2,3,7,8-tetrachlorodibenzodioxine - Ontology Report

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	2,3,7,8-tetrachlorodibenzodioxine	go back to main search page
Accession:	CHEBI:28119	browse the term
Definition:	A polychlorinated dibenzodioxine that has formula C12H4Cl4O2.
Synonyms:	exact_synonym:	2,3,7,8-tetrachlorooxanthrene
	related_synonym:	2,3,7,8-Tetrachlorodibenzo-p-dioxin; 2,3,7,8-Tetrachlorodibenzodioxin; C12H4Cl4O2; Clc1cc2Oc3cc(Cl)c(Cl)cc3Oc2cc1Cl; Dioxin; InChI=1S/C12H4Cl4O2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4H; InChIKey=HGUFODBRKLSHSI-UHFFFAOYSA-N; TCDD; Tetrachlorodibenzodioxin; dioxine; tetradioxin
	alt_id:	CHEBI:19302; CHEBI:869
	xref_casrn:	1746-01-6
	xref:	Beilstein:271116 "Beilstein Registry Number"; ChEMBL:143756 "ChEMBL COMPOUND"; ChemIDplus:1746-01-6 "CAS Registry Number"; Gmelin:366537 "Gmelin Registry Number"; KEGG COMPOUND:1746-01-6 "CAS Registry Number"; KEGG COMPOUND:C07557 "KEGG COMPOUND"
	xref_mesh:	MESH:D013749
	xref:	NIST Chemistry WebBook:1746-01-6 "CAS Registry Number"; Wikipedia:2\,3\,7\,8-Tetrachlorodibenzo-P-Dioxin "Wikipedia"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

2,3,7,8-tetrachlorodibenzodioxine
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	AAED1	AhpC/TSA antioxidant enzyme domain containing 1		increases expression	EXP	9	99,403,533	99,417,599	RGD:6480464	CTD
G	ABRACL	ABRA C-terminal like		increases expression	EXP	6	139,349,819	139,364,439	RGD:6480464	CTD
G	ACYP2	acylphosphatase 2, muscle type		multiple interactions	ISO	2	54,342,410	54,532,437	RGD:6480464	CTD
G	ADAT2	adenosine deaminase, tRNA-specific 2		multiple interactions	ISO	6	143,743,969	143,771,841	RGD:6480464	CTD
G	ADIRF	adipogenesis regulatory factor		decreases expression	EXP	10	88,728,188	88,730,666	RGD:6480464	CTD
G	AGO4	argonaute RISC catalytic component 4		affects expression	ISO	1	36,273,828	36,323,491	RGD:6480464	CTD
G	ALPPL2	alkaline phosphatase, placental-like 2		multiple interactions	ISO	2	233,271,552	233,275,424	RGD:6480464	CTD
G	ANKHD1	ankyrin repeat and KH domain containing 1		decreases expression	ISO	5	139,781,399	139,919,441	RGD:6480464	CTD
G	ANTXR2	anthrax toxin receptor 2		multiple interactions	ISO	4	80,822,771	80,994,477	RGD:6480464	CTD
G	ANTXR2	anthrax toxin receptor 2		multiple interactions	ISO	4	80,822,771	80,994,477	RGD:6480464	CTD
G	ANTXR2	anthrax toxin receptor 2		multiple interactions	ISO	4	80,822,771	80,994,477	RGD:6480464	CTD
G	ANTXR2	anthrax toxin receptor 2		increases expression	ISO	4	80,822,771	80,994,477	RGD:6480464	CTD
G	ARHGEF28	Rho guanine nucleotide exchange factor (GEF) 28		increases expression	ISO	5	72,921,983	73,237,818	RGD:6480464	CTD
G	ARL14EP	ADP-ribosylation factor-like 14 effector protein		decreases expression	EXP	11	30,344,649	30,359,165	RGD:6480464	CTD
G	ARPC1A	actin related protein 2/3 complex, subunit 1A, 41kDa		increases expression	ISO	7	98,923,496	98,963,885	RGD:6480464	CTD
G	AXL	AXL receptor tyrosine kinase		increases expression	EXP	19	41,725,108	41,767,671	RGD:6480464	CTD
G	AZGP1	alpha-2-glycoprotein 1, zinc-binding		multiple interactions	ISO	7	99,564,350	99,573,735	RGD:6480464	CTD
G	AZGP1	alpha-2-glycoprotein 1, zinc-binding		decreases expression	ISO	7	99,564,350	99,573,735	RGD:6480464	CTD
G	AZI2	5-azacytidine induced 2		multiple interactions	ISO	3	28,363,845	28,390,618	RGD:6480464	CTD
G	B2M	beta-2-microglobulin		increases expression	EXP	15	45,003,685	45,010,357	RGD:6480464	CTD
G	B2M	beta-2-microglobulin		decreases expression	ISO	15	45,003,685	45,010,357	RGD:6480464	CTD
G	B2M	beta-2-microglobulin		decreases expression	ISO	15	45,003,685	45,010,357	RGD:6480464	CTD
G	B3GALNT2	beta-1,3-N-acetylgalactosaminyltransferase 2		increases expression	ISO	1	235,610,533	235,667,781	RGD:6480464	CTD
G	B3GALT2	UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 2		increases expression	ISO	1	193,147,860	193,155,743	RGD:6480464	CTD
G	B3GNT1	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 1		multiple interactions	ISO	11	66,112,843	66,115,161	RGD:6480464	CTD
G	B3GNT5	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 5		decreases expression	EXP	3	182,971,032	182,991,179	RGD:6480464	CTD
G	B3GNT7	UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 7		multiple interactions	ISO	2	232,260,335	232,265,875	RGD:6480464	CTD
G	B4GALNT1	beta-1,4-N-acetyl-galactosaminyl transferase 1		multiple interactions	ISO	12	58,019,551	58,026,985	RGD:6480464	CTD
G	B4GALNT1	beta-1,4-N-acetyl-galactosaminyl transferase 1		decreases expression	ISO	12	58,019,551	58,026,985	RGD:6480464	CTD
G	B4GALT1	UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 1		increases expression	EXP	9	33,110,639	33,167,356	RGD:6480464	CTD
G	B4GALT6	UDP-Gal:betaGlcNAc beta 1,4- galactosyltransferase, polypeptide 6		decreases expression	ISO	18	29,202,209	29,264,686	RGD:6480464	CTD
G	B9D1	B9 protein domain 1		multiple interactions	ISO	17	19,240,867	19,281,495	RGD:6480464	CTD
G	BAAT	bile acid CoA: amino acid N-acyltransferase (glycine N-choloyltransferase)		decreases expression	EXP	9	104,122,699	104,147,287	RGD:6480464	CTD
G	BACH1	BTB and CNC homology 1, basic leucine zipper transcription factor 1		decreases expression	EXP	21	30,671,220	30,734,217	RGD:6480464	CTD
G	BACH1	BTB and CNC homology 1, basic leucine zipper transcription factor 1		increases expression	ISO	21	30,671,220	30,734,217	RGD:6480464	CTD
G	BACH2	BTB and CNC homology 1, basic leucine zipper transcription factor 2		multiple interactions	ISO	6	90,636,247	91,006,627	RGD:6480464	CTD
G	BACH2	BTB and CNC homology 1, basic leucine zipper transcription factor 2		increases expression	ISO	6	90,636,247	91,006,627	RGD:6480464	CTD
G	BACH2	BTB and CNC homology 1, basic leucine zipper transcription factor 2		multiple interactions	ISO	6	90,636,247	91,006,627	RGD:6480464	CTD
G	BAD	BCL2-associated agonist of cell death		increases expression	EXP	11	64,037,300	64,052,176	RGD:6480464	CTD
G	BAD	BCL2-associated agonist of cell death		increases expression	ISO	11	64,037,300	64,052,176	RGD:6480464	CTD
G	BAG3	BCL2-associated athanogene 3		multiple interactions	ISO	10	121,410,882	121,437,331	RGD:6480464	CTD
G	BAI2	brain-specific angiogenesis inhibitor 2		multiple interactions	ISO	1	32,192,718	32,229,648	RGD:6480464	CTD
G	BAIAP2	BAI1-associated protein 2		multiple interactions	ISO	17	79,008,947	79,091,232	RGD:6480464	CTD
G	BAIAP2L1	BAI1-associated protein 2-like 1		decreases expression	ISO	7	97,920,962	98,030,427	RGD:6480464	CTD
G	BAIAP2L1	BAI1-associated protein 2-like 1		increases expression	ISO	7	97,920,962	98,030,427	RGD:6480464	CTD
G	BAIAP2L1	BAI1-associated protein 2-like 1		multiple interactions	ISO	7	97,920,962	98,030,427	RGD:6480464	CTD
G	BAK1	BCL2-antagonist/killer 1		increases expression	ISO	6	33,540,323	33,548,070	RGD:6480464	CTD
G	BAMBI	BMP and activin membrane-bound inhibitor homolog (Xenopus laevis)		multiple interactions	EXP	10	28,966,424	28,971,868	RGD:6480464	CTD
G	BAMBI	BMP and activin membrane-bound inhibitor homolog (Xenopus laevis)		increases expression	EXP	10	28,966,424	28,971,868	RGD:6480464	CTD
G	BANF1	barrier to autointegration factor 1		multiple interactions	ISO	11	65,769,550	65,771,617	RGD:6480464	CTD
G	BANK1	B-cell scaffold protein with ankyrin repeats 1		multiple interactions	ISO	4	102,711,764	102,995,969	RGD:6480464	CTD
G	BANK1	B-cell scaffold protein with ankyrin repeats 1		decreases expression	ISO	4	102,711,764	102,995,969	RGD:6480464	CTD
G	BCL6B	B-cell CLL/lymphoma 6, member B		increases expression	ISO	17	6,926,369	6,932,961	RGD:6480464	CTD
G	BCL6B	B-cell CLL/lymphoma 6, member B		multiple interactions	ISO	17	6,926,369	6,932,961	RGD:6480464	CTD
G	BCL7A	B-cell CLL/lymphoma 7A		decreases expression	EXP	12	122,459,861	122,499,950	RGD:6480464	CTD
G	BCL7C	B-cell CLL/lymphoma 7C		increases methylation	ISO	16	30,899,116	30,905,399	RGD:6480464	CTD
G	BCL9	B-cell CLL/lymphoma 9		increases expression	ISO	1	147,013,182	147,098,017	RGD:6480464	CTD
G	BCLAF1	BCL2-associated transcription factor 1		increases expression	ISO	6	136,578,001	136,610,989	RGD:6480464	CTD
G	BCLAF1	BCL2-associated transcription factor 1		multiple interactions	ISO	6	136,578,001	136,610,989	RGD:6480464	CTD
G	BCO2	beta-carotene oxygenase 2		decreases expression	EXP	11	112,046,208	112,089,652	RGD:6480464	CTD
G	BCR	breakpoint cluster region		increases expression	EXP	22	23,522,552	23,660,224	RGD:6480464	CTD
G	BCS1L	BC1 (ubiquinol-cytochrome c reductase) synthesis-like		multiple interactions	ISO	2	219,524,379	219,528,166	RGD:6480464	CTD
G	BCS1L	BC1 (ubiquinol-cytochrome c reductase) synthesis-like		increases expression	ISO	2	219,524,379	219,528,166	RGD:6480464	CTD
G	BDH1	3-hydroxybutyrate dehydrogenase, type 1		multiple interactions	EXP	3	197,236,654	197,300,194	RGD:6480464	CTD
G	BDH1	3-hydroxybutyrate dehydrogenase, type 1		decreases expression	EXP	3	197,236,654	197,300,194	RGD:6480464	CTD
G	BDH1	3-hydroxybutyrate dehydrogenase, type 1		decreases expression	ISO	3	197,236,654	197,300,194	RGD:6480464	CTD
G	BDKRB2	bradykinin receptor B2		multiple interactions	EXP	14	96,671,135	96,710,666	RGD:6480464	CTD
G	BDKRB2	bradykinin receptor B2		decreases expression	EXP	14	96,671,135	96,710,666	RGD:6480464	CTD
G	BDKRB2	bradykinin receptor B2		increases expression	EXP	14	96,671,135	96,710,666	RGD:6480464	CTD
G	BDNF	brain-derived neurotrophic factor		increases expression	ISO	11	27,676,440	27,743,605	RGD:6480464	CTD
G	BDNF	brain-derived neurotrophic factor		affects expression	ISO	11	27,676,440	27,743,605	RGD:6480464	CTD
G	BECN1	beclin 1, autophagy related		multiple interactions	ISO	17	40,962,150	40,976,310	RGD:6480464	CTD
G	BET1	Bet1 golgi vesicular membrane trafficking protein		multiple interactions	ISO	7	93,621,000	93,633,690	RGD:6480464	CTD
G	BET1L	Bet1 golgi vesicular membrane trafficking protein-like		multiple interactions	ISO	11	202,924	207,422	RGD:6480464	CTD
G	BET1L	Bet1 golgi vesicular membrane trafficking protein-like		increases expression	ISO	11	202,924	207,422	RGD:6480464	CTD
G	BEX1	brain expressed, X-linked 1		multiple interactions	ISO	X	102,317,581	102,319,168	RGD:6480464	CTD
G	BFSP2	beaded filament structural protein 2, phakinin		multiple interactions	EXP	3	133,118,790	133,194,056	RGD:6480464	CTD
G	BFSP2	beaded filament structural protein 2, phakinin		increases expression	EXP	3	133,118,790	133,194,056	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		multiple interactions	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		multiple interactions	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGLAP	bone gamma-carboxyglutamate (gla) protein		decreases expression	ISO	1	156,211,951	156,213,123	RGD:6480464	CTD
G	BGN	biglycan		decreases expression	ISO	X	152,760,347	152,775,004	RGD:6480464	CTD
G	BGN	biglycan		increases expression	ISO	X	152,760,347	152,775,004	RGD:6480464	CTD
G	BHLHA15	basic helix-loop-helix family, member a15		multiple interactions	ISO	7	97,841,566	97,842,271	RGD:6480464	CTD
G	BHLHA15	basic helix-loop-helix family, member a15		increases expression	ISO	7	97,841,566	97,842,271	RGD:6480464	CTD
G	BHLHE40	basic helix-loop-helix family, member e40		decreases expression	EXP	3	5,021,097	5,026,866	RGD:6480464	CTD
G	BHLHE40	basic helix-loop-helix family, member e40		decreases expression	ISO	3	5,021,097	5,026,866	RGD:6480464	CTD
G	BHLHE40	basic helix-loop-helix family, member e40		increases expression	ISO	3	5,021,097	5,026,866	RGD:6480464	CTD
G	BHLHE40	basic helix-loop-helix family, member e40		increases expression	ISO	3	5,021,097	5,026,866	RGD:6480464	CTD
G	BHMT	betaine--homocysteine S-methyltransferase		decreases expression	ISO	5	78,407,604	78,428,113	RGD:6480464	CTD
G	BHMT	betaine--homocysteine S-methyltransferase		increases expression	ISO	5	78,407,604	78,428,113	RGD:6480464	CTD
G	BHMT2	betaine--homocysteine S-methyltransferase 2		multiple interactions	ISO	5	78,365,547	78,385,897	RGD:6480464	CTD
G	BHMT2	betaine--homocysteine S-methyltransferase 2		increases expression	ISO	5	78,365,547	78,385,897	RGD:6480464	CTD
G	BICC1	bicaudal C homolog 1 (Drosophila)		increases expression	EXP	10	60,272,904	60,588,845	RGD:6480464	CTD
G	BICD2	bicaudal D homolog 2 (Drosophila)		increases expression	EXP	9	95,473,645	95,527,083	RGD:6480464	CTD
G	BICD2	bicaudal D homolog 2 (Drosophila)		increases expression	ISO	9	95,473,645	95,527,083	RGD:6480464	CTD
G	BICD2	bicaudal D homolog 2 (Drosophila)		multiple interactions	ISO	9	95,473,645	95,527,083	RGD:6480464	CTD
G	BID	BH3 interacting domain death agonist		increases cleavage	ISO	22	18,216,906	18,257,431	RGD:6480464	CTD
G	BID	BH3 interacting domain death agonist		increases expression	ISO	22	18,216,906	18,257,431	RGD:6480464	CTD
G	BIK	BCL2-interacting killer (apoptosis-inducing)		decreases expression	EXP	22	43,506,754	43,525,718	RGD:6480464	CTD
G	BIK	BCL2-interacting killer (apoptosis-inducing)		increases expression	EXP	22	43,506,754	43,525,718	RGD:6480464	CTD
G	BIK	BCL2-interacting killer (apoptosis-inducing)		affects expression	ISO	22	43,506,754	43,525,718	RGD:6480464	CTD
G	BIK	BCL2-interacting killer (apoptosis-inducing)		multiple interactions	EXP	22	43,506,754	43,525,718	RGD:6480464	CTD
G	BIK	BCL2-interacting killer (apoptosis-inducing)		increases expression	ISO	22	43,506,754	43,525,718	RGD:6480464	CTD
G	BIN3	bridging integrator 3		multiple interactions	ISO	8	22,477,931	22,526,661	RGD:6480464	CTD
G	BIRC2	baculoviral IAP repeat containing 2		increases expression	ISO	11	102,217,913	102,249,401	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	EXP	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	ISO	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		multiple interactions	ISO	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		increases expression	ISO	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BIRC5	baculoviral IAP repeat containing 5		multiple interactions	ISO	17	76,210,277	76,221,716	RGD:6480464	CTD
G	BIRC5	baculoviral IAP repeat containing 5		increases expression	ISO	17	76,210,277	76,221,716	RGD:6480464	CTD
G	BIRC6	baculoviral IAP repeat containing 6		decreases expression	ISO	2	32,582,096	32,843,966	RGD:6480464	CTD
G	BLCAP	bladder cancer associated protein		multiple interactions	ISO	20	36,145,819	36,156,333	RGD:6480464	CTD
G	BRCA2	breast cancer 2, early onset		increases expression	ISO	13	32,889,617	32,973,809	RGD:6480464	CTD
G	BRCC3	BRCA1/BRCA2-containing complex, subunit 3		increases expression	ISO	X	154,299,695	154,351,349	RGD:6480464	CTD
G	BRD2	bromodomain containing 2		multiple interactions	EXP	6	32,936,437	32,949,282	RGD:6480464	CTD
G	BRD2	bromodomain containing 2		affects expression	ISO	6	32,936,437	32,949,282	RGD:6480464	CTD
G	BRD3	bromodomain containing 3		multiple interactions	ISO	9	136,895,427	136,933,141	RGD:6480464	CTD
G	BRD7	bromodomain containing 7		multiple interactions	ISO	16	50,352,929	50,402,845	RGD:6480464	CTD
G	BRD8	bromodomain containing 8		multiple interactions	ISO	5	137,475,459	137,514,358	RGD:6480464	CTD
G	BRE	brain and reproductive organ-expressed (TNFRSF1A modulator)		increases expression	ISO	2	28,113,482	28,561,768	RGD:6480464	CTD
G	BRE	brain and reproductive organ-expressed (TNFRSF1A modulator)		increases expression	ISO	2	28,113,482	28,561,768	RGD:6480464	CTD
G	BRF1	BRF1 homolog, subunit of RNA polymerase III transcription initiation factor IIIB (S. cerevisiae)		multiple interactions	ISO	14	105,675,623	105,781,914	RGD:6480464	CTD
G	BRI3	brain protein I3		decreases expression	ISO	7	97,910,979	97,922,275	RGD:6480464	CTD
G	BRI3BP	BRI3 binding protein		multiple interactions	ISO	12	125,478,194	125,510,349	RGD:6480464	CTD
G	BRIP1	BRCA1 interacting protein C-terminal helicase 1		decreases expression	EXP	17	59,756,547	59,940,920	RGD:6480464	CTD
G	BRIX1	BRX1, biogenesis of ribosomes, homolog (S. cerevisiae)		decreases expression	EXP	5	34,915,820	34,925,787	RGD:6480464	CTD
G	BRMS1	breast cancer metastasis suppressor 1		multiple interactions	ISO	11	66,104,804	66,112,582	RGD:6480464	CTD
G	BRPF1	bromodomain and PHD finger containing, 1		multiple interactions	ISO	3	9,773,434	9,789,699	RGD:6480464	CTD
G	BSN	bassoon presynaptic cytomatrix protein		increases expression	ISO	3	49,591,922	49,708,982	RGD:6480464	CTD
G	BST1	bone marrow stromal cell antigen 1		decreases expression	EXP	4	15,704,573	15,733,796	RGD:6480464	CTD
G	BST1	bone marrow stromal cell antigen 1		multiple interactions	ISO	4	15,704,573	15,733,796	RGD:6480464	CTD
G	BST1	bone marrow stromal cell antigen 1		increases expression	ISO	4	15,704,573	15,733,796	RGD:6480464	CTD
G	BST2	bone marrow stromal cell antigen 2		multiple interactions	EXP	19	17,513,755	17,516,384	RGD:6480464	CTD
G	BST2	bone marrow stromal cell antigen 2		increases expression	EXP	19	17,513,755	17,516,384	RGD:6480464	CTD
G	BST2	bone marrow stromal cell antigen 2		decreases expression	EXP	19	17,513,755	17,516,384	RGD:6480464	CTD
G	BTAF1	BTAF1 RNA polymerase II, B-TFIID transcription factor-associated, 170kDa (Mot1 homolog, S. cerevisiae)		increases expression	ISO	10	93,683,736	93,790,082	RGD:6480464	CTD
G	BTBD11	BTB (POZ) domain containing 11		decreases expression	EXP	12	107,712,197	108,053,419	RGD:6480464	CTD
G	BTBD11	BTB (POZ) domain containing 11		increases expression	ISO	12	107,712,197	108,053,419	RGD:6480464	CTD
G	BTBD11	BTB (POZ) domain containing 11		multiple interactions	ISO	12	107,712,197	108,053,419	RGD:6480464	CTD
G	BTBD6	BTB (POZ) domain containing 6		decreases expression	ISO	14	105,714,879	105,717,430	RGD:6480464	CTD
G	BTBD9	BTB (POZ) domain containing 9		multiple interactions	ISO	6	38,136,227	38,607,924	RGD:6480464	CTD
G	BTC	betacellulin		decreases expression	ISO	4	75,671,448	75,719,882	RGD:6480464	CTD
G	BTF3	basic transcription factor 3		affects expression	ISO	5	72,794,250	72,801,448	RGD:6480464	CTD
G	BTF3L4	basic transcription factor 3-like 4		increases expression	ISO	1	52,521,857	52,556,388	RGD:6480464	CTD
G	BTG1	B-cell translocation gene 1, anti-proliferative		multiple interactions	ISO	12	92,534,054	92,539,673	RGD:6480464	CTD
G	BTG1	B-cell translocation gene 1, anti-proliferative		increases expression	ISO	12	92,534,054	92,539,673	RGD:6480464	CTD
G	BTG1	B-cell translocation gene 1, anti-proliferative		increases expression	ISO	12	92,534,054	92,539,673	RGD:6480464	CTD
G	BTG2	BTG family, member 2		multiple interactions	ISO	1	203,274,664	203,278,730	RGD:6480464	CTD
G	BTG2	BTG family, member 2		affects expression	ISO	1	203,274,664	203,278,730	RGD:6480464	CTD
G	BTG2	BTG family, member 2		increases expression	ISO	1	203,274,664	203,278,730	RGD:6480464	CTD
G	BTG4	B-cell translocation gene 4		multiple interactions	ISO	11	111,338,255	111,383,079	RGD:6480464	CTD
G	BTK	Bruton agammaglobulinemia tyrosine kinase		multiple interactions	ISO	X	100,604,435	100,641,212	RGD:6480464	CTD
G	BTNL8	butyrophilin-like 8		decreases expression	EXP	5	180,326,077	180,377,906	RGD:6480464	CTD
G	BUB1	BUB1 mitotic checkpoint serine/threonine kinase		multiple interactions	ISO	2	111,395,409	111,435,684	RGD:6480464	CTD
G	BUB1	BUB1 mitotic checkpoint serine/threonine kinase		increases expression	ISO	2	111,395,409	111,435,684	RGD:6480464	CTD
G	BUB1B	BUB1 mitotic checkpoint serine/threonine kinase B		multiple interactions	ISO	15	40,453,210	40,513,337	RGD:6480464	CTD
G	BUD31	BUD31 homolog (S. cerevisiae)		affects expression	ISO	7	99,006,601	99,017,239	RGD:6480464	CTD
G	BUD31	BUD31 homolog (S. cerevisiae)		decreases expression	EXP	7	99,006,601	99,017,239	RGD:6480464	CTD
G	BYSL	bystin-like		multiple interactions	ISO	6	41,888,965	41,900,784	RGD:6480464	CTD
G	BYSL	bystin-like		increases expression	ISO	6	41,888,965	41,900,784	RGD:6480464	CTD
G	BZW1	basic leucine zipper and W2 domains 1		multiple interactions	ISO	2	201,676,269	201,688,569	RGD:6480464	CTD
G	C11orf24	chromosome 11 open reading frame 24		increases expression	EXP	11	68,028,803	68,039,469	RGD:6480464	CTD
G	C11orf24	chromosome 11 open reading frame 24		decreases expression	ISO	11	68,028,803	68,039,469	RGD:6480464	CTD
G	C12orf23	chromosome 12 open reading frame 23		multiple interactions	EXP	12	107,349,544	107,367,813	RGD:6480464	CTD
G	C12orf23	chromosome 12 open reading frame 23		increases expression	EXP	12	107,349,544	107,367,813	RGD:6480464	CTD
G	C14orf105	chromosome 14 open reading frame 105		increases expression	EXP	14	57,936,595	57,960,576	RGD:6480464	CTD
G	C14orf142	chromosome 14 open reading frame 142		increases expression	EXP	14	93,669,237	93,673,459	RGD:6480464	CTD
G	C16orf45	chromosome 16 open reading frame 45		multiple interactions	EXP	16	15,528,325	15,682,116	RGD:6480464	CTD
G	C19orf26	chromosome 19 open reading frame 26		decreases expression	ISO	19	1,229,947	1,237,990	RGD:6480464	CTD
G	C3orf33	chromosome 3 open reading frame 33		decreases expression	EXP	3	155,480,401	155,524,055	RGD:6480464	CTD
G	C3orf35	chromosome 3 open reading frame 35		decreases expression	EXP	3	37,440,968	37,476,988	RGD:6480464	CTD
G	C4BPA	complement component 4 binding protein, alpha		decreases expression	EXP	1	207,277,607	207,318,317	RGD:6480464	CTD
G	C4orf32	chromosome 4 open reading frame 32		increases expression	EXP	4	113,066,553	113,110,237	RGD:6480464	CTD
G	C5	complement component 5		decreases expression	EXP	9	123,714,613	123,812,554	RGD:6480464	CTD
G	C5	complement component 5		increases expression	EXP	9	123,714,613	123,812,554	RGD:6480464	CTD
G	C5AR1	complement component 5a receptor 1		increases expression	EXP	19	47,813,104	47,825,327	RGD:6480464	CTD
G	C6	complement component 6		decreases expression	EXP	5	41,142,336	41,261,540	RGD:6480464	CTD
G	C6	complement component 6		multiple interactions	ISO	5	41,142,336	41,261,540	RGD:6480464	CTD
G	C8G	complement component 8, gamma polypeptide		affects expression	ISO	9	139,839,698	139,841,426	RGD:6480464	CTD
G	C8G	complement component 8, gamma polypeptide		increases expression	EXP	9	139,839,698	139,841,426	RGD:6480464	CTD
G	C8orf4	chromosome 8 open reading frame 4		multiple interactions	EXP	8	40,010,987	40,012,827	RGD:6480464	CTD
G	C8orf4	chromosome 8 open reading frame 4		decreases expression	EXP	8	40,010,987	40,012,827	RGD:6480464	CTD
G	C8orf58	chromosome 8 open reading frame 58		increases expression	EXP	8	22,457,114	22,461,663	RGD:6480464	CTD
G	C9orf91	chromosome 9 open reading frame 91		decreases expression	EXP	9	117,373,706	117,408,703	RGD:6480464	CTD
G	CA11	carbonic anhydrase XI		multiple interactions	EXP	19	49,141,272	49,149,451	RGD:6480464	CTD
G	CA11	carbonic anhydrase XI		decreases expression	EXP	19	49,141,272	49,149,451	RGD:6480464	CTD
G	CA12	carbonic anhydrase XII		increases expression	EXP	15	63,615,730	63,674,075	RGD:6480464	CTD
G	CA12	carbonic anhydrase XII		multiple interactions	EXP	15	63,615,730	63,674,075	RGD:6480464	CTD
G	CA2	carbonic anhydrase II		multiple interactions	EXP	8	86,376,131	86,393,721	RGD:6480464	CTD
G	CA2	carbonic anhydrase II		decreases expression	ISO	8	86,376,131	86,393,721	RGD:6480464	CTD
G	CA2	carbonic anhydrase II		decreases expression	EXP	8	86,376,131	86,393,721	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		affects expression	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		multiple interactions	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		decreases expression	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		decreases expression	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		decreases expression	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA3	carbonic anhydrase III, muscle specific		decreases expression	ISO	8	86,351,056	86,361,269	RGD:6480464	CTD
G	CA5B	carbonic anhydrase VB, mitochondrial		multiple interactions	ISO	X	15,756,412	15,805,748	RGD:6480464	CTD
G	CA8	carbonic anhydrase VIII		affects expression	ISO	8	61,101,423	61,193,954	RGD:6480464	CTD
G	CA9	carbonic anhydrase IX		multiple interactions	EXP	9	35,673,915	35,681,156	RGD:6480464	CTD
G	CA9	carbonic anhydrase IX		multiple interactions	ISO	9	35,673,915	35,681,156	RGD:6480464	CTD
G	CAB39L	calcium binding protein 39-like		multiple interactions	ISO	13	49,882,786	50,018,221	RGD:6480464	CTD
G	CABIN1	calcineurin binding protein 1		multiple interactions	ISO	22	24,407,765	24,574,596	RGD:6480464	CTD
G	CABYR	calcium binding tyrosine-(Y)-phosphorylation regulated		multiple interactions	ISO	18	21,718,955	21,741,564	RGD:6480464	CTD
G	CABYR	calcium binding tyrosine-(Y)-phosphorylation regulated		multiple interactions	ISO	18	21,718,955	21,741,564	RGD:6480464	CTD
G	CABYR	calcium binding tyrosine-(Y)-phosphorylation regulated		decreases expression	ISO	18	21,718,955	21,741,564	RGD:6480464	CTD
G	CACNA1C	calcium channel, voltage-dependent, L type, alpha 1C subunit		decreases expression	ISO	12	2,162,416	2,807,115	RGD:6480464	CTD
G	CACNA1D	calcium channel, voltage-dependent, L type, alpha 1D subunit		multiple interactions	EXP	3	53,529,031	53,846,492	RGD:6480464	CTD
G	CACNA1D	calcium channel, voltage-dependent, L type, alpha 1D subunit		increases expression	EXP	3	53,529,031	53,846,492	RGD:6480464	CTD
G	CACNA1G	calcium channel, voltage-dependent, T type, alpha 1G subunit		multiple interactions	ISO	17	48,638,429	48,704,835	RGD:6480464	CTD
G	CACNA1S	calcium channel, voltage-dependent, L type, alpha 1S subunit		multiple interactions	ISO	1	201,008,640	201,081,694	RGD:6480464	CTD
G	CACNA1S	calcium channel, voltage-dependent, L type, alpha 1S subunit		multiple interactions	ISO	1	201,008,640	201,081,694	RGD:6480464	CTD
G	CACNB2	calcium channel, voltage-dependent, beta 2 subunit		decreases expression	EXP	10	18,429,606	18,830,688	RGD:6480464	CTD
G	CACNG4	calcium channel, voltage-dependent, gamma subunit 4		decreases expression	EXP	17	64,960,980	65,029,518	RGD:6480464	CTD
G	CACNG4	calcium channel, voltage-dependent, gamma subunit 4		multiple interactions	EXP	17	64,960,980	65,029,518	RGD:6480464	CTD
G	CACNG4	calcium channel, voltage-dependent, gamma subunit 4		multiple interactions	ISO	17	64,960,980	65,029,518	RGD:6480464	CTD
G	CACYBP	calcyclin binding protein		multiple interactions	ISO	1	174,968,571	174,981,163	RGD:6480464	CTD
G	CACYBP	calcyclin binding protein		decreases expression	ISO	1	174,968,571	174,981,163	RGD:6480464	CTD
G	CACYBP	calcyclin binding protein		increases expression	ISO	1	174,968,571	174,981,163	RGD:6480464	CTD
G	CAD	carbamoyl-phosphate synthetase 2, aspartate transcarbamylase, and dihydroorotase		multiple interactions	EXP	2	27,440,258	27,466,654	RGD:6480464	CTD
G	CADPS2	Ca++-dependent secretion activator 2		multiple interactions	ISO	7	121,958,478	122,526,813	RGD:6480464	CTD
G	CADPS2	Ca++-dependent secretion activator 2		decreases expression	EXP	7	121,958,478	122,526,813	RGD:6480464	CTD
G	CADPS2	Ca++-dependent secretion activator 2		multiple interactions	EXP	7	121,958,478	122,526,813	RGD:6480464	CTD
G	CADPS2	Ca++-dependent secretion activator 2		multiple interactions	ISO	7	121,958,478	122,526,813	RGD:6480464	CTD
G	CALB1	calbindin 1, 28kDa		decreases expression	EXP	8	91,070,838	91,095,107	RGD:6480464	CTD
G	CALB1	calbindin 1, 28kDa		multiple interactions	EXP	8	91,070,838	91,095,107	RGD:6480464	CTD
G	CALB1	calbindin 1, 28kDa		multiple interactions	ISO	8	91,070,838	91,095,107	RGD:6480464	CTD
G	CALB1	calbindin 1, 28kDa		decreases expression	ISO	8	91,070,838	91,095,107	RGD:6480464	CTD
G	CALCOCO1	calcium binding and coiled-coil domain 1		increases expression	ISO	12	54,104,902	54,121,307	RGD:6480464	CTD
G	CALCR	calcitonin receptor		multiple interactions	EXP	7	93,053,799	93,204,042	RGD:6480464	CTD
G	CALCR	calcitonin receptor		decreases expression	EXP	7	93,053,799	93,204,042	RGD:6480464	CTD
G	CAPZA1	capping protein (actin filament) muscle Z-line, alpha 1		multiple interactions	ISO	1	113,162,075	113,214,241	RGD:6480464	CTD
G	CARD10	caspase recruitment domain family, member 10		increases expression	EXP	22	37,886,400	37,915,210	RGD:6480464	CTD
G	CARD10	caspase recruitment domain family, member 10		decreases expression	ISO	22	37,886,400	37,915,210	RGD:6480464	CTD
G	CARD10	caspase recruitment domain family, member 10		multiple interactions	ISO	22	37,886,400	37,915,210	RGD:6480464	CTD
G	CARD6	caspase recruitment domain family, member 6		increases expression	ISO	5	40,841,410	40,855,456	RGD:6480464	CTD
G	CARHSP1	calcium regulated heat stable protein 1, 24kDa		multiple interactions	ISO	16	8,946,802	8,962,863	RGD:6480464	CTD
G	CARHSP1	calcium regulated heat stable protein 1, 24kDa		decreases expression	ISO	16	8,946,802	8,962,863	RGD:6480464	CTD
G	CARS	cysteinyl-tRNA synthetase		multiple interactions	ISO	11	3,022,152	3,078,681	RGD:6480464	CTD
G	CARTPT	CART prepropeptide		multiple interactions	ISO	5	71,014,990	71,016,875	RGD:6480464	CTD
G	CARTPT	CART prepropeptide		increases expression	ISO	5	71,014,990	71,016,875	RGD:6480464	CTD
G	CASC3	cancer susceptibility candidate 3		increases expression	ISO	17	38,296,507	38,328,431	RGD:6480464	CTD
G	CASD1	CAS1 domain containing 1		increases expression	ISO	7	94,139,170	94,186,331	RGD:6480464	CTD
G	CASD1	CAS1 domain containing 1		decreases expression	EXP	7	94,139,170	94,186,331	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		multiple interactions	EXP	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		decreases expression	EXP	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		multiple interactions	ISO	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		multiple interactions	ISO	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		increases expression	ISO	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		increases expression	ISO	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP1	caspase 1, apoptosis-related cysteine peptidase		increases expression	EXP	11	104,896,235	104,905,884	RGD:6480464	CTD
G	CASP14	caspase 14, apoptosis-related cysteine peptidase		increases expression	ISO	19	15,160,291	15,169,104	RGD:6480464	CTD
G	CASP14	caspase 14, apoptosis-related cysteine peptidase		increases expression	ISO	19	15,160,291	15,169,104	RGD:6480464	CTD
G	CASP2	caspase 2, apoptosis-related cysteine peptidase		multiple interactions	ISO	7	142,985,308	143,004,789	RGD:6480464	CTD
G	CASP2	caspase 2, apoptosis-related cysteine peptidase		increases expression	ISO	7	142,985,308	143,004,789	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	EXP	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases expression	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		decreases expression	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases expression	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		increases activity	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP4	caspase 4, apoptosis-related cysteine peptidase		multiple interactions	EXP	11	104,813,594	104,839,325	RGD:6480464	CTD
G	CASP4	caspase 4, apoptosis-related cysteine peptidase		increases expression	EXP	11	104,813,594	104,839,325	RGD:6480464	CTD
G	CASP4	caspase 4, apoptosis-related cysteine peptidase		increases expression	ISO	11	104,813,594	104,839,325	RGD:6480464	CTD
G	CASP6	caspase 6, apoptosis-related cysteine peptidase		increases expression	ISO	4	110,609,785	110,624,629	RGD:6480464	CTD
G	CASP6	caspase 6, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	110,609,785	110,624,629	RGD:6480464	CTD
G	CASP6	caspase 6, apoptosis-related cysteine peptidase		increases expression	ISO	4	110,609,785	110,624,629	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		multiple interactions	ISO	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		multiple interactions	EXP	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		increases expression	ISO	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		increases expression	ISO	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		decreases expression	EXP	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		multiple interactions	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		increases expression	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		increases expression	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		increases expression	ISO	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASP8AP2	caspase 8 associated protein 2		decreases expression	ISO	6	90,539,619	90,584,155	RGD:6480464	CTD
G	CASP8AP2	caspase 8 associated protein 2		increases expression	ISO	6	90,539,619	90,584,155	RGD:6480464	CTD
G	CASP8AP2	caspase 8 associated protein 2		increases expression	ISO	6	90,539,619	90,584,155	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		increases expression	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CASP9	caspase 9, apoptosis-related cysteine peptidase		increases expression	ISO	1	15,818,769	15,851,285	RGD:6480464	CTD
G	CCL1	chemokine (C-C motif) ligand 1		multiple interactions	EXP	17	32,687,399	32,690,252	RGD:6480464	CTD
G	CCL1	chemokine (C-C motif) ligand 1		increases expression	EXP	17	32,687,399	32,690,252	RGD:6480464	CTD
G	CCL1	chemokine (C-C motif) ligand 1		increases expression	EXP	17	32,687,399	32,690,252	RGD:6480464	CTD
G	CCL1	chemokine (C-C motif) ligand 1		increases expression	ISO	17	32,687,399	32,690,252	RGD:6480464	CTD
G	CCL11	chemokine (C-C motif) ligand 11		multiple interactions	ISO	17	32,612,687	32,615,199	RGD:6480464	CTD
G	CCL17	chemokine (C-C motif) ligand 17		multiple interactions	ISO	16	57,438,679	57,449,974	RGD:6480464	CTD
G	CCL17	chemokine (C-C motif) ligand 17		increases expression	ISO	16	57,438,679	57,449,974	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		increases expression	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		decreases expression	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		increases expression	ISO	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL20	chemokine (C-C motif) ligand 20		increases expression	ISO	2	228,678,558	228,682,280	RGD:6480464	CTD
G	CCL20	chemokine (C-C motif) ligand 20		increases expression	EXP	2	228,678,558	228,682,280	RGD:6480464	CTD
G	CCL21	chemokine (C-C motif) ligand 21		multiple interactions	ISO	9	34,709,002	34,710,147	RGD:6480464	CTD
G	CCL21	chemokine (C-C motif) ligand 21		decreases expression	ISO	9	34,709,002	34,710,147	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	EXP	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		increases expression	EXP	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		multiple interactions	ISO	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		decreases expression	ISO	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL5	chemokine (C-C motif) ligand 5		decreases expression	ISO	17	34,198,495	34,207,377	RGD:6480464	CTD
G	CCL7	chemokine (C-C motif) ligand 7		multiple interactions	ISO	17	32,597,240	32,599,256	RGD:6480464	CTD
G	CCL7	chemokine (C-C motif) ligand 7		decreases expression	ISO	17	32,597,240	32,599,256	RGD:6480464	CTD
G	CCL8	chemokine (C-C motif) ligand 8		multiple interactions	ISO	17	32,646,066	32,648,421	RGD:6480464	CTD
G	CCNA2	cyclin A2		multiple interactions	ISO	4	122,737,599	122,745,088	RGD:6480464	CTD
G	CCNA2	cyclin A2		decreases expression	ISO	4	122,737,599	122,745,088	RGD:6480464	CTD
G	CCNA2	cyclin A2		increases expression	ISO	4	122,737,599	122,745,088	RGD:6480464	CTD
G	CCNA2	cyclin A2		multiple interactions	ISO	4	122,737,599	122,745,088	RGD:6480464	CTD
G	CCNA2	cyclin A2		increases expression	ISO	4	122,737,599	122,745,088	RGD:6480464	CTD
G	CCNB1	cyclin B1		multiple interactions	ISO	5	68,462,837	68,474,072	RGD:6480464	CTD
G	CCNB1	cyclin B1		decreases expression	ISO	5	68,462,837	68,474,072	RGD:6480464	CTD
G	CCNB1	cyclin B1		increases expression	ISO	5	68,462,837	68,474,072	RGD:6480464	CTD
G	CCNB2	cyclin B2		increases expression	EXP	15	59,397,284	59,417,244	RGD:6480464	CTD
G	CCNB2	cyclin B2		decreases expression	ISO	15	59,397,284	59,417,244	RGD:6480464	CTD
G	CCNB2	cyclin B2		multiple interactions	ISO	15	59,397,284	59,417,244	RGD:6480464	CTD
G	CCNC	cyclin C		decreases expression	EXP	6	99,990,263	100,016,690	RGD:6480464	CTD
G	CCND1	cyclin D1		affects expression	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		increases expression	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		multiple interactions	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND1	cyclin D1		decreases expression	ISO	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND2	cyclin D2		multiple interactions	ISO	12	4,382,902	4,414,522	RGD:6480464	CTD
G	CCND2	cyclin D2		decreases expression	ISO	12	4,382,902	4,414,522	RGD:6480464	CTD
G	CCND2	cyclin D2		multiple interactions	ISO	12	4,382,902	4,414,522	RGD:6480464	CTD
G	CCND3	cyclin D3		multiple interactions	ISO	6	41,902,671	42,016,610	RGD:6480464	CTD
G	CCND3	cyclin D3		affects expression	ISO	6	41,902,671	42,016,610	RGD:6480464	CTD
G	CCND3	cyclin D3		increases expression	ISO	6	41,902,671	42,016,610	RGD:6480464	CTD
G	CCNE1	cyclin E1		multiple interactions	ISO	19	30,302,901	30,315,215	RGD:6480464	CTD
G	CCNE1	cyclin E1		decreases expression	ISO	19	30,302,901	30,315,215	RGD:6480464	CTD
G	CCNE2	cyclin E2		decreases expression	ISO	8	95,892,452	95,907,482	RGD:6480464	CTD
G	CCNF	cyclin F		multiple interactions	ISO	16	2,479,395	2,508,859	RGD:6480464	CTD
G	CCNF	cyclin F		increases expression	ISO	16	2,479,395	2,508,859	RGD:6480464	CTD
G	CD14	CD14 molecule		decreases expression	ISO	5	140,011,313	140,013,286	RGD:6480464	CTD
G	CD160	CD160 molecule		increases expression	ISO	1	145,695,798	145,715,565	RGD:6480464	CTD
G	CD164	CD164 molecule, sialomucin		multiple interactions	ISO	6	109,687,717	109,703,762	RGD:6480464	CTD
G	CD200	CD200 molecule		multiple interactions	ISO	3	112,051,916	112,081,659	RGD:6480464	CTD
G	CD22	CD22 molecule		multiple interactions	ISO	19	35,820,072	35,838,264	RGD:6480464	CTD
G	CD24	CD24 molecule		decreases expression	ISO				RGD:6480464	CTD
G	CD24	CD24 molecule		multiple interactions	ISO				RGD:6480464	CTD
G	CD24	CD24 molecule		decreases expression	ISO				RGD:6480464	CTD
G	CD24	CD24 molecule		decreases expression	ISO				RGD:6480464	CTD
G	CD24	CD24 molecule		increases expression	ISO				RGD:6480464	CTD
G	CD248	CD248 molecule, endosialin		increases expression	ISO	11	66,081,958	66,084,515	RGD:6480464	CTD
G	CD276	CD276 molecule		increases expression	ISO	15	73,976,622	74,006,859	RGD:6480464	CTD
G	CD28	CD28 molecule		decreases expression	ISO	2	204,571,198	204,603,635	RGD:6480464	CTD
G	CD28	CD28 molecule		increases expression	ISO	2	204,571,198	204,603,635	RGD:6480464	CTD
G	CD2BP2	CD2 (cytoplasmic tail) binding protein 2		multiple interactions	ISO	16	30,362,087	30,366,682	RGD:6480464	CTD
G	CD302	CD302 molecule		affects expression	ISO	2	160,625,139	160,654,766	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		decreases expression	EXP	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		increases expression	EXP	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		multiple interactions	EXP	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		affects expression	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		multiple interactions	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		increases expression	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD36	CD36 molecule (thrombospondin receptor)		decreases expression	ISO	7	80,231,504	80,308,593	RGD:6480464	CTD
G	CD38	CD38 molecule		increases expression	ISO	4	15,779,931	15,850,706	RGD:6480464	CTD
G	CD38	CD38 molecule		multiple interactions	ISO	4	15,779,931	15,850,706	RGD:6480464	CTD
G	CD3D	CD3d molecule, delta (CD3-TCR complex)		affects expression	ISO	11	118,209,789	118,213,459	RGD:6480464	CTD
G	CD3D	CD3d molecule, delta (CD3-TCR complex)		multiple interactions	ISO	11	118,209,789	118,213,459	RGD:6480464	CTD
G	CD3D	CD3d molecule, delta (CD3-TCR complex)		decreases expression	ISO	11	118,209,789	118,213,459	RGD:6480464	CTD
G	CD3E	CD3e molecule, epsilon (CD3-TCR complex)		multiple interactions	EXP	11	118,175,295	118,186,890	RGD:6480464	CTD
G	CD3E	CD3e molecule, epsilon (CD3-TCR complex)		decreases expression	EXP	11	118,175,295	118,186,890	RGD:6480464	CTD
G	CD3E	CD3e molecule, epsilon (CD3-TCR complex)		multiple interactions	ISO	11	118,175,295	118,186,890	RGD:6480464	CTD
G	CD3E	CD3e molecule, epsilon (CD3-TCR complex)		increases expression	ISO	11	118,175,295	118,186,890	RGD:6480464	CTD
G	CD4	CD4 molecule		multiple interactions	ISO	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD4	CD4 molecule		multiple interactions	ISO	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD4	CD4 molecule		decreases expression	ISO	12	6,898,638	6,929,976	RGD:6480464	CTD
G	CD40	CD40 molecule, TNF receptor superfamily member 5		increases expression	ISO	20	44,746,906	44,758,384	RGD:6480464	CTD
G	CD40	CD40 molecule, TNF receptor superfamily member 5		increases expression	ISO	20	44,746,906	44,758,384	RGD:6480464	CTD
G	CD40LG	CD40 ligand		decreases response to substance	EXP	X	135,730,336	135,742,549	RGD:6480464	CTD
G	CD40LG	CD40 ligand		increases expression	ISO	X	135,730,336	135,742,549	RGD:6480464	CTD
G	CD40LG	CD40 ligand		decreases response to substance	ISO	X	135,730,336	135,742,549	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		increases expression	EXP	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		multiple interactions	EXP	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		multiple interactions	ISO	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		multiple interactions	ISO	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		increases expression	ISO	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD44	CD44 molecule (Indian blood group)		increases expression	ISO	11	35,160,417	35,253,949	RGD:6480464	CTD
G	CD47	CD47 molecule		multiple interactions	EXP	3	107,761,941	107,809,935	RGD:6480464	CTD
G	CD47	CD47 molecule		increases expression	EXP	3	107,761,941	107,809,935	RGD:6480464	CTD
G	CD47	CD47 molecule		decreases expression	EXP	3	107,761,941	107,809,935	RGD:6480464	CTD
G	CD47	CD47 molecule		decreases expression	ISO	3	107,761,941	107,809,935	RGD:6480464	CTD
G	CD47	CD47 molecule		increases expression	ISO	3	107,761,941	107,809,935	RGD:6480464	CTD
G	CD48	CD48 molecule		multiple interactions	ISO	1	160,648,536	160,681,641	RGD:6480464	CTD
G	CD5	CD5 molecule		decreases expression	ISO	11	60,869,930	60,895,324	RGD:6480464	CTD
G	CD52	CD52 molecule		increases expression	ISO	1	26,644,411	26,647,014	RGD:6480464	CTD
G	CD53	CD53 molecule		multiple interactions	ISO	1	111,413,821	111,442,558	RGD:6480464	CTD
G	CD53	CD53 molecule		increases expression	ISO	1	111,413,821	111,442,558	RGD:6480464	CTD
G	CD55	CD55 molecule, decay accelerating factor for complement (Cromer blood group)		multiple interactions	ISO	1	207,494,817	207,534,311	RGD:6480464	CTD
G	CD55	CD55 molecule, decay accelerating factor for complement (Cromer blood group)		decreases expression	ISO	1	207,494,817	207,534,311	RGD:6480464	CTD
G	CD5L	CD5 molecule-like		decreases expression	ISO	1	157,800,704	157,811,634	RGD:6480464	CTD
G	CD63	CD63 molecule		multiple interactions	EXP	12	56,119,227	56,123,457	RGD:6480464	CTD
G	CD63	CD63 molecule		increases expression	EXP	12	56,119,227	56,123,457	RGD:6480464	CTD
G	CD63	CD63 molecule		multiple interactions	ISO	12	56,119,227	56,123,457	RGD:6480464	CTD
G	CD69	CD69 molecule		multiple interactions	ISO	12	9,905,082	9,913,497	RGD:6480464	CTD
G	CD7	CD7 molecule		multiple interactions	ISO	17	80,272,746	80,275,480	RGD:6480464	CTD
G	CD7	CD7 molecule		increases expression	EXP	17	80,272,746	80,275,480	RGD:6480464	CTD
G	CD70	CD70 molecule		increases expression	ISO	19	6,585,850	6,591,163	RGD:6480464	CTD
G	CD74	CD74 molecule, major histocompatibility complex, class II invariant chain		multiple interactions	ISO	5	149,781,200	149,792,499	RGD:6480464	CTD
G	CD79B	CD79b molecule, immunoglobulin-associated beta		multiple interactions	ISO	17	62,006,098	62,009,704	RGD:6480464	CTD
G	CDC6	cell division cycle 6		increases expression	ISO	17	38,444,146	38,459,413	RGD:6480464	CTD
G	CDC6	cell division cycle 6		multiple interactions	ISO	17	38,444,146	38,459,413	RGD:6480464	CTD
G	CDC6	cell division cycle 6		decreases expression	ISO	17	38,444,146	38,459,413	RGD:6480464	CTD
G	CDC7	cell division cycle 7		decreases expression	EXP	1	91,966,404	91,991,321	RGD:6480464	CTD
G	CDC7	cell division cycle 7		multiple interactions	ISO	1	91,966,404	91,991,321	RGD:6480464	CTD
G	CDCA2	cell division cycle associated 2		increases expression	ISO	8	25,316,513	25,365,425	RGD:6480464	CTD
G	CDCA4	cell division cycle associated 4		multiple interactions	ISO	14	105,475,910	105,487,425	RGD:6480464	CTD
G	CDCA5	cell division cycle associated 5		increases expression	EXP	11	64,844,927	64,851,615	RGD:6480464	CTD
G	CDCA5	cell division cycle associated 5		multiple interactions	ISO	11	64,844,927	64,851,615	RGD:6480464	CTD
G	CDCA5	cell division cycle associated 5		multiple interactions	EXP	11	64,844,927	64,851,615	RGD:6480464	CTD
G	CDCA5	cell division cycle associated 5		increases expression	ISO	11	64,844,927	64,851,615	RGD:6480464	CTD
G	CDCA7	cell division cycle associated 7		decreases expression	EXP	2	174,219,561	174,233,718	RGD:6480464	CTD
G	CDCA8	cell division cycle associated 8		multiple interactions	ISO	1	38,158,073	38,175,391	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		decreases expression	EXP	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		decreases expression	EXP	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		increases expression	EXP	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		decreases expression	ISO	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		multiple interactions	ISO	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH11	cadherin 11, type 2, OB-cadherin (osteoblast)		multiple interactions	EXP	16	64,980,683	65,155,919	RGD:6480464	CTD
G	CDH11	cadherin 11, type 2, OB-cadherin (osteoblast)		decreases expression	EXP	16	64,980,683	65,155,919	RGD:6480464	CTD
G	CDH12	cadherin 12, type 2 (N-cadherin 2)		increases expression	EXP	5	21,750,973	22,853,731	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		multiple interactions	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		multiple interactions	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		decreases expression	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		multiple interactions	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		decreases expression	ISO	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH16	cadherin 16, KSP-cadherin		multiple interactions	ISO	16	66,942,025	66,952,887	RGD:6480464	CTD
G	CDH17	cadherin 17, LI cadherin (liver-intestine)		increases expression	EXP	8	95,139,394	95,229,531	RGD:6480464	CTD
G	CDH2	cadherin 2, type 1, N-cadherin (neuronal)		multiple interactions	ISO	18	25,530,930	25,757,445	RGD:6480464	CTD
G	CDH2	cadherin 2, type 1, N-cadherin (neuronal)		multiple interactions	ISO	18	25,530,930	25,757,445	RGD:6480464	CTD
G	CDH2	cadherin 2, type 1, N-cadherin (neuronal)		decreases expression	ISO	18	25,530,930	25,757,445	RGD:6480464	CTD
G	CDH23	cadherin-related 23		multiple interactions	ISO	10	73,156,691	73,575,704	RGD:6480464	CTD
G	CDH26	cadherin 26		increases expression	ISO	20	58,533,471	58,588,168	RGD:6480464	CTD
G	CDH4	cadherin 4, type 1, R-cadherin (retinal)		increases methylation	ISO	20	59,827,482	60,515,673	RGD:6480464	CTD
G	CDHR1	cadherin-related family member 1		multiple interactions	ISO	10	85,954,412	85,979,377	RGD:6480464	CTD
G	CDIPT	CDP-diacylglycerol--inositol 3-phosphatidyltransferase		multiple interactions	ISO	16	29,869,678	29,874,578	RGD:6480464	CTD
G	CDIPT	CDP-diacylglycerol--inositol 3-phosphatidyltransferase		increases expression	ISO	16	29,869,678	29,874,578	RGD:6480464	CTD
G	CDK1	cyclin-dependent kinase 1		decreases expression	EXP	10	62,538,089	62,554,610	RGD:6480464	CTD
G	CDK1	cyclin-dependent kinase 1		multiple interactions	ISO	10	62,538,089	62,554,610	RGD:6480464	CTD
G	CDK1	cyclin-dependent kinase 1		increases expression	ISO	10	62,538,089	62,554,610	RGD:6480464	CTD
G	CDK12	cyclin-dependent kinase 12		multiple interactions	ISO	17	37,617,739	37,690,800	RGD:6480464	CTD
G	CDK14	cyclin-dependent kinase 14		multiple interactions	ISO	7	90,338,712	90,839,904	RGD:6480464	CTD
G	CDK17	cyclin-dependent kinase 17		decreases expression	EXP	12	96,672,039	96,794,366	RGD:6480464	CTD
G	CDK18	cyclin-dependent kinase 18		multiple interactions	ISO	1	205,473,684	205,501,921	RGD:6480464	CTD
G	CDK18	cyclin-dependent kinase 18		increases expression	ISO	1	205,473,684	205,501,921	RGD:6480464	CTD
G	CDK19	cyclin-dependent kinase 19		multiple interactions	ISO	6	110,931,181	111,136,412	RGD:6480464	CTD
G	CDK19	cyclin-dependent kinase 19		increases expression	ISO	6	110,931,181	111,136,412	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		multiple interactions	ISO	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK2	cyclin-dependent kinase 2		decreases activity	ISO	12	56,360,556	56,366,568	RGD:6480464	CTD
G	CDK20	cyclin-dependent kinase 20		multiple interactions	ISO	9	90,581,356	90,589,695	RGD:6480464	CTD
G	CDK2AP2	cyclin-dependent kinase 2 associated protein 2		increases expression	EXP	11	67,273,968	67,276,102	RGD:6480464	CTD
G	CDK3	cyclin-dependent kinase 3		multiple interactions	ISO	17	73,996,987	74,002,080	RGD:6480464	CTD
G	CDK4	cyclin-dependent kinase 4		increases expression	ISO	12	58,141,510	58,146,230	RGD:6480464	CTD
G	CDK4	cyclin-dependent kinase 4		increases expression	ISO	12	58,141,510	58,146,230	RGD:6480464	CTD
G	CDK5RAP2	CDK5 regulatory subunit associated protein 2		increases expression	EXP	9	123,151,147	123,342,437	RGD:6480464	CTD
G	CDK6	cyclin-dependent kinase 6		increases expression	EXP	7	92,234,235	92,465,941	RGD:6480464	CTD
G	CDK6	cyclin-dependent kinase 6		decreases expression	ISO	7	92,234,235	92,465,941	RGD:6480464	CTD
G	CDK6	cyclin-dependent kinase 6		affects expression	ISO	7	92,234,235	92,465,941	RGD:6480464	CTD
G	CDK7	cyclin-dependent kinase 7		increases expression	ISO	5	68,530,622	68,573,257	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		multiple interactions	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		multiple interactions	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		decreases expression	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		decreases expression	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		increases expression	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		affects binding	ISO	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		increases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		multiple interactions	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPA	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	19	33,790,840	33,793,430	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases activity	EXP	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases response to substance	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	EXP	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		affects expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		decreases expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases activity	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		decreases expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		increases expression	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPB	CCAAT/enhancer binding protein (C/EBP), beta		multiple interactions	ISO	20	48,807,120	48,809,227	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		decreases expression	EXP	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		increases expression	EXP	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		increases activity	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		multiple interactions	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPD	CCAAT/enhancer binding protein (C/EBP), delta		increases expression	ISO	8	48,649,476	48,650,726	RGD:6480464	CTD
G	CEBPG	CCAAT/enhancer binding protein (C/EBP), gamma		decreases expression	EXP	19	33,864,575	33,873,592	RGD:6480464	CTD
G	CEBPZ	CCAAT/enhancer binding protein (C/EBP), zeta		multiple interactions	ISO	2	37,428,772	37,458,740	RGD:6480464	CTD
G	CEBPZ	CCAAT/enhancer binding protein (C/EBP), zeta		increases expression	ISO	2	37,428,772	37,458,740	RGD:6480464	CTD
G	CEBPZ	CCAAT/enhancer binding protein (C/EBP), zeta		decreases expression	EXP	2	37,428,772	37,458,740	RGD:6480464	CTD
G	CELA1	chymotrypsin-like elastase family, member 1		decreases expression	ISO	12	51,722,227	51,740,463	RGD:6480464	CTD
G	CELF2	CUGBP, Elav-like family member 2		multiple interactions	ISO	10	11,047,259	11,378,674	RGD:6480464	CTD
G	CELF2	CUGBP, Elav-like family member 2		multiple interactions	ISO	10	11,047,259	11,378,674	RGD:6480464	CTD
G	CELF2	CUGBP, Elav-like family member 2		decreases expression	ISO	10	11,047,259	11,378,674	RGD:6480464	CTD
G	CELF5	CUGBP, Elav-like family member 5		increases expression	ISO	19	3,224,701	3,297,074	RGD:6480464	CTD
G	CELSR1	cadherin, EGF LAG seven-pass G-type receptor 1		multiple interactions	ISO	22	46,756,731	46,933,067	RGD:6480464	CTD
G	CELSR2	cadherin, EGF LAG seven-pass G-type receptor 2		multiple interactions	ISO	1	109,792,641	109,818,378	RGD:6480464	CTD
G	CELSR2	cadherin, EGF LAG seven-pass G-type receptor 2		decreases expression	EXP	1	109,792,641	109,818,378	RGD:6480464	CTD
G	CELSR2	cadherin, EGF LAG seven-pass G-type receptor 2		multiple interactions	EXP	1	109,792,641	109,818,378	RGD:6480464	CTD
G	CELSR3	cadherin, EGF LAG seven-pass G-type receptor 3		multiple interactions	ISO	3	48,673,896	48,700,348	RGD:6480464	CTD
G	CELSR3	cadherin, EGF LAG seven-pass G-type receptor 3		increases expression	ISO	3	48,673,896	48,700,348	RGD:6480464	CTD
G	CENPA	centromere protein A		multiple interactions	ISO	2	27,008,882	27,017,457	RGD:6480464	CTD
G	CENPL	centromere protein L		increases expression	ISO	1	173,768,688	173,793,777	RGD:6480464	CTD
G	CENPN	centromere protein N		increases expression	ISO	16	81,040,103	81,066,712	RGD:6480464	CTD
G	CENPQ	centromere protein Q		increases expression	ISO	6	49,431,096	49,460,820	RGD:6480464	CTD
G	CEP19	centrosomal protein 19kDa		increases expression	EXP	3	196,433,148	196,439,123	RGD:6480464	CTD
G	CEP290	centrosomal protein 290kDa		increases expression	ISO	12	88,442,790	88,535,993	RGD:6480464	CTD
G	CEP63	centrosomal protein 63kDa		increases expression	ISO	3	134,204,575	134,293,855	RGD:6480464	CTD
G	CEP68	centrosomal protein 68kDa		multiple interactions	ISO	2	65,283,495	65,314,142	RGD:6480464	CTD
G	CEP72	centrosomal protein 72kDa		increases expression	ISO	5	612,405	653,668	RGD:6480464	CTD
G	CHEK1	checkpoint kinase 1		multiple interactions	ISO	11	125,495,031	125,546,150	RGD:6480464	CTD
G	CHEK1	checkpoint kinase 1		increases expression	ISO	11	125,495,031	125,546,150	RGD:6480464	CTD
G	CHGA	chromogranin A (parathyroid secretory protein 1)		increases expression	ISO	14	93,389,445	93,401,638	RGD:6480464	CTD
G	CHGB	chromogranin B (secretogranin 1)		multiple interactions	ISO	20	5,891,974	5,906,007	RGD:6480464	CTD
G	CHI3L1	chitinase 3-like 1 (cartilage glycoprotein-39)		increases expression	ISO	1	203,148,059	203,155,922	RGD:6480464	CTD
G	CHI3L1	chitinase 3-like 1 (cartilage glycoprotein-39)		increases expression	EXP	1	203,148,059	203,155,922	RGD:6480464	CTD
G	CHKA	choline kinase alpha		increases expression	ISO	11	67,820,326	67,888,858	RGD:6480464	CTD
G	CHML	choroideremia-like (Rab escort protein 2)		decreases expression	ISO	1	241,792,166	241,799,232	RGD:6480464	CTD
G	CHMP3	charged multivesicular body protein 3		multiple interactions	ISO	2	86,730,553	86,790,620	RGD:6480464	CTD
G	CHMP7	charged multivesicular body protein 7		decreases expression	ISO	8	23,101,150	23,119,512	RGD:6480464	CTD
G	CHN1	chimerin 1		multiple interactions	ISO	2	175,664,042	175,870,107	RGD:6480464	CTD
G	CHN2	chimerin 2		decreases expression	EXP	7	29,234,121	29,553,944	RGD:6480464	CTD
G	CHPF2	chondroitin polymerizing factor 2		increases expression	ISO	7	150,929,585	150,935,905	RGD:6480464	CTD
G	CHRNA3	cholinergic receptor, nicotinic, alpha 3 (neuronal)		increases expression	ISO	15	78,885,394	78,913,637	RGD:6480464	CTD
G	CHRNE	cholinergic receptor, nicotinic, epsilon (muscle)		multiple interactions	ISO	17	4,801,064	4,806,369	RGD:6480464	CTD
G	CHST1	carbohydrate (keratan sulfate Gal-6) sulfotransferase 1		multiple interactions	ISO	11	45,669,239	45,687,206	RGD:6480464	CTD
G	CHST1	carbohydrate (keratan sulfate Gal-6) sulfotransferase 1		decreases expression	ISO	11	45,669,239	45,687,206	RGD:6480464	CTD
G	CHST10	carbohydrate sulfotransferase 10		multiple interactions	ISO	2	101,008,322	101,034,130	RGD:6480464	CTD
G	CHST11	carbohydrate (chondroitin 4) sulfotransferase 11		decreases expression	ISO	12	104,850,692	105,155,792	RGD:6480464	CTD
G	CHST11	carbohydrate (chondroitin 4) sulfotransferase 11		increases expression	ISO	12	104,850,692	105,155,792	RGD:6480464	CTD
G	CHST2	carbohydrate (N-acetylglucosamine-6-O) sulfotransferase 2		multiple interactions	ISO	3	142,838,618	142,842,856	RGD:6480464	CTD
G	CHST2	carbohydrate (N-acetylglucosamine-6-O) sulfotransferase 2		increases expression	ISO	3	142,838,618	142,842,856	RGD:6480464	CTD
G	CHST6	carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 6		increases expression	EXP	16	75,507,022	75,528,926	RGD:6480464	CTD
G	CHST9	carbohydrate (N-acetylgalactosamine 4-0) sulfotransferase 9		increases expression	EXP	18	24,495,595	24,765,302	RGD:6480464	CTD
G	CHSY1	chondroitin sulfate synthase 1		affects expression	ISO	15	101,715,928	101,792,137	RGD:6480464	CTD
G	CHTF18	CTF18, chromosome transmission fidelity factor 18 homolog (S. cerevisiae)		increases expression	ISO	16	838,622	848,074	RGD:6480464	CTD
G	CHTF18	CTF18, chromosome transmission fidelity factor 18 homolog (S. cerevisiae)		multiple interactions	ISO	16	838,622	848,074	RGD:6480464	CTD
G	CHUK	conserved helix-loop-helix ubiquitous kinase		multiple interactions	ISO	10	101,948,124	101,989,344	RGD:6480464	CTD
G	CIAO1	cytosolic iron-sulfur protein assembly 1		multiple interactions	ISO	2	96,931,884	96,939,917	RGD:6480464	CTD
G	CIB1	calcium and integrin binding 1 (calmyrin)		increases expression	EXP	15	90,773,477	90,777,279	RGD:6480464	CTD
G	CIB1	calcium and integrin binding 1 (calmyrin)		multiple interactions	ISO	15	90,773,477	90,777,279	RGD:6480464	CTD
G	CIDEA	cell death-inducing DFFA-like effector a		multiple interactions	ISO	18	12,254,318	12,277,594	RGD:6480464	CTD
G	CIDEB	cell death-inducing DFFA-like effector b		increases expression	EXP	14	24,774,393	24,780,576	RGD:6480464	CTD
G	CIDEB	cell death-inducing DFFA-like effector b		increases expression	ISO	14	24,774,393	24,780,576	RGD:6480464	CTD
G	CIDEC	cell death-inducing DFFA-like effector c		decreases expression	EXP	3	9,908,394	9,921,938	RGD:6480464	CTD
G	CIDEC	cell death-inducing DFFA-like effector c		increases expression	ISO	3	9,908,394	9,921,938	RGD:6480464	CTD
G	CIRBP	cold inducible RNA binding protein		multiple interactions	ISO	19	1,269,267	1,274,809	RGD:6480464	CTD
G	CIRBP	cold inducible RNA binding protein		decreases expression	ISO	19	1,269,267	1,274,809	RGD:6480464	CTD
G	CISD2	CDGSH iron sulfur domain 2		increases expression	ISO	4	103,790,135	103,813,964	RGD:6480464	CTD
G	CISH	cytokine inducible SH2-containing protein		multiple interactions	ISO	3	50,643,885	50,649,262	RGD:6480464	CTD
G	CISH	cytokine inducible SH2-containing protein		increases expression	ISO	3	50,643,885	50,649,262	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	EXP	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	EXP	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		decreases expression	EXP	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	ISO	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		multiple interactions	ISO	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		decreases expression	ISO	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED2	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 2		decreases expression	ISO	6	139,693,392	139,695,787	RGD:6480464	CTD
G	CITED4	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4		multiple interactions	ISO	1	41,326,728	41,328,018	RGD:6480464	CTD
G	CKB	creatine kinase, brain		increases expression	ISO	14	103,985,995	103,989,196	RGD:6480464	CTD
G	CKB	creatine kinase, brain		multiple interactions	ISO	14	103,985,995	103,989,196	RGD:6480464	CTD
G	CKM	creatine kinase, muscle		multiple interactions	ISO	19	45,809,671	45,826,235	RGD:6480464	CTD
G	CKMT1B	creatine kinase, mitochondrial 1B		multiple interactions	ISO	15	43,885,252	43,891,604	RGD:6480464	CTD
G	CKMT1B	creatine kinase, mitochondrial 1B		increases expression	ISO	15	43,885,252	43,891,604	RGD:6480464	CTD
G	CKMT2	creatine kinase, mitochondrial 2 (sarcomeric)		multiple interactions	ISO	5	80,529,139	80,562,217	RGD:6480464	CTD
G	CKS1B	CDC28 protein kinase regulatory subunit 1B		multiple interactions	EXP	1	154,947,118	154,951,725	RGD:6480464	CTD
G	CKS1B	CDC28 protein kinase regulatory subunit 1B		multiple interactions	ISO	1	154,947,118	154,951,725	RGD:6480464	CTD
G	CKS2	CDC28 protein kinase regulatory subunit 2		multiple interactions	ISO	9	91,926,113	91,931,618	RGD:6480464	CTD
G	CLCA1	chloride channel accessory 1		increases expression	ISO	1	86,934,526	86,965,977	RGD:6480464	CTD
G	CLEC2D	C-type lectin domain family 2, member D		multiple interactions	ISO	12	9,822,304	9,852,151	RGD:6480464	CTD
G	CLEC2D	C-type lectin domain family 2, member D		increases expression	ISO	12	9,822,304	9,852,151	RGD:6480464	CTD
G	CLU	clusterin		decreases expression	EXP	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CLU	clusterin		increases expression	ISO	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CMAS	cytidine monophosphate N-acetylneuraminic acid synthetase		multiple interactions	ISO	12	22,199,110	22,218,608	RGD:6480464	CTD
G	CMBL	carboxymethylenebutenolidase homolog (Pseudomonas)		decreases expression	ISO	5	10,277,707	10,308,168	RGD:6480464	CTD
G	CMPK1	cytidine monophosphate (UMP-CMP) kinase 1, cytosolic		decreases expression	ISO	1	47,799,469	47,844,511	RGD:6480464	CTD
G	CMTM3	CKLF-like MARVEL transmembrane domain containing 3		increases expression	EXP	16	66,637,935	66,647,795	RGD:6480464	CTD
G	CMTM7	CKLF-like MARVEL transmembrane domain containing 7		multiple interactions	ISO	3	32,433,163	32,496,333	RGD:6480464	CTD
G	CMTM7	CKLF-like MARVEL transmembrane domain containing 7		increases expression	ISO	3	32,433,163	32,496,333	RGD:6480464	CTD
G	CMTM8	CKLF-like MARVEL transmembrane domain containing 8		multiple interactions	ISO	3	32,280,171	32,411,813	RGD:6480464	CTD
G	CMTM8	CKLF-like MARVEL transmembrane domain containing 8		decreases expression	ISO	3	32,280,171	32,411,813	RGD:6480464	CTD
G	CNDP2	CNDP dipeptidase 2 (metallopeptidase M20 family)		increases expression	ISO	18	72,163,500	72,190,689	RGD:6480464	CTD
G	CNGA2	cyclic nucleotide gated channel alpha 2		multiple interactions	ISO	X	150,903,218	150,914,036	RGD:6480464	CTD
G	CNGA2	cyclic nucleotide gated channel alpha 2		multiple interactions	ISO	X	150,903,218	150,914,036	RGD:6480464	CTD
G	CNIH	cornichon homolog (Drosophila)		multiple interactions	ISO	14	54,893,647	54,908,148	RGD:6480464	CTD
G	CNIH	cornichon homolog (Drosophila)		increases expression	ISO	14	54,893,647	54,908,148	RGD:6480464	CTD
G	CNIH	cornichon homolog (Drosophila)		decreases expression	EXP	14	54,893,647	54,908,148	RGD:6480464	CTD
G	CNIH2	cornichon homolog 2 (Drosophila)		multiple interactions	ISO	11	66,045,672	66,051,685	RGD:6480464	CTD
G	CNIH2	cornichon homolog 2 (Drosophila)		increases expression	ISO	11	66,045,672	66,051,685	RGD:6480464	CTD
G	CNN1	calponin 1, basic, smooth muscle		increases expression	EXP	19	11,649,579	11,661,138	RGD:6480464	CTD
G	CNN1	calponin 1, basic, smooth muscle		multiple interactions	ISO	19	11,649,579	11,661,138	RGD:6480464	CTD
G	CNN3	calponin 3, acidic		increases expression	ISO	1	95,362,507	95,392,735	RGD:6480464	CTD
G	CNNM2	cyclin M2		multiple interactions	ISO	10	104,678,075	104,838,344	RGD:6480464	CTD
G	CNOT1	CCR4-NOT transcription complex, subunit 1		increases expression	EXP	16	58,553,850	58,663,790	RGD:6480464	CTD
G	CNOT4	CCR4-NOT transcription complex, subunit 4		multiple interactions	ISO	7	135,046,547	135,194,875	RGD:6480464	CTD
G	CNOT4	CCR4-NOT transcription complex, subunit 4		increases expression	ISO	7	135,046,547	135,194,875	RGD:6480464	CTD
G	CNPY2	canopy 2 homolog (zebrafish)		multiple interactions	ISO	12	56,704,212	56,710,128	RGD:6480464	CTD
G	CNPY2	canopy 2 homolog (zebrafish)		increases expression	ISO	12	56,704,212	56,710,128	RGD:6480464	CTD
G	CNR2	cannabinoid receptor 2 (macrophage)		multiple interactions	ISO	1	24,200,460	24,239,817	RGD:6480464	CTD
G	CNTNAP2	contactin associated protein-like 2		multiple interactions	ISO	7	145,813,453	148,118,090	RGD:6480464	CTD
G	CNTRL	centriolin		decreases expression	ISO	9	123,850,574	123,939,886	RGD:6480464	CTD
G	COBL	cordon-bleu WH2 repeat protein		decreases expression	ISO	7	51,083,909	51,384,515	RGD:6480464	CTD
G	COBLL1	cordon-bleu WH2 repeat protein-like 1		decreases expression	EXP	2	165,541,256	165,697,928	RGD:6480464	CTD
G	COG6	component of oligomeric golgi complex 6		decreases expression	EXP	13	40,229,764	40,365,802	RGD:6480464	CTD
G	COG8	component of oligomeric golgi complex 8		multiple interactions	ISO	16	69,362,524	69,373,526	RGD:6480464	CTD
G	COL11A1	collagen, type XI, alpha 1		affects expression	ISO	1	103,342,023	103,574,052	RGD:6480464	CTD
G	COL11A1	collagen, type XI, alpha 1		increases expression	ISO	1	103,342,023	103,574,052	RGD:6480464	CTD
G	COL11A1	collagen, type XI, alpha 1		multiple interactions	ISO	1	103,342,023	103,574,052	RGD:6480464	CTD
G	COL12A1	collagen, type XII, alpha 1		affects expression	ISO	6	75,794,042	75,915,623	RGD:6480464	CTD
G	COL13A1	collagen, type XIII, alpha 1		increases expression	EXP	10	71,561,644	71,718,904	RGD:6480464	CTD
G	COL13A1	collagen, type XIII, alpha 1		multiple interactions	ISO	10	71,561,644	71,718,904	RGD:6480464	CTD
G	COL13A1	collagen, type XIII, alpha 1		increases expression	ISO	10	71,561,644	71,718,904	RGD:6480464	CTD
G	COL14A1	collagen, type XIV, alpha 1		affects expression	ISO	8	121,137,352	121,384,273	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		affects expression	ISO	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		multiple interactions	ISO	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL15A1	collagen, type XV, alpha 1		multiple interactions	ISO	9	101,706,138	101,833,068	RGD:6480464	CTD
G	COL18A1	collagen, type XVIII, alpha 1		multiple interactions	ISO	21	46,825,097	46,933,634	RGD:6480464	CTD
G	COL18A1	collagen, type XVIII, alpha 1		decreases expression	ISO	21	46,825,097	46,933,634	RGD:6480464	CTD
G	COL18A1	collagen, type XVIII, alpha 1		decreases expression	ISO	21	46,825,097	46,933,634	RGD:6480464	CTD
G	COL19A1	collagen, type XIX, alpha 1		multiple interactions	ISO	6	70,576,448	70,922,157	RGD:6480464	CTD
G	COL19A1	collagen, type XIX, alpha 1		increases expression	ISO	6	70,576,448	70,922,157	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		increases expression	EXP	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		multiple interactions	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		affects expression	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		multiple interactions	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL1A1	collagen, type I, alpha 1		increases expression	ISO	17	48,261,457	48,279,000	RGD:6480464	CTD
G	COL1A2	collagen, type I, alpha 2		multiple interactions	ISO	7	94,023,873	94,060,544	RGD:6480464	CTD
G	COL1A2	collagen, type I, alpha 2		decreases expression	ISO	7	94,023,873	94,060,544	RGD:6480464	CTD
G	COQ6	coenzyme Q6 homolog, monooxygenase (S. cerevisiae)		increases expression	ISO	14	74,416,637	74,429,815	RGD:6480464	CTD
G	COQ7	coenzyme Q7 homolog, ubiquinone (yeast)		multiple interactions	ISO	16	19,078,917	19,091,417	RGD:6480464	CTD
G	CORO1B	coronin, actin binding protein, 1B		multiple interactions	ISO	11	67,205,518	67,211,292	RGD:6480464	CTD
G	CORO1B	coronin, actin binding protein, 1B		increases expression	EXP	11	67,205,518	67,211,292	RGD:6480464	CTD
G	CORO2B	coronin, actin binding protein, 2B		multiple interactions	ISO	15	68,871,308	69,020,145	RGD:6480464	CTD
G	CORO7	coronin 7		affects expression	ISO	16	4,404,543	4,466,962	RGD:6480464	CTD
G	CORO7	coronin 7		multiple interactions	ISO	16	4,404,543	4,466,962	RGD:6480464	CTD
G	CORT	cortistatin		multiple interactions	ISO	1	10,509,776	10,512,060	RGD:6480464	CTD
G	COTL1	coactosin-like 1 (Dictyostelium)		decreases expression	EXP	16	84,599,202	84,651,669	RGD:6480464	CTD
G	COTL1	coactosin-like 1 (Dictyostelium)		decreases expression	ISO	16	84,599,202	84,651,669	RGD:6480464	CTD
G	COTL1	coactosin-like 1 (Dictyostelium)		affects expression	ISO	16	84,599,202	84,651,669	RGD:6480464	CTD
G	COX19	cytochrome c oxidase assembly homolog 19 (S. cerevisiae)		multiple interactions	ISO	7	1,004,486	1,015,235	RGD:6480464	CTD
G	COX19	cytochrome c oxidase assembly homolog 19 (S. cerevisiae)		increases expression	ISO	7	1,004,486	1,015,235	RGD:6480464	CTD
G	COX4I1	cytochrome c oxidase subunit IV isoform 1		increases expression	ISO	16	85,833,173	85,840,608	RGD:6480464	CTD
G	COX4I2	cytochrome c oxidase subunit IV isoform 2 (lung)		increases expression	ISO	20	30,225,691	30,232,800	RGD:6480464	CTD
G	COX5A	cytochrome c oxidase subunit Va		multiple interactions	ISO	15	75,212,616	75,230,495	RGD:6480464	CTD
G	COX5A	cytochrome c oxidase subunit Va		increases expression	ISO	15	75,212,616	75,230,495	RGD:6480464	CTD
G	COX5B	cytochrome c oxidase subunit Vb		multiple interactions	ISO	2	98,262,521	98,264,657	RGD:6480464	CTD
G	COX5B	cytochrome c oxidase subunit Vb		increases expression	ISO	2	98,262,521	98,264,657	RGD:6480464	CTD
G	COX6A1	cytochrome c oxidase subunit VIa polypeptide 1		increases expression	ISO	12	120,875,893	120,878,545	RGD:6480464	CTD
G	COX6A2	cytochrome c oxidase subunit VIa polypeptide 2		decreases expression	ISO	16	31,439,052	31,439,749	RGD:6480464	CTD
G	COX6B1	cytochrome c oxidase subunit VIb polypeptide 1 (ubiquitous)		increases expression	ISO	19	36,139,125	36,149,686	RGD:6480464	CTD
G	COX6B2	cytochrome c oxidase subunit VIb polypeptide 2 (testis)		decreases expression	ISO	19	55,861,070	55,866,182	RGD:6480464	CTD
G	COX6C	cytochrome c oxidase subunit VIc		multiple interactions	ISO	8	100,890,223	100,906,242	RGD:6480464	CTD
G	COX6C	cytochrome c oxidase subunit VIc		increases expression	ISO	8	100,890,223	100,906,242	RGD:6480464	CTD
G	COX7A2	cytochrome c oxidase subunit VIIa polypeptide 2 (liver)		increases expression	ISO	6	75,947,391	75,953,644	RGD:6480464	CTD
G	COX7A2L	cytochrome c oxidase subunit VIIa polypeptide 2 like		multiple interactions	ISO	2	42,577,642	42,588,356	RGD:6480464	CTD
G	COX7B	cytochrome c oxidase subunit VIIb		increases expression	ISO	X	77,154,961	77,160,881	RGD:6480464	CTD
G	COX7C	cytochrome c oxidase subunit VIIc		multiple interactions	ISO	5	85,913,784	85,916,583	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		multiple interactions	EXP	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		decreases expression	EXP	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		multiple interactions	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		multiple interactions	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		increases expression	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CP	ceruloplasmin (ferroxidase)		decreases expression	ISO	3	148,880,197	148,939,832	RGD:6480464	CTD
G	CPA3	carboxypeptidase A3 (mast cell)		multiple interactions	ISO	3	148,583,043	148,614,874	RGD:6480464	CTD
G	CPA3	carboxypeptidase A3 (mast cell)		decreases expression	ISO	3	148,583,043	148,614,874	RGD:6480464	CTD
G	CPA5	carboxypeptidase A5		multiple interactions	ISO	7	129,984,630	130,008,571	RGD:6480464	CTD
G	CPAMD8	C3 and PZP-like, alpha-2-macroglobulin domain containing 8		decreases expression	ISO	19	17,003,762	17,137,625	RGD:6480464	CTD
G	CPB1	carboxypeptidase B1 (tissue)		multiple interactions	ISO	3	148,545,588	148,577,974	RGD:6480464	CTD
G	CPB2	carboxypeptidase B2 (plasma)		increases expression	ISO	13	46,627,322	46,679,211	RGD:6480464	CTD
G	CPB2	carboxypeptidase B2 (plasma)		decreases expression	EXP	13	46,627,322	46,679,211	RGD:6480464	CTD
G	CPD	carboxypeptidase D		multiple interactions	ISO	17	28,705,942	28,796,675	RGD:6480464	CTD
G	CPD	carboxypeptidase D		decreases expression	ISO	17	28,705,942	28,796,675	RGD:6480464	CTD
G	CPE	carboxypeptidase E		multiple interactions	EXP	4	166,300,097	166,419,482	RGD:6480464	CTD
G	CPE	carboxypeptidase E		multiple interactions	ISO	4	166,300,097	166,419,482	RGD:6480464	CTD
G	CPE	carboxypeptidase E		decreases expression	EXP	4	166,300,097	166,419,482	RGD:6480464	CTD
G	CPEB2	cytoplasmic polyadenylation element binding protein 2		increases expression	EXP	4	15,004,298	15,071,777	RGD:6480464	CTD
G	CPEB2	cytoplasmic polyadenylation element binding protein 2		decreases expression	ISO	4	15,004,298	15,071,777	RGD:6480464	CTD
G	CPEB3	cytoplasmic polyadenylation element binding protein 3		decreases expression	EXP	10	93,808,397	94,050,875	RGD:6480464	CTD
G	CPEB4	cytoplasmic polyadenylation element binding protein 4		affects expression	ISO	5	173,315,331	173,387,313	RGD:6480464	CTD
G	CPED1	cadherin-like and PC-esterase domain containing 1		decreases expression	EXP	7	120,628,751	120,937,498	RGD:6480464	CTD
G	CPLX1	complexin 1		decreases expression	ISO	4	778,745	819,945	RGD:6480464	CTD
G	CPN1	carboxypeptidase N, polypeptide 1		multiple interactions	ISO	10	101,802,065	101,841,642	RGD:6480464	CTD
G	CPN2	carboxypeptidase N, polypeptide 2		multiple interactions	ISO	3	194,060,494	194,072,057	RGD:6480464	CTD
G	CPNE2	copine II		multiple interactions	ISO	16	57,126,455	57,181,878	RGD:6480464	CTD
G	CPNE2	copine II		increases expression	EXP	16	57,126,455	57,181,878	RGD:6480464	CTD
G	CR1L	complement component (3b/4b) receptor 1-like		decreases expression	ISO	1	207,818,458	207,897,036	RGD:6480464	CTD
G	CRY1	cryptochrome 1 (photolyase-like)		decreases expression	EXP	12	107,385,142	107,487,635	RGD:6480464	CTD
G	CRY1	cryptochrome 1 (photolyase-like)		multiple interactions	ISO	12	107,385,142	107,487,635	RGD:6480464	CTD
G	CRY1	cryptochrome 1 (photolyase-like)		increases expression	ISO	12	107,385,142	107,487,635	RGD:6480464	CTD
G	CRY2	cryptochrome 2 (photolyase-like)		increases expression	ISO	11	45,868,669	45,904,799	RGD:6480464	CTD
G	CRYAA	crystallin, alpha A		multiple interactions	ISO	21	44,589,141	44,592,913	RGD:6480464	CTD
G	CRYAB	crystallin, alpha B		multiple interactions	ISO	11	111,779,350	111,782,473	RGD:6480464	CTD
G	CRYBA1	crystallin, beta A1		multiple interactions	ISO	17	27,573,875	27,581,512	RGD:6480464	CTD
G	CRYBA2	crystallin, beta A2		multiple interactions	ISO	2	219,854,912	219,858,127	RGD:6480464	CTD
G	CRYGB	crystallin, gamma B		multiple interactions	ISO	2	209,007,297	209,010,877	RGD:6480464	CTD
G	CRYGN	crystallin, gamma N		multiple interactions	ISO	7	151,127,056	151,137,099	RGD:6480464	CTD
G	CRYGS	crystallin, gamma S		multiple interactions	ISO	3	186,256,232	186,262,167	RGD:6480464	CTD
G	CRYL1	crystallin, lambda 1		multiple interactions	EXP	13	20,977,806	21,100,012	RGD:6480464	CTD
G	CRYL1	crystallin, lambda 1		increases expression	EXP	13	20,977,806	21,100,012	RGD:6480464	CTD
G	CRYL1	crystallin, lambda 1		multiple interactions	ISO	13	20,977,806	21,100,012	RGD:6480464	CTD
G	CRYZ	crystallin, zeta (quinone reductase)		decreases expression	EXP	1	75,171,170	75,199,092	RGD:6480464	CTD
G	CRYZ	crystallin, zeta (quinone reductase)		multiple interactions	ISO	1	75,171,170	75,199,092	RGD:6480464	CTD
G	CRYZ	crystallin, zeta (quinone reductase)		increases activity	ISO	1	75,171,170	75,199,092	RGD:6480464	CTD
G	CRYZ	crystallin, zeta (quinone reductase)		increases expression	ISO	1	75,171,170	75,199,092	RGD:6480464	CTD
G	CS	citrate synthase		decreases expression	EXP	12	56,665,483	56,694,175	RGD:6480464	CTD
G	CS	citrate synthase		multiple interactions	ISO	12	56,665,483	56,694,175	RGD:6480464	CTD
G	CS	citrate synthase		multiple interactions	ISO	12	56,665,483	56,694,175	RGD:6480464	CTD
G	CSAD	cysteine sulfinic acid decarboxylase		multiple interactions	ISO	12	53,551,447	53,574,693	RGD:6480464	CTD
G	CSAD	cysteine sulfinic acid decarboxylase		decreases expression	ISO	12	53,551,447	53,574,693	RGD:6480464	CTD
G	CSE1L	CSE1 chromosome segregation 1-like (yeast)		multiple interactions	ISO	20	47,662,783	47,713,497	RGD:6480464	CTD
G	CSE1L	CSE1 chromosome segregation 1-like (yeast)		increases expression	ISO	20	47,662,783	47,713,497	RGD:6480464	CTD
G	CSF1	colony stimulating factor 1 (macrophage)		multiple interactions	EXP	1	110,453,233	110,473,616	RGD:6480464	CTD
G	CSF1	colony stimulating factor 1 (macrophage)		increases expression	EXP	1	110,453,233	110,473,616	RGD:6480464	CTD
G	CSF1	colony stimulating factor 1 (macrophage)		multiple interactions	ISO	1	110,453,233	110,473,616	RGD:6480464	CTD
G	CSF1	colony stimulating factor 1 (macrophage)		decreases expression	ISO	1	110,453,233	110,473,616	RGD:6480464	CTD
G	CSF1R	colony stimulating factor 1 receptor		multiple interactions	ISO	5	149,432,854	149,492,935	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2	colony stimulating factor 2 (granulocyte-macrophage)		increases expression	ISO	5	131,409,485	131,411,863	RGD:6480464	CTD
G	CSF2RB	colony stimulating factor 2 receptor, beta, low-affinity (granulocyte-macrophage)		increases expression	ISO	22	37,309,675	37,336,481	RGD:6480464	CTD
G	CSF3	colony stimulating factor 3 (granulocyte)		increases expression	ISO	17	38,171,614	38,174,066	RGD:6480464	CTD
G	CSGALNACT2	chondroitin sulfate N-acetylgalactosaminyltransferase 2		decreases expression	EXP	10	43,633,934	43,680,750	RGD:6480464	CTD
G	CSK	c-src tyrosine kinase		increases expression	ISO	15	75,074,425	75,095,539	RGD:6480464	CTD
G	CSN2	casein beta		decreases expression	ISO	4	70,820,974	70,826,726	RGD:6480464	CTD
G	CSNK1A1	casein kinase 1, alpha 1		decreases expression	ISO	5	148,874,845	148,931,007	RGD:6480464	CTD
G	CSNK1D	casein kinase 1, delta		multiple interactions	EXP	17	80,200,537	80,231,594	RGD:6480464	CTD
G	CSNK1D	casein kinase 1, delta		decreases expression	EXP	17	80,200,537	80,231,594	RGD:6480464	CTD
G	CSNK1G1	casein kinase 1, gamma 1		multiple interactions	ISO	15	64,457,716	64,648,442	RGD:6480464	CTD
G	CSNK1G1	casein kinase 1, gamma 1		increases expression	ISO	15	64,457,716	64,648,442	RGD:6480464	CTD
G	CSNK1G3	casein kinase 1, gamma 3		multiple interactions	ISO	5	122,847,793	122,952,739	RGD:6480464	CTD
G	CSNK2A1	casein kinase 2, alpha 1 polypeptide		affects expression	ISO	20	463,338	524,482	RGD:6480464	CTD
G	CSNK2A1	casein kinase 2, alpha 1 polypeptide		multiple interactions	ISO	20	463,338	524,482	RGD:6480464	CTD
G	CSNK2A1	casein kinase 2, alpha 1 polypeptide		increases expression	ISO	20	463,338	524,482	RGD:6480464	CTD
G	CSNK2A2	casein kinase 2, alpha prime polypeptide		multiple interactions	ISO	16	58,191,811	58,231,782	RGD:6480464	CTD
G	CSNK2A2	casein kinase 2, alpha prime polypeptide		increases expression	ISO	16	58,191,811	58,231,782	RGD:6480464	CTD
G	CSNK2B	casein kinase 2, beta polypeptide		affects expression	ISO	6	31,633,657	31,637,843	RGD:6480464	CTD
G	CSNK2B	casein kinase 2, beta polypeptide		multiple interactions	ISO	6	31,633,657	31,637,843	RGD:6480464	CTD
G	CSPG5	chondroitin sulfate proteoglycan 5 (neuroglycan C)		decreases expression	ISO	3	47,603,728	47,621,730	RGD:6480464	CTD
G	CSRNP1	cysteine-serine-rich nuclear protein 1		decreases expression	ISO	3	39,183,342	39,195,102	RGD:6480464	CTD
G	CTSD	cathepsin D		multiple interactions	EXP	11	1,773,982	1,785,222	RGD:6480464	CTD
G	CTSD	cathepsin D		decreases expression	EXP	11	1,773,982	1,785,222	RGD:6480464	CTD
G	CTSD	cathepsin D		increases expression	ISO	11	1,773,982	1,785,222	RGD:6480464	CTD
G	CTSG	cathepsin G		increases expression	ISO	14	25,042,724	25,045,466	RGD:6480464	CTD
G	CTSH	cathepsin H		multiple interactions	ISO	15	79,214,092	79,237,420	RGD:6480464	CTD
G	CTSL1	cathepsin L1		multiple interactions	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		affects expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		multiple interactions	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		multiple interactions	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		decreases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSL1	cathepsin L1		increases expression	ISO	9	90,340,974	90,346,384	RGD:6480464	CTD
G	CTSS	cathepsin S		increases expression	EXP	1	150,702,672	150,738,433	RGD:6480464	CTD
G	CTSS	cathepsin S		multiple interactions	ISO	1	150,702,672	150,738,433	RGD:6480464	CTD
G	CTSW	cathepsin W		multiple interactions	ISO	11	65,647,284	65,651,212	RGD:6480464	CTD
G	CTSZ	cathepsin Z		multiple interactions	ISO	20	57,570,242	57,582,309	RGD:6480464	CTD
G	CTXN1	cortexin 1		decreases expression	ISO	19	7,989,381	7,991,051	RGD:6480464	CTD
G	CTXN1	cortexin 1		increases expression	ISO	19	7,989,381	7,991,051	RGD:6480464	CTD
G	CUEDC1	CUE domain containing 1		increases expression	EXP	17	55,940,337	55,980,750	RGD:6480464	CTD
G	CUL2	cullin 2		increases expression	EXP	10	35,297,479	35,379,570	RGD:6480464	CTD
G	CUL3	cullin 3		decreases expression	ISO	2	225,334,867	225,450,114	RGD:6480464	CTD
G	CUL4B	cullin 4B		increases expression	ISO	X	119,658,444	119,709,684	RGD:6480464	CTD
G	CUTA	cutA divalent cation tolerance homolog (E. coli)		decreases expression	ISO	6	33,384,319	33,386,065	RGD:6480464	CTD
G	CUTC	cutC copper transporter homolog (E. coli)		multiple interactions	ISO	10	101,491,958	101,515,894	RGD:6480464	CTD
G	CUX1	cut-like homeobox 1		multiple interactions	ISO	7	101,459,184	101,927,250	RGD:6480464	CTD
G	CUX1	cut-like homeobox 1		multiple interactions	ISO	7	101,459,184	101,927,250	RGD:6480464	CTD
G	CUX2	cut-like homeobox 2		decreases expression	EXP	12	111,471,828	111,788,358	RGD:6480464	CTD
G	CUX2	cut-like homeobox 2		multiple interactions	ISO	12	111,471,828	111,788,358	RGD:6480464	CTD
G	CX3CL1	chemokine (C-X3-C motif) ligand 1		multiple interactions	ISO	16	57,406,414	57,418,956	RGD:6480464	CTD
G	CX3CL1	chemokine (C-X3-C motif) ligand 1		multiple interactions	ISO	16	57,406,414	57,418,956	RGD:6480464	CTD
G	CX3CL1	chemokine (C-X3-C motif) ligand 1		decreases expression	ISO	16	57,406,414	57,418,956	RGD:6480464	CTD
G	CXADR	coxsackie virus and adenovirus receptor		decreases expression	EXP	21	18,885,224	18,965,897	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		increases expression	ISO	4	74,735,109	74,737,019	RGD:6480464	CTD
G	CXCL10	chemokine (C-X-C motif) ligand 10		decreases expression	EXP	4	76,942,269	76,944,689	RGD:6480464	CTD
G	CXCL10	chemokine (C-X-C motif) ligand 10		multiple interactions	ISO	4	76,942,269	76,944,689	RGD:6480464	CTD
G	CXCL10	chemokine (C-X-C motif) ligand 10		increases expression	ISO	4	76,942,269	76,944,689	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		multiple interactions	EXP	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		decreases expression	EXP	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		decreases expression	EXP	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		increases expression	EXP	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		multiple interactions	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		decreases expression	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		increases expression	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL12	chemokine (C-X-C motif) ligand 12		increases expression	ISO	10	44,865,605	44,880,545	RGD:6480464	CTD
G	CXCL13	chemokine (C-X-C motif) ligand 13		decreases expression	EXP	4	78,432,907	78,532,988	RGD:6480464	CTD
G	CXCL13	chemokine (C-X-C motif) ligand 13		multiple interactions	EXP	4	78,432,907	78,532,988	RGD:6480464	CTD
G	CXCL13	chemokine (C-X-C motif) ligand 13		increases expression	ISO	4	78,432,907	78,532,988	RGD:6480464	CTD
G	CXCL14	chemokine (C-X-C motif) ligand 14		multiple interactions	ISO	5	134,906,369	134,914,969	RGD:6480464	CTD
G	CXCL2	chemokine (C-X-C motif) ligand 2		increases expression	EXP	4	74,962,752	74,964,997	RGD:6480464	CTD
G	CYP11B1	cytochrome P450, family 11, subfamily B, polypeptide 1		decreases expression	ISO	8	143,953,773	143,961,236	RGD:6480464	CTD
G	CYP11B2	cytochrome P450, family 11, subfamily B, polypeptide 2		decreases expression	ISO	8	143,991,975	143,999,259	RGD:6480464	CTD
G	CYP17A1	cytochrome P450, family 17, subfamily A, polypeptide 1		multiple interactions	ISO	10	104,590,288	104,597,290	RGD:6480464	CTD
G	CYP17A1	cytochrome P450, family 17, subfamily A, polypeptide 1		decreases expression	ISO	10	104,590,288	104,597,290	RGD:6480464	CTD
G	CYP17A1	cytochrome P450, family 17, subfamily A, polypeptide 1		decreases expression	ISO	10	104,590,288	104,597,290	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		multiple interactions	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		affects activity	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases expression	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases activity	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases expression	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		multiple interactions	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases stability	EXP	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		affects expression	ISO	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		multiple interactions	ISO	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		decreases activity	ISO	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		decreases expression	ISO	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP19A1	cytochrome P450, family 19, subfamily A, polypeptide 1		increases expression	ISO	15	51,500,254	51,630,795	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	ISO	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		multiple interactions	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP1A1	cytochrome P450, family 1, subfamily A, polypeptide 1		increases activity	EXP	15	75,011,883	75,017,877	RGD:6480464	CTD
G	CYP2A13	cytochrome P450, family 2, subfamily A, polypeptide 13		multiple interactions	ISO	19	41,594,356	41,602,100	RGD:6480464	CTD
G	CYP2C18	cytochrome P450, family 2, subfamily C, polypeptide 18		multiple interactions	ISO	10	96,443,251	96,495,947	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		increases expression	ISO	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		decreases activity	ISO	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		multiple interactions	ISO	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP2C9	cytochrome P450, family 2, subfamily C, polypeptide 9		increases expression	ISO	10	96,698,415	96,749,148	RGD:6480464	CTD
G	CYP4F3	cytochrome P450, family 4, subfamily F, polypeptide 3		multiple interactions	ISO	19	15,751,707	15,771,570	RGD:6480464	CTD
G	CYP4F8	cytochrome P450, family 4, subfamily F, polypeptide 8		multiple interactions	ISO	19	15,726,029	15,740,448	RGD:6480464	CTD
G	CYP4F8	cytochrome P450, family 4, subfamily F, polypeptide 8		decreases expression	ISO	19	15,726,029	15,740,448	RGD:6480464	CTD
G	CYP4F8	cytochrome P450, family 4, subfamily F, polypeptide 8		decreases expression	ISO	19	15,726,029	15,740,448	RGD:6480464	CTD
G	CYP4F8	cytochrome P450, family 4, subfamily F, polypeptide 8		increases expression	ISO	19	15,726,029	15,740,448	RGD:6480464	CTD
G	DIABLO	diablo, IAP-binding mitochondrial protein		affects expression	ISO	12	122,692,209	122,712,068	RGD:6480464	CTD
G	DROSHA	drosha, ribonuclease type III		multiple interactions	ISO	5	31,400,601	31,532,282	RGD:6480464	CTD
G	DSC1	desmocollin 1		increases expression	ISO	18	28,709,199	28,742,819	RGD:6480464	CTD
G	DTNBP1	dystrobrevin binding protein 1		affects expression	ISO	6	15,523,032	15,663,289	RGD:6480464	CTD
G	DTNBP1	dystrobrevin binding protein 1		increases expression	ISO	6	15,523,032	15,663,289	RGD:6480464	CTD
G	DTNBP1	dystrobrevin binding protein 1		multiple interactions	ISO	6	15,523,032	15,663,289	RGD:6480464	CTD
G	EAPP	E2F-associated phosphoprotein		multiple interactions	ISO	14	34,985,135	35,008,943	RGD:6480464	CTD
G	EIF1	eukaryotic translation initiation factor 1		multiple interactions	ISO	17	39,845,127	39,847,898	RGD:6480464	CTD
G	EMC8	ER membrane protein complex subunit 8		affects expression	ISO	16	85,812,230	85,833,148	RGD:6480464	CTD
G	EMC8	ER membrane protein complex subunit 8		multiple interactions	ISO	16	85,812,230	85,833,148	RGD:6480464	CTD
G	EMC8	ER membrane protein complex subunit 8		increases expression	ISO	16	85,812,230	85,833,148	RGD:6480464	CTD
G	ENHO	energy homeostasis associated		multiple interactions	ISO	9	34,521,040	34,523,037	RGD:6480464	CTD
G	ERH	enhancer of rudimentary homolog (Drosophila)		multiple interactions	ISO	14	69,846,840	69,865,021	RGD:6480464	CTD
G	ERH	enhancer of rudimentary homolog (Drosophila)		increases expression	ISO	14	69,846,840	69,865,021	RGD:6480464	CTD
G	EVI5L	ecotropic viral integration site 5-like		affects expression	ISO	19	7,895,161	7,929,862	RGD:6480464	CTD
G	FAM127B	family with sequence similarity 127, member B		multiple interactions	ISO	X	134,184,962	134,186,221	RGD:6480464	CTD
G	FAM213A	family with sequence similarity 213, member A		increases expression	EXP	10	82,167,585	82,192,753	RGD:6480464	CTD
G	FAM213A	family with sequence similarity 213, member A		decreases expression	EXP	10	82,167,585	82,192,753	RGD:6480464	CTD
G	FOXC2	forkhead box C2 (MFH-1, mesenchyme forkhead 1)		affects expression	ISO	16	86,600,857	86,602,539	RGD:6480464	CTD
G	FOXC2	forkhead box C2 (MFH-1, mesenchyme forkhead 1)		multiple interactions	ISO	16	86,600,857	86,602,539	RGD:6480464	CTD
G	FOXC2	forkhead box C2 (MFH-1, mesenchyme forkhead 1)		decreases expression	ISO	16	86,600,857	86,602,539	RGD:6480464	CTD
G	FOXP4	forkhead box P4		affects expression	ISO	6	41,514,164	41,570,122	RGD:6480464	CTD
G	FOXP4	forkhead box P4		multiple interactions	ISO	6	41,514,164	41,570,122	RGD:6480464	CTD
G	FZD7	frizzled family receptor 7		increases expression	ISO	2	202,899,310	202,903,160	RGD:6480464	CTD
G	GRAMD1C	GRAM domain containing 1C		multiple interactions	ISO	3	113,557,681	113,666,021	RGD:6480464	CTD
G	GSTA5	glutathione S-transferase alpha 5		increases expression	ISO	6	52,696,540	52,710,893	RGD:6480464	CTD
G	HBG1	hemoglobin, gamma A		increases expression	ISO	11	5,269,502	5,271,087	RGD:6480464	CTD
G	HIST1H2BL	histone cluster 1, H2bl		decreases expression	ISO	6	27,775,257	27,775,709	RGD:6480464	CTD
G	HIST1H2BO	histone cluster 1, H2bo		affects expression	ISO	6	27,861,203	27,861,669	RGD:6480464	CTD
G	HLA-C	major histocompatibility complex, class I, C		multiple interactions	ISO	6	31,236,526	31,239,913	RGD:6480464	CTD
G	HLA-C	major histocompatibility complex, class I, C		increases expression	ISO	6	31,236,526	31,239,913	RGD:6480464	CTD
G	HSPA1A	heat shock 70kDa protein 1A		multiple interactions	ISO	6	31,783,291	31,785,719	RGD:6480464	CTD
G	HSPA1A	heat shock 70kDa protein 1A		increases expression	ISO	6	31,783,291	31,785,719	RGD:6480464	CTD
G	HSPA1A	heat shock 70kDa protein 1A		affects expression	ISO	6	31,783,291	31,785,719	RGD:6480464	CTD
G	HSPA1A	heat shock 70kDa protein 1A		multiple interactions	ISO	6	31,783,291	31,785,719	RGD:6480464	CTD
G	HSPE1	heat shock 10kDa protein 1 (chaperonin 10)		multiple interactions	ISO	2	198,364,721	198,368,187	RGD:6480464	CTD
G	HSPE1	heat shock 10kDa protein 1 (chaperonin 10)		increases expression	ISO	2	198,364,721	198,368,187	RGD:6480464	CTD
G	HSPG2	heparan sulfate proteoglycan 2		affects expression	ISO	1	22,148,737	22,263,750	RGD:6480464	CTD
G	HSPG2	heparan sulfate proteoglycan 2		increases expression	ISO	1	22,148,737	22,263,750	RGD:6480464	CTD
G	ICOS	inducible T-cell co-stimulator		affects expression	ISO	2	204,801,471	204,826,300	RGD:6480464	CTD
G	ICOS	inducible T-cell co-stimulator		increases expression	ISO	2	204,801,471	204,826,300	RGD:6480464	CTD
G	IFIT3	interferon-induced protein with tetratricopeptide repeats 3		increases expression	ISO	10	91,087,602	91,100,725	RGD:6480464	CTD
G	IPO11	importin 11		affects expression	ISO	5	61,708,573	61,924,416	RGD:6480464	CTD
G	IPO11	importin 11		multiple interactions	ISO	5	61,708,573	61,924,416	RGD:6480464	CTD
G	ITGA3	integrin, alpha 3 (antigen CD49C, alpha 3 subunit of VLA-3 receptor)		affects expression	ISO	17	48,133,340	48,167,849	RGD:6480464	CTD
G	KDM5A	lysine (K)-specific demethylase 5A		multiple interactions	ISO	12	389,223	498,620	RGD:6480464	CTD
G	KIR3DL2	killer cell immunoglobulin-like receptor, three domains, long cytoplasmic tail, 2		multiple interactions	ISO	19	55,361,898	55,378,670	RGD:6480464	CTD
G	LCE3C	late cornified envelope 3C		decreases expression	ISO	1	152,573,138	152,573,562	RGD:6480464	CTD
G	LDB3	LIM domain binding 3		increases expression	ISO	10	88,428,206	88,495,825	RGD:6480464	CTD
G	MED13L	mediator complex subunit 13-like		affects expression	ISO	12	116,396,381	116,714,991	RGD:6480464	CTD
G	MED13L	mediator complex subunit 13-like		decreases expression	ISO	12	116,396,381	116,714,991	RGD:6480464	CTD
G	MLXIPL	MLX interacting protein-like		increases expression	ISO	7	73,007,524	73,038,870	RGD:6480464	CTD
G	MMAB	methylmalonic aciduria (cobalamin deficiency) cblB type		affects expression	ISO	12	109,991,520	110,011,358	RGD:6480464	CTD
G	MRPL33	mitochondrial ribosomal protein L33		multiple interactions	ISO	2	27,994,584	28,002,608	RGD:6480464	CTD
G	MT-CO2	mitochondrially encoded cytochrome c oxidase II		multiple interactions	EXP	MT	7,586	8,269	RGD:6480464	CTD
G	MT-CO2	mitochondrially encoded cytochrome c oxidase II		decreases expression	ISO	MT	7,586	8,269	RGD:6480464	CTD
G	MT-COI	mitochondrially encoded cytochrome c oxidase I		decreases expression	ISO	MT	5,904	7,445	RGD:6480464	CTD
G	NDUFB3	NADH dehydrogenase (ubiquinone) 1 beta subcomplex, 3, 12kDa		increases expression	ISO	2	201,936,462	201,950,473	RGD:6480464	CTD
G	NMRK1	nicotinamide riboside kinase 1		decreases expression	EXP	9	77,676,116	77,703,133	RGD:6480464	CTD
G	PEO1	progressive external ophthalmoplegia 1		decreases expression	EXP				RGD:6480464	CTD
G	PHF11	PHD finger protein 11		multiple interactions	ISO	13	50,069,801	50,103,117	RGD:6480464	CTD
G	PRDX1	peroxiredoxin 1		multiple interactions	ISO	1	45,976,707	45,988,562	RGD:6480464	CTD
G	RASA3	RAS p21 protein activator 3		increases expression	ISO	13	114,747,194	114,898,095	RGD:6480464	CTD
G	RNASE3	ribonuclease, RNase A family, 3		decreases expression	ISO	14	21,359,562	21,360,507	RGD:6480464	CTD
G	RORA	RAR-related orphan receptor A		affects expression	ISO	15	60,780,483	61,521,502	RGD:6480464	CTD
G	RORA	RAR-related orphan receptor A		decreases expression	ISO	15	60,780,483	61,521,502	RGD:6480464	CTD
G	RPL17	ribosomal protein L17		multiple interactions	ISO	18	47,014,851	47,018,935	RGD:6480464	CTD
G	SLC18B1	solute carrier family 18, subfamily B, member 1		decreases expression	EXP	6	133,090,507	133,119,747	RGD:6480464	CTD
G	SLC25A36	solute carrier family 25 (pyrimidine nucleotide carrier ), member 36		affects expression	ISO	3	140,660,662	140,698,785	RGD:6480464	CTD
G	SLC25A36	solute carrier family 25 (pyrimidine nucleotide carrier ), member 36		increases expression	ISO	3	140,660,662	140,698,785	RGD:6480464	CTD
G	SMIM3	small integral membrane protein 3		decreases expression	EXP	5	150,157,508	150,176,298	RGD:6480464	CTD
G	SNRNP200	small nuclear ribonucleoprotein 200kDa (U5)		affects expression	ISO	2	96,940,074	96,971,307	RGD:6480464	CTD
G	TMA16	translation machinery associated 16 homolog (S. cerevisiae)		decreases expression	EXP	4	164,415,673	164,441,691	RGD:6480464	CTD
G	TMEM167B	transmembrane protein 167B		affects expression	ISO	1	109,633,403	109,639,554	RGD:6480464	CTD
G	TMEM254	transmembrane protein 254		multiple interactions	ISO	10	81,838,402	81,852,307	RGD:6480464	CTD
G	WBP1L	WW domain binding protein 1-like		increases expression	EXP	10	104,503,727	104,576,021	RGD:6480464	CTD
G	YBX3	Y box binding protein 3		multiple interactions	ISO	12	10,851,676	10,875,953	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	513696
role	503218
biological role	501391
xenobiotic	43067
dibenzodioxine	34501
polychlorinated dibenzodioxine	34501
2,3,7,8-tetrachlorodibenzodioxine	34500
Path 2
Term	Annotations
CHEBI ontology	513696
subatomic particle	512589
composite particle	512589
hadron	512589
baryon	512589
nucleon	512589
atomic nucleus	512589
atom	512589
main group element atom	480600
p-block element atom	478018
carbon group element atom	427607
carbon atom	424015
organic molecular entity	424008
organic molecule	311307
organic cyclic compound	311226
organic heterocyclic compound	160187
organic heteropolycyclic compound	99800
organic heterotricyclic compound	39495
dibenzodioxine	34501
polychlorinated dibenzodioxine	34501
2,3,7,8-tetrachlorodibenzodioxine	34500