folic acid - Ontology Report - Rat Genome Database

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	folic acid	go back to main search page
Accession:	CHEBI:27470	browse the term
Definition:	Folic acid is a form of the water-soluble vitamine B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
Synonyms:	exact_synonym:	N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
	related_synonym:	C19H19N7O6; Folate; Folsaeure; InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1; InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N; N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid; N-pteroyl-L-glutamic acid; Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1; PGA; PteGlu; Pteroylglutamic acid; pteroyl-L-glutamic acid; pteroyl-L-monoglutamic acid; vitamin Bc; vitamin M
	alt_id:	CHEBI:24075; CHEBI:42610; CHEBI:5140; CHEBI:569217
	xref_casrn:	59-30-3
	xref:	Beilstein:100781 "Beilstein Registry Number"; ChEMBL:18788725 "PubMed citation"; ChEMBL:569217 "ChEMBL COMPOUND"; ChemIDplus:59-30-3 "CAS Registry Number"; CiteXplore:17784727 "PubMed citation"; DrugBank:DB00158 "DrugBank"; KEGG COMPOUND:59-30-3 "CAS Registry Number"; KEGG COMPOUND:C00504 "KEGG COMPOUND"
	xref_mesh:	MESH:D005492
	xref:	MetaCyc:CPD-12826 "MetaCyc"; NIST Chemistry WebBook:59-30-3 "CAS Registry Number"; PDBeChem:FOL "PDBeChem"; Wikipedia:Folic_Acid "Wikipedia"
	cyclic_relationship:	is_conjugate_acid_of CHEBI:62501

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

folic acid
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	ABCB10	ATP-binding cassette, sub-family B (MDR/TAP), member 10		multiple interactions	ISO	1	229,652,329	229,694,442	RGD:6480464	CTD
G	ABCC1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		affects activity	EXP	16	16,043,434	16,236,931	RGD:6480464	CTD
G	ABCC1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		affects expression	EXP	16	16,043,434	16,236,931	RGD:6480464	CTD
G	ABCC1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		multiple interactions	EXP	16	16,043,434	16,236,931	RGD:6480464	CTD
G	ABCC1	ATP-binding cassette, sub-family C (CFTR/MRP), member 1		multiple interactions	ISO	16	16,043,434	16,236,931	RGD:6480464	CTD
G	ABCC4	ATP-binding cassette, sub-family C (CFTR/MRP), member 4		multiple interactions	ISO	13	95,672,083	95,953,687	RGD:6480464	CTD
G	ABCC5	ATP-binding cassette, sub-family C (CFTR/MRP), member 5		multiple interactions	ISO	3	183,637,722	183,735,727	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		affects transport	EXP	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		multiple interactions	EXP	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		multiple interactions	EXP	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ABCG2	ATP-binding cassette, sub-family G (WHITE), member 2		decreases expression	ISO	4	89,011,416	89,152,474	RGD:6480464	CTD
G	ACE	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		multiple interactions	ISO	17	61,554,422	61,575,741	RGD:6480464	CTD
G	ACE	angiotensin I converting enzyme (peptidyl-dipeptidase A) 1		increases expression	ISO	17	61,554,422	61,575,741	RGD:6480464	CTD
G	ACHE	acetylcholinesterase		multiple interactions	EXP	7	100,487,615	100,493,541	RGD:6480464	CTD
G	ACSS1	acyl-CoA synthetase short-chain family member 1		multiple interactions	ISO	20	24,986,866	25,038,818	RGD:6480464	CTD
G	ACTA2	actin, alpha 2, smooth muscle, aorta		affects expression	EXP	10	90,694,831	90,751,147	RGD:6480464	CTD
G	ACTC1	actin, alpha, cardiac muscle 1		affects expression	EXP	15	35,080,297	35,087,927	RGD:6480464	CTD
G	ACTC1	actin, alpha, cardiac muscle 1		multiple interactions	ISO	15	35,080,297	35,087,927	RGD:6480464	CTD
G	ADAM11	ADAM metallopeptidase domain 11		multiple interactions	ISO	17	42,836,568	42,859,214	RGD:6480464	CTD
G	ADAMTS2	ADAM metallopeptidase with thrombospondin type 1 motif, 2		multiple interactions	ISO	5	178,537,852	178,772,431	RGD:6480464	CTD
G	ADAMTS9	ADAM metallopeptidase with thrombospondin type 1 motif, 9		multiple interactions	ISO	3	64,501,330	64,673,365	RGD:6480464	CTD
G	ADAMTSL2	ADAMTS-like 2		multiple interactions	ISO	9	136,397,286	136,440,641	RGD:6480464	CTD
G	ADC	arginine decarboxylase		multiple interactions	ISO	1	33,546,714	33,585,995	RGD:6480464	CTD
G	ADCY3	adenylate cyclase 3		multiple interactions	ISO	2	25,042,038	25,142,055	RGD:6480464	CTD
G	ADCY7	adenylate cyclase 7		multiple interactions	ISO	16	50,321,823	50,352,043	RGD:6480464	CTD
G	ADD3	adducin 3 (gamma)		multiple interactions	ISO	10	111,765,726	111,895,323	RGD:6480464	CTD
G	ADH5	alcohol dehydrogenase 5 (class III), chi polypeptide		multiple interactions	ISO	4	99,992,129	100,009,931	RGD:6480464	CTD
G	ADHFE1	alcohol dehydrogenase, iron containing, 1		multiple interactions	ISO	8	67,344,718	67,381,044	RGD:6480464	CTD
G	ADIPOR2	adiponectin receptor 2		multiple interactions	ISO	12	1,800,247	1,897,845	RGD:6480464	CTD
G	ADNP2	ADNP homeobox 2		multiple interactions	ISO	18	77,866,915	77,898,229	RGD:6480464	CTD
G	ADORA2B	adenosine A2b receptor		multiple interactions	ISO	17	15,848,231	15,879,210	RGD:6480464	CTD
G	ADRA2A	adrenoceptor alpha 2A		multiple interactions	ISO	10	112,836,790	112,840,665	RGD:6480464	CTD
G	ADRB3	adrenoceptor beta 3		multiple interactions	ISO	8	37,820,513	37,824,184	RGD:6480464	CTD
G	ADSSL1	adenylosuccinate synthase like 1		multiple interactions	ISO	14	105,190,534	105,213,647	RGD:6480464	CTD
G	AEN	apoptosis enhancing nuclease		multiple interactions	ISO	15	89,164,527	89,175,512	RGD:6480464	CTD
G	AFAP1	actin filament associated protein 1		affects expression	EXP	4	7,760,440	7,941,653	RGD:6480464	CTD
G	AGO1	argonaute RISC catalytic component 1		multiple interactions	ISO	1	36,348,810	36,389,899	RGD:6480464	CTD
G	AGR2	anterior gradient 2 homolog (Xenopus laevis)		increases expression	EXP	7	16,832,264	16,844,738	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		multiple interactions	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGT	angiotensinogen (serpin peptidase inhibitor, clade A, member 8)		increases localization	ISO	1	230,838,269	230,850,336	RGD:6480464	CTD
G	AGTR1	angiotensin II receptor, type 1		multiple interactions	ISO	3	148,415,658	148,460,790	RGD:6480464	CTD
G	AGTR1	angiotensin II receptor, type 1		multiple interactions	ISO	3	148,415,658	148,460,790	RGD:6480464	CTD
G	AGTR2	angiotensin II receptor, type 2		increases expression	ISO	X	115,301,958	115,306,225	RGD:6480464	CTD
G	AIG1	androgen-induced 1		multiple interactions	ISO	6	143,382,023	143,661,441	RGD:6480464	CTD
G	AK4	adenylate kinase 4		affects expression	EXP	1	65,613,232	65,697,828	RGD:6480464	CTD
G	AK7	adenylate kinase 7		multiple interactions	ISO	14	96,858,448	96,955,764	RGD:6480464	CTD
G	AKAP12	A kinase (PRKA) anchor protein 12		decreases expression	EXP	6	151,561,134	151,679,694	RGD:6480464	CTD
G	AKAP5	A kinase (PRKA) anchor protein 5		multiple interactions	ISO	14	64,932,217	64,941,221	RGD:6480464	CTD
G	AKNA	AT-hook transcription factor		multiple interactions	ISO	9	117,096,429	117,156,685	RGD:6480464	CTD
G	ALB	albumin		affects binding	EXP	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALB	albumin		affects expression	ISO	4	74,269,972	74,287,129	RGD:6480464	CTD
G	ALDH1A1	aldehyde dehydrogenase 1 family, member A1		affects expression	EXP	9	75,515,578	75,568,233	RGD:6480464	CTD
G	ALDH1L1	aldehyde dehydrogenase 1 family, member L1		increases degradation	EXP	3	125,822,404	125,900,029	RGD:6480464	CTD
G	ALDH1L1	aldehyde dehydrogenase 1 family, member L1		multiple interactions	ISO	3	125,822,404	125,900,029	RGD:6480464	CTD
G	ALDH1L1	aldehyde dehydrogenase 1 family, member L1		affects activity	ISO	3	125,822,404	125,900,029	RGD:6480464	CTD
G	ALDH2	aldehyde dehydrogenase 2 family (mitochondrial)		multiple interactions	ISO	12	112,204,691	112,247,789	RGD:6480464	CTD
G	AMD1	adenosylmethionine decarboxylase 1		increases activity	ISO	6	111,195,987	111,216,913	RGD:6480464	CTD
G	AMD1	adenosylmethionine decarboxylase 1		multiple interactions	ISO	6	111,195,987	111,216,913	RGD:6480464	CTD
G	ANKRD1	ankyrin repeat domain 1 (cardiac muscle)		increases expression	EXP	10	92,671,857	92,681,032	RGD:6480464	CTD
G	ANTXR2	anthrax toxin receptor 2		multiple interactions	ISO	4	80,822,771	80,994,477	RGD:6480464	CTD
G	ANXA13	annexin A13		affects expression	EXP	8	124,693,034	124,749,647	RGD:6480464	CTD
G	AP1S3	adaptor-related protein complex 1, sigma 3 subunit		multiple interactions	ISO	2	224,620,047	224,702,319	RGD:6480464	CTD
G	APOA1	apolipoprotein A-I		multiple interactions	ISO	11	116,706,469	116,708,338	RGD:6480464	CTD
G	APOA2	apolipoprotein A-II		multiple interactions	ISO	1	161,192,083	161,193,418	RGD:6480464	CTD
G	APOA4	apolipoprotein A-IV		multiple interactions	ISO	11	116,691,418	116,694,011	RGD:6480464	CTD
G	APOB	apolipoprotein B (including Ag(x) antigen)		multiple interactions	EXP	2	21,224,301	21,266,945	RGD:6480464	CTD
G	APOB	apolipoprotein B (including Ag(x) antigen)		increases expression	EXP	2	21,224,301	21,266,945	RGD:6480464	CTD
G	APOB	apolipoprotein B (including Ag(x) antigen)		multiple interactions	ISO	2	21,224,301	21,266,945	RGD:6480464	CTD
G	APOE	apolipoprotein E		affects response to substance	ISO	19	45,409,039	45,412,650	RGD:6480464	CTD
G	APOE	apolipoprotein E		multiple interactions	ISO	19	45,409,039	45,412,650	RGD:6480464	CTD
G	ARHGAP29	Rho GTPase activating protein 29		affects expression	EXP	1	94,634,463	94,703,307	RGD:6480464	CTD
G	ARL4C	ADP-ribosylation factor-like 4C		affects expression	EXP	2	235,401,685	235,405,693	RGD:6480464	CTD
G	AS3MT	arsenic (+3 oxidation state) methyltransferase		multiple interactions	EXP	10	104,629,210	104,661,656	RGD:6480464	CTD
G	ASIP	agouti signaling protein		increases methylation	ISO	20	32,848,171	32,857,148	RGD:6480464	CTD
G	ATF6B	activating transcription factor 6 beta		affects expression	EXP	6	32,083,045	32,096,017	RGD:6480464	CTD
G	ATM	ataxia telangiectasia mutated		affects expression	EXP	11	108,093,559	108,239,826	RGD:6480464	CTD
G	AXIN1	axin 1		multiple interactions	ISO	16	337,440	402,676	RGD:6480464	CTD
G	B2M	beta-2-microglobulin		affects expression	EXP	15	45,003,685	45,010,357	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		affects expression	EXP	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		multiple interactions	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		multiple interactions	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BAX	BCL2-associated X protein		multiple interactions	ISO	19	49,458,117	49,465,055	RGD:6480464	CTD
G	BCHE	butyrylcholinesterase		multiple interactions	ISO	3	165,490,692	165,555,253	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		affects expression	EXP	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		affects expression	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2	B-cell CLL/lymphoma 2		multiple interactions	ISO	18	60,790,579	60,986,613	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		decreases expression	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L1	BCL2-like 1		multiple interactions	ISO	20	30,252,261	30,310,656	RGD:6480464	CTD
G	BCL2L11	BCL2-like 11 (apoptosis facilitator)		affects expression	EXP	2	111,878,491	111,926,022	RGD:6480464	CTD
G	BFAR	bifunctional apoptosis regulator		affects expression	EXP	16	14,726,668	14,763,093	RGD:6480464	CTD
G	BIRC2	baculoviral IAP repeat containing 2		increases expression	EXP	11	102,217,913	102,249,401	RGD:6480464	CTD
G	BIRC2	baculoviral IAP repeat containing 2		multiple interactions	ISO	11	102,217,913	102,249,401	RGD:6480464	CTD
G	BIRC3	baculoviral IAP repeat containing 3		affects expression	EXP	11	102,188,181	102,210,134	RGD:6480464	CTD
G	BNIP3	BCL2/adenovirus E1B 19kDa interacting protein 3		affects expression	EXP	10	133,781,204	133,795,435	RGD:6480464	CTD
G	BNIP3L	BCL2/adenovirus E1B 19kDa interacting protein 3-like		affects expression	EXP	8	26,240,523	26,270,644	RGD:6480464	CTD
G	BPNT1	3'(2'), 5'-bisphosphate nucleotidase 1		affects expression	ISO	1	220,230,824	220,263,191	RGD:6480464	CTD
G	CA2	carbonic anhydrase II		multiple interactions	ISO	8	86,376,131	86,393,721	RGD:6480464	CTD
G	CASC5	cancer susceptibility candidate 5		multiple interactions	ISO	15	40,886,447	40,954,881	RGD:6480464	CTD
G	CASP12	caspase 12 (gene/pseudogene)		multiple interactions	ISO	11	104,756,445	104,769,397	RGD:6480464	CTD
G	CASP3	caspase 3, apoptosis-related cysteine peptidase		multiple interactions	ISO	4	185,548,850	185,570,629	RGD:6480464	CTD
G	CASP4	caspase 4, apoptosis-related cysteine peptidase		affects expression	EXP	11	104,813,594	104,839,325	RGD:6480464	CTD
G	CASP4	caspase 4, apoptosis-related cysteine peptidase		multiple interactions	ISO	11	104,813,594	104,839,325	RGD:6480464	CTD
G	CASP6	caspase 6, apoptosis-related cysteine peptidase		affects expression	EXP	4	110,609,785	110,624,629	RGD:6480464	CTD
G	CASP7	caspase 7, apoptosis-related cysteine peptidase		multiple interactions	ISO	10	115,438,921	115,490,668	RGD:6480464	CTD
G	CASP8	caspase 8, apoptosis-related cysteine peptidase		affects expression	EXP	2	202,098,166	202,152,434	RGD:6480464	CTD
G	CASZ1	castor zinc finger 1		multiple interactions	ISO	1	10,696,661	10,856,733	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CAT	catalase		multiple interactions	ISO	11	34,460,472	34,493,607	RGD:6480464	CTD
G	CBFA2T2	core-binding factor, runt domain, alpha subunit 2; translocated to, 2		multiple interactions	ISO	20	32,077,928	32,237,837	RGD:6480464	CTD
G	CBLN2	cerebellin 2 precursor		multiple interactions	ISO	18	70,203,915	70,211,723	RGD:6480464	CTD
G	CBR3	carbonyl reductase 3		multiple interactions	ISO	21	37,507,263	37,518,860	RGD:6480464	CTD
G	CBX1	chromobox homolog 1		multiple interactions	ISO	17	46,147,414	46,178,883	RGD:6480464	CTD
G	CBX6	chromobox homolog 6		multiple interactions	ISO	22	39,260,243	39,268,258	RGD:6480464	CTD
G	CC2D1B	coiled-coil and C2 domain containing 1B		multiple interactions	ISO	1	52,816,265	52,831,877	RGD:6480464	CTD
G	CCDC103	coiled-coil domain containing 103		multiple interactions	ISO	17	42,977,080	42,981,047	RGD:6480464	CTD
G	CCDC106	coiled-coil domain containing 106		multiple interactions	ISO	19	56,158,954	56,164,527	RGD:6480464	CTD
G	CCDC109B	coiled-coil domain containing 109B		multiple interactions	ISO	4	110,481,355	110,608,872	RGD:6480464	CTD
G	CCDC117	coiled-coil domain containing 117		multiple interactions	ISO	22	29,168,662	29,185,283	RGD:6480464	CTD
G	CCDC3	coiled-coil domain containing 3		multiple interactions	ISO	10	12,938,625	13,043,704	RGD:6480464	CTD
G	CCDC68	coiled-coil domain containing 68		multiple interactions	ISO	18	52,568,740	52,626,739	RGD:6480464	CTD
G	CCDC80	coiled-coil domain containing 80		multiple interactions	ISO	3	112,323,407	112,359,977	RGD:6480464	CTD
G	CCDC85A	coiled-coil domain containing 85A		multiple interactions	ISO	2	56,411,258	56,613,309	RGD:6480464	CTD
G	CCDC88B	coiled-coil domain containing 88B		multiple interactions	ISO	11	64,107,690	64,125,006	RGD:6480464	CTD
G	CCDC88C	coiled-coil domain containing 88C		multiple interactions	ISO	14	91,737,667	91,884,188	RGD:6480464	CTD
G	CCDC9	coiled-coil domain containing 9		multiple interactions	ISO	19	47,759,731	47,775,210	RGD:6480464	CTD
G	CCDC92	coiled-coil domain containing 92		multiple interactions	ISO	12	124,420,955	124,457,163	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		decreases expression	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCL2	chemokine (C-C motif) ligand 2		multiple interactions	EXP	17	32,582,296	32,584,222	RGD:6480464	CTD
G	CCND1	cyclin D1		affects expression	EXP	11	69,455,873	69,469,242	RGD:6480464	CTD
G	CCND3	cyclin D3		decreases expression	EXP	6	41,902,671	42,016,610	RGD:6480464	CTD
G	CCNE1	cyclin E1		affects expression	EXP	19	30,302,901	30,315,215	RGD:6480464	CTD
G	CCRL1	chemokine (C-C motif) receptor-like 1		affects expression	EXP	3	132,316,094	132,321,382	RGD:6480464	CTD
G	CDH1	cadherin 1, type 1, E-cadherin (epithelial)		decreases expression	EXP	16	68,771,195	68,869,444	RGD:6480464	CTD
G	CDH13	cadherin 13, H-cadherin (heart)		decreases expression	EXP	16	82,660,399	83,830,215	RGD:6480464	CTD
G	CDH3	cadherin 3, type 1, P-cadherin (placental)		increases expression	EXP	16	68,678,151	68,732,957	RGD:6480464	CTD
G	CDKN1A	cyclin-dependent kinase inhibitor 1A (p21, Cip1)		affects expression	EXP	6	36,644,237	36,655,116	RGD:6480464	CTD
G	CDKN1B	cyclin-dependent kinase inhibitor 1B (p27, Kip1)		affects expression	EXP	12	12,870,302	12,875,305	RGD:6480464	CTD
G	CDKN2A	cyclin-dependent kinase inhibitor 2A		affects methylation	EXP	9	21,967,751	21,994,490	RGD:6480464	CTD
G	CDKN2A	cyclin-dependent kinase inhibitor 2A		multiple interactions	EXP	9	21,967,751	21,994,490	RGD:6480464	CTD
G	CDKN2A	cyclin-dependent kinase inhibitor 2A		affects methylation	ISO	9	21,967,751	21,994,490	RGD:6480464	CTD
G	CDKN2A	cyclin-dependent kinase inhibitor 2A		affects expression	ISO	9	21,967,751	21,994,490	RGD:6480464	CTD
G	CEP112	centrosomal protein 112kDa		multiple interactions	ISO	17	63,631,658	64,188,212	RGD:6480464	CTD
G	CFL1	cofilin 1 (non-muscle)		affects expression	ISO	11	65,622,282	65,625,804	RGD:6480464	CTD
G	CHEK1	checkpoint kinase 1		affects expression	EXP	11	125,495,031	125,546,150	RGD:6480464	CTD
G	CHTF18	CTF18, chromosome transmission fidelity factor 18 homolog (S. cerevisiae)		multiple interactions	ISO	16	838,622	848,074	RGD:6480464	CTD
G	CHURC1	churchill domain containing 1		multiple interactions	ISO	14	65,381,079	65,402,086	RGD:6480464	CTD
G	CIAPIN1	cytokine induced apoptosis inhibitor 1		multiple interactions	ISO	16	57,462,086	57,481,369	RGD:6480464	CTD
G	CIDEB	cell death-inducing DFFA-like effector b		affects expression	EXP	14	24,774,393	24,780,576	RGD:6480464	CTD
G	CILP2	cartilage intermediate layer protein 2		multiple interactions	ISO	19	19,649,074	19,657,468	RGD:6480464	CTD
G	CISD3	CDGSH iron sulfur domain 3		multiple interactions	ISO	17	36,886,510	36,891,858	RGD:6480464	CTD
G	CITED1	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 1		multiple interactions	ISO	X	71,521,488	71,527,037	RGD:6480464	CTD
G	CITED4	Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4		multiple interactions	ISO	1	41,326,728	41,328,018	RGD:6480464	CTD
G	CLCA2	chloride channel accessory 2		multiple interactions	ISO	1	86,889,769	86,922,241	RGD:6480464	CTD
G	CLGN	calmegin		increases expression	EXP	4	141,309,607	141,348,815	RGD:6480464	CTD
G	CLU	clusterin		increases expression	ISO	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CLU	clusterin		increases expression	ISO	8	27,454,434	27,472,328	RGD:6480464	CTD
G	CNTF	ciliary neurotrophic factor		multiple interactions	EXP	11	58,390,146	58,393,206	RGD:6480464	CTD
G	COL1A2	collagen, type I, alpha 2		multiple interactions	ISO	7	94,023,873	94,060,544	RGD:6480464	CTD
G	CREB1	cAMP responsive element binding protein 1		multiple interactions	ISO	2	208,394,616	208,470,284	RGD:6480464	CTD
G	CREB1	cAMP responsive element binding protein 1		increases activity	ISO	2	208,394,616	208,470,284	RGD:6480464	CTD
G	CRP	C-reactive protein, pentraxin-related		multiple interactions	EXP	1	159,682,079	159,684,379	RGD:6480464	CTD
G	CRP	C-reactive protein, pentraxin-related		multiple interactions	EXP	1	159,682,079	159,684,379	RGD:6480464	CTD
G	CRP	C-reactive protein, pentraxin-related		decreases expression	EXP	1	159,682,079	159,684,379	RGD:6480464	CTD
G	CRY2	cryptochrome 2 (photolyase-like)		multiple interactions	ISO	11	45,868,669	45,904,799	RGD:6480464	CTD
G	CTNNB1	catenin (cadherin-associated protein), beta 1, 88kDa		affects expression	EXP	3	41,240,942	41,281,939	RGD:6480464	CTD
G	CTSC	cathepsin C		affects expression	EXP	11	88,026,760	88,070,941	RGD:6480464	CTD
G	CXCR7	chemokine (C-X-C motif) receptor 7		affects expression	EXP	2	237,478,380	237,490,997	RGD:6480464	CTD
G	CYP2E1	cytochrome P450, family 2, subfamily E, polypeptide 1		multiple interactions	ISO	10	135,340,867	135,352,620	RGD:6480464	CTD
G	CYP4A11	cytochrome P450, family 4, subfamily A, polypeptide 11		multiple interactions	ISO	1	47,394,846	47,407,156	RGD:6480464	CTD
G	DEK	DEK oncogene		affects expression	EXP	6	18,224,400	18,264,799	RGD:6480464	CTD
G	DET1	de-etiolated homolog 1 (Arabidopsis)		multiple interactions	ISO	15	89,055,714	89,089,912	RGD:6480464	CTD
G	DHCR7	7-dehydrocholesterol reductase		multiple interactions	ISO	11	71,145,457	71,159,477	RGD:6480464	CTD
G	DHFR	dihydrofolate reductase		multiple interactions	EXP	5	79,922,045	79,950,800	RGD:6480464	CTD
G	DHFR	dihydrofolate reductase		decreases abundance	EXP	5	79,922,045	79,950,800	RGD:6480464	CTD
G	DHFR	dihydrofolate reductase		affects expression	EXP	5	79,922,045	79,950,800	RGD:6480464	CTD
G	DHFR	dihydrofolate reductase		multiple interactions	ISO	5	79,922,045	79,950,800	RGD:6480464	CTD
G	DHTKD1	dehydrogenase E1 and transketolase domain containing 1		multiple interactions	ISO	10	12,110,934	12,165,224	RGD:6480464	CTD
G	DHX29	DEAH (Asp-Glu-Ala-His) box polypeptide 29		multiple interactions	ISO	5	54,552,073	54,603,521	RGD:6480464	CTD
G	DHX33	DEAH (Asp-Glu-Ala-His) box polypeptide 33		multiple interactions	ISO	17	5,344,232	5,372,380	RGD:6480464	CTD
G	DIABLO	diablo, IAP-binding mitochondrial protein		increases expression	ISO	12	122,692,209	122,712,068	RGD:6480464	CTD
G	DIABLO	diablo, IAP-binding mitochondrial protein		increases expression	ISO	12	122,692,209	122,712,068	RGD:6480464	CTD
G	DICER1	dicer 1, ribonuclease type III		multiple interactions	ISO	14	95,552,565	95,623,759	RGD:6480464	CTD
G	DIDO1	death inducer-obliterator 1		multiple interactions	ISO	20	61,509,090	61,569,304	RGD:6480464	CTD
G	DIO3	deiodinase, iodothyronine, type III		multiple interactions	ISO	14	102,027,688	102,029,789	RGD:6480464	CTD
G	DKC1	dyskeratosis congenita 1, dyskerin		multiple interactions	ISO	X	153,991,031	154,005,964	RGD:6480464	CTD
G	DKK1	dickkopf 1 homolog (Xenopus laevis)		increases expression	EXP	10	54,074,041	54,077,417	RGD:6480464	CTD
G	DKK1	dickkopf 1 homolog (Xenopus laevis)		affects expression	EXP	10	54,074,041	54,077,417	RGD:6480464	CTD
G	DLX1	distal-less homeobox 1		multiple interactions	ISO	2	172,950,208	172,954,402	RGD:6480464	CTD
G	DMPK	dystrophia myotonica-protein kinase		multiple interactions	ISO	19	46,272,975	46,285,815	RGD:6480464	CTD
G	DNAH11	dynein, axonemal, heavy chain 11		multiple interactions	ISO	7	21,582,833	21,941,457	RGD:6480464	CTD
G	DNAH12	dynein, axonemal, heavy chain 12		multiple interactions	ISO	3	57,327,727	57,530,071	RGD:6480464	CTD
G	DNAJC1	DnaJ (Hsp40) homolog, subfamily C, member 1		multiple interactions	ISO	10	22,045,477	22,292,650	RGD:6480464	CTD
G	DNAJC10	DnaJ (Hsp40) homolog, subfamily C, member 10		multiple interactions	ISO	2	183,580,999	183,643,255	RGD:6480464	CTD
G	DNAJC19	DnaJ (Hsp40) homolog, subfamily C, member 19		multiple interactions	ISO	3	180,701,497	180,707,562	RGD:6480464	CTD
G	DNM2	dynamin 2		multiple interactions	ISO	19	10,828,729	10,942,586	RGD:6480464	CTD
G	DNMT1	DNA (cytosine-5-)-methyltransferase 1		affects expression	EXP	19	10,244,022	10,305,755	RGD:6480464	CTD
G	DNMT1	DNA (cytosine-5-)-methyltransferase 1		affects activity	ISO	19	10,244,022	10,305,755	RGD:6480464	CTD
G	DNMT1	DNA (cytosine-5-)-methyltransferase 1		multiple interactions	ISO	19	10,244,022	10,305,755	RGD:6480464	CTD
G	DNMT3A	DNA (cytosine-5-)-methyltransferase 3 alpha		affects expression	EXP	2	25,455,830	25,565,459	RGD:6480464	CTD
G	DNMT3A	DNA (cytosine-5-)-methyltransferase 3 alpha		multiple interactions	ISO	2	25,455,830	25,565,459	RGD:6480464	CTD
G	DNMT3B	DNA (cytosine-5-)-methyltransferase 3 beta		affects expression	EXP	20	31,350,191	31,397,162	RGD:6480464	CTD
G	DNPEP	aspartyl aminopeptidase		multiple interactions	ISO	2	220,238,180	220,252,662	RGD:6480464	CTD
G	DOC2B	double C2-like domains, beta		multiple interactions	ISO	17	6,009	31,420	RGD:6480464	CTD
G	DOCK6	dedicator of cytokinesis 6		multiple interactions	ISO	19	11,309,969	11,373,168	RGD:6480464	CTD
G	DOLK	dolichol kinase		multiple interactions	ISO	9	131,707,809	131,710,012	RGD:6480464	CTD
G	DOLPP1	dolichyl pyrophosphate phosphatase 1		multiple interactions	ISO	9	131,843,383	131,852,717	RGD:6480464	CTD
G	DPT	dermatopontin		affects expression	EXP	1	168,664,695	168,698,442	RGD:6480464	CTD
G	DPYSL4	dihydropyrimidinase-like 4		multiple interactions	ISO	10	134,000,414	134,019,280	RGD:6480464	CTD
G	DRD4	dopamine receptor D4		multiple interactions	ISO	11	637,305	640,706	RGD:6480464	CTD
G	DST	dystonin		multiple interactions	ISO	6 6 6	56,322,785 56,535,286 56,713,863	56,507,694 56,708,082 56,820,047	RGD:6480464	CTD
G	DTD1	D-tyrosyl-tRNA deacylase 1		multiple interactions	ISO	20	18,568,556	18,744,561	RGD:6480464	CTD
G	DTNA	dystrobrevin, alpha		multiple interactions	ISO	18	32,073,254	32,471,808	RGD:6480464	CTD
G	DTX3	deltex homolog 3 (Drosophila)		multiple interactions	ISO	12	57,998,604	58,003,583	RGD:6480464	CTD
G	DUOXA1	dual oxidase maturation factor 1		multiple interactions	ISO	15	45,409,685	45,422,057	RGD:6480464	CTD
G	DUS1L	dihydrouridine synthase 1-like (S. cerevisiae)		multiple interactions	ISO	17	80,015,748	80,023,697	RGD:6480464	CTD
G	DUS3L	dihydrouridine synthase 3-like (S. cerevisiae)		multiple interactions	ISO	19	5,785,151	5,791,249	RGD:6480464	CTD
G	DUSP1	dual specificity phosphatase 1		multiple interactions	ISO	5	172,195,093	172,198,203	RGD:6480464	CTD
G	DUSP10	dual specificity phosphatase 10		multiple interactions	ISO	1	221,874,764	221,915,516	RGD:6480464	CTD
G	DUSP11	dual specificity phosphatase 11 (RNA/RNP complex 1-interacting)		multiple interactions	ISO	2	73,989,325	74,007,284	RGD:6480464	CTD
G	DUSP14	dual specificity phosphatase 14		multiple interactions	ISO	17	35,849,951	35,873,588	RGD:6480464	CTD
G	DUSP2	dual specificity phosphatase 2		multiple interactions	ISO	2	96,808,908	96,811,179	RGD:6480464	CTD
G	DUSP26	dual specificity phosphatase 26 (putative)		multiple interactions	ISO	8	33,448,851	33,457,439	RGD:6480464	CTD
G	DUSP4	dual specificity phosphatase 4		multiple interactions	ISO	8	29,190,579	29,208,267	RGD:6480464	CTD
G	DUSP9	dual specificity phosphatase 9		multiple interactions	ISO	X	152,907,897	152,916,781	RGD:6480464	CTD
G	DVL2	dishevelled, dsh homolog 2 (Drosophila)		multiple interactions	ISO	17	7,128,661	7,137,863	RGD:6480464	CTD
G	DYM	dymeclin		multiple interactions	ISO	18	46,570,172	46,987,079	RGD:6480464	CTD
G	DYNC2LI1	dynein, cytoplasmic 2, light intermediate chain 1		multiple interactions	ISO	2	44,001,178	44,037,149	RGD:6480464	CTD
G	DYNLL1	dynein, light chain, LC8-type 1		multiple interactions	ISO	12	120,907,660	120,936,298	RGD:6480464	CTD
G	DYNLL2	dynein, light chain, LC8-type 2		multiple interactions	ISO	17	56,160,780	56,167,618	RGD:6480464	CTD
G	DYNLT1	dynein, light chain, Tctex-type 1		multiple interactions	ISO	6	159,057,506	159,065,804	RGD:6480464	CTD
G	DYRK1A	dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1A		multiple interactions	ISO	21	38,739,859	38,887,679	RGD:6480464	CTD
G	DYRK3	dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3		multiple interactions	ISO	1	206,808,881	206,822,542	RGD:6480464	CTD
G	DZIP1L	DAZ interacting protein 1-like		multiple interactions	ISO	3	137,780,827	137,834,451	RGD:6480464	CTD
G	E2F1	E2F transcription factor 1		multiple interactions	ISO	20	32,263,292	32,274,210	RGD:6480464	CTD
G	EAF2	ELL associated factor 2		multiple interactions	ISO	3	121,554,034	121,605,373	RGD:6480464	CTD
G	EBI3	Epstein-Barr virus induced 3		multiple interactions	ISO	19	4,229,540	4,237,525	RGD:6480464	CTD
G	EBPL	emopamil binding protein-like		multiple interactions	ISO	13	50,234,810	50,265,623	RGD:6480464	CTD
G	ECE2	endothelin converting enzyme 2		multiple interactions	ISO	3	183,967,445	184,010,819	RGD:6480464	CTD
G	ECH1	enoyl CoA hydratase 1, peroxisomal		multiple interactions	ISO	19	39,306,062	39,322,497	RGD:6480464	CTD
G	ECHDC1	enoyl CoA hydratase domain containing 1		multiple interactions	ISO	6	127,609,857	127,664,754	RGD:6480464	CTD
G	EDN2	endothelin 2		multiple interactions	EXP	1	41,944,446	41,950,344	RGD:6480464	CTD
G	EDNRB	endothelin receptor type B		multiple interactions	ISO	13 13	78,469,616 78,513,393	78,549,664 78,549,674	RGD:6480464	CTD
G	EEF1A1	eukaryotic translation elongation factor 1 alpha 1		multiple interactions	ISO	6	74,225,473	74,230,755	RGD:6480464	CTD
G	EEF1G	eukaryotic translation elongation factor 1 gamma		multiple interactions	ISO	11	62,327,073	62,341,460	RGD:6480464	CTD
G	EEF2K	eukaryotic elongation factor-2 kinase		multiple interactions	ISO	16	22,217,592	22,300,066	RGD:6480464	CTD
G	EFEMP2	EGF containing fibulin-like extracellular matrix protein 2		multiple interactions	ISO	11	65,633,912	65,640,405	RGD:6480464	CTD
G	EFHC1	EF-hand domain (C-terminal) containing 1		multiple interactions	ISO	6	52,284,994	52,360,583	RGD:6480464	CTD
G	EFHD1	EF-hand domain family, member D1		multiple interactions	ISO	2	233,470,767	233,547,491	RGD:6480464	CTD
G	EFNA1	ephrin-A1		multiple interactions	ISO	1	155,100,349	155,107,386	RGD:6480464	CTD
G	EFNA2	ephrin-A2		multiple interactions	ISO	19	1,286,153	1,301,430	RGD:6480464	CTD
G	EFNA3	ephrin-A3		multiple interactions	ISO	1	155,051,348	155,060,014	RGD:6480464	CTD
G	EFNA5	ephrin-A5		multiple interactions	ISO	5	106,712,590	107,006,596	RGD:6480464	CTD
G	EFNB2	ephrin-B2		multiple interactions	ISO	13	107,142,079	107,187,388	RGD:6480464	CTD
G	EFR3B	EFR3 homolog B (S. cerevisiae)		multiple interactions	ISO	2	25,264,973	25,382,004	RGD:6480464	CTD
G	EGLN3	egl nine homolog 3 (C. elegans)		multiple interactions	ISO	14	34,393,421	34,420,284	RGD:6480464	CTD
G	EGR1	early growth response 1		multiple interactions	ISO	5	137,801,181	137,805,004	RGD:6480464	CTD
G	EGR2	early growth response 2		multiple interactions	ISO	10	64,571,756	64,578,927	RGD:6480464	CTD
G	EGR3	early growth response 3		multiple interactions	ISO	8	22,545,174	22,550,815	RGD:6480464	CTD
G	EHBP1L1	EH domain binding protein 1-like 1		multiple interactions	ISO	11	65,343,509	65,360,116	RGD:6480464	CTD
G	EHD3	EH-domain containing 3		multiple interactions	ISO	2	31,456,880	31,491,260	RGD:6480464	CTD
G	EHF	ets homologous factor		multiple interactions	ISO	11	34,642,588	34,684,835	RGD:6480464	CTD
G	EID1	EP300 interacting inhibitor of differentiation 1		multiple interactions	ISO	15	49,170,290	49,172,380	RGD:6480464	CTD
G	EID2	EP300 interacting inhibitor of differentiation 2		multiple interactions	ISO	19	40,029,446	40,030,838	RGD:6480464	CTD
G	EIF2AK3	eukaryotic translation initiation factor 2-alpha kinase 3		multiple interactions	ISO	2	88,856,259	88,927,094	RGD:6480464	CTD
G	EIF2B4	eukaryotic translation initiation factor 2B, subunit 4 delta, 67kDa		multiple interactions	ISO	2	27,587,219	27,593,324	RGD:6480464	CTD
G	EIF3F	eukaryotic translation initiation factor 3, subunit F		multiple interactions	ISO	11	8,008,867	8,017,718	RGD:6480464	CTD
G	EIF3M	eukaryotic translation initiation factor 3, subunit M		multiple interactions	ISO	11	32,605,313	32,624,037	RGD:6480464	CTD
G	EIF4B	eukaryotic translation initiation factor 4B		multiple interactions	ISO	12	53,400,062	53,435,993	RGD:6480464	CTD
G	EIF4E2	eukaryotic translation initiation factor 4E family member 2		multiple interactions	ISO	2	233,415,357	233,433,920	RGD:6480464	CTD
G	EIF4EBP2	eukaryotic translation initiation factor 4E binding protein 2		multiple interactions	ISO	10	72,163,861	72,188,374	RGD:6480464	CTD
G	EIF4G3	eukaryotic translation initiation factor 4 gamma, 3		multiple interactions	ISO	1	21,132,785	21,503,381	RGD:6480464	CTD
G	EIF4H	eukaryotic translation initiation factor 4H		multiple interactions	ISO	7	73,588,706	73,611,429	RGD:6480464	CTD
G	ELF3	E74-like factor 3 (ets domain transcription factor, epithelial-specific )		multiple interactions	ISO	1	201,979,690	201,986,316	RGD:6480464	CTD
G	ELFN1	extracellular leucine-rich repeat and fibronectin type III domain containing 1		multiple interactions	ISO	7	1,748,798	1,787,590	RGD:6480464	CTD
G	ELL2	elongation factor, RNA polymerase II, 2		multiple interactions	ISO	5	95,220,802	95,297,775	RGD:6480464	CTD
G	ELN	elastin		multiple interactions	ISO	7	73,442,427	73,484,237	RGD:6480464	CTD
G	ELOVL6	ELOVL fatty acid elongase 6		multiple interactions	ISO	4	110,970,229	111,119,820	RGD:6480464	CTD
G	ELOVL7	ELOVL fatty acid elongase 7		multiple interactions	ISO	5	60,047,616	60,140,101	RGD:6480464	CTD
G	EMB	embigin		multiple interactions	ISO	5	49,692,031	49,737,234	RGD:6480464	CTD
G	EMILIN2	elastin microfibril interfacer 2		multiple interactions	ISO	18	2,847,028	2,914,090	RGD:6480464	CTD
G	EMILIN3	elastin microfibril interfacer 3		multiple interactions	ISO	20	39,988,606	39,995,498	RGD:6480464	CTD
G	EML1	echinoderm microtubule associated protein like 1		multiple interactions	ISO	14	100,259,745	100,408,397	RGD:6480464	CTD
G	EMP1	epithelial membrane protein 1		multiple interactions	ISO	12	13,349,602	13,369,708	RGD:6480464	CTD
G	EMP2	epithelial membrane protein 2		multiple interactions	ISO	16	10,622,279	10,674,539	RGD:6480464	CTD
G	EMX2	empty spiracles homeobox 2		multiple interactions	ISO	10	119,301,956	119,309,057	RGD:6480464	CTD
G	ENAH	enabled homolog (Drosophila)		multiple interactions	ISO	1	225,674,534	225,840,845	RGD:6480464	CTD
G	ENC1	ectodermal-neural cortex 1 (with BTB domain)		multiple interactions	ISO	5	73,923,231	73,937,249	RGD:6480464	CTD
G	ENDOD1	endonuclease domain containing 1		multiple interactions	ISO	11	94,822,974	94,865,815	RGD:6480464	CTD
G	ENOX1	ecto-NOX disulfide-thiol exchanger 1		multiple interactions	ISO	13	43,787,661	44,361,116	RGD:6480464	CTD
G	ENPP3	ectonucleotide pyrophosphatase/phosphodiesterase 3		multiple interactions	ISO	6	131,958,442	132,068,550	RGD:6480464	CTD
G	ENTPD2	ectonucleoside triphosphate diphosphohydrolase 2		multiple interactions	ISO	9	139,942,550	139,948,503	RGD:6480464	CTD
G	ENTPD5	ectonucleoside triphosphate diphosphohydrolase 5		multiple interactions	ISO	14	74,433,172	74,486,026	RGD:6480464	CTD
G	EPAS1	endothelial PAS domain protein 1		multiple interactions	ISO	2	46,524,541	46,613,842	RGD:6480464	CTD
G	EPB41L1	erythrocyte membrane protein band 4.1-like 1		multiple interactions	ISO	20	34,679,426	34,820,721	RGD:6480464	CTD
G	EPB41L4A	erythrocyte membrane protein band 4.1 like 4A		multiple interactions	ISO	5	111,498,315	111,755,010	RGD:6480464	CTD
G	EPC2	enhancer of polycomb homolog 2 (Drosophila)		multiple interactions	ISO	2	149,402,560	149,545,136	RGD:6480464	CTD
G	EPCAM	epithelial cell adhesion molecule		multiple interactions	ISO	2	47,596,287	47,614,167	RGD:6480464	CTD
G	EPDR1	ependymin related protein 1 (zebrafish)		multiple interactions	ISO	7	37,960,163	37,991,543	RGD:6480464	CTD
G	EPHB1	EPH receptor B1		multiple interactions	ISO	3	134,514,099	134,979,309	RGD:6480464	CTD
G	EPHB6	EPH receptor B6		affects expression	EXP	7	142,552,792	142,568,847	RGD:6480464	CTD
G	EPHX3	epoxide hydrolase 3		multiple interactions	ISO	19	15,337,730	15,343,858	RGD:6480464	CTD
G	EPN2	epsin 2		multiple interactions	ISO	17	19,140,690	19,240,028	RGD:6480464	CTD
G	EPS15	epidermal growth factor receptor pathway substrate 15		multiple interactions	ISO	1	51,819,935	51,984,995	RGD:6480464	CTD
G	EPS8L3	EPS8-like 3		multiple interactions	ISO	1	110,292,702	110,306,644	RGD:6480464	CTD
G	EPSTI1	epithelial stromal interaction 1 (breast)		multiple interactions	ISO	13	43,460,524	43,566,407	RGD:6480464	CTD
G	ERBB2	v-erb-b2 erythroblastic leukemia viral oncogene homolog 2, neuro/glioblastoma derived oncogene homolog (avian)		multiple interactions	ISO	17	37,844,393	37,884,915	RGD:6480464	CTD
G	ERBB3	v-erb-b2 erythroblastic leukemia viral oncogene homolog 3 (avian)		multiple interactions	ISO	12	56,473,809	56,497,291	RGD:6480464	CTD
G	ERCC1	excision repair cross-complementing rodent repair deficiency, complementation group 1 (includes overlapping antisense sequence)		multiple interactions	ISO	19	45,910,591	45,927,177	RGD:6480464	CTD
G	ERCC6	excision repair cross-complementing rodent repair deficiency, complementation group 6		multiple interactions	ISO	10	50,664,491	50,747,147	RGD:6480464	CTD
G	ERCC6L	excision repair cross-complementing rodent repair deficiency, complementation group 6-like		multiple interactions	ISO	X	71,424,507	71,458,858	RGD:6480464	CTD
G	ERGIC1	endoplasmic reticulum-golgi intermediate compartment (ERGIC) 1		multiple interactions	ISO	5	172,261,223	172,379,688	RGD:6480464	CTD
G	ERI1	exoribonuclease 1		multiple interactions	ISO	8	8,860,314	8,890,849	RGD:6480464	CTD
G	ERN1	endoplasmic reticulum to nucleus signaling 1		multiple interactions	ISO	17	62,120,390	62,207,502	RGD:6480464	CTD
G	ERO1LB	ERO1-like beta (S. cerevisiae)		multiple interactions	ISO	1	236,378,422	236,445,339	RGD:6480464	CTD
G	ESCO1	establishment of cohesion 1 homolog 1 (S. cerevisiae)		multiple interactions	ISO	18	19,109,262	19,180,693	RGD:6480464	CTD
G	ESPL1	extra spindle pole bodies homolog 1 (S. cerevisiae)		multiple interactions	ISO	12	53,662,083	53,687,427	RGD:6480464	CTD
G	ESPN	espin		multiple interactions	ISO	1	6,484,848	6,521,004	RGD:6480464	CTD
G	ESYT1	extended synaptotagmin-like protein 1		multiple interactions	ISO	12	56,521,986	56,538,460	RGD:6480464	CTD
G	ETF1	eukaryotic translation termination factor 1		multiple interactions	ISO	5	137,841,782	137,878,989	RGD:6480464	CTD
G	ETFA	electron-transfer-flavoprotein, alpha polypeptide		multiple interactions	ISO	15	76,508,628	76,603,810	RGD:6480464	CTD
G	ETNK1	ethanolamine kinase 1		multiple interactions	ISO	12	22,778,076	22,843,608	RGD:6480464	CTD
G	ETS2	v-ets erythroblastosis virus E26 oncogene homolog 2 (avian)		affects expression	EXP	21	40,177,231	40,196,879	RGD:6480464	CTD
G	EVC2	Ellis van Creveld syndrome 2		multiple interactions	ISO	4	5,564,146	5,711,275	RGD:6480464	CTD
G	EVI2A	ecotropic viral integration site 2A		multiple interactions	ISO	17	29,643,428	29,648,767	RGD:6480464	CTD
G	EVI2B	ecotropic viral integration site 2B		multiple interactions	ISO	17	29,630,788	29,641,130	RGD:6480464	CTD
G	EVL	Enah/Vasp-like		multiple interactions	ISO	14	100,531,751	100,610,573	RGD:6480464	CTD
G	EVPL	envoplakin		multiple interactions	ISO	17	74,002,927	74,023,507	RGD:6480464	CTD
G	EVX1	even-skipped homeobox 1		multiple interactions	ISO	7	27,282,164	27,286,192	RGD:6480464	CTD
G	EXD1	exonuclease 3'-5' domain containing 1		multiple interactions	ISO	15	41,474,926	41,522,895	RGD:6480464	CTD
G	EXO1	exonuclease 1		multiple interactions	ISO	1	242,011,493	242,053,241	RGD:6480464	CTD
G	EXOSC8	exosome component 8		multiple interactions	ISO	13	37,574,678	37,583,751	RGD:6480464	CTD
G	FAM126A	family with sequence similarity 126, member A		affects expression	EXP	7	22,980,878	23,053,770	RGD:6480464	CTD
G	FARS2	phenylalanyl-tRNA synthetase 2, mitochondrial		multiple interactions	ISO	6	5,261,584	5,771,816	RGD:6480464	CTD
G	FAS	Fas (TNF receptor superfamily, member 6)		affects expression	EXP	10	90,750,288	90,775,542	RGD:6480464	CTD
G	FGA	fibrinogen alpha chain		increases expression	EXP	4	155,504,280	155,511,897	RGD:6480464	CTD
G	FGF8	fibroblast growth factor 8 (androgen-induced)		multiple interactions	ISO	10	103,529,887	103,540,126	RGD:6480464	CTD
G	FHL1	four and a half LIM domains 1		affects expression	EXP	X	135,228,861	135,293,518	RGD:6480464	CTD
G	FKBP4	FK506 binding protein 4, 59kDa		multiple interactions	ISO	12	2,904,108	2,914,589	RGD:6480464	CTD
G	FLNB	filamin B, beta		multiple interactions	ISO	3	57,994,127	58,157,982	RGD:6480464	CTD
G	FLNC	filamin C, gamma		multiple interactions	ISO	7	128,470,483	128,499,328	RGD:6480464	CTD
G	FLRT2	fibronectin leucine rich transmembrane protein 2		multiple interactions	ISO	14	85,996,488	86,094,270	RGD:6480464	CTD
G	FLT1	fms-related tyrosine kinase 1		multiple interactions	ISO	13	28,874,483	29,069,265	RGD:6480464	CTD
G	FLT3LG	fms-related tyrosine kinase 3 ligand		multiple interactions	ISO	19	49,977,466	49,989,488	RGD:6480464	CTD
G	FMN2	formin 2		multiple interactions	ISO	1	240,255,185	240,638,489	RGD:6480464	CTD
G	FNBP1	formin binding protein 1		multiple interactions	ISO	9	132,649,466	132,805,473	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		affects expression	EXP	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		decreases expression	EXP	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		affects abundance	ISO	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		increases uptake	ISO	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		multiple interactions	ISO	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR1	folate receptor 1 (adult)		decreases expression	ISO	11	71,900,602	71,907,367	RGD:6480464	CTD
G	FOLR2	folate receptor 2 (fetal)		multiple interactions	EXP	11	71,927,819	71,932,994	RGD:6480464	CTD
G	FOLR2	folate receptor 2 (fetal)		decreases expression	EXP	11	71,927,819	71,932,994	RGD:6480464	CTD
G	FOLR2	folate receptor 2 (fetal)		multiple interactions	ISO	11	71,927,819	71,932,994	RGD:6480464	CTD
G	FOLR2	folate receptor 2 (fetal)		multiple interactions	ISO	11	71,927,819	71,932,994	RGD:6480464	CTD
G	FOXC2	forkhead box C2 (MFH-1, mesenchyme forkhead 1)		multiple interactions	ISO	16	86,600,857	86,602,539	RGD:6480464	CTD
G	FOXP4	forkhead box P4		multiple interactions	ISO	6	41,514,164	41,570,122	RGD:6480464	CTD
G	FPGS	folylpolyglutamate synthase		affects expression	EXP	9	130,565,154	130,576,556	RGD:6480464	CTD
G	FTL	ferritin, light polypeptide		affects expression	EXP	19	49,468,566	49,470,136	RGD:6480464	CTD
G	GAS6	growth arrest-specific 6		affects expression	EXP	13	114,523,522	114,567,046	RGD:6480464	CTD
G	GDF15	growth differentiation factor 15		multiple interactions	EXP	19	18,496,968	18,499,986	RGD:6480464	CTD
G	GDPD3	glycerophosphodiester phosphodiesterase domain containing 3		affects expression	EXP	16	30,116,131	30,124,878	RGD:6480464	CTD
G	GGH	gamma-glutamyl hydrolase (conjugase, folylpolygammaglutamyl hydrolase)		affects expression	EXP	8	63,927,638	63,951,610	RGD:6480464	CTD
G	GGH	gamma-glutamyl hydrolase (conjugase, folylpolygammaglutamyl hydrolase)		multiple interactions	ISO	8	63,927,638	63,951,610	RGD:6480464	CTD
G	GGH	gamma-glutamyl hydrolase (conjugase, folylpolygammaglutamyl hydrolase)		increases hydrolysis	ISO	8	63,927,638	63,951,610	RGD:6480464	CTD
G	GGT1	gamma-glutamyltransferase 1		affects activity	ISO	22	24,979,718	25,024,972	RGD:6480464	CTD
G	GJA1	gap junction protein, alpha 1, 43kDa		affects expression	EXP	6	121,756,745	121,770,873	RGD:6480464	CTD
G	GLI3	GLI family zinc finger 3		multiple interactions	ISO	7	42,000,547	42,276,618	RGD:6480464	CTD
G	GNMT	glycine N-methyltransferase		affects activity	ISO	6	42,928,500	42,931,618	RGD:6480464	CTD
G	GNMT	glycine N-methyltransferase		multiple interactions	ISO	6	42,928,500	42,931,618	RGD:6480464	CTD
G	GPT	glutamic-pyruvate transaminase (alanine aminotransferase)		decreases expression	EXP	8	145,729,465	145,732,555	RGD:6480464	CTD
G	GPX1	glutathione peroxidase 1		affects activity	ISO	3	49,394,609	49,395,791	RGD:6480464	CTD
G	GPX1	glutathione peroxidase 1		affects expression	ISO	3	49,394,609	49,395,791	RGD:6480464	CTD
G	GUK1	guanylate kinase 1		multiple interactions	EXP	1	228,327,785	228,336,656	RGD:6480464	CTD
G	HGF	hepatocyte growth factor (hepapoietin A; scatter factor)		increases expression	ISO	7	81,331,444	81,399,452	RGD:6480464	CTD
G	HHEX	hematopoietically expressed homeobox		multiple interactions	ISO	10	94,449,681	94,455,408	RGD:6480464	CTD
G	HIF1A	hypoxia inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor)		decreases expression	ISO	14	62,162,119	62,214,977	RGD:6480464	CTD
G	HRK	harakiri, BCL2 interacting protein (contains only BH3 domain)		affects expression	EXP	12	117,299,027	117,319,232	RGD:6480464	CTD
G	HSPA9	heat shock 70kDa protein 9 (mortalin)		affects expression	ISO	5	137,890,571	137,911,318	RGD:6480464	CTD
G	HSPB7	heat shock 27kDa protein family, member 7 (cardiovascular)		affects expression	EXP	1	16,340,523	16,345,285	RGD:6480464	CTD
G	ICOS	inducible T-cell co-stimulator		multiple interactions	ISO	2	204,801,471	204,826,300	RGD:6480464	CTD
G	ID1	inhibitor of DNA binding 1, dominant negative helix-loop-helix protein		affects expression	EXP	20	30,193,086	30,194,318	RGD:6480464	CTD
G	IFITM1	interferon induced transmembrane protein 1		multiple interactions	EXP	11	313,991	315,272	RGD:6480464	CTD
G	IFITM3	interferon induced transmembrane protein 3		decreases expression	EXP	11	319,673	320,914	RGD:6480464	CTD
G	IFNLR1	interferon, lambda receptor 1		multiple interactions	ISO	1	24,480,647	24,513,765	RGD:6480464	CTD
G	IGF1R	insulin-like growth factor 1 receptor		multiple interactions	EXP	15	99,192,761	99,507,759	RGD:6480464	CTD
G	IGF1R	insulin-like growth factor 1 receptor		decreases expression	EXP	15	99,192,761	99,507,759	RGD:6480464	CTD
G	IGFBP5	insulin-like growth factor binding protein 5		affects expression	EXP	2	217,536,828	217,560,272	RGD:6480464	CTD
G	IL13RA1	interleukin 13 receptor, alpha 1		multiple interactions	ISO	X	117,861,559	117,928,496	RGD:6480464	CTD
G	IL1B	interleukin 1, beta		multiple interactions	ISO	2	113,587,337	113,594,356	RGD:6480464	CTD
G	IL1R2	interleukin 1 receptor, type II		multiple interactions	ISO	2	102,608,306	102,644,885	RGD:6480464	CTD
G	IL1RAPL2	interleukin 1 receptor accessory protein-like 2		multiple interactions	ISO	X	103,810,996	105,011,822	RGD:6480464	CTD
G	IL1RL2	interleukin 1 receptor-like 2		multiple interactions	ISO	2	102,803,433	102,855,811	RGD:6480464	CTD
G	IL1RN	interleukin 1 receptor antagonist		multiple interactions	ISO	2	113,875,470	113,891,593	RGD:6480464	CTD
G	IL2	interleukin 2		affects expression	EXP	4	123,372,625	123,377,650	RGD:6480464	CTD
G	IL20RB	interleukin 20 receptor beta		multiple interactions	ISO	3	136,676,707	136,729,927	RGD:6480464	CTD
G	IL4I1	interleukin 4 induced 1		multiple interactions	ISO	19	50,392,911	50,432,796	RGD:6480464	CTD
G	IL4R	interleukin 4 receptor		multiple interactions	ISO	16	27,325,230	27,376,099	RGD:6480464	CTD
G	IL6	interleukin 6 (interferon, beta 2)		multiple interactions	ISO	7	22,766,766	22,771,621	RGD:6480464	CTD
G	IL6R	interleukin 6 receptor		multiple interactions	ISO	1	154,377,669	154,441,926	RGD:6480464	CTD
G	IL7R	interleukin 7 receptor		multiple interactions	ISO	5	35,856,977	35,879,705	RGD:6480464	CTD
G	IL8	interleukin 8		decreases expression	EXP	4	74,606,223	74,609,433	RGD:6480464	CTD
G	ILDR1	immunoglobulin-like domain containing receptor 1		multiple interactions	ISO	3	121,706,170	121,741,127	RGD:6480464	CTD
G	ILF3	interleukin enhancer binding factor 3, 90kDa		multiple interactions	ISO	19	10,764,937	10,803,095	RGD:6480464	CTD
G	IMPA1	inositol(myo)-1(or 4)-monophosphatase 1		multiple interactions	ISO	8	82,569,151	82,598,589	RGD:6480464	CTD
G	IMPAD1	inositol monophosphatase domain containing 1		multiple interactions	ISO	8	57,870,488	57,906,430	RGD:6480464	CTD
G	IMPDH1	IMP (inosine 5'-monophosphate) dehydrogenase 1		multiple interactions	ISO	7	128,032,331	128,050,036	RGD:6480464	CTD
G	INCENP	inner centromere protein antigens 135/155kDa		multiple interactions	ISO	11	61,891,445	61,920,635	RGD:6480464	CTD
G	ING1	inhibitor of growth family, member 1		multiple interactions	ISO	13	111,364,970	111,373,421	RGD:6480464	CTD
G	ING2	inhibitor of growth family, member 2		multiple interactions	ISO	4	184,426,220	184,432,249	RGD:6480464	CTD
G	INHBB	inhibin, beta B		multiple interactions	ISO	2	121,103,719	121,109,383	RGD:6480464	CTD
G	INO80	INO80 homolog (S. cerevisiae)		multiple interactions	ISO	15	41,271,078	41,408,340	RGD:6480464	CTD
G	INPP5A	inositol polyphosphate-5-phosphatase, 40kDa		multiple interactions	ISO	10	134,351,353	134,596,984	RGD:6480464	CTD
G	INPP5D	inositol polyphosphate-5-phosphatase, 145kDa		multiple interactions	ISO	2 2	233,925,036 234,054,795	233,995,880 234,116,549	RGD:6480464	CTD
G	INPPL1	inositol polyphosphate phosphatase-like 1		multiple interactions	ISO	11	71,935,882	71,950,191	RGD:6480464	CTD
G	INSIG1	insulin induced gene 1		increases expression	EXP	7	155,089,486	155,101,945	RGD:6480464	CTD
G	INSL6	insulin-like 6		multiple interactions	ISO	9	5,163,863	5,185,618	RGD:6480464	CTD
G	INSM1	insulinoma-associated 1		multiple interactions	ISO	20	20,348,765	20,351,593	RGD:6480464	CTD
G	INSM2	insulinoma-associated 2		multiple interactions	ISO	14	36,003,248	36,006,260	RGD:6480464	CTD
G	INSRR	insulin receptor-related receptor		multiple interactions	ISO	1	156,810,665	156,828,712	RGD:6480464	CTD
G	INTS1	integrator complex subunit 1		multiple interactions	ISO	7	1,509,913	1,544,018	RGD:6480464	CTD
G	INTS6	integrator complex subunit 6		multiple interactions	ISO	13	51,935,701	52,027,275	RGD:6480464	CTD
G	INTU	inturned planar cell polarity protein		multiple interactions	ISO	4	128,554,087	128,637,934	RGD:6480464	CTD
G	IP6K1	inositol hexakisphosphate kinase 1		multiple interactions	ISO	3	49,761,728	49,823,973	RGD:6480464	CTD
G	IPMK	inositol polyphosphate multikinase		multiple interactions	ISO	10	59,951,278	60,027,694	RGD:6480464	CTD
G	IPO9	importin 9		multiple interactions	ISO	1	201,798,288	201,853,422	RGD:6480464	CTD
G	IPP	intracisternal A particle-promoted polypeptide		multiple interactions	ISO	1	46,159,996	46,216,485	RGD:6480464	CTD
G	IQCG	IQ motif containing G		multiple interactions	ISO	3	197,615,946	197,686,886	RGD:6480464	CTD
G	IQGAP1	IQ motif containing GTPase activating protein 1		multiple interactions	ISO	15	90,931,473	91,045,475	RGD:6480464	CTD
G	IQGAP3	IQ motif containing GTPase activating protein 3		multiple interactions	ISO	1	156,495,197	156,542,396	RGD:6480464	CTD
G	IRAK3	interleukin-1 receptor-associated kinase 3		multiple interactions	ISO	12	66,582,978	66,648,402	RGD:6480464	CTD
G	IRF2BP1	interferon regulatory factor 2 binding protein 1		multiple interactions	ISO	19	46,386,866	46,389,376	RGD:6480464	CTD
G	IRF8	interferon regulatory factor 8		multiple interactions	ISO	16	85,932,774	85,956,212	RGD:6480464	CTD
G	IRGC	immunity-related GTPase family, cinema		multiple interactions	ISO	19	44,220,214	44,224,173	RGD:6480464	CTD
G	IRS1	insulin receptor substrate 1		multiple interactions	ISO	2	227,596,033	227,663,506	RGD:6480464	CTD
G	IRX2	iroquois homeobox 2		multiple interactions	ISO	5	2,746,279	2,751,769	RGD:6480464	CTD
G	IRX5	iroquois homeobox 5		multiple interactions	ISO	16	54,965,111	54,968,397	RGD:6480464	CTD
G	IRX6	iroquois homeobox 6		multiple interactions	ISO	16	55,358,471	55,364,672	RGD:6480464	CTD
G	ISCA1	iron-sulfur cluster assembly 1 homolog (S. cerevisiae)		multiple interactions	ISO	9	88,879,461	88,897,490	RGD:6480464	CTD
G	ISL1	ISL LIM homeobox 1		multiple interactions	ISO	5	50,678,958	50,690,564	RGD:6480464	CTD
G	ISL2	ISL LIM homeobox 2		multiple interactions	ISO	15	76,629,147	76,634,816	RGD:6480464	CTD
G	ISLR	immunoglobulin superfamily containing leucine-rich repeat		multiple interactions	ISO	15	74,466,087	74,469,212	RGD:6480464	CTD
G	ISLR2	immunoglobulin superfamily containing leucine-rich repeat 2		multiple interactions	ISO	15	74,421,715	74,429,143	RGD:6480464	CTD
G	ISY1	ISY1 splicing factor homolog (S. cerevisiae)		multiple interactions	ISO	3	128,846,259	128,880,073	RGD:6480464	CTD
G	ISYNA1	inositol-3-phosphate synthase 1		multiple interactions	ISO	19	18,545,198	18,549,111	RGD:6480464	CTD
G	ITGA3	integrin, alpha 3 (antigen CD49C, alpha 3 subunit of VLA-3 receptor)		affects expression	EXP	17	48,133,340	48,167,849	RGD:6480464	CTD
G	ITGA4	integrin, alpha 4 (antigen CD49D, alpha 4 subunit of VLA-4 receptor)		affects expression	EXP	2	182,321,619	182,402,474	RGD:6480464	CTD
G	ITGA5	integrin, alpha 5 (fibronectin receptor, alpha polypeptide)		affects expression	EXP	12	54,789,045	54,813,050	RGD:6480464	CTD
G	ITGA6	integrin, alpha 6		affects expression	EXP	2	173,292,314	173,371,181	RGD:6480464	CTD
G	ITGB1	integrin, beta 1 (fibronectin receptor, beta polypeptide, antigen CD29 includes MDF2, MSK12)		affects expression	EXP	10	33,189,246	33,247,293	RGD:6480464	CTD
G	ITGB8	integrin, beta 8		multiple interactions	ISO	7	20,370,725	20,455,382	RGD:6480464	CTD
G	JUN	jun proto-oncogene		multiple interactions	EXP	1	59,246,463	59,249,785	RGD:6480464	CTD
G	KAT6B	K(lysine) acetyltransferase 6B		multiple interactions	ISO	10	76,586,171	76,792,380	RGD:6480464	CTD
G	KCTD13	potassium channel tetramerisation domain containing 13		multiple interactions	ISO	16	29,917,657	29,937,545	RGD:6480464	CTD
G	KCTD15	potassium channel tetramerisation domain containing 15		multiple interactions	ISO	19	34,287,751	34,306,666	RGD:6480464	CTD
G	KCTD17	potassium channel tetramerisation domain containing 17		multiple interactions	ISO	22	37,447,779	37,459,430	RGD:6480464	CTD
G	KDELR3	KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 3		multiple interactions	ISO	22	38,864,083	38,879,445	RGD:6480464	CTD
G	KDM2B	lysine (K)-specific demethylase 2B		multiple interactions	ISO	12	121,866,899	122,018,920	RGD:6480464	CTD
G	KLHDC7A	kelch domain containing 7A		multiple interactions	ISO	1	18,807,424	18,812,493	RGD:6480464	CTD
G	KLHL12	kelch-like family member 12		multiple interactions	ISO	1	202,860,230	202,896,371	RGD:6480464	CTD
G	KLK3	kallikrein-related peptidase 3		multiple interactions	ISO	19	51,358,171	51,364,020	RGD:6480464	CTD
G	KLRD1	killer cell lectin-like receptor subfamily D, member 1		multiple interactions	ISO	12	10,457,050	10,469,850	RGD:6480464	CTD
G	KNCN	kinocilin		multiple interactions	ISO	1	47,011,316	47,016,887	RGD:6480464	CTD
G	KNTC1	kinetochore associated 1		affects expression	EXP	12	123,011,809	123,110,947	RGD:6480464	CTD
G	KPNA4	karyopherin alpha 4 (importin alpha 3)		multiple interactions	ISO	3	160,212,783	160,283,376	RGD:6480464	CTD
G	KPNB1	karyopherin (importin) beta 1		multiple interactions	ISO	17	45,727,275	45,761,004	RGD:6480464	CTD
G	KRI1	KRI1 homolog (S. cerevisiae)		multiple interactions	ISO	19	10,663,761	10,676,702	RGD:6480464	CTD
G	KRT14	keratin 14		decreases expression	EXP	17	39,738,531	39,743,147	RGD:6480464	CTD
G	KRT19	keratin 19		multiple interactions	ISO	17	39,679,869	39,684,641	RGD:6480464	CTD
G	LGALS3	lectin, galactoside-binding, soluble, 3		increases expression	ISO	14	55,595,935	55,612,148	RGD:6480464	CTD
G	MALL	mal, T-cell differentiation protein-like		affects expression	EXP	2	110,841,447	110,874,143	RGD:6480464	CTD
G	MAP1B	microtubule-associated protein 1B		affects expression	EXP	5	71,403,118	71,505,397	RGD:6480464	CTD
G	MAPK1	mitogen-activated protein kinase 1		multiple interactions	EXP	22	22,113,946	22,221,970	RGD:6480464	CTD
G	MAPK1	mitogen-activated protein kinase 1		multiple interactions	EXP	22	22,113,946	22,221,970	RGD:6480464	CTD
G	MAPK1	mitogen-activated protein kinase 1		increases activity	ISO	22	22,113,946	22,221,970	RGD:6480464	CTD
G	MAPK1	mitogen-activated protein kinase 1		multiple interactions	ISO	22	22,113,946	22,221,970	RGD:6480464	CTD
G	MAPK1	mitogen-activated protein kinase 1		multiple interactions	ISO	22	22,113,946	22,221,970	RGD:6480464	CTD
G	MAPK3	mitogen-activated protein kinase 3		multiple interactions	EXP	16	30,125,426	30,134,630	RGD:6480464	CTD
G	MAPK3	mitogen-activated protein kinase 3		multiple interactions	EXP	16	30,125,426	30,134,630	RGD:6480464	CTD
G	MAPK3	mitogen-activated protein kinase 3		multiple interactions	ISO	16	30,125,426	30,134,630	RGD:6480464	CTD
G	MAPK3	mitogen-activated protein kinase 3		multiple interactions	ISO	16	30,125,426	30,134,630	RGD:6480464	CTD
G	MAPK3	mitogen-activated protein kinase 3		increases activity	ISO	16	30,125,426	30,134,630	RGD:6480464	CTD
G	MAPK8	mitogen-activated protein kinase 8		multiple interactions	ISO	10	49,609,687	49,643,183	RGD:6480464	CTD
G	MBD2	methyl-CpG binding domain protein 2		affects expression	EXP	18	51,677,971	51,751,158	RGD:6480464	CTD
G	MCL1	myeloid cell leukemia sequence 1 (BCL2-related)		affects expression	EXP	1	150,547,027	150,552,214	RGD:6480464	CTD
G	MCU	mitochondrial calcium uniporter		multiple interactions	ISO	10	74,451,889	74,647,452	RGD:6480464	CTD
G	MDM2	MDM2 oncogene, E3 ubiquitin protein ligase		affects expression	EXP	12	69,201,971	69,239,320	RGD:6480464	CTD
G	MEF2A	myocyte enhancer factor 2A		multiple interactions	ISO	15	100,106,133	100,256,630	RGD:6480464	CTD
G	MET	met proto-oncogene (hepatocyte growth factor receptor)		multiple interactions	ISO	7	116,312,459	116,438,440	RGD:6480464	CTD
G	MET	met proto-oncogene (hepatocyte growth factor receptor)		increases expression	ISO	7	116,312,459	116,438,440	RGD:6480464	CTD
G	MGLL	monoglyceride lipase		affects expression	EXP	3	127,407,905	127,542,093	RGD:6480464	CTD
G	MGMT	O-6-methylguanine-DNA methyltransferase		multiple interactions	EXP	10	131,265,454	131,565,783	RGD:6480464	CTD
G	MICA	MHC class I polypeptide-related sequence A		affects expression	EXP	6	31,367,561	31,383,090	RGD:6480464	CTD
G	MIF	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		affects expression	EXP	22	24,236,565	24,237,409	RGD:6480464	CTD
G	MME	membrane metallo-endopeptidase		affects expression	EXP	3	154,797,436	154,901,518	RGD:6480464	CTD
G	MMP1	matrix metallopeptidase 1 (interstitial collagenase)		decreases activity	ISO	11	102,660,641	102,668,966	RGD:6480464	CTD
G	MMP1	matrix metallopeptidase 1 (interstitial collagenase)		multiple interactions	ISO	11	102,660,641	102,668,966	RGD:6480464	CTD
G	MMP1	matrix metallopeptidase 1 (interstitial collagenase)		decreases expression	ISO	11	102,660,641	102,668,966	RGD:6480464	CTD
G	MMP3	matrix metallopeptidase 3 (stromelysin 1, progelatinase)		affects expression	EXP	11	102,706,528	102,714,342	RGD:6480464	CTD
G	MMP7	matrix metallopeptidase 7 (matrilysin, uterine)		increases expression	ISO	11	102,391,239	102,401,478	RGD:6480464	CTD
G	MMP7	matrix metallopeptidase 7 (matrilysin, uterine)		multiple interactions	ISO	11	102,391,239	102,401,478	RGD:6480464	CTD
G	MT1A	metallothionein 1A		multiple interactions	ISO	16	56,672,578	56,673,999	RGD:6480464	CTD
G	MT3	metallothionein 3		multiple interactions	EXP	16	56,623,267	56,625,000	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects expression	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		multiple interactions	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		decreases abundance	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		multiple interactions	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects abundance	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects metabolic processing	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		multiple interactions	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects metabolic processing	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects abundance	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTHFR	methylenetetrahydrofolate reductase (NAD(P)H)		affects abundance	EXP	1	11,845,787	11,866,160	RGD:6480464	CTD
G	MTR	5-methyltetrahydrofolate-homocysteine methyltransferase		affects expression	EXP	1	236,958,581	237,067,281	RGD:6480464	CTD
G	MTRR	5-methyltetrahydrofolate-homocysteine methyltransferase reductase		affects expression	EXP	5	7,869,217	7,901,237	RGD:6480464	CTD
G	MUC1	mucin 1, cell surface associated		affects expression	EXP	1	155,158,300	155,162,706	RGD:6480464	CTD
G	MUC13	mucin 13, cell surface associated		multiple interactions	ISO	3	124,624,289	124,653,595	RGD:6480464	CTD
G	MUSTN1	musculoskeletal, embryonic nuclear protein 1		multiple interactions	ISO	3	52,867,131	52,869,235	RGD:6480464	CTD
G	MXI1	MAX interactor 1, dimerization protein		multiple interactions	ISO	10	111,967,363	112,047,123	RGD:6480464	CTD
G	MYB	v-myb myeloblastosis viral oncogene homolog (avian)		multiple interactions	ISO	6	135,502,453	135,540,311	RGD:6480464	CTD
G	MYO10	myosin X		affects expression	EXP	5	16,662,016	16,936,385	RGD:6480464	CTD
G	MYO1F	myosin IF		multiple interactions	ISO	19	8,585,674	8,642,331	RGD:6480464	CTD
G	MYO5A	myosin VA (heavy chain 12, myoxin)		multiple interactions	ISO	15	52,599,480	52,821,247	RGD:6480464	CTD
G	MYO6	myosin VI		multiple interactions	ISO	6	76,458,909	76,629,254	RGD:6480464	CTD
G	MYOF	myoferlin		multiple interactions	ISO	10	95,066,186	95,242,074	RGD:6480464	CTD
G	MYOM1	myomesin 1		multiple interactions	ISO	18	3,066,805	3,220,106	RGD:6480464	CTD
G	MYOZ1	myozenin 1		multiple interactions	ISO	10	75,391,370	75,401,515	RGD:6480464	CTD
G	MZF1	myeloid zinc finger 1		multiple interactions	ISO	19	59,073,284	59,084,942	RGD:6480464	CTD
G	N4BP2L1	NEDD4 binding protein 2-like 1		multiple interactions	ISO	13	32,974,860	33,002,315	RGD:6480464	CTD
G	NAB1	NGFI-A binding protein 1 (EGR1 binding protein 1)		multiple interactions	ISO	2	191,513,848	191,557,492	RGD:6480464	CTD
G	NACC2	NACC family member 2, BEN and BTB (POZ) domain containing		multiple interactions	ISO	9	138,898,383	138,987,131	RGD:6480464	CTD
G	NAE1	NEDD8 activating enzyme E1 subunit 1		multiple interactions	ISO	16	66,836,781	66,864,879	RGD:6480464	CTD
G	NANP	N-acetylneuraminic acid phosphatase		multiple interactions	ISO	20	25,593,571	25,604,648	RGD:6480464	CTD
G	NANS	N-acetylneuraminic acid synthase		multiple interactions	ISO	9	100,818,959	100,845,365	RGD:6480464	CTD
G	NAP1L1	nucleosome assembly protein 1-like 1		multiple interactions	ISO	12	76,438,672	76,478,738	RGD:6480464	CTD
G	NAPA	N-ethylmaleimide-sensitive factor attachment protein, alpha		multiple interactions	ISO	19	47,990,891	48,018,515	RGD:6480464	CTD
G	NAPSA	napsin A aspartic peptidase		multiple interactions	ISO	19	50,861,734	50,868,931	RGD:6480464	CTD
G	NARF	nuclear prelamin A recognition factor		multiple interactions	ISO	17	80,416,060	80,446,143	RGD:6480464	CTD
G	NARS2	asparaginyl-tRNA synthetase 2, mitochondrial (putative)		multiple interactions	ISO	11	78,147,007	78,285,909	RGD:6480464	CTD
G	NAT1	N-acetyltransferase 1 (arylamine N-acetyltransferase)		decreases activity	EXP	8	18,027,971	18,081,198	RGD:6480464	CTD
G	NAT1	N-acetyltransferase 1 (arylamine N-acetyltransferase)		increases acetylation	EXP	8	18,027,971	18,081,198	RGD:6480464	CTD
G	NCAM1	neural cell adhesion molecule 1		affects expression	EXP	11	112,831,969	113,149,158	RGD:6480464	CTD
G	NCAPH	non-SMC condensin I complex, subunit H		multiple interactions	ISO	2	97,001,484	97,041,274	RGD:6480464	CTD
G	NCF1	neutrophil cytosolic factor 1		multiple interactions	EXP	7	74,188,309	74,203,659	RGD:6480464	CTD
G	NDST1	N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 1		affects expression	EXP	5	149,887,674	149,937,773	RGD:6480464	CTD
G	NEUROG2	neurogenin 2		multiple interactions	ISO	4	113,434,672	113,437,328	RGD:6480464	CTD
G	NEXN	nexilin (F actin binding protein)		multiple interactions	ISO	1	78,354,200	78,409,580	RGD:6480464	CTD
G	NF1	neurofibromin 1		multiple interactions	ISO	17	29,421,945	29,704,695	RGD:6480464	CTD
G	NFASC	neurofascin		multiple interactions	ISO	1	204,797,782	204,991,950	RGD:6480464	CTD
G	NFATC1	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 1		multiple interactions	ISO	18	77,155,772	77,289,323	RGD:6480464	CTD
G	NFATC2	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 2		multiple interactions	ISO	20	50,003,494	50,179,370	RGD:6480464	CTD
G	NFATC2IP	nuclear factor of activated T-cells, cytoplasmic, calcineurin-dependent 2 interacting protein		multiple interactions	ISO	16	28,962,318	28,977,786	RGD:6480464	CTD
G	NFE2L1	nuclear factor (erythroid-derived 2)-like 1		multiple interactions	ISO	17	46,125,686	46,138,907	RGD:6480464	CTD
G	NFIA	nuclear factor I/A		multiple interactions	ISO	1	61,542,946	61,928,460	RGD:6480464	CTD
G	NFIL3	nuclear factor, interleukin 3 regulated		multiple interactions	ISO	9	94,171,327	94,186,144	RGD:6480464	CTD
G	NFIX	nuclear factor I/X (CCAAT-binding transcription factor)		multiple interactions	ISO	19	13,106,584	13,209,610	RGD:6480464	CTD
G	NFKB1	nuclear factor of kappa light polypeptide gene enhancer in B-cells 1		affects expression	EXP	4	103,422,486	103,538,459	RGD:6480464	CTD
G	NFKBIA	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		affects expression	EXP	14	35,870,716	35,873,960	RGD:6480464	CTD
G	NFKBIA	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, alpha		multiple interactions	EXP	14	35,870,716	35,873,960	RGD:6480464	CTD
G	NFKBIZ	nuclear factor of kappa light polypeptide gene enhancer in B-cells inhibitor, zeta		multiple interactions	ISO	3	101,546,834	101,579,869	RGD:6480464	CTD
G	NFYB	nuclear transcription factor Y, beta		multiple interactions	ISO	12	104,510,858	104,532,040	RGD:6480464	CTD
G	NGFRAP1	nerve growth factor receptor (TNFRSF16) associated protein 1		multiple interactions	ISO	X	102,631,268	102,633,001	RGD:6480464	CTD
G	NME4	NME/NM23 nucleoside diphosphate kinase 4		affects expression	EXP	16	447,192	450,754	RGD:6480464	CTD
G	NME5	NME/NM23 family member 5		multiple interactions	ISO	5	137,450,861	137,475,132	RGD:6480464	CTD
G	NMNAT2	nicotinamide nucleotide adenylyltransferase 2		multiple interactions	ISO	1	183,217,372	183,387,634	RGD:6480464	CTD
G	NMT2	N-myristoyltransferase 2		multiple interactions	ISO	10	15,147,771	15,210,695	RGD:6480464	CTD
G	NOB1	NIN1/RPN12 binding protein 1 homolog (S. cerevisiae)		multiple interactions	ISO	16	69,775,774	69,788,829	RGD:6480464	CTD
G	NODAL	nodal growth differentiation factor		multiple interactions	ISO	10	72,191,692	72,201,465	RGD:6480464	CTD
G	NOL3	nucleolar protein 3 (apoptosis repressor with CARD domain)		multiple interactions	ISO	16	67,204,405	67,209,643	RGD:6480464	CTD
G	NOS2	nitric oxide synthase 2, inducible		multiple interactions	ISO	17	26,083,792	26,127,555	RGD:6480464	CTD
G	NOTCH4	notch 4		multiple interactions	EXP	6	32,162,620	32,191,844	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		affects expression	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NR3C1	nuclear receptor subfamily 3, group C, member 1 (glucocorticoid receptor)		affects metabolic processing	ISO	5	142,657,496	142,815,077	RGD:6480464	CTD
G	NREP	neuronal regeneration related protein		affects expression	EXP	5	111,065,000	111,312,628	RGD:6480464	CTD
G	NTHL1	nth endonuclease III-like 1 (E. coli)		multiple interactions	EXP	16	2,089,816	2,097,867	RGD:6480464	CTD
G	NTN4	netrin 4		affects expression	EXP	12	96,051,583	96,184,536	RGD:6480464	CTD
G	PARP1	poly (ADP-ribose) polymerase 1		increases cleavage	EXP	1	226,548,392	226,595,801	RGD:6480464	CTD
G	PASK	PAS domain containing serine/threonine kinase		multiple interactions	ISO	2	242,045,514	242,089,394	RGD:6480464	CTD
G	PATL1	protein associated with topoisomerase II homolog 1 (yeast)		multiple interactions	ISO	11	59,404,189	59,436,511	RGD:6480464	CTD
G	PAX2	paired box 2		multiple interactions	ISO	10	102,505,468	102,589,698	RGD:6480464	CTD
G	PAX3	paired box 3		multiple interactions	ISO	2	223,064,606	223,163,715	RGD:6480464	CTD
G	PAX6	paired box 6		multiple interactions	ISO	11	31,806,340	31,839,509	RGD:6480464	CTD
G	PBLD	phenazine biosynthesis-like protein domain containing		affects expression	ISO	10	70,042,417	70,092,684	RGD:6480464	CTD
G	PBLD	phenazine biosynthesis-like protein domain containing		affects expression	ISO	10	70,042,417	70,092,684	RGD:6480464	CTD
G	PBX3	pre-B-cell leukemia homeobox 3		multiple interactions	ISO	9	128,509,617	128,729,656	RGD:6480464	CTD
G	PCBP1	poly(rC) binding protein 1		multiple interactions	ISO	2	70,314,585	70,316,335	RGD:6480464	CTD
G	PCDHB7	protocadherin beta 7		multiple interactions	ISO	5	140,552,243	140,555,957	RGD:6480464	CTD
G	PCGF1	polycomb group ring finger 1		multiple interactions	ISO	2	74,732,170	74,734,821	RGD:6480464	CTD
G	PCK2	phosphoenolpyruvate carboxykinase 2 (mitochondrial)		multiple interactions	ISO	14	24,563,483	24,573,339	RGD:6480464	CTD
G	PCNA	proliferating cell nuclear antigen		increases expression	ISO	20	5,095,599	5,107,268	RGD:6480464	CTD
G	PCNP	PEST proteolytic signal containing nuclear protein		multiple interactions	ISO	3	101,293,042	101,313,281	RGD:6480464	CTD
G	PCOLCE2	procollagen C-endopeptidase enhancer 2		affects expression	EXP	3	142,536,702	142,608,045	RGD:6480464	CTD
G	PCSK1N	proprotein convertase subtilisin/kexin type 1 inhibitor		multiple interactions	ISO	X	48,689,506	48,693,960	RGD:6480464	CTD
G	PCSK5	proprotein convertase subtilisin/kexin type 5		multiple interactions	ISO	9	78,505,560	78,977,255	RGD:6480464	CTD
G	PDGFA	platelet-derived growth factor alpha polypeptide		affects expression	EXP	7	536,895	559,481	RGD:6480464	CTD
G	PFDN5	prefoldin subunit 5		multiple interactions	EXP	12	53,689,235	53,693,234	RGD:6480464	CTD
G	PGK1	phosphoglycerate kinase 1		affects expression	EXP	X	77,359,666	77,382,324	RGD:6480464	CTD
G	PGRMC2	progesterone receptor membrane component 2		affects expression	EXP	4	129,190,392	129,209,984	RGD:6480464	CTD
G	PHLDB1	pleckstrin homology-like domain, family B, member 1		multiple interactions	ISO	11	118,477,213	118,528,748	RGD:6480464	CTD
G	PHTF2	putative homeodomain transcription factor 2		multiple interactions	ISO	7	77,428,109	77,586,821	RGD:6480464	CTD
G	PIAS1	protein inhibitor of activated STAT, 1		multiple interactions	ISO	15	68,346,572	68,480,413	RGD:6480464	CTD
G	PIF1	PIF1 5'-to-3' DNA helicase homolog (S. cerevisiae)		multiple interactions	ISO	15	65,107,831	65,117,838	RGD:6480464	CTD
G	PIGA	phosphatidylinositol glycan anchor biosynthesis, class A		multiple interactions	ISO	X	15,337,573	15,353,676	RGD:6480464	CTD
G	PIGB	phosphatidylinositol glycan anchor biosynthesis, class B		multiple interactions	ISO	15	55,611,133	55,647,846	RGD:6480464	CTD
G	PIK3R1	phosphoinositide-3-kinase, regulatory subunit 1 (alpha)		affects expression	EXP	5	67,511,584	67,597,649	RGD:6480464	CTD
G	PIM1	pim-1 oncogene		multiple interactions	ISO	6	37,137,922	37,143,204	RGD:6480464	CTD
G	PLAT	plasminogen activator, tissue		multiple interactions	ISO	8	42,032,236	42,065,194	RGD:6480464	CTD
G	PLAU	plasminogen activator, urokinase		affects expression	EXP	10	75,670,862	75,677,259	RGD:6480464	CTD
G	PLAUR	plasminogen activator, urokinase receptor		affects expression	EXP	19	44,150,247	44,174,498	RGD:6480464	CTD
G	PMP22	peripheral myelin protein 22		multiple interactions	ISO	17	15,133,096	15,168,644	RGD:6480464	CTD
G	PNKD	paroxysmal nonkinesigenic dyskinesia		multiple interactions	ISO	2	219,135,115	219,211,516	RGD:6480464	CTD
G	PNPLA2	patatin-like phospholipase domain containing 2		multiple interactions	ISO	11	818,901	825,573	RGD:6480464	CTD
G	PNPLA3	patatin-like phospholipase domain containing 3		multiple interactions	ISO	22	44,319,619	44,343,448	RGD:6480464	CTD
G	PNPLA8	patatin-like phospholipase domain containing 8		multiple interactions	ISO	7	108,110,866	108,168,605	RGD:6480464	CTD
G	PNRC1	proline-rich nuclear receptor coactivator 1		multiple interactions	ISO	6	89,790,429	89,794,879	RGD:6480464	CTD
G	PODXL	podocalyxin-like		affects expression	EXP	7	131,185,021	131,241,376	RGD:6480464	CTD
G	POLA1	polymerase (DNA directed), alpha 1, catalytic subunit		multiple interactions	ISO	X	24,712,064	25,015,103	RGD:6480464	CTD
G	PPARA	peroxisome proliferator-activated receptor alpha		multiple interactions	ISO	22	46,546,499	46,639,653	RGD:6480464	CTD
G	PPARA	peroxisome proliferator-activated receptor alpha		affects expression	ISO	22	46,546,499	46,639,653	RGD:6480464	CTD
G	PPARA	peroxisome proliferator-activated receptor alpha		affects metabolic processing	ISO	22	46,546,499	46,639,653	RGD:6480464	CTD
G	PRDX6	peroxiredoxin 6		affects expression	ISO	1	173,446,486	173,457,946	RGD:6480464	CTD
G	PRKDC	protein kinase, DNA-activated, catalytic polypeptide		affects expression	EXP	8	48,685,669	48,872,743	RGD:6480464	CTD
G	PRR16	proline rich 16		affects expression	EXP	5	119,800,019	120,022,965	RGD:6480464	CTD
G	PTH1R	parathyroid hormone 1 receptor		multiple interactions	ISO	3	46,919,236	46,945,289	RGD:6480464	CTD
G	PTH1R	parathyroid hormone 1 receptor		decreases expression	ISO	3	46,919,236	46,945,289	RGD:6480464	CTD
G	PTH1R	parathyroid hormone 1 receptor		decreases expression	ISO	3	46,919,236	46,945,289	RGD:6480464	CTD
G	PTHLH	parathyroid hormone-like hormone		multiple interactions	ISO	12	28,111,017	28,124,916	RGD:6480464	CTD
G	PTHLH	parathyroid hormone-like hormone		multiple interactions	ISO	12	28,111,017	28,124,916	RGD:6480464	CTD
G	PTHLH	parathyroid hormone-like hormone		increases expression	ISO	12	28,111,017	28,124,916	RGD:6480464	CTD
G	PTHLH	parathyroid hormone-like hormone		increases expression	ISO	12	28,111,017	28,124,916	RGD:6480464	CTD
G	PTHLH	parathyroid hormone-like hormone		increases expression	ISO	12	28,111,017	28,124,916	RGD:6480464	CTD
G	PTK6	protein tyrosine kinase 6		affects expression	EXP	20	62,159,766	62,168,723	RGD:6480464	CTD
G	PTPN18	protein tyrosine phosphatase, non-receptor type 18 (brain-derived)		multiple interactions	ISO	2	131,113,580	131,132,982	RGD:6480464	CTD
G	PTPN3	protein tyrosine phosphatase, non-receptor type 3		multiple interactions	ISO	9	112,137,974	112,260,593	RGD:6480464	CTD
G	PTPN7	protein tyrosine phosphatase, non-receptor type 7		multiple interactions	ISO	1	202,116,141	202,130,716	RGD:6480464	CTD
G	PTPRD	protein tyrosine phosphatase, receptor type, D		multiple interactions	ISO	9	8,314,246	10,612,723	RGD:6480464	CTD
G	PURG	purine-rich element binding protein G		multiple interactions	ISO	8	30,853,321	30,891,231	RGD:6480464	CTD
G	PUS3	pseudouridylate synthase 3		multiple interactions	ISO	11	125,763,380	125,773,116	RGD:6480464	CTD
G	PYGB	phosphorylase, glycogen; brain		multiple interactions	ISO	20	25,228,706	25,278,648	RGD:6480464	CTD
G	RACGAP1P	Rac GTPase activating protein 1 pseudogene		affects expression	EXP	12	45,456,401	45,459,194	RGD:6480464	CTD
G	RAF1	v-raf-1 murine leukemia viral oncogene homolog 1		affects expression	EXP	3	12,625,100	12,705,700	RGD:6480464	CTD
G	RASA1	RAS p21 protein activator (GTPase activating protein) 1		affects expression	EXP	5	86,564,070	86,687,743	RGD:6480464	CTD
G	RECK	reversion-inducing-cysteine-rich protein with kazal motifs		affects expression	EXP	9	36,036,910	36,124,452	RGD:6480464	CTD
G	RELA	v-rel reticuloendotheliosis viral oncogene homolog A (avian)		multiple interactions	ISO	11	65,421,067	65,430,443	RGD:6480464	CTD
G	RFC1	replication factor C (activator 1) 1, 145kDa		multiple interactions	ISO	4	39,289,069	39,368,001	RGD:6480464	CTD
G	RHOC	ras homolog family member C		multiple interactions	EXP	1	113,243,749	113,250,025	RGD:6480464	CTD
G	RNASE2	ribonuclease, RNase A family, 2 (liver, eosinophil-derived neurotoxin)		multiple interactions	ISO	14	21,423,630	21,424,594	RGD:6480464	CTD
G	RNASE3	ribonuclease, RNase A family, 3		multiple interactions	ISO	14	21,359,562	21,360,507	RGD:6480464	CTD
G	RPA3	replication protein A3, 14kDa		affects expression	EXP	7	7,676,575	7,758,238	RGD:6480464	CTD
G	RPS5	ribosomal protein S5		multiple interactions	EXP	19	58,898,636	58,906,171	RGD:6480464	CTD
G	RPUSD1	RNA pseudouridylate synthase domain containing 1		multiple interactions	ISO	16	834,974	838,383	RGD:6480464	CTD
G	RRAD	Ras-related associated with diabetes		multiple interactions	ISO	16	66,955,582	66,959,439	RGD:6480464	CTD
G	RRAGC	Ras-related GTP binding C		multiple interactions	ISO	1	39,305,005	39,325,340	RGD:6480464	CTD
G	RRAGD	Ras-related GTP binding D		multiple interactions	ISO	6	90,074,335	90,121,995	RGD:6480464	CTD
G	RRBP1	ribosome binding protein 1		multiple interactions	ISO	20	17,594,323	17,662,928	RGD:6480464	CTD
G	RSF1	remodeling and spacing factor 1		multiple interactions	ISO	11	77,377,274	77,531,880	RGD:6480464	CTD
G	S100A10	S100 calcium binding protein A10		affects expression	EXP	1	151,955,386	151,966,714	RGD:6480464	CTD
G	S100A4	S100 calcium binding protein A4		affects expression	EXP	1	153,516,095	153,518,282	RGD:6480464	CTD
G	SAT1	spermidine/spermine N1-acetyltransferase 1		increases expression	EXP	X	23,801,275	23,804,327	RGD:6480464	CTD
G	SEMA5A	sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5A		multiple interactions	ISO	5	9,035,138	9,546,233	RGD:6480464	CTD
G	SERPINB2	serpin peptidase inhibitor, clade B (ovalbumin), member 2		affects expression	EXP	18	61,554,939	61,571,124	RGD:6480464	CTD
G	SHMT1	serine hydroxymethyltransferase 1 (soluble)		affects expression	EXP	17	18,231,187	18,266,856	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		multiple interactions	EXP	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		affects expression	EXP	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		decreases expression	EXP	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		multiple interactions	EXP	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		increases uptake	EXP	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC19A1	solute carrier family 19 (folate transporter), member 1		affects uptake	ISO	21	46,934,629	46,962,385	RGD:6480464	CTD
G	SLC22A6	solute carrier family 22 (organic anion transporter), member 6		decreases expression	ISO	11	62,744,069	62,752,495	RGD:6480464	CTD
G	SLC22A8	solute carrier family 22 (organic anion transporter), member 8		decreases expression	ISO	11	62,760,296	62,783,317	RGD:6480464	CTD
G	SLC24A3	solute carrier family 24 (sodium/potassium/calcium exchanger), member 3		multiple interactions	ISO	20	19,193,290	19,703,541	RGD:6480464	CTD
G	SLC25A1	solute carrier family 25 (mitochondrial carrier; citrate transporter), member 1		multiple interactions	ISO	22	19,163,088	19,166,338	RGD:6480464	CTD
G	SLC25A24	solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 24		multiple interactions	ISO	1	108,677,344	108,742,980	RGD:6480464	CTD
G	SLC25A25	solute carrier family 25 (mitochondrial carrier; phosphate carrier), member 25		multiple interactions	ISO	9	130,830,479	130,871,537	RGD:6480464	CTD
G	SLC25A27	solute carrier family 25, member 27		multiple interactions	ISO	6	46,620,652	46,645,927	RGD:6480464	CTD
G	SLC25A29	solute carrier family 25 (mitochondrial carnitine/acylcarnitine carrier), member 29		multiple interactions	ISO	14	100,757,453	100,772,860	RGD:6480464	CTD
G	SLC25A36	solute carrier family 25 (pyrimidine nucleotide carrier ), member 36		multiple interactions	ISO	3	140,660,662	140,698,785	RGD:6480464	CTD
G	SLC25A4	solute carrier family 25 (mitochondrial carrier; adenine nucleotide translocator), member 4		multiple interactions	ISO	4	186,064,417	186,071,538	RGD:6480464	CTD
G	SLC2A2	solute carrier family 2 (facilitated glucose transporter), member 2		multiple interactions	ISO	3	170,714,137	170,744,768	RGD:6480464	CTD
G	SLC2A6	solute carrier family 2 (facilitated glucose transporter), member 6		multiple interactions	ISO	9	136,336,216	136,344,276	RGD:6480464	CTD
G	SLC30A9	solute carrier family 30 (zinc transporter), member 9		multiple interactions	ISO	4	41,992,523	42,089,551	RGD:6480464	CTD
G	SLC32A1	solute carrier family 32 (GABA vesicular transporter), member 1		multiple interactions	ISO	20	37,353,105	37,358,015	RGD:6480464	CTD
G	SLC35A3	solute carrier family 35 (UDP-N-acetylglucosamine (UDP-GlcNAc) transporter), member A3		multiple interactions	ISO	1	100,435,540	100,489,006	RGD:6480464	CTD
G	SLC35B3	solute carrier family 35, member B3		multiple interactions	ISO	6	8,413,301	8,435,794	RGD:6480464	CTD
G	SLC35D1	solute carrier family 35 (UDP-glucuronic acid/UDP-N-acetylgalactosamine dual transporter), member D1		multiple interactions	ISO	1	67,465,015	67,520,080	RGD:6480464	CTD
G	SLC35D3	solute carrier family 35, member D3		multiple interactions	ISO	6	137,243,402	137,246,777	RGD:6480464	CTD
G	SLC35E1	solute carrier family 35, member E1		multiple interactions	ISO	19	16,660,648	16,683,193	RGD:6480464	CTD
G	SLC35E4	solute carrier family 35, member E4		multiple interactions	ISO	22	31,031,793	31,043,862	RGD:6480464	CTD
G	SLC35F1	solute carrier family 35, member F1		multiple interactions	ISO	6	118,228,689	118,638,839	RGD:6480464	CTD
G	SLC35F2	solute carrier family 35, member F2		multiple interactions	ISO	11	107,661,717	107,729,914	RGD:6480464	CTD
G	SLC36A1	solute carrier family 36 (proton/amino acid symporter), member 1		multiple interactions	ISO	5	150,827,163	150,871,940	RGD:6480464	CTD
G	SLC37A2	solute carrier family 37 (glycerol-3-phosphate transporter), member 2		multiple interactions	ISO	11	124,933,013	124,960,412	RGD:6480464	CTD
G	SLC38A1	solute carrier family 38, member 1		multiple interactions	ISO	12	46,576,838	46,663,208	RGD:6480464	CTD
G	SLC38A5	solute carrier family 38, member 5		multiple interactions	ISO	X	48,316,927	48,328,644	RGD:6480464	CTD
G	SLC3A2	solute carrier family 3 (activators of dibasic and neutral amino acid transport), member 2		multiple interactions	ISO	11	62,623,484	62,656,355	RGD:6480464	CTD
G	SLC40A1	solute carrier family 40 (iron-regulated transporter), member 1		affects expression	EXP	2	190,425,316	190,445,537	RGD:6480464	CTD
G	SLC41A3	solute carrier family 41, member 3		multiple interactions	ISO	3	125,725,200	125,820,391	RGD:6480464	CTD
G	SLC43A2	solute carrier family 43, member 2		multiple interactions	ISO	17	1,477,696	1,532,130	RGD:6480464	CTD
G	SLC44A3	solute carrier family 44, member 3		multiple interactions	ISO	1	95,285,898	95,360,803	RGD:6480464	CTD
G	SLC44A4	solute carrier family 44, member 4		multiple interactions	ISO	6	31,830,969	31,846,823	RGD:6480464	CTD
G	SLC45A1	solute carrier family 45, member 1		multiple interactions	ISO	1	8,384,390	8,404,227	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		multiple interactions	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		decreases expression	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases uptake	ISO	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	ISO	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		multiple interactions	ISO	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC46A1	solute carrier family 46 (folate transporter), member 1		increases transport	EXP	17	26,721,661	26,733,230	RGD:6480464	CTD
G	SLC5A1	solute carrier family 5 (sodium/glucose cotransporter), member 1		multiple interactions	ISO	22	32,439,019	32,509,016	RGD:6480464	CTD
G	SLC6A8	solute carrier family 6 (neurotransmitter transporter, creatine), member 8		multiple interactions	ISO	X	152,953,752	152,962,048	RGD:6480464	CTD
G	SLC6A9	solute carrier family 6 (neurotransmitter transporter, glycine), member 9		multiple interactions	ISO	1	44,462,155	44,497,164	RGD:6480464	CTD
G	SLC7A11	solute carrier family 7 (anionic amino acid transporter light chain, xc- system), member 11		multiple interactions	ISO	4	139,085,248	139,163,503	RGD:6480464	CTD
G	SLC7A2	solute carrier family 7 (cationic amino acid transporter, y+ system), member 2		multiple interactions	ISO	8	17,354,597	17,428,077	RGD:6480464	CTD
G	SLC7A6	solute carrier family 7 (amino acid transporter light chain, y+L system), member 6		multiple interactions	ISO	16	68,298,419	68,335,726	RGD:6480464	CTD
G	SLC7A7	solute carrier family 7 (amino acid transporter light chain, y+L system), member 7		affects expression	EXP	14	23,242,431	23,289,020	RGD:6480464	CTD
G	SLC9A3	solute carrier family 9, subfamily A (NHE3, cation proton antiporter 3), member 3		multiple interactions	ISO	5	473,334	524,549	RGD:6480464	CTD
G	SLC9A7	solute carrier family 9, subfamily A (NHE7, cation proton antiporter 7), member 7		multiple interactions	ISO	X	46,458,686	46,618,607	RGD:6480464	CTD
G	SLCO3A1	solute carrier organic anion transporter family, member 3A1		multiple interactions	ISO	15	92,396,938	92,715,665	RGD:6480464	CTD
G	SLFN12L	schlafen family member 12-like		multiple interactions	ISO	17	33,801,942	33,814,758	RGD:6480464	CTD
G	SLIT2	slit homolog 2 (Drosophila)		multiple interactions	ISO	4	20,255,235	20,620,788	RGD:6480464	CTD
G	SLIT3	slit homolog 3 (Drosophila)		multiple interactions	ISO	5	168,093,071	168,728,133	RGD:6480464	CTD
G	SLITRK4	SLIT and NTRK-like family, member 4		multiple interactions	ISO	X	142,710,595	142,723,926	RGD:6480464	CTD
G	SLK	STE20-like kinase		multiple interactions	ISO	10	105,727,470	105,787,342	RGD:6480464	CTD
G	SLTM	SAFB-like, transcription modulator		multiple interactions	ISO	15	59,171,244	59,225,852	RGD:6480464	CTD
G	SMAD3	SMAD family member 3		multiple interactions	ISO	15	67,358,195	67,487,533	RGD:6480464	CTD
G	SMAD6	SMAD family member 6		multiple interactions	ISO	15	66,994,674	67,074,338	RGD:6480464	CTD
G	SMAD7	SMAD family member 7		multiple interactions	ISO	18	46,446,223	46,477,081	RGD:6480464	CTD
G	SMARCA2	SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2		multiple interactions	ISO	9	2,015,342	2,193,624	RGD:6480464	CTD
G	SMOX	spermine oxidase		multiple interactions	ISO	20	4,129,426	4,168,394	RGD:6480464	CTD
G	SMPD1	sphingomyelin phosphodiesterase 1, acid lysosomal		increases expression	ISO	11	6,411,644	6,416,228	RGD:6480464	CTD
G	SMPD3	sphingomyelin phosphodiesterase 3, neutral membrane (neutral sphingomyelinase II)		multiple interactions	ISO	16	68,392,230	68,482,409	RGD:6480464	CTD
G	SMPDL3A	sphingomyelin phosphodiesterase, acid-like 3A		multiple interactions	ISO	6	123,109,971	123,130,865	RGD:6480464	CTD
G	SNAI1	snail homolog 1 (Drosophila)		multiple interactions	ISO	20	48,599,513	48,605,423	RGD:6480464	CTD
G	SNAPC3	small nuclear RNA activating complex, polypeptide 3, 50kDa		multiple interactions	ISO	9	15,422,782	15,461,627	RGD:6480464	CTD
G	SNRPG	small nuclear ribonucleoprotein polypeptide G		multiple interactions	ISO	2	70,508,510	70,520,869	RGD:6480464	CTD
G	SNX19	sorting nexin 19		multiple interactions	ISO	11	130,745,766	130,786,382	RGD:6480464	CTD
G	SNX22	sorting nexin 22		multiple interactions	ISO	15	64,443,916	64,449,680	RGD:6480464	CTD
G	SNX9	sorting nexin 9		multiple interactions	ISO	6	158,244,294	158,366,109	RGD:6480464	CTD
G	SOAT1	sterol O-acyltransferase 1		multiple interactions	ISO	1	179,262,849	179,327,815	RGD:6480464	CTD
G	SOBP	sine oculis binding protein homolog (Drosophila)		multiple interactions	ISO	6	107,811,317	107,982,513	RGD:6480464	CTD
G	SOCS1	suppressor of cytokine signaling 1		multiple interactions	ISO	16	11,348,274	11,350,039	RGD:6480464	CTD
G	SOCS2	suppressor of cytokine signaling 2		multiple interactions	ISO	12	93,963,598	93,970,521	RGD:6480464	CTD
G	SOCS6	suppressor of cytokine signaling 6		multiple interactions	ISO	18	67,956,137	67,997,434	RGD:6480464	CTD
G	SOD1	superoxide dismutase 1, soluble		decreases expression	ISO	21	33,031,935	33,041,244	RGD:6480464	CTD
G	SORBS3	sorbin and SH3 domain containing 3		multiple interactions	ISO	8	22,409,251	22,433,008	RGD:6480464	CTD
G	SORCS2	sortilin-related VPS10 domain containing receptor 2		multiple interactions	ISO	4	7,194,374	7,744,564	RGD:6480464	CTD
G	SORCS3	sortilin-related VPS10 domain containing receptor 3		multiple interactions	ISO	10	106,400,859	107,024,993	RGD:6480464	CTD
G	SOX1	SRY (sex determining region Y)-box 1		multiple interactions	ISO	13	112,721,913	112,726,020	RGD:6480464	CTD
G	SOX11	SRY (sex determining region Y)-box 11		multiple interactions	ISO	2	5,832,799	5,841,517	RGD:6480464	CTD
G	SOX12	SRY (sex determining region Y)-box 12		multiple interactions	ISO	20	306,239	310,868	RGD:6480464	CTD
G	SOX18	SRY (sex determining region Y)-box 18		multiple interactions	ISO	20	62,679,079	62,680,979	RGD:6480464	CTD
G	SOX3	SRY (sex determining region Y)-box 3		multiple interactions	ISO	X	139,585,152	139,587,225	RGD:6480464	CTD
G	SOX4	SRY (sex determining region Y)-box 4		increases expression	EXP	6	21,593,972	21,598,850	RGD:6480464	CTD
G	SOX9	SRY (sex determining region Y)-box 9		multiple interactions	ISO	17	70,117,161	70,122,561	RGD:6480464	CTD
G	SP1	Sp1 transcription factor		multiple interactions	EXP	12	53,773,979	53,810,230	RGD:6480464	CTD
G	SPACA1	sperm acrosome associated 1		multiple interactions	ISO	6	88,757,507	88,776,550	RGD:6480464	CTD
G	SPAG9	sperm associated antigen 9		multiple interactions	ISO	17	49,039,535	49,198,226	RGD:6480464	CTD
G	SPIC	Spi-C transcription factor (Spi-1/PU.1 related)		multiple interactions	ISO	12	101,870,657	101,880,775	RGD:6480464	CTD
G	SPINK1	serine peptidase inhibitor, Kazal type 1		increases expression	EXP	5	147,204,143	147,211,260	RGD:6480464	CTD
G	SPINT1	serine peptidase inhibitor, Kunitz type 1		multiple interactions	ISO	15	41,136,246	41,149,853	RGD:6480464	CTD
G	SPIRE2	spire homolog 2 (Drosophila)		multiple interactions	ISO	16	89,894,907	89,937,727	RGD:6480464	CTD
G	SPTBN1	spectrin, beta, non-erythrocytic 1		multiple interactions	ISO	2	54,683,454	54,898,583	RGD:6480464	CTD
G	SPTBN2	spectrin, beta, non-erythrocytic 2		multiple interactions	ISO	11	66,452,720	66,488,870	RGD:6480464	CTD
G	STARD13	StAR-related lipid transfer (START) domain containing 13		multiple interactions	ISO	13	33,677,272	34,250,932	RGD:6480464	CTD
G	STAT1	signal transducer and activator of transcription 1, 91kDa		multiple interactions	ISO	2	191,833,762	191,878,976	RGD:6480464	CTD
G	STAT4	signal transducer and activator of transcription 4		multiple interactions	ISO	2	191,894,302	192,016,322	RGD:6480464	CTD
G	STK38L	serine/threonine kinase 38 like		multiple interactions	ISO	12	27,397,078	27,478,892	RGD:6480464	CTD
G	STOX2	storkhead box 2		multiple interactions	ISO	4	184,826,509	184,938,875	RGD:6480464	CTD
G	STRA6	stimulated by retinoic acid 6		multiple interactions	ISO	15	74,471,807	74,502,046	RGD:6480464	CTD
G	STRADB	STE20-related kinase adaptor beta		multiple interactions	ISO	2	202,316,392	202,345,574	RGD:6480464	CTD
G	STT3B	STT3B, subunit of the oligosaccharyltransferase complex (catalytic)		multiple interactions	ISO	3	31,574,491	31,677,556	RGD:6480464	CTD
G	STX3	syntaxin 3		multiple interactions	ISO	11	59,522,532	59,573,355	RGD:6480464	CTD
G	STX4	syntaxin 4		multiple interactions	ISO	16	31,044,903	31,051,485	RGD:6480464	CTD
G	STXBP5	syntaxin binding protein 5 (tomosyn)		multiple interactions	ISO	6	147,525,494	147,711,612	RGD:6480464	CTD
G	STYXL1	serine/threonine/tyrosine interacting-like 1		multiple interactions	ISO	7	75,625,655	75,677,321	RGD:6480464	CTD
G	SUCLG2	succinate-CoA ligase, GDP-forming, beta subunit		multiple interactions	ISO	3	67,410,884	67,705,038	RGD:6480464	CTD
G	SULT2B1	sulfotransferase family, cytosolic, 2B, member 1		multiple interactions	ISO	19	49,055,429	49,102,684	RGD:6480464	CTD
G	SULT4A1	sulfotransferase family 4A, member 1		multiple interactions	ISO	22	44,220,387	44,258,378	RGD:6480464	CTD
G	SUMF1	sulfatase modifying factor 1		multiple interactions	ISO	3	4,402,829	4,508,966	RGD:6480464	CTD
G	SUPT3H	suppressor of Ty 3 homolog (S. cerevisiae)		multiple interactions	ISO	6	44,794,467	45,345,788	RGD:6480464	CTD
G	SURF2	surfeit 2		multiple interactions	ISO	9	136,223,421	136,228,040	RGD:6480464	CTD
G	TAGLN	transgelin		affects expression	EXP	11	117,070,040	117,075,508	RGD:6480464	CTD
G	TM4SF1	transmembrane 4 L six family member 1		affects expression	EXP	3	149,086,805	149,095,568	RGD:6480464	CTD
G	TMEM192	transmembrane protein 192		multiple interactions	ISO	4	165,997,230	166,034,024	RGD:6480464	CTD
G	TMEM33	transmembrane protein 33		multiple interactions	ISO	4	41,937,137	41,962,824	RGD:6480464	CTD
G	TMEM39A	transmembrane protein 39A		multiple interactions	ISO	3	119,149,701	119,182,471	RGD:6480464	CTD
G	TMEM40	transmembrane protein 40		multiple interactions	ISO	3	12,775,392	12,800,808	RGD:6480464	CTD
G	TMEM43	transmembrane protein 43		multiple interactions	ISO	3	14,166,440	14,185,180	RGD:6480464	CTD
G	TMEM45A	transmembrane protein 45A		multiple interactions	ISO	3	100,211,463	100,296,285	RGD:6480464	CTD
G	TMEM45B	transmembrane protein 45B		multiple interactions	ISO	11	129,685,741	129,729,898	RGD:6480464	CTD
G	TMEM47	transmembrane protein 47		multiple interactions	ISO	X	34,645,181	34,675,405	RGD:6480464	CTD
G	TMEM48	transmembrane protein 48		multiple interactions	ISO	1	54,231,133	54,304,225	RGD:6480464	CTD
G	TMEM56	transmembrane protein 56		multiple interactions	ISO	1	95,582,894	95,663,163	RGD:6480464	CTD
G	TMEM57	transmembrane protein 57		multiple interactions	ISO	1	25,757,388	25,826,700	RGD:6480464	CTD
G	TMEM63A	transmembrane protein 63A		multiple interactions	ISO	1	226,033,233	226,070,420	RGD:6480464	CTD
G	TMEM65	transmembrane protein 65		multiple interactions	ISO	8	125,323,159	125,384,940	RGD:6480464	CTD
G	TMEM71	transmembrane protein 71		multiple interactions	ISO	8	133,722,191	133,772,914	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		increases expression	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNF	tumor necrosis factor		multiple interactions	ISO	6	31,543,344	31,546,113	RGD:6480464	CTD
G	TNFRSF10B	tumor necrosis factor receptor superfamily, member 10b		affects expression	EXP	8	22,877,646	22,926,700	RGD:6480464	CTD
G	TNFRSF12A	tumor necrosis factor receptor superfamily, member 12A		increases expression	ISO	16	3,070,313	3,072,384	RGD:6480464	CTD
G	TNFRSF14	tumor necrosis factor receptor superfamily, member 14		affects expression	EXP	1	2,487,805	2,495,268	RGD:6480464	CTD
G	TNFRSF21	tumor necrosis factor receptor superfamily, member 21		multiple interactions	ISO	6	47,199,268	47,277,680	RGD:6480464	CTD
G	TNFRSF25	tumor necrosis factor receptor superfamily, member 25		multiple interactions	ISO	1	6,521,211	6,526,255	RGD:6480464	CTD
G	TNFSF12	tumor necrosis factor (ligand) superfamily, member 12		increases expression	ISO	17	7,452,375	7,461,207	RGD:6480464	CTD
G	TNFSF13	tumor necrosis factor (ligand) superfamily, member 13		multiple interactions	ISO	17	7,461,609	7,464,925	RGD:6480464	CTD
G	TNIP1	TNFAIP3 interacting protein 1		multiple interactions	ISO	5	150,409,504	150,467,221	RGD:6480464	CTD
G	TNIP2	TNFAIP3 interacting protein 2		multiple interactions	ISO	4	2,743,387	2,758,103	RGD:6480464	CTD
G	TNK1	tyrosine kinase, non-receptor, 1		multiple interactions	ISO	17	7,284,293	7,293,093	RGD:6480464	CTD
G	TNK2	tyrosine kinase, non-receptor, 2		multiple interactions	ISO	3	195,590,236	195,635,880	RGD:6480464	CTD
G	TNKS1BP1	tankyrase 1 binding protein 1, 182kDa		multiple interactions	ISO	11	57,067,103	57,092,413	RGD:6480464	CTD
G	TNNC1	troponin C type 1 (slow)		multiple interactions	ISO	3	52,485,107	52,488,057	RGD:6480464	CTD
G	TNNI2	troponin I type 2 (skeletal, fast)		multiple interactions	ISO	11	1,860,233	1,862,910	RGD:6480464	CTD
G	TNNT2	troponin T type 2 (cardiac)		multiple interactions	ISO	1	201,328,142	201,346,805	RGD:6480464	CTD
G	TNRC6A	trinucleotide repeat containing 6A		multiple interactions	ISO	16	24,741,049	24,837,548	RGD:6480464	CTD
G	TOE1	target of EGR1, member 1 (nuclear)		multiple interactions	ISO	1	45,805,342	45,809,650	RGD:6480464	CTD
G	TOMM20	translocase of outer mitochondrial membrane 20 homolog (yeast)		multiple interactions	ISO	1	235,272,656	235,292,256	RGD:6480464	CTD
G	TOMM40	translocase of outer mitochondrial membrane 40 homolog (yeast)		multiple interactions	ISO	19	45,394,477	45,406,946	RGD:6480464	CTD
G	TOP1	topoisomerase (DNA) I		multiple interactions	ISO	20	39,657,462	39,753,127	RGD:6480464	CTD
G	TOR1AIP1	torsin A interacting protein 1		multiple interactions	ISO	1	179,851,177	179,889,212	RGD:6480464	CTD
G	TOX	thymocyte selection-associated high mobility group box		multiple interactions	ISO	8	59,717,977	60,031,767	RGD:6480464	CTD
G	TOX3	TOX high mobility group box family member 3		multiple interactions	ISO	16	52,471,918	52,581,714	RGD:6480464	CTD
G	TP53	tumor protein p53		affects methylation	ISO	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		multiple interactions	ISO	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		multiple interactions	ISO	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		multiple interactions	ISO	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		affects expression	EXP	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		affects expression	EXP	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53	tumor protein p53		affects expression	EXP	17	7,571,720	7,590,868	RGD:6480464	CTD
G	TP53I11	tumor protein p53 inducible protein 11		multiple interactions	ISO	11	44,953,899	44,972,857	RGD:6480464	CTD
G	TPCN2	two pore segment channel 2		multiple interactions	ISO	11	68,816,350	68,858,072	RGD:6480464	CTD
G	TPD52	tumor protein D52		multiple interactions	ISO	8	80,947,103	81,083,836	RGD:6480464	CTD
G	TPD52L1	tumor protein D52-like 1		multiple interactions	ISO	6	125,474,879	125,584,644	RGD:6480464	CTD
G	TPM1	tropomyosin 1 (alpha)		multiple interactions	ISO	15	63,334,838	63,364,114	RGD:6480464	CTD
G	TPM4	tropomyosin 4		multiple interactions	ISO	19	16,178,317	16,213,813	RGD:6480464	CTD
G	TPP2	tripeptidyl peptidase II		multiple interactions	ISO	13	103,249,286	103,331,524	RGD:6480464	CTD
G	TPRG1L	tumor protein p63 regulated 1-like		multiple interactions	ISO	1	3,541,556	3,546,695	RGD:6480464	CTD
G	TPST1	tyrosylprotein sulfotransferase 1		multiple interactions	ISO	7	65,670,259	65,825,438	RGD:6480464	CTD
G	TPT1	tumor protein, translationally-controlled 1		multiple interactions	ISO	13	45,911,304	45,915,297	RGD:6480464	CTD
G	TPX2	TPX2, microtubule-associated, homolog (Xenopus laevis)		multiple interactions	ISO	20	30,326,904	30,389,603	RGD:6480464	CTD
G	TRA2B	transformer 2 beta homolog (Drosophila)		multiple interactions	ISO	3	185,632,356	185,655,924	RGD:6480464	CTD
G	TRAF1	TNF receptor-associated factor 1		affects expression	EXP	9	123,664,671	123,691,451	RGD:6480464	CTD
G	TRAF4	TNF receptor-associated factor 4		affects expression	EXP	17	27,071,023	27,077,976	RGD:6480464	CTD
G	TRAF6	TNF receptor-associated factor 6, E3 ubiquitin protein ligase		affects expression	EXP	11	36,505,317	36,531,863	RGD:6480464	CTD
G	TRAIP	TRAF interacting protein		affects expression	EXP	3	49,866,028	49,893,992	RGD:6480464	CTD
G	TRAIP	TRAF interacting protein		multiple interactions	ISO	3	49,866,028	49,893,992	RGD:6480464	CTD
G	TRAK1	trafficking protein, kinesin binding 1		multiple interactions	ISO	3	42,132,746	42,267,382	RGD:6480464	CTD
G	TRAM2	translocation associated membrane protein 2		multiple interactions	ISO	6	52,362,200	52,441,862	RGD:6480464	CTD
G	TRAP1	TNF receptor-associated protein 1		multiple interactions	ISO	16	3,708,038	3,767,598	RGD:6480464	CTD
G	TREH	trehalase (brush-border membrane glycoprotein)		multiple interactions	ISO	11	118,528,942	118,550,381	RGD:6480464	CTD
G	TREM1	triggering receptor expressed on myeloid cells 1		multiple interactions	ISO	6	41,242,999	41,254,457	RGD:6480464	CTD
G	TREM2	triggering receptor expressed on myeloid cells 2		multiple interactions	ISO	6	41,126,246	41,130,922	RGD:6480464	CTD
G	TREML4	triggering receptor expressed on myeloid cells-like 4		multiple interactions	ISO	6	41,196,062	41,206,120	RGD:6480464	CTD
G	TRERF1	transcriptional regulating factor 1		multiple interactions	ISO	6	42,192,669	42,419,783	RGD:6480464	CTD
G	TRHDE	thyrotropin-releasing hormone degrading enzyme		multiple interactions	ISO	12	72,666,529	73,059,422	RGD:6480464	CTD
G	TRIAP1	TP53 regulated inhibitor of apoptosis 1		multiple interactions	ISO	12	120,881,764	120,884,215	RGD:6480464	CTD
G	TRIB1	tribbles homolog 1 (Drosophila)		multiple interactions	ISO	8	126,442,563	126,450,645	RGD:6480464	CTD
G	TRIM11	tripartite motif containing 11		multiple interactions	ISO	1	228,581,377	228,594,517	RGD:6480464	CTD
G	TRIM13	tripartite motif containing 13		multiple interactions	ISO	13	50,571,143	50,592,603	RGD:6480464	CTD
G	TRIM16	tripartite motif containing 16		multiple interactions	ISO	17	15,531,280	15,586,193	RGD:6480464	CTD
G	TRIM24	tripartite motif containing 24		multiple interactions	ISO	7	138,145,079	138,270,333	RGD:6480464	CTD
G	TRIM27	tripartite motif containing 27		multiple interactions	ISO	6	28,870,779	28,891,768	RGD:6480464	CTD
G	TRIM29	tripartite motif containing 29		multiple interactions	ISO	11	119,981,994	120,008,863	RGD:6480464	CTD
G	TRIM35	tripartite motif containing 35		multiple interactions	ISO	8	27,142,404	27,168,834	RGD:6480464	CTD
G	TRIM36	tripartite motif containing 36		multiple interactions	ISO	5	114,460,459	114,516,243	RGD:6480464	CTD
G	TRIM41	tripartite motif containing 41		multiple interactions	ISO	5	180,650,263	180,662,808	RGD:6480464	CTD
G	TRIM45	tripartite motif containing 45		multiple interactions	ISO	1	117,653,677	117,664,411	RGD:6480464	CTD
G	TRIM6	tripartite motif containing 6		multiple interactions	ISO	11	5,617,331	5,634,188	RGD:6480464	CTD
G	TRIM6	tripartite motif containing 6		multiple interactions	ISO	11	5,617,331	5,634,188	RGD:6480464	CTD
G	TRIM71	tripartite motif containing 71, E3 ubiquitin protein ligase		multiple interactions	ISO	3	32,859,510	32,933,771	RGD:6480464	CTD
G	TRIO	trio Rho guanine nucleotide exchange factor		multiple interactions	ISO	5	14,143,829	14,509,458	RGD:6480464	CTD
G	TRIP12	thyroid hormone receptor interactor 12		multiple interactions	ISO	2	230,631,930	230,786,655	RGD:6480464	CTD
G	TRMT1	tRNA methyltransferase 1 homolog (S. cerevisiae)		multiple interactions	ISO	19	13,215,714	13,227,563	RGD:6480464	CTD
G	TRMT12	tRNA methyltransferase 12 homolog (S. cerevisiae)		multiple interactions	ISO	8	125,463,048	125,465,267	RGD:6480464	CTD
G	TRMT2A	tRNA methyltransferase 2 homolog A (S. cerevisiae)		multiple interactions	ISO	22	20,099,389	20,104,818	RGD:6480464	CTD
G	TRMT5	tRNA methyltransferase 5 homolog (S. cerevisiae)		multiple interactions	ISO	14	61,438,159	61,447,782	RGD:6480464	CTD
G	TRO	trophinin		multiple interactions	ISO	X	54,946,996	54,957,864	RGD:6480464	CTD
G	TROVE2	TROVE domain family, member 2		multiple interactions	ISO	1	193,028,552	193,060,907	RGD:6480464	CTD
G	TRPC4AP	transient receptor potential cation channel, subfamily C, member 4 associated protein		multiple interactions	ISO	20	33,590,207	33,680,618	RGD:6480464	CTD
G	TRPM4	transient receptor potential cation channel, subfamily M, member 4		multiple interactions	ISO	19	49,661,016	49,715,098	RGD:6480464	CTD
G	TRPS1	trichorhinophalangeal syndrome I		multiple interactions	ISO	8	116,420,724	116,681,228	RGD:6480464	CTD
G	TRPV2	transient receptor potential cation channel, subfamily V, member 2		multiple interactions	ISO	17	16,318,856	16,340,317	RGD:6480464	CTD
G	TRPV4	transient receptor potential cation channel, subfamily V, member 4		multiple interactions	ISO	12	110,220,892	110,271,212	RGD:6480464	CTD
G	TSC22D1	TSC22 domain family, member 1		multiple interactions	ISO	13	45,006,279	45,150,701	RGD:6480464	CTD
G	TSGA10	testis specific, 10		multiple interactions	ISO	2	99,613,724	99,771,187	RGD:6480464	CTD
G	TSHZ1	teashirt zinc finger homeobox 1		multiple interactions	ISO	18	72,922,710	73,001,905	RGD:6480464	CTD
G	TSHZ3	teashirt zinc finger homeobox 3		multiple interactions	ISO	19	31,765,851	31,840,190	RGD:6480464	CTD
G	TSPYL4	TSPY-like 4		multiple interactions	ISO	6	116,571,127	116,575,261	RGD:6480464	CTD
G	TSSK6	testis-specific serine kinase 6		multiple interactions	ISO	19	19,625,028	19,626,469	RGD:6480464	CTD
G	TSTA3	tissue specific transplantation antigen P35B		multiple interactions	ISO	8	144,694,788	144,699,732	RGD:6480464	CTD
G	TTC12	tetratricopeptide repeat domain 12		multiple interactions	ISO	11	113,185,251	113,237,114	RGD:6480464	CTD
G	TTC21A	tetratricopeptide repeat domain 21A		multiple interactions	ISO	3	39,149,152	39,180,394	RGD:6480464	CTD
G	TTC21A	tetratricopeptide repeat domain 21A		multiple interactions	ISO	3	39,149,152	39,180,394	RGD:6480464	CTD
G	TTC21B	tetratricopeptide repeat domain 21B		multiple interactions	ISO	2	166,729,872	166,810,348	RGD:6480464	CTD
G	TTC22	tetratricopeptide repeat domain 22		multiple interactions	ISO	1	55,246,752	55,266,941	RGD:6480464	CTD
G	TTC26	tetratricopeptide repeat domain 26		multiple interactions	ISO	7	138,818,490	138,874,550	RGD:6480464	CTD
G	TTC34	tetratricopeptide repeat domain 34		multiple interactions	ISO	1	2,572,807	2,706,230	RGD:6480464	CTD
G	TTF2	transcription termination factor, RNA polymerase II		multiple interactions	ISO	1	117,602,949	117,645,492	RGD:6480464	CTD
G	TTK	TTK protein kinase		multiple interactions	ISO	6	80,714,322	80,752,244	RGD:6480464	CTD
G	TTLL3	tubulin tyrosine ligase-like family, member 3		multiple interactions	ISO	3	9,851,644	9,878,040	RGD:6480464	CTD
G	TUBA1A	tubulin, alpha 1a		multiple interactions	EXP	12	49,578,578	49,583,107	RGD:6480464	CTD
G	TUBA3E	tubulin, alpha 3e		multiple interactions	ISO	2	130,949,318	130,956,034	RGD:6480464	CTD
G	TUBA4A	tubulin, alpha 4a		multiple interactions	ISO	2	220,115,001	220,118,638	RGD:6480464	CTD
G	TUBA8	tubulin, alpha 8		multiple interactions	ISO	22	18,593,453	18,614,498	RGD:6480464	CTD
G	TUBB2A	tubulin, beta 2A class IIa		multiple interactions	ISO	6	3,153,900	3,157,783	RGD:6480464	CTD
G	TUBB6	tubulin, beta 6 class V		multiple interactions	ISO	18	12,308,257	12,326,568	RGD:6480464	CTD
G	TUBG2	tubulin, gamma 2		multiple interactions	ISO	17	40,811,266	40,819,024	RGD:6480464	CTD
G	TUBGCP3	tubulin, gamma complex associated protein 3		multiple interactions	ISO	13	113,139,328	113,242,481	RGD:6480464	CTD
G	TUBGCP5	tubulin, gamma complex associated protein 5		multiple interactions	ISO	15	22,833,395	22,873,891	RGD:6480464	CTD
G	TUG1	taurine upregulated 1 (non-protein coding)		increases expression	EXP	22	31,365,634	31,375,381	RGD:6480464	CTD
G	TULP1	tubby like protein 1		multiple interactions	ISO	6	35,465,651	35,480,647	RGD:6480464	CTD
G	TUSC3	tumor suppressor candidate 3		multiple interactions	ISO	8	15,397,596	15,624,158	RGD:6480464	CTD
G	TWF1	twinfilin actin-binding protein 1		multiple interactions	ISO	12	44,187,526	44,200,178	RGD:6480464	CTD
G	TWF2	twinfilin actin-binding protein 2		multiple interactions	ISO	3	52,262,626	52,273,183	RGD:6480464	CTD
G	TWIST1	twist basic helix-loop-helix transcription factor 1		multiple interactions	ISO	7	19,155,091	19,157,295	RGD:6480464	CTD
G	TWIST2	twist basic helix-loop-helix transcription factor 2		multiple interactions	ISO	2	239,756,673	239,795,893	RGD:6480464	CTD
G	TXNDC9	thioredoxin domain containing 9		multiple interactions	ISO	2	99,935,487	99,952,860	RGD:6480464	CTD
G	TXNIP	thioredoxin interacting protein		increases expression	EXP	1	145,438,462	145,442,635	RGD:6480464	CTD
G	TXNL1	thioredoxin-like 1		multiple interactions	ISO	18	54,270,053	54,305,920	RGD:6480464	CTD
G	TXNRD3	thioredoxin reductase 3		multiple interactions	ISO	3	126,325,895	126,373,967	RGD:6480464	CTD
G	TYMS	thymidylate synthetase		decreases activity	EXP	18	657,604	673,499	RGD:6480464	CTD
G	TYMS	thymidylate synthetase		affects expression	EXP	18	657,604	673,499	RGD:6480464	CTD
G	TYMS	thymidylate synthetase		increases expression	ISO	18	657,604	673,499	RGD:6480464	CTD
G	TYMS	thymidylate synthetase		affects expression	EXP	18	657,604	673,499	RGD:6480464	CTD
G	U2AF2	U2 small nuclear RNA auxiliary factor 2		multiple interactions	ISO	19	56,165,416	56,186,082	RGD:6480464	CTD
G	UAP1L1	UDP-N-acteylglucosamine pyrophosphorylase 1-like 1		multiple interactions	ISO	9	139,971,953	139,978,990	RGD:6480464	CTD
G	UBE2A	ubiquitin-conjugating enzyme E2A		multiple interactions	ISO	X	118,708,499	118,718,381	RGD:6480464	CTD
G	UBE2B	ubiquitin-conjugating enzyme E2B		multiple interactions	ISO	5	133,706,870	133,727,799	RGD:6480464	CTD
G	UBE2C	ubiquitin-conjugating enzyme E2C		multiple interactions	ISO	20	44,441,255	44,445,596	RGD:6480464	CTD
G	UBE2H	ubiquitin-conjugating enzyme E2H		multiple interactions	ISO	7	129,470,572	129,592,800	RGD:6480464	CTD
G	UBE2Q1	ubiquitin-conjugating enzyme E2Q family member 1		multiple interactions	ISO	1	154,521,051	154,531,120	RGD:6480464	CTD
G	UBE2S	ubiquitin-conjugating enzyme E2S		multiple interactions	ISO	19	55,912,650	55,919,325	RGD:6480464	CTD
G	UBOX5	U-box domain containing 5		multiple interactions	ISO	20	3,088,219	3,140,556	RGD:6480464	CTD
G	UCHL1	ubiquitin carboxyl-terminal esterase L1 (ubiquitin thiolesterase)		multiple interactions	ISO	4	41,258,898	41,270,446	RGD:6480464	CTD
G	UGGT2	UDP-glucose glycoprotein glucosyltransferase 2		multiple interactions	ISO	13	96,453,834	96,705,736	RGD:6480464	CTD
G	UHRF1	ubiquitin-like with PHD and ring finger domains 1		multiple interactions	ISO	19	4,909,510	4,962,165	RGD:6480464	CTD
G	UHRF1BP1	UHRF1 binding protein 1		multiple interactions	ISO	6	34,759,794	34,845,291	RGD:6480464	CTD
G	UNC13A	unc-13 homolog A (C. elegans)		multiple interactions	ISO	19	17,712,137	17,799,008	RGD:6480464	CTD
G	UNC13B	unc-13 homolog B (C. elegans)		multiple interactions	ISO	9	35,161,989	35,405,332	RGD:6480464	CTD
G	UNC5B	unc-5 homolog B (C. elegans)		multiple interactions	ISO	10	72,972,292	73,062,635	RGD:6480464	CTD
G	UNCX	UNC homeobox		multiple interactions	ISO	7	1,272,654	1,276,613	RGD:6480464	CTD
G	UPF1	UPF1 regulator of nonsense transcripts homolog (yeast)		multiple interactions	ISO	19	18,942,744	18,979,039	RGD:6480464	CTD
G	UQCRFS1	ubiquinol-cytochrome c reductase, Rieske iron-sulfur polypeptide 1		multiple interactions	ISO	19	29,698,167	29,704,136	RGD:6480464	CTD
G	USF2	upstream transcription factor 2, c-fos interacting		multiple interactions	ISO	19	35,759,896	35,770,718	RGD:6480464	CTD
G	USP10	ubiquitin specific peptidase 10		multiple interactions	ISO	16	84,733,555	84,813,528	RGD:6480464	CTD
G	USP15	ubiquitin specific peptidase 15		multiple interactions	ISO	12	62,654,121	62,803,501	RGD:6480464	CTD
G	USP2	ubiquitin specific peptidase 2		multiple interactions	ISO	11	119,225,925	119,252,436	RGD:6480464	CTD
G	USP21	ubiquitin specific peptidase 21		multiple interactions	ISO	1	161,129,254	161,135,516	RGD:6480464	CTD
G	USP3	ubiquitin specific peptidase 3		multiple interactions	ISO	15	63,796,710	63,886,839	RGD:6480464	CTD
G	USP38	ubiquitin specific peptidase 38		multiple interactions	ISO	4	144,106,070	144,143,141	RGD:6480464	CTD
G	USP43	ubiquitin specific peptidase 43		multiple interactions	ISO	17	9,548,854	9,633,004	RGD:6480464	CTD
G	USP45	ubiquitin specific peptidase 45		multiple interactions	ISO	6	99,880,182	99,963,252	RGD:6480464	CTD
G	USP53	ubiquitin specific peptidase 53		affects expression	EXP	4	120,133,782	120,216,673	RGD:6480464	CTD
G	USP53	ubiquitin specific peptidase 53		multiple interactions	ISO	4	120,133,782	120,216,673	RGD:6480464	CTD
G	USP8	ubiquitin specific peptidase 8		multiple interactions	ISO	15	50,716,579	50,793,277	RGD:6480464	CTD
G	USPL1	ubiquitin specific peptidase like 1		multiple interactions	ISO	13	31,191,830	31,233,686	RGD:6480464	CTD
G	UTF1	undifferentiated embryonic cell transcription factor 1		multiple interactions	ISO	10	135,043,778	135,045,062	RGD:6480464	CTD
G	UTP15	UTP15, U3 small nucleolar ribonucleoprotein, homolog (S. cerevisiae)		multiple interactions	ISO	5	72,861,598	72,877,794	RGD:6480464	CTD
G	UTS2B	urotensin 2B		multiple interactions	ISO	3	190,984,944	191,048,325	RGD:6480464	CTD
G	VAMP1	vesicle-associated membrane protein 1 (synaptobrevin 1)		multiple interactions	ISO	12	6,571,403	6,579,843	RGD:6480464	CTD
G	VASP	vasodilator-stimulated phosphoprotein		multiple interactions	ISO	19	46,010,688	46,030,241	RGD:6480464	CTD
G	VAT1	vesicle amine transport protein 1 homolog (T. californica)		multiple interactions	ISO	17	41,166,622	41,174,459	RGD:6480464	CTD
G	VAV2	vav 2 guanine nucleotide exchange factor		multiple interactions	ISO	9	136,627,016	136,857,446	RGD:6480464	CTD
G	VAX1	ventral anterior homeobox 1		multiple interactions	ISO	10	118,888,032	118,897,812	RGD:6480464	CTD
G	VAX2	ventral anterior homeobox 2		multiple interactions	ISO	2	71,127,720	71,160,576	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		decreases expression	ISO	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VCAM1	vascular cell adhesion molecule 1		multiple interactions	ISO	1	101,185,196	101,204,601	RGD:6480464	CTD
G	VDAC1	voltage-dependent anion channel 1		multiple interactions	ISO	5	133,307,566	133,340,824	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		decreases expression	ISO	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		affects expression	EXP	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEGFA	vascular endothelial growth factor A		multiple interactions	ISO	6	43,737,946	43,754,224	RGD:6480464	CTD
G	VEZF1	vascular endothelial zinc finger 1		multiple interactions	ISO	17	56,048,910	56,065,615	RGD:6480464	CTD
G	VGF	VGF nerve growth factor inducible		multiple interactions	ISO	7	100,805,790	100,808,852	RGD:6480464	CTD
G	VGLL3	vestigial like 3 (Drosophila)		affects expression	EXP	3	86,987,123	87,040,257	RGD:6480464	CTD
G	VHL	von Hippel-Lindau tumor suppressor, E3 ubiquitin protein ligase		increases expression	ISO	3	10,183,319	10,195,354	RGD:6480464	CTD
G	WDR45B	WD repeat domain 45B		multiple interactions	ISO	17	80,572,438	80,606,411	RGD:6480464	CTD
G	WDR67	WD repeat domain 67		multiple interactions	ISO	8	124,084,920	124,164,393	RGD:6480464	CTD
G	WISP1	WNT1 inducible signaling pathway protein 1		affects expression	EXP	8	134,203,282	134,243,933	RGD:6480464	CTD
G	WNT5A	wingless-type MMTV integration site family, member 5A		affects expression	EXP	3	55,499,743	55,521,670	RGD:6480464	CTD
G	ZBTB14	zinc finger and BTB domain containing 14		multiple interactions	ISO	18	5,289,018	5,297,052	RGD:6480464	CTD
G	ZHX2	zinc fingers and homeoboxes 2		multiple interactions	ISO	8	123,793,901	123,986,755	RGD:6480464	CTD
G	ZIC3	Zic family member 3		multiple interactions	ISO	X	136,648,346	136,654,259	RGD:6480464	CTD
G	ZIK1	zinc finger protein interacting with K protein 1		multiple interactions	ISO	19	58,095,628	58,103,758	RGD:6480464	CTD
G	ZMIZ1	zinc finger, MIZ-type containing 1		multiple interactions	ISO	10	80,828,792	81,076,285	RGD:6480464	CTD
G	ZMYM6	zinc finger, MYM-type 6		multiple interactions	ISO	1	35,451,766	35,497,569	RGD:6480464	CTD
G	ZNF219	zinc finger protein 219		affects expression	EXP	14	21,558,205	21,572,863	RGD:6480464	CTD
G	ZNRF1	zinc and ring finger 1, E3 ubiquitin protein ligase		multiple interactions	ISO	16	75,032,915	75,144,892	RGD:6480464	CTD
G	ZPBP	zona pellucida binding protein		multiple interactions	ISO	7	49,977,023	50,132,860	RGD:6480464	CTD
G	ZSCAN12	zinc finger and SCAN domain containing 12		multiple interactions	ISO	6	28,346,598	28,367,544	RGD:6480464	CTD
G	ZSWIM4	zinc finger, SWIM-type containing 4		multiple interactions	ISO	19	13,906,274	13,943,044	RGD:6480464	CTD
G	ZSWIM5	zinc finger, SWIM-type containing 5		multiple interactions	ISO	1	45,482,074	45,672,250	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	513708
role	503229
biological role	501402
physiological role	494880
vitamin	9372
folic acid	3699
4-aminofolic acid	0
Path 2
Term	Annotations
CHEBI ontology	513708
subatomic particle	512601
composite particle	512601
hadron	512601
baryon	512601
nucleon	512601
atomic nucleus	512601
atom	512601
main group element atom	480609
p-block element atom	478027
carbon group element atom	427614
carbon atom	424022
organic molecular entity	424015
organic group	174681
organic divalent group	173480
organodiyl group	173480
carbonyl group	173163
carbonyl compound	173163
carboxylic acid	126604
amino acid	52260
modified amino acid	8795