| Term: | 3,4-dihydroxymandelaldehyde |
|
| Accession: | CHEBI:27852
|
 browse the term
|
| Definition: | An aldehyde consisting of phenylacetaldehyde having three hydroxy substituents located at the alpha-, 3- and 4-positions |
| Synonyms: | related_synonym: | 3,4-Dihydroxyphenylglycolaldehyde; 3,4-dihydroxymandelic aldehyde; 3,4-dihydroxyphenylglycolic aldehyde; C8H8O4; DHMAL; DHPGALD; DOPEGAL; InChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H; InChIKey=YUGMCLJIWGEKCK-UHFFFAOYSA-N; [H]C(=O)C(O)c1ccc(O)c(O)c1; alpha,3,4-trihydroxybenzeneacetaldehyde; alpha,3,4-trihydroxyphenylacetaldehyde |
| | alt_id: | CHEBI:1382; CHEBI:19883 |
| | xref_casrn: | 13023-73-9 |
| | xref: | ChemIDplus:13023-73-9 "CAS Registry Number"; CiteXplore:10424772 "PubMed citation"; CiteXplore:11532332 "PubMed citation"; CiteXplore:12729575 "PubMed citation"; CiteXplore:14697885 "PubMed citation"; CiteXplore:18783367 "PubMed citation"; CiteXplore:8813375 "PubMed citation"; CiteXplore:9237550 "PubMed citation"; CiteXplore:9518674 "PubMed citation"; CiteXplore:9878889 "PubMed citation"; KEGG COMPOUND:C05577 "KEGG COMPOUND"; MetaCyc:DIHYDROXYPHENYLGLYCOLALDEHYDE "MetaCyc"; Reaxys:2092210 "Reaxys Registry Number" |
|
|
