:D013806
	xref:	MetaCyc:CPD-12479 "MetaCyc"; NIST Chemistry WebBook:58-55-9 "CAS Registry Number"; PDBeChem:TEP "PDBeChem"; Reaxys:13463 "Reaxys Registry Number"; Wikipedia:Theophylline "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

theophylline
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	4930590J08Rik	RIKEN cDNA 4930590J08 gene		multiple interactions	ISO	6	91,854,227	91,900,719	RGD:6480464	CTD
G	4933411K20Rik	RIKEN cDNA 4933411K20 gene		increases expression	ISO	8	47,254,910	47,280,944	RGD:6480464	CTD
G	4933434E20Rik	RIKEN cDNA 4933434E20 gene		multiple interactions	ISO	3	89,856,739	89,866,369	RGD:6480464	CTD
G	9030624J02Rik	RIKEN cDNA 9030624J02 gene		multiple interactions	ISO	7	125,883,785	125,985,005	RGD:6480464	CTD
G	Abhd11	abhydrolase domain containing 11		multiple interactions	ISO	5	135,485,022	135,488,045	RGD:6480464	CTD
G	Abl2	v-abl Abelson murine leukemia viral oncogene 2 (arg, Abelson-related gene)		decreases expression	ISO	1	158,488,918	158,579,750	RGD:6480464	CTD
G	Abp1	amiloride binding protein 1 (amine oxidase, copper-containing)		increases activity	ISO	6	48,845,254	48,859,186	RGD:6480464	CTD
G	Abp1	amiloride binding protein 1 (amine oxidase, copper-containing)		decreases expression	ISO	6	48,845,254	48,859,186	RGD:6480464	CTD
G	Acaa1a	acetyl-Coenzyme A acyltransferase 1A		multiple interactions	ISO	9	119,250,412	119,259,413	RGD:6480464	CTD
G	Acadm	acyl-Coenzyme A dehydrogenase, medium chain		decreases expression	ISO	3	153,585,323	153,607,396	RGD:6480464	CTD
G	Acot7	acyl-CoA thioesterase 7		multiple interactions	ISO	4	151,552,209	151,645,964	RGD:6480464	CTD
G	Acta2	actin, alpha 2, smooth muscle, aorta		multiple interactions	ISO	19	34,315,581	34,329,826	RGD:6480464	CTD
G	Actr2	ARP2 actin-related protein 2		decreases expression	ISO	11	19,962,307	20,012,954	RGD:6480464	CTD
G	Actr3	ARP3 actin-related protein 3		decreases expression	ISO	1	127,289,483	127,332,067	RGD:6480464	CTD
G	Adad1	adenosine deaminase domain containing 1 (testis specific)		decreases expression	ISO	3	36,962,578	37,010,434	RGD:6480464	CTD
G	Adamtsl3	ADAMTS-like 3		multiple interactions	ISO	7	89,484,204	89,762,958	RGD:6480464	CTD
G	Adora1	adenosine A1 receptor		multiple interactions	ISO	1	136,095,799	136,132,008	RGD:6480464	CTD
G	Adora1	adenosine A1 receptor		decreases activity	ISO	1	136,095,799	136,132,008	RGD:6480464	CTD
G	Adora1	adenosine A1 receptor		multiple interactions	ISO	1	136,095,799	136,132,008	RGD:6480464	CTD
G	Adora1	adenosine A1 receptor		decreases expression	ISO	1	136,095,799	136,132,008	RGD:6480464	CTD
G	Adora1	adenosine A1 receptor		multiple interactions	ISO	1	136,095,799	136,132,008	RGD:6480464	CTD
G	Adrbk2	adrenergic receptor kinase, beta 2		multiple interactions	ISO	5	113,339,498	113,444,534	RGD:6480464	CTD
G	Adrbk2	adrenergic receptor kinase, beta 2		decreases expression	ISO	5	113,339,498	113,444,534	RGD:6480464	CTD
G	Aff4	AF4/FMR2 family, member 4		multiple interactions	ISO	11	53,164,269	53,235,332	RGD:6480464	CTD
G	Agfg1	ArfGAP with FG repeats 1		increases expression	ISO	1	82,836,058	82,892,850	RGD:6480464	CTD
G	Ahctf1	AT hook containing transcription factor 1		multiple interactions	ISO	1	181,675,035	181,734,146	RGD:6480464	CTD
G	Akt1s1	AKT1 substrate 1 (proline-rich)		increases expression	ISO	7	52,104,597	52,110,780	RGD:6480464	CTD
G	Aldoc	aldolase C, fructose-bisphosphate		decreases expression	ISO	11	78,137,700	78,140,262	RGD:6480464	CTD
G	Alg9	asparagine-linked glycosylation 9 (alpha 1,2 mannosyltransferase)		multiple interactions	ISO	9	50,583,435	50,651,633	RGD:6480464	CTD
G	Ankdd1a	ankyrin repeat and death domain containing 1A		increases expression	ISO	9	65,349,791	65,368,000	RGD:6480464	CTD
G	Ankrd13c	ankyrin repeat domain 13c		multiple interactions	ISO	3	157,610,430	157,669,801	RGD:6480464	CTD
G	Ankrd44	ankyrin repeat domain 44		increases expression	ISO	1	54,702,184	54,983,231	RGD:6480464	CTD
G	Apex1	apurinic/apyrimidinic endonuclease 1		decreases expression	ISO	14	51,544,696	51,546,813	RGD:6480464	CTD
G	Arf1	ADP-ribosylation factor 1		multiple interactions	ISO	11	59,024,914	59,041,769	RGD:6480464	CTD
G	Arhgap15	Rho GTPase activating protein 15		increases expression	ISO	2	43,604,344	44,243,143	RGD:6480464	CTD
G	Arid2	AT rich interactive domain 2 (ARID, RFX-like)		multiple interactions	ISO	15	96,117,953	96,235,894	RGD:6480464	CTD
G	Armc8	armadillo repeat containing 8		multiple interactions	ISO	9	99,378,810	99,469,318	RGD:6480464	CTD
G	Arnt	aryl hydrocarbon receptor nuclear translocator		multiple interactions	ISO	3	95,238,312	95,301,162	RGD:6480464	CTD
G	Arsb	arylsulfatase B		multiple interactions	ISO	13	94,541,634	94,712,971	RGD:6480464	CTD
G	Asl	argininosuccinate lyase		decreases expression	ISO	5	130,487,373	130,500,201	RGD:6480464	CTD
G	Atg3	autophagy related 3		increases expression	ISO	16	45,158,942	45,188,651	RGD:6480464	CTD
G	Atp5s	ATP synthase, H+ transporting, mitochondrial F0 complex, subunit s		decreases expression	ISO	12	70,825,949	70,845,645	RGD:6480464	CTD
G	Atpaf2	ATP synthase mitochondrial F1 complex assembly factor 2		multiple interactions	ISO	11	60,214,126	60,230,601	RGD:6480464	CTD
G	Atrx	alpha thalassemia/mental retardation syndrome X-linked homolog (human)		multiple interactions	ISO	X	102,992,954	103,124,711	RGD:6480464	CTD
G	AU019823	expressed sequence AU019823		increases expression	ISO	9	50,413,345	50,425,569	RGD:6480464	CTD
G	Aurkb	aurora kinase B		multiple interactions	ISO	11	68,859,145	68,865,164	RGD:6480464	CTD
G	Azi2	5-azacytidine induced gene 2		multiple interactions	ISO	9	117,949,617	117,973,025	RGD:6480464	CTD
G	Azi2	5-azacytidine induced gene 2		decreases expression	ISO	9	117,949,617	117,973,025	RGD:6480464	CTD
G	B4galt7	xylosylprotein beta1,4-galactosyltransferase, polypeptide 7 (galactosyltransferase I)		multiple interactions	ISO	13	55,701,472	55,711,315	RGD:6480464	CTD
G	Bag5	BCL2-associated athanogene 5		multiple interactions	ISO	12	112,947,699	112,951,467	RGD:6480464	CTD
G	BC030336	cDNA sequence BC030336		increases expression	ISO	7	127,821,134	127,878,368	RGD:6480464	CTD
G	BC053749	cDNA sequence BC053749		increases expression	ISO	7	31,324,153	31,337,291	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		multiple interactions	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl2	B cell leukemia/lymphoma 2		decreases expression	ISO	1	108,434,756	108,610,867	RGD:6480464	CTD
G	Bcl7c	B cell CLL/lymphoma 7C		multiple interactions	ISO	7	134,848,492	134,852,280	RGD:6480464	CTD
G	Bcr	breakpoint cluster region		increases expression	ISO	10	74,523,641	74,647,668	RGD:6480464	CTD
G	Blnk	B cell linker		increases expression	ISO	19	41,003,417	41,069,025	RGD:6480464	CTD
G	Braf	Braf transforming gene		multiple interactions	ISO	6	39,553,236	39,675,462	RGD:6480464	CTD
G	Bre	brain and reproductive organ-expressed protein		multiple interactions	ISO	5	32,000,423	32,387,112	RGD:6480464	CTD
G	Btbd10	BTB (POZ) domain containing 10		increases expression	ISO	7	120,459,158	120,512,853	RGD:6480464	CTD
G	Btg3	B cell translocation gene 3		multiple interactions	ISO	16	78,360,105	78,377,030	RGD:6480464	CTD
G	C2cd5	C2 calcium-dependent domain containing 5		multiple interactions	ISO	6	142,959,440	143,048,627	RGD:6480464	CTD
G	Calu	calumenin		increases expression	ISO	6	29,298,119	29,326,675	RGD:6480464	CTD
G	Calu	calumenin		increases expression	ISO	6	29,298,119	29,326,675	RGD:6480464	CTD
G	Camk2d	calcium/calmodulin-dependent protein kinase II, delta		decreases expression	ISO	3	126,299,891	126,547,972	RGD:6480464	CTD
G	Cand1	cullin associated and neddylation disassociated 1		multiple interactions	ISO	10	118,635,868	118,677,111	RGD:6480464	CTD
G	Caprin1	cell cycle associated protein 1		increases expression	ISO	2	103,603,102	103,637,797	RGD:6480464	CTD
G	Capza1	capping protein (actin filament) muscle Z-line, alpha 1		decreases expression	ISO	3	104,625,703	104,667,423	RGD:6480464	CTD
G	Casp2	caspase 2		multiple interactions	ISO	6	42,215,038	42,232,495	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	8	47,702,803	47,724,071	RGD:6480464	CTD
G	Cat	catalase		multiple interactions	ISO	2	103,294,061	103,325,310	RGD:6480464	CTD
G	Cav1	caveolin 1, caveolae protein		increases expression	ISO	6	17,256,370	17,291,324	RGD:6480464	CTD
G	Ccdc130	coiled-coil domain containing 130		multiple interactions	ISO	8	86,781,694	86,794,259	RGD:6480464	CTD
G	Ccdc181	coiled-coil domain containing 181		decreases expression	ISO	1	166,205,729	166,217,978	RGD:6480464	CTD
G	Ccdc30	coiled-coil domain containing 30		multiple interactions	ISO	4	118,996,444	119,088,126	RGD:6480464	CTD
G	Ccdc82	coiled-coil domain containing 82		multiple interactions	ISO				RGD:6480464	CTD
G	Ccdc93	coiled-coil domain containing 93		multiple interactions	ISO	1	123,327,644	123,403,037	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	11	81,849,079	81,850,954	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Ccnd1	cyclin D1		multiple interactions	ISO	7	152,115,836	152,125,830	RGD:6480464	CTD
G	Cd33	CD33 antigen		multiple interactions	ISO	7	50,782,826	50,788,541	RGD:6480464	CTD
G	Cd36	CD36 antigen		decreases expression	ISO	5	17,287,508	17,394,777	RGD:6480464	CTD
G	Cd4	CD4 antigen		decreases expression	ISO	6	124,814,711	124,838,227	RGD:6480464	CTD
G	Cdk13	cyclin-dependent kinase 13		multiple interactions	ISO	13	17,807,796	17,896,931	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	6	134,870,419	134,875,543	RGD:6480464	CTD
G	Cdkn1b	cyclin-dependent kinase inhibitor 1B		multiple interactions	ISO	6	134,870,419	134,875,543	RGD:6480464	CTD
G	Ceacam1	carcinoembryonic antigen-related cell adhesion molecule 1		decreases expression	ISO	7	26,246,721	26,262,644	RGD:6480464	CTD
G	Cep63	centrosomal protein 63		multiple interactions	ISO	9	102,488,908	102,528,454	RGD:6480464	CTD
G	Cept1	choline/ethanolaminephosphotransferase 1		multiple interactions	ISO	3	106,305,178	106,350,679	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		multiple interactions	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		multiple interactions	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		multiple interactions	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		increases expression	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		increases stability	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Cga	glycoprotein hormones, alpha subunit		multiple interactions	ISO	4	34,841,028	34,854,623	RGD:6480464	CTD
G	Clec16a	C-type lectin domain family 16, member A		decreases expression	ISO	16	10,545,480	10,744,964	RGD:6480464	CTD
G	Clec4f	C-type lectin domain family 4, member f		decreases expression	ISO	6	83,594,536	83,606,110	RGD:6480464	CTD
G	Clpb	ClpB caseinolytic peptidase B		multiple interactions	ISO	7	108,812,282	108,938,682	RGD:6480464	CTD
G	Clpb	ClpB caseinolytic peptidase B		increases expression	ISO	7	108,812,282	108,938,682	RGD:6480464	CTD
G	Clu	clusterin		increases expression	ISO	14	66,587,320	66,600,382	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		multiple interactions	ISO	11	94,797,584	94,813,181	RGD:6480464	CTD
G	Coq4	coenzyme Q4 homolog (yeast)		multiple interactions	ISO	2	29,643,783	29,653,263	RGD:6480464	CTD
G	Cox5b	cytochrome c oxidase subunit Vb		multiple interactions	ISO	1	36,748,332	36,750,233	RGD:6480464	CTD
G	Cpm	carboxypeptidase M		multiple interactions	ISO	10	117,066,556	117,124,408	RGD:6480464	CTD
G	Cpne1	copine I		affects binding	ISO	2	155,897,577	155,937,701	RGD:6480464	CTD
G	Creld1	cysteine-rich with EGF-like domains 1		multiple interactions	ISO	6	113,433,563	113,443,332	RGD:6480464	CTD
G	Crtc3	CREB regulated transcription coactivator 3		multiple interactions	ISO	7	87,731,518	87,833,763	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		decreases expression	ISO	11	54,060,772	54,063,401	RGD:6480464	CTD
G	Csf3	colony stimulating factor 3 (granulocyte)		increases expression	ISO	11	98,562,627	98,564,943	RGD:6480464	CTD
G	Csnk1e	casein kinase 1, epsilon		multiple interactions	ISO	15	79,248,282	79,272,487	RGD:6480464	CTD
G	Ctps	cytidine 5'-triphosphate synthase		decreases expression	ISO	4	120,212,473	120,242,881	RGD:6480464	CTD
G	Ctrl	chymotrypsin-like		increases expression	ISO	8	108,455,894	108,457,762	RGD:6480464	CTD
G	Ctsb	cathepsin B		increases expression	ISO	14	63,741,302	63,764,758	RGD:6480464	CTD
G	Ctsl	cathepsin L		decreases expression	ISO	13	64,464,522	64,471,614	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		decreases activity	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	EXP	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects hydroxylation	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects response to substance	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		increases chemical synthesis	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		multiple interactions	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp1a2	cytochrome P450, family 1, subfamily a, polypeptide 2		affects metabolic processing	ISO	9	57,524,744	57,531,462	RGD:6480464	CTD
G	Cyp2d9	cytochrome P450, family 2, subfamily d, polypeptide 9		decreases expression	ISO	15	82,282,807	82,287,257	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects metabolic processing	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects metabolic processing	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects hydroxylation	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects metabolic processing	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		affects metabolic processing	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp2e1	cytochrome P450, family 2, subfamily e, polypeptide 1		increases chemical synthesis	ISO	7	147,949,731	147,960,880	RGD:6480464	CTD
G	Cyp3a41a	cytochrome P450, family 3, subfamily a, polypeptide 41A		multiple interactions	ISO	5	146,505,624	146,531,712	RGD:6480464	CTD
G	Cysltr1	cysteinyl leukotriene receptor 1		decreases expression	ISO	X	103,771,856	103,798,801	RGD:6480464	CTD
G	Dab2	disabled 2, mitogen-responsive phosphoprotein		multiple interactions	ISO	15	6,249,789	6,390,712	RGD:6480464	CTD
G	Dact3	dapper homolog 3, antagonist of beta-catenin (xenopus)		multiple interactions	ISO	7	17,460,666	17,472,650	RGD:6480464	CTD
G	Dcbld1	discoidin, CUB and LCCL domain containing 1		multiple interactions	ISO	10	51,953,425	52,041,183	RGD:6480464	CTD
G	Ddi2	DNA-damage inducible protein 2		multiple interactions	ISO	4	141,239,478	141,279,334	RGD:6480464	CTD
G	Dhx8	DEAH (Asp-Glu-Ala-His) box polypeptide 8		multiple interactions	ISO	11	101,594,270	101,628,672	RGD:6480464	CTD
G	Dlg1	discs, large homolog 1 (Drosophila)		multiple interactions	ISO	16	31,664,125	31,873,432	RGD:6480464	CTD
G	Dnajc15	DnaJ (Hsp40) homolog, subfamily C, member 15		multiple interactions	ISO	14	78,226,024	78,274,724	RGD:6480464	CTD
G	Dnajc4	DnaJ (Hsp40) homolog, subfamily C, member 4		multiple interactions	ISO	19	7,062,401	7,066,762	RGD:6480464	CTD
G	Dock4	dedicator of cytokinesis 4		multiple interactions	ISO	12	41,172,640	41,573,082	RGD:6480464	CTD
G	Dolk	dolichol kinase		multiple interactions	ISO	2	30,139,749	30,141,874	RGD:6480464	CTD
G	Drd5	dopamine receptor D5		increases expression	ISO	5	38,710,748	38,713,549	RGD:6480464	CTD
G	Dusp19	dual specificity phosphatase 19		multiple interactions	ISO	2	80,457,371	80,471,818	RGD:6480464	CTD
G	Ears2	glutamyl-tRNA synthetase 2 (mitochondrial)(putative)		increases expression	ISO	7	129,182,335	129,210,577	RGD:6480464	CTD
G	Egln3	EGL nine homolog 3 (C. elegans)		multiple interactions	ISO	12	55,279,968	55,304,861	RGD:6480464	CTD
G	Eif2s3x	eukaryotic translation initiation factor 2, subunit 3, structural gene X-linked		increases expression	ISO	X	91,434,048	91,457,990	RGD:6480464	CTD
G	Eif3a	eukaryotic translation initiation factor 3, subunit A		increases expression	ISO	19	60,837,019	60,866,596	RGD:6480464	CTD
G	Eif3b	eukaryotic translation initiation factor 3, subunit B		increases expression	ISO	5	140,895,259	140,919,312	RGD:6480464	CTD
G	Eif3e	eukaryotic translation initiation factor 3, subunit E		decreases expression	ISO	15	43,081,586	43,114,282	RGD:6480464	CTD
G	Eif4b	eukaryotic translation initiation factor 4B		increases expression	ISO	15	101,904,204	101,927,604	RGD:6480464	CTD
G	Eif5	eukaryotic translation initiation factor 5		decreases expression	ISO	12	112,776,312	112,784,964	RGD:6480464	CTD
G	Elp6	elongator acetyltransferase complex subunit 6		multiple interactions	ISO	9	110,207,696	110,224,606	RGD:6480464	CTD
G	Emc3	ER membrane protein complex subunit 3		multiple interactions	ISO	6	113,464,881	113,481,632	RGD:6480464	CTD
G	Entpd5	ectonucleoside triphosphate diphosphohydrolase 5		multiple interactions	ISO	12	85,714,807	85,749,979	RGD:6480464	CTD
G	Epg5	ectopic P-granules autophagy protein 5 homolog (C. elegans)		multiple interactions	ISO	18	78,135,212	78,231,766	RGD:6480464	CTD
G	Eps15	epidermal growth factor receptor pathway substrate 15		decreases expression	ISO	4	108,952,880	109,060,422	RGD:6480464	CTD
G	Eps8l1	EPS8-like 1		multiple interactions	ISO	7	4,416,344	4,430,844	RGD:6480464	CTD
G	Ercc5	excision repair cross-complementing rodent repair deficiency, complementation group 5		multiple interactions	ISO	1	44,204,589	44,238,105	RGD:6480464	CTD
G	Erf	Ets2 repressor factor		multiple interactions	ISO	7	26,027,579	26,035,777	RGD:6480464	CTD
G	Ergic1	endoplasmic reticulum-golgi intermediate compartment (ERGIC) 1		multiple interactions	ISO	17	26,698,457	26,793,879	RGD:6480464	CTD
G	Erlin1	ER lipid raft associated 1		multiple interactions	ISO	19	44,109,433	44,144,275	RGD:6480464	CTD
G	Erlin2	ER lipid raft associated 2		multiple interactions	ISO	8	28,134,331	28,149,896	RGD:6480464	CTD
G	Evi2b	ecotropic viral integration site 2b		decreases expression	ISO	11	79,326,887	79,344,091	RGD:6480464	CTD
G	Exosc3	exosome component 3		multiple interactions	ISO	4	45,329,501	45,333,475	RGD:6480464	CTD
G	Exosc4	exosome component 4		multiple interactions	ISO	15	76,157,827	76,161,100	RGD:6480464	CTD
G	Eya3	eyes absent 3 homolog (Drosophila)		increases expression	ISO	4	132,194,961	132,280,678	RGD:6480464	CTD
G	Fabp1	fatty acid binding protein 1, liver		increases expression	ISO	6	71,149,882	71,155,017	RGD:6480464	CTD
G	Fads3	fatty acid desaturase 3		multiple interactions	ISO	19	10,116,038	10,134,161	RGD:6480464	CTD
G	Fam222b	family with sequence similarity 222, member B		multiple interactions	ISO	11	77,908,175	77,970,841	RGD:6480464	CTD
G	Fbxo8	F-box protein 8		multiple interactions	ISO	8	59,029,931	59,072,736	RGD:6480464	CTD
G	Fchsd2	FCH and double SH3 domains 2		multiple interactions	ISO	7	108,257,289	108,432,919	RGD:6480464	CTD
G	Fdxr	ferredoxin reductase		multiple interactions	ISO	11	115,129,339	115,138,283	RGD:6480464	CTD
G	Fga	fibrinogen alpha chain		increases expression	ISO	3	82,830,075	82,837,549	RGD:6480464	CTD
G	Fgb	fibrinogen beta chain		increases expression	ISO	3	82,846,225	82,853,712	RGD:6480464	CTD
G	Fhl3	four and a half LIM domains 3		multiple interactions	ISO	4	124,377,943	124,385,855	RGD:6480464	CTD
G	Fibp	fibroblast growth factor (acidic) intracellular binding protein		multiple interactions	ISO	19	5,460,694	5,464,994	RGD:6480464	CTD
G	Fip1l1	FIP1 like 1 (S. cerevisiae)		multiple interactions	ISO	5	74,931,507	74,993,149	RGD:6480464	CTD
G	Fitm2	fat storage-inducing transmembrane protein 2		multiple interactions	ISO	2	163,294,439	163,298,365	RGD:6480464	CTD
G	Flot2	flotillin 2		multiple interactions	ISO	11	77,851,443	77,873,934	RGD:6480464	CTD
G	Fnbp4	formin binding protein 4		multiple interactions	ISO	2	90,585,527	90,621,178	RGD:6480464	CTD
G	Fntb	farnesyltransferase, CAAX box, beta		multiple interactions	ISO	12	77,938,454	78,022,399	RGD:6480464	CTD
G	Folr1	folate receptor 1 (adult)		multiple interactions	ISO	7	109,006,845	109,019,197	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	12	86,814,851	86,818,219	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	12	86,814,851	86,818,219	RGD:6480464	CTD
G	Foxf2	forkhead box F2		multiple interactions	ISO	13	31,717,685	31,723,275	RGD:6480464	CTD
G	Foxk2	forkhead box K2		increases expression	ISO	11	121,121,301	121,171,210	RGD:6480464	CTD
G	Fsd1l	fibronectin type III and SPRY domain containing 1-like		increases expression	ISO	4	53,644,427	53,664,491	RGD:6480464	CTD
G	Gabarapl1	gamma-aminobutyric acid (GABA) A receptor-associated protein-like 1		multiple interactions	ISO	6	129,483,210	129,492,349	RGD:6480464	CTD
G	Gabra1	gamma-aminobutyric acid (GABA) A receptor, subunit alpha 1		multiple interactions	EXP	11	41,944,982	41,996,432	RGD:6480464	CTD
G	Gabrb2	gamma-aminobutyric acid (GABA) A receptor, subunit beta 2		multiple interactions	EXP	11	42,233,259	42,446,093	RGD:6480464	CTD
G	Gabrg2	gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2		multiple interactions	EXP	11	41,723,697	41,814,180	RGD:6480464	CTD
G	Gabrr2	gamma-aminobutyric acid (GABA) C receptor, subunit rho 2		multiple interactions	ISO	4	33,150,087	33,182,840	RGD:6480464	CTD
G	Gck	glucokinase		increases expression	ISO	11	5,800,826	5,849,602	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		multiple interactions	ISO	8	73,153,293	73,155,534	RGD:6480464	CTD
G	Gfpt1	glutamine fructose-6-phosphate transaminase 1		increases expression	ISO	6	86,992,840	87,042,201	RGD:6480464	CTD
G	Ggps1	geranylgeranyl diphosphate synthase 1		multiple interactions	ISO	13	14,144,712	14,155,668	RGD:6480464	CTD
G	Gkap1	G kinase anchoring protein 1		increases expression	ISO	13	58,334,712	58,375,549	RGD:6480464	CTD
G	Glrx3	glutaredoxin 3		increases expression	ISO	7	144,629,331	144,660,277	RGD:6480464	CTD
G	Gls	glutaminase		multiple interactions	ISO	1	52,220,293	52,290,076	RGD:6480464	CTD
G	Gm12597	predicted gene 12597		decreases metabolic processing	ISO	4	88,203,577	88,204,149	RGD:6480464	CTD
G	Gm3608	predicted gene 3608		decreases expression	ISO	1	107,352,518	107,355,475	RGD:6480464	CTD
G	Gnai1	guanine nucleotide binding protein (G protein), alpha inhibiting 1		decreases expression	ISO	5	17,770,953	17,866,231	RGD:6480464	CTD
G	Gnai1	guanine nucleotide binding protein (G protein), alpha inhibiting 1		increases expression	ISO	5	17,770,953	17,866,231	RGD:6480464	CTD
G	Gnai2	guanine nucleotide binding protein (G protein), alpha inhibiting 2		decreases expression	ISO	9	107,516,469	107,537,673	RGD:6480464	CTD
G	Gnaq	guanine nucleotide binding protein, alpha q polypeptide		decreases expression	ISO	19	16,207,321	16,461,943	RGD:6480464	CTD
G	Gnas	GNAS (guanine nucleotide binding protein, alpha stimulating) complex locus		decreases expression	ISO	2	174,109,821	174,172,245	RGD:6480464	CTD
G	Gnb1	guanine nucleotide binding protein (G protein), beta 1		multiple interactions	ISO	4	154,865,470	154,933,378	RGD:6480464	CTD
G	Gnb1	guanine nucleotide binding protein (G protein), beta 1		decreases expression	ISO	4	154,865,470	154,933,378	RGD:6480464	CTD
G	Gpatch8	G patch domain containing 8		multiple interactions	ISO	11	102,337,229	102,417,472	RGD:6480464	CTD
G	Gpm6a	glycoprotein m6a		increases expression	ISO	8	56,040,081	56,146,231	RGD:6480464	CTD
G	Gpr137c	G protein-coupled receptor 137C		increases expression	ISO	14	45,839,392	45,900,651	RGD:6480464	CTD
G	Gpx1	glutathione peroxidase 1		decreases expression	ISO	9	108,241,607	108,242,671	RGD:6480464	CTD
G	Grm1	glutamate receptor, metabotropic 1		decreases expression	ISO	10	10,408,551	10,802,129	RGD:6480464	CTD
G	Grm6	glutamate receptor, metabotropic 6		multiple interactions	ISO	11	50,664,187	50,679,710	RGD:6480464	CTD
G	Gsr	glutathione reductase		multiple interactions	ISO	8	34,763,710	34,808,634	RGD:6480464	CTD
G	Gstm2	glutathione S-transferase, mu 2		decreases expression	ISO	3	107,784,620	107,789,354	RGD:6480464	CTD
G	Gstm3	glutathione S-transferase, mu 3		decreases expression	ISO	3	107,766,614	107,772,076	RGD:6480464	CTD
G	Gtpbp5	GTP binding protein 5		multiple interactions	ISO	2	179,805,298	179,820,607	RGD:6480464	CTD
G	H13	histocompatibility 13		affects binding	ISO	2	152,495,197	152,534,404	RGD:6480464	CTD
G	Hadh	hydroxyacyl-Coenzyme A dehydrogenase		decreases expression	ISO	3	130,936,342	130,974,955	RGD:6480464	CTD
G	Hc	hemolytic complement		multiple interactions	ISO	2	34,838,851	34,916,961	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		increases expression	ISO	4	129,193,348	129,219,890	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		increases activity	ISO	4	129,193,348	129,219,890	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		increases expression	ISO	4	129,193,348	129,219,890	RGD:6480464	CTD
G	Hdac1	histone deacetylase 1		increases expression	ISO	4	129,193,348	129,219,890	RGD:6480464	CTD
G	Hdac2	histone deacetylase 2		increases expression	ISO	10	36,694,350	36,721,694	RGD:6480464	CTD
G	Hdac3	histone deacetylase 3		increases activity	ISO	18	38,096,625	38,114,642	RGD:6480464	CTD
G	Hdc	histidine decarboxylase		affects response to substance	EXP	2	126,419,404	126,444,401	RGD:6480464	CTD
G	Helq	helicase, POLQ-like		multiple interactions	ISO	5	101,191,167	101,227,619	RGD:6480464	CTD
G	Hemk1	HemK methyltransferase family member 1		multiple interactions	ISO	9	107,229,413	107,240,681	RGD:6480464	CTD
G	Hibadh	3-hydroxyisobutyrate dehydrogenase		decreases expression	ISO	6	52,496,224	52,590,294	RGD:6480464	CTD
G	Hint1	histidine triad nucleotide binding protein 1		multiple interactions	ISO	11	54,679,940	54,683,998	RGD:6480464	CTD
G	Hist1h2ak	histone cluster 1, H2ak		decreases expression	ISO	13	21,845,304	21,845,696	RGD:6480464	CTD
G	Hist1h3e	histone cluster 1, H3e		multiple interactions	ISO	13	23,653,824	23,654,234	RGD:6480464	CTD
G	Hist2h2aa1	histone cluster 2, H2aa1		multiple interactions	ISO	3	96,043,639	96,044,216	RGD:6480464	CTD
G	Hist4h4	histone cluster 4, H4		multiple interactions	ISO	6	136,752,589	136,752,900	RGD:6480464	CTD
G	Hnrnph3	heterogeneous nuclear ribonucleoprotein H3		multiple interactions	ISO	10	62,477,412	62,486,597	RGD:6480464	CTD
G	Hps4	Hermansky-Pudlak syndrome 4 homolog (human)		decreases expression	ISO	5	112,772,115	112,807,444	RGD:6480464	CTD
G	Hspa2	heat shock protein 2		increases expression	ISO	12	77,505,163	77,507,925	RGD:6480464	CTD
G	Htra2	HtrA serine peptidase 2		multiple interactions	ISO	6	83,001,260	83,004,565	RGD:6480464	CTD
G	Hus1	Hus1 homolog (S. pombe)		decreases expression	ISO	11	8,893,145	8,911,140	RGD:6480464	CTD
G	Icam4	intercellular adhesion molecule 4, Landsteiner-Wiener blood group		multiple interactions	ISO	9	20,833,817	20,834,975	RGD:6480464	CTD
G	Idua	iduronidase, alpha-L-		multiple interactions	ISO	5	109,098,125	109,113,577	RGD:6480464	CTD
G	Ier2	immediate early response 2		multiple interactions	ISO	8	87,185,230	87,186,751	RGD:6480464	CTD
G	Ifng	interferon gamma		decreases expression	ISO	10	117,878,103	117,882,948	RGD:6480464	CTD
G	Ift122	intraflagellar transport 122		multiple interactions	ISO	6	115,803,546	115,876,717	RGD:6480464	CTD
G	Ift57	intraflagellar transport 57		multiple interactions	ISO	16	49,699,407	49,765,239	RGD:6480464	CTD
G	Ift88	intraflagellar transport 88		multiple interactions	ISO	14	58,042,908	58,136,773	RGD:6480464	CTD
G	Igfbp5	insulin-like growth factor binding protein 5		decreases expression	ISO	1	72,904,639	72,921,439	RGD:6480464	CTD
G	Ihh	Indian hedgehog		increases expression	ISO	1	74,991,892	74,998,225	RGD:6480464	CTD
G	Ikbip	IKBKB interacting protein		multiple interactions	ISO	10	90,545,784	90,565,358	RGD:6480464	CTD
G	Il10	interleukin 10		decreases secretion	EXP	1	132,916,422	132,921,547	RGD:6480464	CTD
G	Il12a	interleukin 12a		multiple interactions	ISO	3	68,494,566	68,502,469	RGD:6480464	CTD
G	Il12b	interleukin 12b		multiple interactions	ISO	11	44,213,565	44,227,519	RGD:6480464	CTD
G	Il12b	interleukin 12b		decreases expression	ISO	11	44,213,565	44,227,519	RGD:6480464	CTD
G	Il13	interleukin 13		decreases expression	ISO	11	53,444,825	53,448,204	RGD:6480464	CTD
G	Il13	interleukin 13		decreases secretion	ISO	11	53,444,825	53,448,204	RGD:6480464	CTD
G	Il18	interleukin 18		multiple interactions	ISO	9	50,373,473	50,389,942	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il1b	interleukin 1 beta		multiple interactions	ISO	2	129,190,315	129,196,856	RGD:6480464	CTD
G	Il2	interleukin 2		increases secretion	EXP	3	37,019,635	37,024,876	RGD:6480464	CTD
G	Il2ra	interleukin 2 receptor, alpha chain		decreases expression	ISO	2	11,564,419	11,614,821	RGD:6480464	CTD
G	Il3	interleukin 3		decreases expression	ISO	11	54,078,587	54,080,781	RGD:6480464	CTD
G	Il4	interleukin 4		multiple interactions	ISO	11	53,425,962	53,432,167	RGD:6480464	CTD
G	Il4	interleukin 4		decreases secretion	EXP	11	53,425,962	53,432,167	RGD:6480464	CTD
G	Il4	interleukin 4		decreases expression	ISO	11	53,425,962	53,432,167	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	5	30,339,701	30,346,508	RGD:6480464	CTD
G	Il6	interleukin 6		increases expression	ISO	5	30,339,701	30,346,508	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	5	30,339,701	30,346,508	RGD:6480464	CTD
G	Il6ra	interleukin 6 receptor, alpha		decreases expression	ISO	3	89,673,246	89,717,084	RGD:6480464	CTD
G	Il6st	interleukin 6 signal transducer		increases expression	ISO	13	113,254,278	113,297,068	RGD:6480464	CTD
G	Il8	interleukin 8		decreases expression	ISO	5	91,223,560	91,232,093	RGD:6480464	CTD
G	Il8	interleukin 8		multiple interactions	ISO	5	91,223,560	91,232,093	RGD:6480464	CTD
G	Il8	interleukin 8		multiple interactions	ISO	5	91,223,560	91,232,093	RGD:6480464	CTD
G	Ilk	integrin linked kinase		multiple interactions	ISO	7	112,885,104	112,891,439	RGD:6480464	CTD
G	Inip	INTS3 and NABP interacting protein		multiple interactions	ISO	4	59,782,514	59,796,727	RGD:6480464	CTD
G	Ins1	insulin I		multiple interactions	ISO	19	52,338,813	52,339,966	RGD:6480464	CTD
G	Irf7	interferon regulatory factor 7		decreases expression	ISO	7	148,449,088	148,452,300	RGD:6480464	CTD
G	Irs1	insulin receptor substrate 1		increases expression	ISO	1	82,229,680	82,288,014	RGD:6480464	CTD
G	Itfg1	integrin alpha FG-GAP repeat containing 1		multiple interactions	ISO	8	88,241,456	88,364,848	RGD:6480464	CTD
G	Itgam	integrin alpha M		multiple interactions	ISO	7	135,206,154	135,262,005	RGD:6480464	CTD
G	Itgb2	integrin beta 2		increases expression	ISO	10	76,993,093	77,028,419	RGD:6480464	CTD
G	Itm2b	integral membrane protein 2B		multiple interactions	ISO	14	73,736,789	73,762,615	RGD:6480464	CTD
G	Jak1	Janus kinase 1		multiple interactions	ISO	4	100,824,579	100,937,887	RGD:6480464	CTD
G	Kcnc3	potassium voltage gated channel, Shaw-related subfamily, member 3		multiple interactions	ISO	7	51,846,256	51,860,121	RGD:6480464	CTD
G	Kcnmb4	potassium large conductance calcium-activated channel, subfamily M, beta member 4		multiple interactions	ISO	10	115,854,924	115,910,579	RGD:6480464	CTD
G	Kdm4b	lysine (K)-specific demethylase 4B		multiple interactions	ISO	17	56,465,473	56,542,296	RGD:6480464	CTD
G	Kif1b	kinesin family member 1B		multiple interactions	ISO	4	148,550,430	148,681,807	RGD:6480464	CTD
G	Kin	antigenic determinant of rec-A protein		multiple interactions	ISO	2	10,002,239	10,014,328	RGD:6480464	CTD
G	Klhl7	kelch-like 7		multiple interactions	ISO	5	23,606,408	23,667,049	RGD:6480464	CTD
G	Krt8	keratin 8		increases expression	ISO	15	101,827,142	101,834,773	RGD:6480464	CTD
G	Lamc1	laminin, gamma 1		multiple interactions	ISO	1	155,066,052	155,179,916	RGD:6480464	CTD
G	Lbp	lipopolysaccharide binding protein		increases expression	ISO	2	158,132,229	158,158,588	RGD:6480464	CTD
G	Letm2	leucine zipper-EF-hand containing transmembrane protein 2		decreases expression	ISO	8	26,688,962	26,707,959	RGD:6480464	CTD
G	Lgals3	lectin, galactose binding, soluble 3		increases expression	ISO	14	47,993,535	48,005,842	RGD:6480464	CTD
G	Lhfp	lipoma HMGIC fusion partner		multiple interactions	ISO	3	52,845,469	53,065,601	RGD:6480464	CTD
G	Lhfp	lipoma HMGIC fusion partner		decreases expression	ISO	3	52,845,469	53,065,601	RGD:6480464	CTD
G	Limk1	LIM-domain containing, protein kinase		multiple interactions	ISO	5	135,131,909	135,164,460	RGD:6480464	CTD
G	Lipc	lipase, hepatic		decreases expression	ISO	9	70,645,935	70,782,615	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		multiple interactions	ISO	7	26,164,546	26,181,006	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		increases activity	ISO	7	26,164,546	26,181,006	RGD:6480464	CTD
G	Lipe	lipase, hormone sensitive		affects localization	ISO	7	26,164,546	26,181,006	RGD:6480464	CTD
G	Lpl	lipoprotein lipase		increases expression	ISO	8	71,404,454	71,430,831	RGD:6480464	CTD
G	Lrrc23	leucine rich repeat containing 23		multiple interactions	ISO	6	124,719,881	124,729,736	RGD:6480464	CTD
G	Lst1	leukocyte specific transcript 1		increases expression	ISO	17	35,322,040	35,325,385	RGD:6480464	CTD
G	Ltb	lymphotoxin B		multiple interactions	ISO	17	35,331,452	35,333,250	RGD:6480464	CTD
G	Ltc4s	leukotriene C4 synthase		decreases secretion	ISO	11	50,049,974	50,051,973	RGD:6480464	CTD
G	Ltf	lactotransferrin		decreases expression	ISO	9	110,921,796	110,945,270	RGD:6480464	CTD
G	Lyplal1	lysophospholipase-like 1		multiple interactions	ISO	1	187,911,611	187,941,189	RGD:6480464	CTD
G	Mapk1ip1l	mitogen-activated protein kinase 1 interacting protein 1-like		multiple interactions	ISO	14	47,917,989	47,942,766	RGD:6480464	CTD
G	Mapk7	mitogen-activated protein kinase 7		multiple interactions	ISO	11	61,302,314	61,307,715	RGD:6480464	CTD
G	Mdh1	malate dehydrogenase 1, NAD (soluble)		multiple interactions	ISO	11	21,456,695	21,471,937	RGD:6480464	CTD
G	Med13l	mediator complex subunit 13-like		multiple interactions	ISO	5	119,010,728	119,215,447	RGD:6480464	CTD
G	Med16	mediator complex subunit 16		multiple interactions	ISO	10	79,357,452	79,371,683	RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2A		decreases expression	ISO	7	74,378,710	74,517,744	RGD:6480464	CTD
G	Mettl15	methyltransferase like 15		multiple interactions	ISO	2	108,932,457	109,118,447	RGD:6480464	CTD
G	Mfsd10	major facilitator superfamily domain containing 10		multiple interactions	ISO	5	34,976,296	34,979,763	RGD:6480464	CTD
G	Milr1	mast cell immunoglobulin like receptor 1		decreases expression	ISO	11	106,612,582	106,628,882	RGD:6480464	CTD
G	Mlf1ip	myeloid leukemia factor 1 interacting protein		multiple interactions	ISO	8	47,637,423	47,664,938	RGD:6480464	CTD
G	Mmab	methylmalonic aciduria (cobalamin deficiency) type B homolog (human)		multiple interactions	ISO	5	114,881,043	114,894,036	RGD:6480464	CTD
G	Mon1b	MON1 homolog b (yeast)		decreases expression	ISO	8	116,159,486	116,169,079	RGD:6480464	CTD
G	Mphosph6	M phase phosphoprotein 6		multiple interactions	ISO	8	120,315,545	120,325,829	RGD:6480464	CTD
G	Mpo	myeloperoxidase		decreases expression	ISO	11	87,607,286	87,617,914	RGD:6480464	CTD
G	Mpo	myeloperoxidase		multiple interactions	ISO	11	87,607,286	87,617,914	RGD:6480464	CTD
G	Mtif3	mitochondrial translational initiation factor 3		multiple interactions	ISO	5	147,766,098	147,775,350	RGD:6480464	CTD
G	Mto1	mitochondrial translation optimization 1 homolog (S. cerevisiae)		multiple interactions	ISO	9	78,296,017	78,321,959	RGD:6480464	CTD
G	Mug1	murinoglobulin 1		decreases expression	ISO	6	121,788,559	121,839,075	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		multiple interactions	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		increases expression	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		affects expression	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		increases expression	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		decreases expression	ISO	15	61,816,896	61,821,916	RGD:6480464	CTD
G	Mzt1	mitotic spindle organizing protein 1		decreases expression	ISO	14	99,433,763	99,445,355	RGD:6480464	CTD
G	N4bp2l2	NEDD4 binding protein 2-like 2		multiple interactions	ISO	5	151,438,548	151,468,187	RGD:6480464	CTD
G	Nacc2	nucleus accumbens associated 2, BEN and BTB (POZ) domain containing		increases expression	ISO	2	25,911,056	25,978,331	RGD:6480464	CTD
G	Napepld	N-acyl phosphatidylethanolamine phospholipase D		multiple interactions	ISO	5	21,168,721	21,207,163	RGD:6480464	CTD
G	Narg2	NMDA receptor-regulated gene 2		multiple interactions	ISO	9	69,245,805	69,280,881	RGD:6480464	CTD
G	Nbeal1	neurobeachin like 1		multiple interactions	ISO	1	60,237,443	60,391,549	RGD:6480464	CTD
G	Nck2	non-catalytic region of tyrosine kinase adaptor protein 2		multiple interactions	ISO	1	43,502,596	43,627,363	RGD:6480464	CTD
G	Ndufb2	NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 2		multiple interactions	ISO	6	39,520,009	39,553,417	RGD:6480464	CTD
G	Nedd4l	neural precursor cell expressed, developmentally down-regulated gene 4-like		increases expression	ISO	18	65,047,410	65,377,480	RGD:6480464	CTD
G	Nfkb1	nuclear factor of kappa light polypeptide gene enhancer in B cells 1, p105		multiple interactions	ISO	3	135,247,619	135,354,511	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, alpha		affects expression	ISO	12	56,590,396	56,593,634	RGD:6480464	CTD
G	Nfkbia	nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, alpha		decreases degradation	ISO	12	56,590,396	56,593,634	RGD:6480464	CTD
G	Nlk	nemo like kinase		multiple interactions	ISO	11	78,380,670	78,510,927	RGD:6480464	CTD
G	Nnt	nicotinamide nucleotide transhydrogenase		multiple interactions	ISO	13	120,124,334	120,197,945	RGD:6480464	CTD
G	Nomo1	nodal modulator 1		affects binding	ISO	7	53,289,066	53,339,582	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	ISO	11	78,734,361	78,773,626	RGD:6480464	CTD
G	Nqo2	NAD(P)H dehydrogenase, quinone 2		multiple interactions	ISO	13	34,056,528	34,080,334	RGD:6480464	CTD
G	Nrep	neuronal regeneration related protein		decreases expression	ISO	18	33,596,673	33,623,683	RGD:6480464	CTD
G	Nrxn3	neurexin III		increases expression	ISO	12	90,191,834	91,573,375	RGD:6480464	CTD
G	Nsun4	NOL1/NOP2/Sun domain family, member 4		increases expression	ISO	4	115,704,375	115,726,481	RGD:6480464	CTD
G	Nts	neurotensin		multiple interactions	ISO	10	101,944,390	101,953,052	RGD:6480464	CTD
G	Nup50	nucleoporin 50		multiple interactions	ISO	15	84,753,858	84,773,393	RGD:6480464	CTD
G	Nutf2	nuclear transport factor 2		increases expression	ISO	8	108,384,534	108,404,302	RGD:6480464	CTD
G	Ociad1	OCIA domain containing 1		multiple interactions	ISO	5	73,684,033	73,705,316	RGD:6480464	CTD
G	Olfr732	olfactory receptor 732		increases expression	ISO	14	50,900,903	50,901,946	RGD:6480464	CTD
G	Osbp	oxysterol binding protein		increases expression	ISO	19	12,040,334	12,068,604	RGD:6480464	CTD
G	Otc	ornithine transcarbamylase		decreases expression	ISO	X	9,829,485	9,898,150	RGD:6480464	CTD
G	Otp	orthopedia homolog (Drosophila)		multiple interactions	ISO	13	95,645,582	95,653,636	RGD:6480464	CTD
G	Pan3	PAN3 polyA specific ribonuclease subunit homolog (S. cerevisiae)		multiple interactions	ISO	5	148,242,156	148,360,077	RGD:6480464	CTD
G	Parp1	poly (ADP-ribose) polymerase family, member 1		affects binding	ISO	1	182,499,106	182,531,385	RGD:6480464	CTD
G	Pcp4l1	Purkinje cell protein 4-like 1		multiple interactions	ISO	1	173,103,395	173,126,399	RGD:6480464	CTD
G	Pcsk5	proprotein convertase subtilisin/kexin type 5		increases expression	ISO	19	17,507,322	17,912,122	RGD:6480464	CTD
G	Pde3a	phosphodiesterase 3A, cGMP inhibited		increases expression	ISO	6	141,197,790	141,447,872	RGD:6480464	CTD
G	Pdss2	prenyl (solanesyl) diphosphate synthase, subunit 2		multiple interactions	ISO	10	42,941,292	43,184,688	RGD:6480464	CTD
G	Pea15a	phosphoprotein enriched in astrocytes 15A		decreases expression	ISO	1	174,126,860	174,136,912	RGD:6480464	CTD
G	Pex7	peroxisomal biogenesis factor 7		multiple interactions	ISO	10	19,579,896	19,627,480	RGD:6480464	CTD
G	Phf17	PHD finger protein 17		increases expression	ISO	3	41,359,656	41,420,786	RGD:6480464	CTD
G	Pias1	protein inhibitor of activated STAT 1		multiple interactions	ISO	9	62,727,884	62,828,686	RGD:6480464	CTD
G	Pias2	protein inhibitor of activated STAT 2		multiple interactions	ISO	18	77,303,947	77,394,447	RGD:6480464	CTD
G	Picalm	phosphatidylinositol binding clathrin assembly protein		multiple interactions	ISO	7	97,278,742	97,357,442	RGD:6480464	CTD
G	Pigc	phosphatidylinositol glycan anchor biosynthesis, class C		multiple interactions	ISO	1	163,899,319	163,903,566	RGD:6480464	CTD
G	Pipox	pipecolic acid oxidase		decreases expression	ISO	11	77,694,117	77,707,374	RGD:6480464	CTD
G	Pitpnb	phosphatidylinositol transfer protein, beta		multiple interactions	ISO	5	111,759,783	111,817,379	RGD:6480464	CTD
G	Pkhd1	polycystic kidney and hepatic disease 1		decreases expression	ISO	1	20,047,860	20,608,138	RGD:6480464	CTD
G	Pklr	pyruvate kinase liver and red blood cell		decreases expression	ISO	3	88,940,064	88,950,516	RGD:6480464	CTD
G	Plcb1	phospholipase C, beta 1		multiple interactions	ISO	2	134,611,900	135,300,994	RGD:6480464	CTD
G	Plcb1	phospholipase C, beta 1		decreases expression	ISO	2	134,611,900	135,300,994	RGD:6480464	CTD
G	Pld3	phospholipase D family, member 3		increases expression	ISO	7	28,317,037	28,338,131	RGD:6480464	CTD
G	Plekha1	pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 1		multiple interactions	ISO	7	138,009,424	138,056,816	RGD:6480464	CTD
G	Plrg1	pleiotropic regulator 1, PRL1 homolog (Arabidopsis)		increases expression	ISO	3	82,859,460	82,876,213	RGD:6480464	CTD
G	Polr1b	polymerase (RNA) I polypeptide B		multiple interactions	ISO	2	128,926,732	128,952,331	RGD:6480464	CTD
G	Polr2f	polymerase (RNA) II (DNA directed) polypeptide F		multiple interactions	ISO	15	78,971,797	78,982,197	RGD:6480464	CTD
G	Polr3h	polymerase (RNA) III (DNA directed) polypeptide H		multiple interactions	ISO	15	81,745,460	81,756,643	RGD:6480464	CTD
G	Polr3k	polymerase (RNA) III (DNA directed) polypeptide K		multiple interactions	ISO	2	181,599,065	181,605,535	RGD:6480464	CTD
G	Pomc	pro-opiomelanocortin-alpha		multiple interactions	ISO	12	3,954,951	3,960,618	RGD:6480464	CTD
G	Ppara	peroxisome proliferator activated receptor alpha		multiple interactions	ISO	15	85,565,994	85,637,281	RGD:6480464	CTD
G	Pparg	peroxisome proliferator activated receptor gamma		increases expression	ISO	6	115,311,239	115,440,419	RGD:6480464	CTD
G	Ppp2ca	protein phosphatase 2 (formerly 2A), catalytic subunit, alpha isoform		decreases expression	ISO	11	51,912,326	51,936,251	RGD:6480464	CTD
G	Ppp3cb	protein phosphatase 3, catalytic subunit, beta isoform		decreases expression	ISO	14	21,318,536	21,365,795	RGD:6480464	CTD
G	Prim2	DNA primase, p58 subunit		multiple interactions	ISO	1	33,510,656	33,726,603	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		decreases expression	ISO	15	5,093,861	5,131,899	RGD:6480464	CTD
G	Prkaca	protein kinase, cAMP dependent, catalytic, alpha		multiple interactions	ISO	8	86,496,877	86,520,344	RGD:6480464	CTD
G	Prkca	protein kinase C, alpha		decreases expression	ISO	11	107,794,701	108,205,202	RGD:6480464	CTD
G	Prkra	protein kinase, interferon inducible double stranded RNA dependent activator		multiple interactions	ISO	2	76,467,994	76,486,051	RGD:6480464	CTD
G	Prlr	prolactin receptor		multiple interactions	ISO	15	10,106,993	10,266,775	RGD:6480464	CTD
G	Prpf38b	PRP38 pre-mRNA processing factor 38 (yeast) domain containing B		multiple interactions	ISO	3	108,705,725	108,714,622	RGD:6480464	CTD
G	Psmb1	proteasome (prosome, macropain) subunit, beta type 1		affects expression	ISO	17	15,612,685	15,635,240	RGD:6480464	CTD
G	Psmb10	proteasome (prosome, macropain) subunit, beta type 10		affects expression	ISO	8	108,459,628	108,462,292	RGD:6480464	CTD
G	Psmb2	proteasome (prosome, macropain) subunit, beta type 2		affects expression	ISO	4	126,354,887	126,386,959	RGD:6480464	CTD
G	Psmb5	proteasome (prosome, macropain) subunit, beta type 5		affects expression	ISO	14	55,232,957	55,236,832	RGD:6480464	CTD
G	Psmb8	proteasome (prosome, macropain) subunit, beta type 8 (large multifunctional peptidase 7)		affects expression	ISO	17	34,335,140	34,338,399	RGD:6480464	CTD
G	Psmb9	proteasome (prosome, macropain) subunit, beta type 9 (large multifunctional peptidase 2)		affects expression	ISO	17	34,319,044	34,324,275	RGD:6480464	CTD
G	Ptma	prothymosin alpha		decreases expression	ISO	1	88,423,311	88,427,273	RGD:6480464	CTD
G	Ptp4a1	protein tyrosine phosphatase 4a1		decreases expression	ISO	1	30,997,148	31,006,600	RGD:6480464	CTD
G	Ptpn2	protein tyrosine phosphatase, non-receptor type 2		increases expression	ISO	18	67,825,155	67,884,275	RGD:6480464	CTD
G	Ptpre	protein tyrosine phosphatase, receptor type, E		increases expression	ISO	7	142,729,507	142,877,977	RGD:6480464	CTD
G	Pycr2	pyrroline-5-carboxylate reductase family, member 2		multiple interactions	ISO	1	182,834,405	182,838,219	RGD:6480464	CTD
G	Rab11b	RAB11B, member RAS oncogene family		increases expression	ISO	17	33,879,429	33,897,431	RGD:6480464	CTD
G	Rab21	RAB21, member RAS oncogene family		multiple interactions	ISO	10	114,726,918	114,752,647	RGD:6480464	CTD
G	Rad9a	RAD9 homolog A		decreases expression	ISO	19	4,195,198	4,201,603	RGD:6480464	CTD
G	Rangrf	RAN guanine nucleotide release factor		increases expression	ISO	11	68,785,989	68,787,322	RGD:6480464	CTD
G	Rasal2	RAS protein activator like 2		decreases expression	ISO	1	159,065,314	159,342,726	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		multiple interactions	ISO	14	73,595,309	73,725,598	RGD:6480464	CTD
G	Rbm8a	RNA binding motif protein 8a		multiple interactions	ISO	3	96,433,851	96,437,714	RGD:6480464	CTD
G	Rc3h1	RING CCCH (C3H) domains 1		multiple interactions	ISO	1	162,836,542	162,905,107	RGD:6480464	CTD
G	Rcan1	regulator of calcineurin 1		increases expression	ISO	16	92,392,198	92,466,391	RGD:6480464	CTD
G	Rdh10	retinol dehydrogenase 10 (all-trans)		increases expression	ISO	1	16,095,963	16,122,631	RGD:6480464	CTD
G	Reck	reversion-inducing-cysteine-rich protein with kazal motifs		multiple interactions	ISO	4	43,888,402	43,957,678	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	19	5,637,490	5,648,130	RGD:6480464	CTD
G	Rela	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		affects localization	ISO	19	5,637,490	5,648,130	RGD:6480464	CTD
G	Ren1	renin 1 structural		affects expression	ISO	1	135,247,251	135,256,894	RGD:6480464	CTD
G	Rfk	riboflavin kinase		multiple interactions	ISO	19	17,468,533	17,475,839	RGD:6480464	CTD
G	Rftn1	raftlin lipid raft linker 1		multiple interactions	ISO	17	50,132,632	50,329,822	RGD:6480464	CTD
G	Rgs16	regulator of G-protein signaling 16		increases expression	ISO	1	155,587,483	155,592,598	RGD:6480464	CTD
G	Rhno1	RAD9-HUS1-RAD1 interacting nuclear orphan 1		multiple interactions	ISO	6	128,307,018	128,312,915	RGD:6480464	CTD
G	Rhot2	ras homolog gene family, member T2		multiple interactions	ISO	17	25,975,783	25,981,796	RGD:6480464	CTD
G	Ric3	resistance to inhibitors of cholinesterase 3 homolog (C. elegans)		affects binding	ISO	7	116,177,833	116,226,838	RGD:6480464	CTD
G	Riok3	RIO kinase 3		decreases expression	ISO	18	12,287,359	12,315,876	RGD:6480464	CTD
G	Ripk3	receptor-interacting serine-threonine kinase 3		multiple interactions	ISO	14	56,403,832	56,407,694	RGD:6480464	CTD
G	Rmnd5a	required for meiotic nuclear division 5 homolog A (S. cerevisiae)		multiple interactions	ISO	6	71,338,628	71,390,631	RGD:6480464	CTD
G	Rnaset2a	ribonuclease T2A		multiple interactions	ISO	17	8,321,463	8,340,653	RGD:6480464	CTD
G	Rps15	ribosomal protein S15		decreases expression	ISO	10	79,755,176	79,756,859	RGD:6480464	CTD
G	Sbspon	somatomedin B and thrombospondin, type 1 domain containing		decreases expression	ISO	1	15,843,943	15,882,803	RGD:6480464	CTD
G	Sco2	SCO cytochrome oxidase deficient homolog 2 (yeast)		multiple interactions	ISO	15	89,202,068	89,204,249	RGD:6480464	CTD
G	Sds	serine dehydratase		increases expression	ISO	5	120,926,556	120,933,914	RGD:6480464	CTD
G	Secisbp2	SECIS binding protein 2		multiple interactions	ISO	13	51,747,083	51,779,015	RGD:6480464	CTD
G	Sell	selectin, lymphocyte		multiple interactions	ISO	1	165,992,207	166,010,916	RGD:6480464	CTD
G	Setd2	SET domain containing 2		decreases expression	ISO	9	110,435,101	110,521,137	RGD:6480464	CTD
G	Sftpb	surfactant associated protein B		multiple interactions	ISO	6	72,253,239	72,264,364	RGD:6480464	CTD
G	Sh2d2a	SH2 domain protein 2A		multiple interactions	ISO	3	87,650,677	87,659,644	RGD:6480464	CTD
G	Shprh	SNF2 histone linker PHD RING helicase		multiple interactions	ISO	10	10,869,228	10,935,072	RGD:6480464	CTD
G	Sirt2	sirtuin 2 (silent mating type information regulation 2, homolog) 2 (S. cerevisiae)		multiple interactions	ISO	7	29,551,771	29,573,684	RGD:6480464	CTD
G	Slc12a8	solute carrier family 12 (potassium/chloride transporters), member 8		multiple interactions	ISO	16	33,518,415	33,664,221	RGD:6480464	CTD
G	Slc12a9	solute carrier family 12 (potassium/chloride transporters), member 9		multiple interactions	ISO	5	137,755,786	137,774,810	RGD:6480464	CTD
G	Slc16a1	solute carrier family 16 (monocarboxylic acid transporters), member 1		multiple interactions	ISO	3	104,442,591	104,462,385	RGD:6480464	CTD
G	Slc25a24	solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 24		multiple interactions	ISO	3	108,926,067	108,971,327	RGD:6480464	CTD
G	Slc39a9	solute carrier family 39 (zinc transporter), member 9		increases expression	ISO	12	81,745,202	81,784,329	RGD:6480464	CTD
G	Slc5a5	solute carrier family 5 (sodium iodide symporter), member 5		increases expression	ISO	8	73,406,788	73,416,656	RGD:6480464	CTD
G	Slco1b2	solute carrier organic anion transporter family, member 1b2		increases expression	ISO	6	141,578,039	141,635,156	RGD:6480464	CTD
G	Slmap	sarcolemma associated protein		multiple interactions	ISO	14	27,232,661	27,353,226	RGD:6480464	CTD
G	Smad2	SMAD family member 2		multiple interactions	ISO	18	76,401,579	76,465,385	RGD:6480464	CTD
G	Smad5	SMAD family member 5		multiple interactions	ISO	13	56,804,371	56,843,739	RGD:6480464	CTD
G	Smek2	SMEK homolog 2, suppressor of mek1 (Dictyostelium)		multiple interactions	ISO	11	29,072,907	29,120,797	RGD:6480464	CTD
G	Smim7	small integral membrane protein 7		multiple interactions	ISO	8	75,089,097	75,094,947	RGD:6480464	CTD
G	Smu1	smu-1 suppressor of mec-8 and unc-52 homolog (C. elegans)		increases expression	ISO	4	40,682,682	40,704,918	RGD:6480464	CTD
G	Snap23	synaptosomal-associated protein 23		multiple interactions	ISO	2	120,393,407	120,426,458	RGD:6480464	CTD
G	Snx13	sorting nexin 13		multiple interactions	ISO	12	35,731,861	35,832,149	RGD:6480464	CTD
G	Spats2l	spermatogenesis associated, serine-rich 2-like		decreases expression	ISO	1	57,831,705	58,005,241	RGD:6480464	CTD
G	Srebf1	sterol regulatory element binding transcription factor 1		decreases expression	ISO	11	60,012,591	60,034,106	RGD:6480464	CTD
G	Srr	serine racemase		decreases expression	ISO	11	74,719,861	74,739,300	RGD:6480464	CTD
G	Srsf3	serine/arginine-rich splicing factor 3		multiple interactions	ISO	17	29,169,618	29,180,311	RGD:6480464	CTD
G	Ssr1	signal sequence receptor, alpha		decreases expression	ISO	13	38,063,270	38,086,059	RGD:6480464	CTD
G	Ssr3	signal sequence receptor, gamma		increases expression	ISO	3	65,183,579	65,196,475	RGD:6480464	CTD
G	Sst	somatostatin		increases secretion	ISO	16	23,889,667	23,890,930	RGD:6480464	CTD
G	St3gal3	ST3 beta-galactoside alpha-2,3-sialyltransferase 3		multiple interactions	ISO	4	117,604,758	117,807,519	RGD:6480464	CTD
G	Stam2	signal transducing adaptor molecule (SH3 domain and ITAM motif) 2		multiple interactions	ISO	2	52,547,725	52,601,183	RGD:6480464	CTD
G	Stat3	signal transducer and activator of transcription 3		increases expression	ISO	11	100,748,124	100,800,825	RGD:6480464	CTD
G	Stk24	serine/threonine kinase 24		multiple interactions	ISO	14	121,685,563	121,778,452	RGD:6480464	CTD
G	Stk35	serine/threonine kinase 35		multiple interactions	ISO	2	129,626,253	129,658,023	RGD:6480464	CTD
G	Supt6	suppressor of Ty 6		decreases expression	ISO	11	78,020,251	78,059,205	RGD:6480464	CTD
G	Tac1	tachykinin 1		multiple interactions	ISO	6	7,505,071	7,512,973	RGD:6480464	CTD
G	Taf1a	TATA box binding protein (Tbp)-associated factor, RNA polymerase I, A		increases expression	ISO				RGD:6480464	CTD
G	Tars2	threonyl-tRNA synthetase 2, mitochondrial (putative)		multiple interactions	ISO	3	95,543,897	95,558,900	RGD:6480464	CTD
G	Tas2r140	taste receptor, type 2, member 140		multiple interactions	ISO	6	133,004,873	133,005,811	RGD:6480464	CTD
G	Tbca	tubulin cofactor A		increases expression	ISO	13	95,558,898	95,612,854	RGD:6480464	CTD
G	Tbxas1	thromboxane A synthase 1, platelet		multiple interactions	ISO	6	38,868,985	39,034,578	RGD:6480464	CTD
G	Tcf3	transcription factor 3		multiple interactions	ISO	10	79,871,910	79,896,398	RGD:6480464	CTD
G	Tcn2	transcobalamin 2		increases expression	ISO	11	3,817,080	3,832,081	RGD:6480464	CTD
G	Tefm	transcription elongation factor, mitochondrial		multiple interactions	ISO	11	79,950,180	79,955,655	RGD:6480464	CTD
G	Tesk1	testis specific protein kinase 1		increases expression	ISO	4	43,455,149	43,460,947	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		multiple interactions	ISO	7	26,472,021	26,490,015	RGD:6480464	CTD
G	Tgif1	TGFB-induced factor homeobox 1		increases expression	ISO	17	71,193,545	71,202,872	RGD:6480464	CTD
G	Thrsp	thyroid hormone responsive		decreases expression	ISO	7	104,561,467	104,566,020	RGD:6480464	CTD
G	Timp1	tissue inhibitor of metalloproteinase 1		increases expression	ISO	X	20,447,292	20,451,863	RGD:6480464	CTD
G	Tmc5	transmembrane channel-like gene family 5		multiple interactions	ISO	7	125,740,811	125,818,599	RGD:6480464	CTD
G	Tmed4	transmembrane emp24 protein transport domain containing 4		multiple interactions	ISO	11	6,170,717	6,174,840	RGD:6480464	CTD
G	Tmem106b	transmembrane protein 106B		multiple interactions	ISO	6	13,019,759	13,039,269	RGD:6480464	CTD
G	Tmem19	transmembrane protein 19		decreases expression	ISO	10	114,777,795	114,799,318	RGD:6480464	CTD
G	Tmem243	transmembrane protein 243, mitochondrial		multiple interactions	ISO	5	9,100,737	9,118,983	RGD:6480464	CTD
G	Tmem260	transmembrane protein 260		multiple interactions	ISO	14	49,066,027	49,134,834	RGD:6480464	CTD
G	Tmem63a	transmembrane protein 63a		decreases expression	ISO	1	182,872,649	182,905,235	RGD:6480464	CTD
G	Tmem80	transmembrane protein 80		multiple interactions	ISO	7	148,514,029	148,523,054	RGD:6480464	CTD
G	Tmem87b	transmembrane protein 87B		multiple interactions	ISO	2	128,644,039	128,679,997	RGD:6480464	CTD
G	Tmx3	thioredoxin-related transmembrane protein 3		increases expression	ISO	18	90,679,546	90,712,659	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		decreases secretion	EXP	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	17	35,336,335	35,338,941	RGD:6480464	CTD
G	Tnfaip8	tumor necrosis factor, alpha-induced protein 8		multiple interactions	ISO	18	50,139,081	50,252,883	RGD:6480464	CTD
G	Tpmt	thiopurine methyltransferase		increases expression	ISO	13	47,118,912	47,138,586	RGD:6480464	CTD
G	Tpp2	tripeptidyl peptidase II		multiple interactions	ISO	1	43,990,852	44,059,816	RGD:6480464	CTD
G	Traf1	TNF receptor-associated factor 1		decreases expression	ISO	2	34,798,778	34,817,292	RGD:6480464	CTD
G	Trmt10a	tRNA methyltransferase 10A		multiple interactions	ISO	3	137,806,502	137,822,785	RGD:6480464	CTD
G	Trmt10a	tRNA methyltransferase 10A		decreases expression	ISO	3	137,806,502	137,822,785	RGD:6480464	CTD
G	Trmt61a	tRNA methyltransferase 61A		multiple interactions	ISO	12	112,916,316	112,922,113	RGD:6480464	CTD
G	Trp53	transformation related protein 53		multiple interactions	ISO	11	69,393,861	69,405,375	RGD:6480464	CTD
G	Trp53	transformation related protein 53		decreases expression	ISO	11	69,393,861	69,405,375	RGD:6480464	CTD
G	Trp53	transformation related protein 53		decreases expression	ISO	11	69,393,861	69,405,375	RGD:6480464	CTD
G	Trpm7	transient receptor potential cation channel, subfamily M, member 7		multiple interactions	ISO	2	126,617,294	126,701,997	RGD:6480464	CTD
G	Ttc3	tetratricopeptide repeat domain 3		multiple interactions	ISO	16	94,592,346	94,690,828	RGD:6480464	CTD
G	Ttc37	tetratricopeptide repeat domain 37		decreases expression	ISO	13	76,236,182	76,325,431	RGD:6480464	CTD
G	Ttll3	tubulin tyrosine ligase-like family, member 3		affects binding	ISO	6	113,339,254	113,364,577	RGD:6480464	CTD
G	Ttn	titin		multiple interactions	ISO	2	76,542,041	76,820,604	RGD:6480464	CTD
G	Tuba1b	tubulin, alpha 1B		multiple interactions	ISO	15	98,761,860	98,764,821	RGD:6480464	CTD
G	Tubd1	tubulin, delta 1		multiple interactions	ISO	11	86,358,510	86,380,862	RGD:6480464	CTD
G	Tusc3	tumor suppressor candidate 3		increases expression	ISO	8	40,068,921	40,193,932	RGD:6480464	CTD
G	Tyr	tyrosinase		increases expression	EXP	7	94,575,915	94,641,921	RGD:6480464	CTD
G	Uba1	ubiquitin-like modifier activating enzyme 1		affects expression	ISO	X	20,235,547	20,260,305	RGD:6480464	CTD
G	Ube2d3	ubiquitin-conjugating enzyme E2D 3		affects expression	ISO	3	135,101,723	135,130,142	RGD:6480464	CTD
G	Ubfd1	ubiquitin family domain containing 1		multiple interactions	ISO	7	129,210,712	129,225,713	RGD:6480464	CTD
G	Ubqln2	ubiquilin 2		increases expression	ISO	X	149,932,775	149,936,105	RGD:6480464	CTD
G	Ubtf	upstream binding transcription factor, RNA polymerase I		multiple interactions	ISO	11	102,165,874	102,180,410	RGD:6480464	CTD
G	Uchl1	ubiquitin carboxy-terminal hydrolase L1		affects expression	ISO	5	67,067,360	67,078,473	RGD:6480464	CTD
G	Ufm1	ubiquitin-fold modifier 1		multiple interactions	ISO	3	53,659,131	53,667,729	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		decreases expression	ISO	5	87,429,885	87,442,299	RGD:6480464	CTD
G	Ugt2b38	UDP glucuronosyltransferase 2 family, polypeptide B38		decreases expression	ISO	5	87,838,964	87,853,228	RGD:6480464	CTD
G	Utp15	UTP15, U3 small nucleolar ribonucleoprotein, homolog (yeast)		increases expression	ISO	13	99,016,800	99,032,947	RGD:6480464	CTD
G	Uvrag	UV radiation resistance associated gene		multiple interactions	ISO	7	106,035,253	106,289,654	RGD:6480464	CTD
G	Vegfc	vascular endothelial growth factor C		increases expression	ISO	8	55,162,886	55,271,808	RGD:6480464	CTD
G	Vps26a	vacuolar protein sorting 26 homolog A (yeast)		multiple interactions	ISO	10	61,917,591	61,949,553	RGD:6480464	CTD
G	Vsx1	visual system homeobox 1 homolog (zebrafish)		multiple interactions	ISO	2	150,506,438	150,514,873	RGD:6480464	CTD
G	Wbscr16	Williams-Beuren syndrome chromosome region 16 homolog (human)		multiple interactions	ISO	5	134,623,928	134,652,637	RGD:6480464	CTD
G	Wdr20a	WD repeat domain 20A		multiple interactions	ISO	12	111,976,159	112,033,238	RGD:6480464	CTD
G	Wdr20b	WD repeat domain 20b		multiple interactions	ISO	12	66,326,504	66,329,441	RGD:6480464	CTD
G	Wdyhv1	WDYHV motif containing 1		multiple interactions	ISO	15	57,972,991	57,990,209	RGD:6480464	CTD
G	Whsc1l1	Wolf-Hirschhorn syndrome candidate 1-like 1 (human)		multiple interactions	ISO	8	26,712,778	26,830,139	RGD:6480464	CTD
G	Wtap	Wilms' tumour 1-associating protein		multiple interactions	ISO	17	13,159,665	13,185,405	RGD:6480464	CTD
G	Wwox	WW domain-containing oxidoreductase		multiple interactions	ISO	8	116,963,552	117,876,612	RGD:6480464	CTD
G	Xiap	X-linked inhibitor of apoptosis		increases expression	ISO	X	39,421,013	39,462,841	RGD:6480464	CTD
G	Xylb	xylulokinase homolog (H. influenzae)		multiple interactions	ISO	9	119,266,499	119,302,438	RGD:6480464	CTD
G	Yap1	yes-associated protein 1		decreases expression	ISO	9	7,931,999	8,004,596	RGD:6480464	CTD
G	Yipf4	Yip1 domain family, member 4		multiple interactions	ISO	17	74,888,854	74,899,617	RGD:6480464	CTD
G	Yipf6	Yip1 domain family, member 6		increases expression	ISO	X	96,133,120	96,144,360	RGD:6480464	CTD
G	Ythdc1	YTH domain containing 1		increases expression	ISO	5	87,233,515	87,265,682	RGD:6480464	CTD
G	Zbtb18	zinc finger and BTB domain containing 18		multiple interactions	ISO	1	179,374,792	179,380,895	RGD:6480464	CTD
G	Zbtb25	zinc finger and BTB domain containing 25		multiple interactions	ISO	12	77,449,887	77,470,547	RGD:6480464	CTD
G	Zbtb45	zinc finger and BTB domain containing 45		multiple interactions	ISO	7	13,591,015	13,595,149	RGD:6480464	CTD
G	Zcchc10	zinc finger, CCHC domain containing 10		multiple interactions	ISO	11	53,138,191	53,146,803	RGD:6480464	CTD
G	Zdhhc11	zinc finger, DHHC domain containing 11		decreases expression	ISO	13	74,101,310	74,130,288	RGD:6480464	CTD
G	Zfand3	zinc finger, AN1-type domain 3		multiple interactions	ISO	17	30,142,032	30,346,965	RGD:6480464	CTD
G	Zfp191	zinc finger protein 191		multiple interactions	ISO	18	24,170,768	24,179,272	RGD:6480464	CTD
G	Zfp354a	zinc finger protein 354A		multiple interactions	ISO	11	50,872,759	50,886,301	RGD:6480464	CTD
G	Zfp788	zinc finger protein 788		multiple interactions	ISO	7	48,888,901	48,906,904	RGD:6480464	CTD
G	Zfpl1	zinc finger like protein 1		multiple interactions	ISO	19	6,080,762	6,084,891	RGD:6480464	CTD
G	Zrsr2	zinc finger (CCCH type), RNA binding motif and serine/arginine rich 2		decreases expression	ISO	X	160,373,375	160,396,598	RGD:6480464	CTD
G	Zxdc	ZXD family zinc finger C		multiple interactions	ISO	6	90,319,488	90,353,480	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	510113
role	499731
biological role	497863
immunomodulator	23881
theophylline	592
aminophylline	0
Path 2
Term	Annotations
CHEBI ontology	510113
subatomic particle	509030
composite particle	509030
hadron	509030
baryon	509030
nucleon	509030
atomic nucleus	509030
atom	509030
main group element atom	478086
p-block element atom	475563
carbon group element atom	426237
carbon atom	422681
organic molecular entity	422675
organic molecule	372372
organic cyclic compound	309983
organic heterocyclic compound	160993
organic heteropolycyclic compound	98897
organic heterobicyclic compound	60119
imidazopyrimidine	5078
purines	5078
oxopurine	2029
xanthine	1684
methylxanthine	1197
dimethylxanthine	616
theophylline	592
aminophylline	0