17beta-hydroxy-5alpha-androstan-3-one - Ontology Report

Help | FTP Download | Citing RGD | Contact Us

Keyword

ONTOLOGY REPORT - ANNOTATIONS

Term:	17beta-hydroxy-5alpha-androstan-3-one	go back to main search page
Accession:	CHEBI:16330	browse the term
Definition:	An androgen that has formula C19H30O2.
Synonyms:	related_synonym:	17beta-Hydroxyandrostan-3-one; 17beta-hydroxyandrostan-3-one; 5alpha-Dihydrotestosterone; 5alpha-dihydrotestosterone; Androstanolone; C19H30O2; DIHYDROTESTOSTERONE; Dihydrotestosteron; InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14-,15-,16-,17-,18-,19-/m0/s1; InChIKey=NVKAWKQGWWIWPM-ABEVXSGRSA-N; Stanolone; [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@H](O)[C@@]4(C)CC[C@]3([H])[C@@]1(C)CCC(=O)C2; androstanolona; androstanolone; androstanolonum; dihydrotestosterone
	alt_id:	CHEBI:11341; CHEBI:11342; CHEBI:19175; CHEBI:41876; CHEBI:793
	xref_casrn:	521-18-6
	xref:	ChEMBL:134933 "ChEMBL COMPOUND"; ChemIDplus:521-18-6 "CAS Registry Number"; DrugBank:DB02901 "DrugBank"; KEGG COMPOUND:521-18-6 "CAS Registry Number"; KEGG COMPOUND:C03917 "KEGG COMPOUND"; LIPID MAPS:LMST02020042 "LIPID MAPS instance"
	xref_mesh:	MESH:D013196
	xref:	NIST Chemistry WebBook:521-18-6 "CAS Registry Number"; PDBeChem:DHT "PDBeChem"

Rat
Mouse
Human
All
show annotations for term's descendants
Sort by:

17beta-hydroxy-5alpha-androstan-3-one
	Symbol	Object Name	GBrowse	Qualifiers	Evidence	Chr	Start	Stop	Reference	Source
G	Acaca	acetyl-CoA carboxylase alpha		decreases phosphorylation	ISO	10	72,483,772	72,677,134	RGD:6480464	CTD
G	Acaca	acetyl-CoA carboxylase alpha		decreases expression	ISO	10	72,483,772	72,677,134	RGD:6480464	CTD
G	Acacb	acetyl-CoA carboxylase beta		decreases phosphorylation	ISO	12	43,388,679	43,492,993	RGD:6480464	CTD
G	Acpp	acid phosphatase, prostate		decreases expression	ISO	8	109,354,381	109,400,296	RGD:6480464	CTD
G	Acyp2	acylphosphatase 2, muscle type		increases expression	ISO	14	111,507,725	111,512,680	RGD:6480464	CTD
G	Acyp2-ps1	acylphosphatase 2, muscle type, pseudogene 1		increases expression	ISO	14	111,836,252	111,836,724	RGD:6480464	CTD
G	Adam9	ADAM metallopeptidase domain 9		multiple interactions	ISO	16	71,446,498	71,526,108	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		increases expression	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adamts1	ADAM metallopeptidase with thrombospondin type 1 motif, 1		multiple interactions	ISO	11	25,434,262	25,443,144	RGD:6480464	CTD
G	Adcyap1r1	adenylate cyclase activating polypeptide 1 receptor 1		increases expression	ISO	4	84,209,729	84,254,982	RGD:6480464	CTD
G	Adm	adrenomedullin		multiple interactions	EXP	1	168,380,255	168,382,426	RGD:6480464	CTD
G	Adm	adrenomedullin		increases expression	EXP	1	168,380,255	168,382,426	RGD:6480464	CTD
G	Aes	amino-terminal enhancer of split		increases expression	ISO	7	9,616,545	9,621,697	RGD:6480464	CTD
G	Agps	alkylglycerone phosphate synthase		decreases expression	ISO				RGD:6480464	CTD
G	Agr2	anterior gradient 2 homolog (Xenopus laevis)		affects expression	ISO	6	54,695,633	54,716,858	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		multiple interactions	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Ahr	aryl hydrocarbon receptor		affects binding	ISO	6	54,205,104	54,240,268	RGD:6480464	CTD
G	Akr1c1	aldo-keto reductase family 1, member C1		multiple interactions	ISO	17	77,084,306	77,112,994	RGD:6480464	CTD
G	Akr1c1	aldo-keto reductase family 1, member C1		increases metabolic processing	ISO	17	77,084,306	77,112,994	RGD:6480464	CTD
G	Akr1c14	aldo-keto reductase family 1, member C14		increases metabolic processing	EXP	17	77,316,456	77,332,903	RGD:6480464	CTD
G	Akr1c2	aldo-keto reductase family 1, member C2		multiple interactions	ISO	17	77,034,737	77,081,406	RGD:6480464	CTD
G	Akr1c2	aldo-keto reductase family 1, member C2		increases reduction	ISO	17	77,034,737	77,081,406	RGD:6480464	CTD
G	Akr1c2	aldo-keto reductase family 1, member C2		increases metabolic processing	ISO	17	77,034,737	77,081,406	RGD:6480464	CTD
G	Akr1c2	aldo-keto reductase family 1, member C2		multiple interactions	ISO	17	77,034,737	77,081,406	RGD:6480464	CTD
G	Akr1c3	aldo-keto reductase family 1, member C3		multiple interactions	ISO	17	77,269,626	77,286,521	RGD:6480464	CTD
G	Akr1c3	aldo-keto reductase family 1, member C3		multiple interactions	ISO	17	77,269,626	77,286,521	RGD:6480464	CTD
G	Akr1c3	aldo-keto reductase family 1, member C3		increases metabolic processing	ISO	17	77,269,626	77,286,521	RGD:6480464	CTD
G	Akt1	v-akt murine thymoma viral oncogene homolog 1		decreases activity	ISO	6	137,640,482	137,657,552	RGD:6480464	CTD
G	Aldh1a3	aldehyde dehydrogenase 1 family, member A3		multiple interactions	ISO	1	120,847,746	120,881,883	RGD:6480464	CTD
G	Aldh1a3	aldehyde dehydrogenase 1 family, member A3		increases expression	ISO	1	120,847,746	120,881,883	RGD:6480464	CTD
G	Aldh1a3	aldehyde dehydrogenase 1 family, member A3		increases activity	ISO	1	120,847,746	120,881,883	RGD:6480464	CTD
G	Alpl	alkaline phosphatase, liver/bone/kidney		increases expression	ISO	5	156,501,739	156,558,727	RGD:6480464	CTD
G	Apoe	apolipoprotein E		multiple interactions	ISO	1	79,003,634	79,006,387	RGD:6480464	CTD
G	Apoe	apolipoprotein E		affects response to substance	ISO	1	79,003,634	79,006,387	RGD:6480464	CTD
G	App	amyloid beta (A4) precursor protein		decreases expression	ISO	11	24,457,855	24,693,851	RGD:6480464	CTD
G	Aqp9	aquaporin 9		increases expression	EXP	8	75,611,485	75,651,646	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases localization	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects localization	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		decreases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	EXP	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases expression	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		affects binding	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases activity	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		multiple interactions	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Ar	androgen receptor		increases localization	ISO	X	85,949,507	86,119,199	RGD:6480464	CTD
G	Atf3	activating transcription factor 3		increases expression	ISO	13	107,191,622	107,223,850	RGD:6480464	CTD
G	Atp1b3	ATPase, Na+/K+ transporting, beta 3 polypeptide		decreases expression	ISO	8	101,405,877	101,437,757	RGD:6480464	CTD
G	Bax	Bcl2-associated X protein		multiple interactions	EXP	1	95,933,023	95,938,176	RGD:6480464	CTD
G	Bcar1	breast cancer anti-estrogen resistance 1		increases expression	ISO	19	41,646,190	41,669,234	RGD:6480464	CTD
G	Bcl2	B-cell CLL/lymphoma 2		multiple interactions	EXP	13	12,730,736	12,905,108	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		increases expression	ISO	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bcl2l1	Bcl2-like 1		multiple interactions	EXP	3	143,129,087	143,180,199	RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		increases expression	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		increases expression	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bglap	bone gamma-carboxyglutamate (gla) protein		increases expression	ISO	2	180,482,313	180,483,290	RGD:6480464	CTD
G	Bmpr1b	bone morphogenetic protein receptor, type IB		increases expression	ISO	2	239,727,569	239,767,802	RGD:6480464	CTD
G	Bub1b	BUB1 mitotic checkpoint serine/threonine kinase B		increases expression	ISO	3	105,063,018	105,116,145	RGD:6480464	CTD
G	Cacybp	calcyclin binding protein		increases expression	ISO	13	75,623,161	75,633,644	RGD:6480464	CTD
G	Camkk2	calcium/calmodulin-dependent protein kinase kinase 2, beta		multiple interactions	ISO	12	34,907,317	34,938,479	RGD:6480464	CTD
G	Camkk2	calcium/calmodulin-dependent protein kinase kinase 2, beta		increases expression	ISO	12	34,907,317	34,938,479	RGD:6480464	CTD
G	Casp3	caspase 3		increases activity	ISO	16	48,944,226	48,962,420	RGD:6480464	CTD
G	Casp7	caspase 7		increases activity	ISO	1	262,689,300	262,721,591	RGD:6480464	CTD
G	Cat	catalase		decreases activity	ISO	3	88,654,077	88,686,212	RGD:6480464	CTD
G	Cbs	cystathionine beta synthase		decreases expression	ISO	20	10,047,478	10,075,520	RGD:6480464	CTD
G	Ccl2	chemokine (C-C motif) ligand 2		multiple interactions	ISO	10	70,256,263	70,258,061	RGD:6480464	CTD
G	Ccna2	cyclin A2		increases expression	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccna2	cyclin A2		increases expression	ISO	2	123,062,752	123,069,085	RGD:6480464	CTD
G	Ccnb1	cyclin B1		increases expression	ISO	2	31,574,600	31,581,784	RGD:6480464	CTD
G	Ccnb2	cyclin B2		increases expression	ISO	8	74,892,108	74,906,181	RGD:6480464	CTD
G	Ccnd1	cyclin D1		decreases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccnd1	cyclin D1		increases expression	ISO	1	205,357,235	205,366,757	RGD:6480464	CTD
G	Ccne1	cyclin E1		increases expression	ISO	1	90,568,189	90,577,426	RGD:6480464	CTD
G	Cd40	CD40 molecule, TNF receptor superfamily member 5		multiple interactions	ISO	3	156,092,602	156,107,427	RGD:6480464	CTD
G	Cd83	CD83 molecule		increases expression	ISO	17	26,705,646	26,725,470	RGD:6480464	CTD
G	Cdc20	cell division cycle 20		increases expression	ISO	5	138,913,180	138,916,744	RGD:6480464	CTD
G	Cdk2	cyclin dependent kinase 2		increases expression	ISO	7	2,000,196	2,007,682	RGD:6480464	CTD
G	Cdk5rap2	CDK5 regulatory subunit associated protein 2		decreases expression	ISO	5	87,564,010	87,738,257	RGD:6480464	CTD
G	Cdkn1a	cyclin-dependent kinase inhibitor 1A		decreases expression	ISO	20	7,376,325	7,386,778	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Cebpa	CCAAT/enhancer binding protein (C/EBP), alpha		decreases expression	ISO	1	87,626,111	87,627,499	RGD:6480464	CTD
G	Chek2	checkpoint kinase 2		multiple interactions	ISO	12	45,933,900	45,965,427	RGD:6480464	CTD
G	Chpf	chondroitin polymerizing factor		increases expression	ISO	9	74,749,945	74,754,639	RGD:6480464	CTD
G	Chrm1	cholinergic receptor, muscarinic 1		multiple interactions	ISO	1	211,351,738	211,353,120	RGD:6480464	CTD
G	Chrm1	cholinergic receptor, muscarinic 1		decreases expression	ISO	1	211,351,738	211,353,120	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		increases activity	ISO	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		increases activity	EXP	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Ckb	creatine kinase, brain		multiple interactions	ISO	6	136,452,215	136,455,122	RGD:6480464	CTD
G	Clu	clusterin		multiple interactions	ISO	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Clu	clusterin		decreases expression	ISO	15	45,365,779	45,405,314	RGD:6480464	CTD
G	Col1a1	collagen, type I, alpha 1		increases expression	ISO	10	83,622,438	83,639,368	RGD:6480464	CTD
G	Col6a1	collagen, type VI, alpha 1		decreases expression	ISO	20	12,320,102	12,338,500	RGD:6480464	CTD
G	Coro1b	coronin, actin-binding protein, 1B		decreases expression	EXP	1	206,733,360	206,738,018	RGD:6480464	CTD
G	Creb1	cAMP responsive element binding protein 1		multiple interactions	ISO	9	63,170,785	63,234,727	RGD:6480464	CTD
G	Csf1	colony stimulating factor 1 (macrophage)		decreases expression	ISO	2	203,292,765	203,307,968	RGD:6480464	CTD
G	Csf2	colony stimulating factor 2 (granulocyte-macrophage)		multiple interactions	ISO	10	39,665,850	39,667,831	RGD:6480464	CTD
G	Csnk2a1	casein kinase 2, alpha 1 polypeptide		decreases expression	ISO	3	142,564,754	142,609,311	RGD:6480464	CTD
G	Cst8	cystatin 8 (cystatin-related epididymal specific)		decreases expression	ISO	3	137,557,637	137,564,274	RGD:6480464	CTD
G	Cst8	cystatin 8 (cystatin-related epididymal specific)		increases expression	ISO	3	137,557,637	137,564,274	RGD:6480464	CTD
G	Ctcf	CCCTC-binding factor (zinc finger protein)		decreases expression	ISO	19	35,461,942	35,514,934	RGD:6480464	CTD
G	Ctnna1	catenin (cadherin-associated protein), alpha 1, 102kDa		decreases expression	ISO	18	27,629,915	27,769,360	RGD:6480464	CTD
G	Ctsl1	cathepsin L1		decreases expression	ISO	17	6,288,013	6,294,174	RGD:6480464	CTD
G	Cux2	cut-like homeobox 2		decreases expression	ISO	12	35,850,093	35,910,414	RGD:6480464	CTD
G	Cxcl1	chemokine (C-X-C motif) ligand 1 (melanoma growth stimulating activity, alpha)		multiple interactions	ISO	14	18,690,339	18,692,118	RGD:6480464	CTD
G	Cxcl12	chemokine (C-X-C motif) ligand 12		decreases expression	ISO	4	153,503,576	153,516,423	RGD:6480464	CTD
G	Cyp11a1	cytochrome P450, family 11, subfamily a, polypeptide 1		increases expression	EXP	8	61,793,976	61,805,308	RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases expression	EXP				RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases expression	EXP				RGD:6480464	CTD
G	Cyp19a1	cytochrome P450, family 19, subfamily a, polypeptide 1		increases expression	EXP				RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		multiple interactions	ISO	3	161,542,131	161,553,801	RGD:6480464	CTD
G	Cyp24a1	cytochrome P450, family 24, subfamily a, polypeptide 1		multiple interactions	ISO	3	161,542,131	161,553,801	RGD:6480464	CTD
G	Cyp26a1	cytochrome P450, family 26, subfamily a, polypeptide 1		multiple interactions	ISO	1	241,945,472	241,949,220	RGD:6480464	CTD
G	Cyp27b1	cytochrome P450, family 27, subfamily b, polypeptide 1		affects expression	ISO				RGD:6480464	CTD
G	Cyp7b1	cytochrome P450, family 7, subfamily b, polypeptide 1		decreases activity	ISO	2	103,102,679	103,271,273	RGD:6480464	CTD
G	Cyp7b1	cytochrome P450, family 7, subfamily b, polypeptide 1		decreases expression	ISO	2	103,102,679	103,271,273	RGD:6480464	CTD
G	Dbi	diazepam binding inhibitor (GABA receptor modulator, acyl-CoA binding protein)		increases expression	ISO				RGD:6480464	CTD
G	Dgat2	diacylglycerol O-acyltransferase 2		decreases expression	ISO	1	156,447,588	156,478,740	RGD:6480464	CTD
G	Dgcr6	DiGeorge syndrome critical region gene 6		increases expression	ISO	11	84,922,649	84,927,694	RGD:6480464	CTD
G	Dhcr24	24-dehydrocholesterol reductase		affects expression	ISO	5	127,637,438	127,662,621	RGD:6480464	CTD
G	Dkk1	dickkopf 1 homolog (Xenopus laevis)		increases expression	ISO	1	234,392,743	234,396,426	RGD:6480464	CTD
G	Dkk1	dickkopf 1 homolog (Xenopus laevis)		multiple interactions	ISO	1	234,392,743	234,396,426	RGD:6480464	CTD
G	Dynll1	dynein light chain LC8-type 1		increases expression	ISO	12	42,580,542	42,582,915	RGD:6480464	CTD
G	E2f1	E2F transcription factor 1		increases expression	ISO	3	145,032,489	145,043,729	RGD:6480464	CTD
G	Egr1	early growth response 1		increases expression	ISO	18	27,343,919	27,346,117	RGD:6480464	CTD
G	Emp2	epithelial membrane protein 2		increases expression	ISO	10	5,311,157	5,348,038	RGD:6480464	CTD
G	Enc1	ectodermal-neural cortex 1		decreases expression	ISO	2	27,720,805	27,733,168	RGD:6480464	CTD
G	Ep300	E1A binding protein p300		multiple interactions	ISO	7	119,938,507	120,008,886	RGD:6480464	CTD
G	Ep300	E1A binding protein p300		multiple interactions	ISO	7	119,938,507	120,008,886	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		multiple interactions	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		affects binding	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		affects binding	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		increases activity	EXP	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		affects binding	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		affects binding	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		affects response to substance	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr1	estrogen receptor 1		multiple interactions	ISO	1	35,523,680	35,759,891	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		multiple interactions	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		decreases expression	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		increases activity	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		multiple interactions	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Esr2	estrogen receptor 2 (ER beta)		increases localization	ISO	6	98,691,167	98,775,299	RGD:6480464	CTD
G	Etl4	enhancer trap locus 4		multiple interactions	ISO	17	94,757,415	94,770,668	RGD:6480464	CTD
G	Etl4	enhancer trap locus 4		decreases expression	ISO	17	94,757,415	94,770,668	RGD:6480464	CTD
G	F2r	coagulation factor II (thrombin) receptor		decreases expression	ISO	2	25,985,800	25,989,072	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		multiple interactions	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fabp4	fatty acid binding protein 4, adipocyte		decreases expression	ISO	2	93,536,133	93,540,734	RGD:6480464	CTD
G	Fam193a	family with sequence similarity 193, member A		increases expression	ISO	14	81,898,783	81,981,572	RGD:6480464	CTD
G	Fasn	fatty acid synthase		increases expression	ISO				RGD:6480464	CTD
G	Fbxl16	F-box and leucine-rich repeat protein 16		decreases expression	ISO	10	15,082,199	15,085,374	RGD:6480464	CTD
G	Fbxo28	F-box protein 28		decreases expression	ISO	13	98,317,300	98,342,771	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		increases expression	ISO	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgf2	fibroblast growth factor 2		multiple interactions	ISO	2	123,893,314	123,947,136	RGD:6480464	CTD
G	Fgfr1	Fibroblast growth factor receptor 1		decreases expression	ISO	16	70,869,974	70,910,045	RGD:6480464	CTD
G	Fhl2	four and a half LIM domains 2		multiple interactions	ISO	9	42,319,997	42,349,055	RGD:6480464	CTD
G	Figf	c-fos induced growth factor		increases expression	ISO	X	50,830,612	50,864,445	RGD:6480464	CTD
G	Fkbp5	FK506 binding protein 5		increases expression	ISO	20	6,637,478	6,686,768	RGD:6480464	CTD
G	Folh1	folate hydrolase 1		increases expression	ISO	1	142,936,379	143,010,358	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		multiple interactions	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fos	FBJ osteosarcoma oncogene		increases expression	ISO	6	109,559,135	109,562,001	RGD:6480464	CTD
G	Fosl1	fos-like antigen 1		increases expression	ISO	1	208,090,612	208,099,118	RGD:6480464	CTD
G	Foxa2	forkhead box A2		multiple interactions	ISO	3	136,739,009	136,743,204	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		multiple interactions	ISO	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		increases expression	ISO	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fshb	follicle stimulating hormone, beta polypeptide		multiple interactions	EXP	3	92,569,344	92,571,254	RGD:6480464	CTD
G	Fst	follistatin		decreases expression	ISO	2	46,542,246	46,550,678	RGD:6480464	CTD
G	Fzd6	frizzled family receptor 6		decreases expression	ISO	7	74,562,307	74,594,014	RGD:6480464	CTD
G	Gad2	glutamate decarboxylase 2		decreases expression	EXP	17	96,259,430	96,321,857	RGD:6480464	CTD
G	Gas6	growth arrest specific 6		multiple interactions	ISO	16	80,900,159	80,930,929	RGD:6480464	CTD
G	Gas6	growth arrest specific 6		increases expression	ISO	16	80,900,159	80,930,929	RGD:6480464	CTD
G	Gdf15	growth differentiation factor 15		increases expression	ISO	16	19,310,882	19,313,465	RGD:6480464	CTD
G	Gjb3	gap junction protein, beta 3		decreases expression	ISO	5	146,771,804	146,772,616	RGD:6480464	CTD
G	Gpi	glucose-6-phosphate isomerase		increases expression	ISO	1	86,658,836	86,686,712	RGD:6480464	CTD
G	Gpx5	glutathione peroxidase 5		increases expression	ISO				RGD:6480464	CTD
G	Gtf2i	general transcription factor II I		increases expression	ISO	12	23,470,042	23,545,621	RGD:6480464	CTD
G	Hmgn1	high mobility group nucleosome binding domain 1		increases expression	ISO	11	36,429,800	36,435,719	RGD:6480464	CTD
G	Hoxb2	homeobox B2		increases expression	EXP	10	85,085,425	85,087,617	RGD:6480464	CTD
G	Hsp90ab1	heat shock protein 90 alpha (cytosolic), class B member 1		increases expression	ISO	9	11,033,496	11,038,868	RGD:6480464	CTD
G	Hsp90ab1	heat shock protein 90 alpha (cytosolic), class B member 1		decreases expression	ISO	9	11,033,496	11,038,868	RGD:6480464	CTD
G	Icam1	intercellular adhesion molecule 1		multiple interactions	ISO	8	20,040,177	20,051,939	RGD:6480464	CTD
G	Id1	inhibitor of DNA binding 1		increases expression	ISO	3	143,086,162	143,087,289	RGD:6480464	CTD
G	Id2	inhibitor of DNA binding 2		increases expression	ISO	6	42,781,476	42,783,307	RGD:6480464	CTD
G	Id3	inhibitor of DNA binding 3		increases expression	ISO	5	154,934,138	154,935,707	RGD:6480464	CTD
G	Id4	inhibitor of DNA binding 4		increases expression	ISO	17	22,525,292	22,527,861	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		multiple interactions	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		increases secretion	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1	insulin-like growth factor 1		decreases expression	ISO	7	24,531,669	24,605,742	RGD:6480464	CTD
G	Igf1r	insulin-like growth factor 1 receptor		multiple interactions	ISO	1	122,704,976	122,990,007	RGD:6480464	CTD
G	Igf1r	insulin-like growth factor 1 receptor		increases expression	ISO	1	122,704,976	122,990,007	RGD:6480464	CTD
G	Igfbp2	insulin-like growth factor binding protein 2		multiple interactions	ISO	9	71,966,877	71,994,211	RGD:6480464	CTD
G	Igfbp2	insulin-like growth factor binding protein 2		increases expression	ISO	9	71,966,877	71,994,211	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		decreases expression	ISO	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		decreases secretion	ISO	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp3	insulin-like growth factor binding protein 3		increases expression	ISO	14	87,959,153	87,967,085	RGD:6480464	CTD
G	Igfbp6	insulin-like growth factor binding protein 6		decreases expression	ISO	7	140,885,388	140,890,028	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		multiple interactions	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il6	interleukin 6		decreases expression	ISO	4	456,799	461,376	RGD:6480464	CTD
G	Il7	interleukin 7		increases expression	ISO	2	96,356,083	96,399,796	RGD:6480464	CTD
G	Ints4	integrator complex subunit 4		increases expression	ISO	1	154,714,605	154,778,362	RGD:6480464	CTD
G	Itgb1	integrin, beta 1		decreases expression	ISO	19	58,600,095	58,647,531	RGD:6480464	CTD
G	Kitlg	KIT ligand		increases expression	ISO	7	37,714,157	37,795,722	RGD:6480464	CTD
G	Klf3	Kruppel-like factor 3 (basic)		increases expression	ISO	14	46,203,638	46,226,077	RGD:6480464	CTD
G	Klk7	kallikrein-related peptidase 7		increases expression	ISO	1	94,243,421	94,246,711	RGD:6480464	CTD
G	Krt19	keratin 19		increases expression	ISO	10	89,080,953	89,085,670	RGD:6480464	CTD
G	Lama5	laminin, alpha 5		increases expression	ISO	3	169,233,897	169,282,410	RGD:6480464	CTD
G	Lamc1	laminin, gamma 1		increases expression	ISO	13	68,241,453	68,369,419	RGD:6480464	CTD
G	Lcn5	lipocalin 5		increases expression	ISO	3	3,825,478	3,829,490	RGD:6480464	CTD
G	Lcn5	lipocalin 5		multiple interactions	ISO	3	3,825,478	3,829,490	RGD:6480464	CTD
G	Lep	leptin		decreases expression	ISO	4	55,943,837	55,945,938	RGD:6480464	CTD
G	Lhb	luteinizing hormone beta		multiple interactions	ISO	1	95,892,999	95,893,988	RGD:6480464	CTD
G	Lpl	lipoprotein lipase		increases expression	ISO	16	22,533,105	22,556,905	RGD:6480464	CTD
G	Lrrc28	leucine rich repeat containing 28		increases expression	ISO	1	122,267,092	122,385,096	RGD:6480464	CTD
G	Mak	male germ cell-associated kinase		multiple interactions	ISO	17	29,644,795	29,698,155	RGD:6480464	CTD
G	Mak	male germ cell-associated kinase		increases expression	ISO	17	29,644,795	29,698,155	RGD:6480464	CTD
G	Map2k1	mitogen activated protein kinase kinase 1		multiple interactions	ISO	8	68,379,074	68,451,554	RGD:6480464	CTD
G	Map2k2	mitogen activated protein kinase kinase 2		multiple interactions	ISO	7	10,074,654	10,094,003	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk1	mitogen activated protein kinase 1		multiple interactions	ISO	11	85,968,732	86,030,387	RGD:6480464	CTD
G	Mapk10	mitogen activated protein kinase 10		multiple interactions	ISO	14	7,719,595	8,010,694	RGD:6480464	CTD
G	Mapk14	mitogen activated protein kinase 14		increases expression	ISO	20	6,939,249	7,000,378	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk3	mitogen activated protein kinase 3		multiple interactions	ISO	1	185,935,044	185,941,245	RGD:6480464	CTD
G	Mapk6	mitogen-activated protein kinase 6		increases expression	ISO	8	80,212,726	80,236,362	RGD:6480464	CTD
G	Mapk9	mitogen-activated protein kinase 9		multiple interactions	ISO	10	35,353,486	35,384,319	RGD:6480464	CTD
G	Mcm5	minichromosome maintenance complex component 5		increases expression	ISO	19	13,978,940	14,000,641	RGD:6480464	CTD
G	Me1	malic enzyme 1, NADP(+)-dependent, cytosolic		increases expression	ISO	8	91,839,845	91,955,917	RGD:6480464	CTD
G	Mef2a	myocyte enhancer factor 2a		increases expression	ISO				RGD:6480464	CTD
G	Mef2c	myocyte enhancer factor 2C		increases expression	ISO	2	12,331,078	12,346,520	RGD:6480464	CTD
G	Mif	macrophage migration inhibitory factor (glycosylation-inhibiting factor)		increases expression	ISO	20	13,191,986	13,192,851	RGD:6480464	CTD
G	Mt2A	metallothionein 2A		decreases expression	ISO	19	11,267,811	11,268,585	RGD:6480464	CTD
G	Mybl2	myeloblastosis oncogene-like 2		increases expression	ISO	3	153,925,908	153,954,323	RGD:6480464	CTD
G	Myc	myelocytomatosis oncogene		increases expression	ISO	7	98,953,142	98,958,060	RGD:6480464	CTD
G	Myh2	myosin, heavy chain 2, skeletal muscle, adult		increases expression	ISO	10	53,864,777	53,891,711	RGD:6480464	CTD
G	Myod1	myogenic differentiation 1		increases expression	ISO	1	96,910,190	96,912,900	RGD:6480464	CTD
G	Myod1	myogenic differentiation 1		increases expression	ISO	1	96,910,190	96,912,900	RGD:6480464	CTD
G	Myog	myogenin		increases expression	ISO	13	47,243,712	47,246,301	RGD:6480464	CTD
G	Ncoa1	nuclear receptor coactivator 1		multiple interactions	ISO	6	27,224,396	27,473,926	RGD:6480464	CTD
G	Ncoa1	nuclear receptor coactivator 1		multiple interactions	ISO	6	27,224,396	27,473,926	RGD:6480464	CTD
G	Ncoa1	nuclear receptor coactivator 1		multiple interactions	ISO	6	27,224,396	27,473,926	RGD:6480464	CTD
G	Ncoa2	nuclear receptor coactivator 2		multiple interactions	ISO	5	5,197,891	5,275,776	RGD:6480464	CTD
G	Ncoa2	nuclear receptor coactivator 2		multiple interactions	ISO	5	5,197,891	5,275,776	RGD:6480464	CTD
G	Ncoa2	nuclear receptor coactivator 2		multiple interactions	ISO	5	5,197,891	5,275,776	RGD:6480464	CTD
G	Ncoa3	nuclear receptor coactivator 3		multiple interactions	ISO	3	157,168,492	157,196,566	RGD:6480464	CTD
G	Ncoa4	nuclear receptor coactivator 4		multiple interactions	ISO	16	7,642,116	7,662,460	RGD:6480464	CTD
G	Ncoa4	nuclear receptor coactivator 4		multiple interactions	ISO	16	7,642,116	7,662,460	RGD:6480464	CTD
G	Ncor1	nuclear receptor co-repressor 1		multiple interactions	ISO	10	48,481,110	48,628,538	RGD:6480464	CTD
G	Ncor1	nuclear receptor co-repressor 1		multiple interactions	ISO	10	48,481,110	48,628,538	RGD:6480464	CTD
G	Ncor2	nuclear receptor co-repressor 2		multiple interactions	ISO	12	32,617,643	32,725,753	RGD:6480464	CTD
G	Ncor2	nuclear receptor co-repressor 2		multiple interactions	ISO	12	32,617,643	32,725,753	RGD:6480464	CTD
G	Nkx3-1	NK3 homeobox 1		decreases expression	ISO	15	49,743,313	49,745,905	RGD:6480464	CTD
G	Nkx3-1	NK3 homeobox 1		increases expression	ISO	15	49,743,313	49,745,905	RGD:6480464	CTD
G	Nkx3-1	NK3 homeobox 1		multiple interactions	ISO	15	49,743,313	49,745,905	RGD:6480464	CTD
G	Nos2	nitric oxide synthase 2, inducible		multiple interactions	EXP	10	65,036,884	65,072,453	RGD:6480464	CTD
G	Nr1i2	nuclear receptor subfamily 1, group I, member 2		multiple interactions	EXP	11	64,239,918	64,276,702	RGD:6480464	CTD
G	Nr3c2	nuclear receptor subfamily 3, group C, member 2		affects binding	ISO	19	32,527,752	32,875,369	RGD:6480464	CTD
G	Nr3c2	nuclear receptor subfamily 3, group C, member 2		multiple interactions	ISO	19	32,527,752	32,875,369	RGD:6480464	CTD
G	Nts	neurotensin		affects expression	ISO	7	40,474,654	40,484,058	RGD:6480464	CTD
G	Nucb1	nucleobindin 1		decreases expression	ISO	1	95,961,163	95,981,910	RGD:6480464	CTD
G	Orm1	orosomucoid 1		increases expression	ISO	5	80,325,042	80,328,194	RGD:6480464	CTD
G	Pa2g4	proliferation-associated 2G4		increases expression	ISO	7	1,846,628	1,854,096	RGD:6480464	CTD
G	Pdia3	protein disulfide isomerase family A, member 3		affects expression	EXP	3	108,216,414	108,240,138	RGD:6480464	CTD
G	Pdia3	protein disulfide isomerase family A, member 3		multiple interactions	EXP	3	108,216,414	108,240,138	RGD:6480464	CTD
G	Pdia4	protein disulfide isomerase family A, member 4		decreases expression	ISO	4	75,929,398	75,948,299	RGD:6480464	CTD
G	Pea15	phosphoprotein enriched in astrocytes 15		increases expression	ISO	13	88,187,674	88,197,296	RGD:6480464	CTD
G	Pelp1	proline, glutamate and leucine rich protein 1		multiple interactions	ISO	10	57,220,324	57,237,359	RGD:6480464	CTD
G	Phb	prohibitin		multiple interactions	ISO				RGD:6480464	CTD
G	Phex	phosphate regulating endopeptidase homolog, X-linked		increases expression	ISO	X	58,911,144	59,168,857	RGD:6480464	CTD
G	Phgdh	phosphoglycerate dehydrogenase		increases expression	ISO	2	193,147,943	193,177,137	RGD:6480464	CTD
G	Phlda1	pleckstrin homology-like domain, family A, member 1		increases expression	ISO	7	50,541,011	50,543,215	RGD:6480464	CTD
G	Phospho2	phosphatase, orphan 2		increases expression	ISO	3	51,937,823	51,944,984	RGD:6480464	CTD
G	Pigf	phosphatidylinositol glycan anchor biosynthesis, class F		increases expression	ISO	6	10,446,734	10,474,805	RGD:6480464	CTD
G	Pim1	pim-1 oncogene		decreases expression	ISO	20	7,817,403	7,821,800	RGD:6480464	CTD
G	Pip	prolactin induced protein		multiple interactions	ISO	4	69,633,474	69,637,768	RGD:6480464	CTD
G	Pip	prolactin induced protein		increases expression	ISO	4	69,633,474	69,637,768	RGD:6480464	CTD
G	Pltp	phospholipid transfer protein		decreases expression	ISO	3	155,871,842	155,889,959	RGD:6480464	CTD
G	Pmepa1	prostate transmembrane protein, androgen induced 1		increases expression	ISO	3	164,094,654	164,140,142	RGD:6480464	CTD
G	Postn	periostin, osteoblast specific factor		decreases expression	ISO	2	143,537,099	143,568,341	RGD:6480464	CTD
G	Pou2f1	POU class 2 homeobox 1		decreases expression	ISO	13	81,607,326	81,739,958	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		decreases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Pparg	peroxisome proliferator-activated receptor gamma		increases expression	ISO	4	151,492,220	151,617,331	RGD:6480464	CTD
G	Ppm1a	protein phosphatase, Mg2+/Mn2+ dependent, 1A		decreases expression	ISO	6	95,162,067	95,198,936	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		multiple interactions	ISO	2	54,327,821	54,360,462	RGD:6480464	CTD
G	Prkaa1	protein kinase, AMP-activated, alpha 1 catalytic subunit		decreases phosphorylation	ISO	2	54,327,821	54,360,462	RGD:6480464	CTD
G	Prkaa2	protein kinase, AMP-activated, alpha 2 catalytic subunit		decreases phosphorylation	ISO	5	126,007,672	126,074,012	RGD:6480464	CTD
G	Prkaa2	protein kinase, AMP-activated, alpha 2 catalytic subunit		multiple interactions	ISO	5	126,007,672	126,074,012	RGD:6480464	CTD
G	Prl	prolactin		decreases abundance	ISO	17	44,699,101	44,709,162	RGD:6480464	CTD
G	Prnp	prion protein		decreases expression	ISO	3	119,676,137	119,691,507	RGD:6480464	CTD
G	Ptgs2	prostaglandin-endoperoxide synthase 2		multiple interactions	ISO	13	64,427,288	64,432,978	RGD:6480464	CTD
G	Pthlh	parathyroid hormone-like hormone		decreases expression	ISO	4	184,887,702	184,898,841	RGD:6480464	CTD
G	Pts	6-pyruvoyl-tetrahydropterin synthase		increases expression	ISO	8	53,880,701	53,887,711	RGD:6480464	CTD
G	Pura	purine rich element binding protein A		increases expression	ISO	18	28,916,722	28,925,008	RGD:6480464	CTD
G	Rab7a	RAB7A, member RAS oncogene family		multiple interactions	EXP	4	122,202,685	122,220,649	RGD:6480464	CTD
G	Rab7a	RAB7A, member RAS oncogene family		affects expression	EXP	4	122,202,685	122,220,649	RGD:6480464	CTD
G	Rad21	RAD21 homolog (S. pombe)		increases expression	ISO	7	88,267,648	88,294,703	RGD:6480464	CTD
G	Rad23b	RAD23 homolog B (S. cerevisiae)		decreases expression	ISO	5	73,256,542	73,294,296	RGD:6480464	CTD
G	Rad50	RAD50 homolog (S. cerevisiae)		decreases expression	ISO	10	39,112,733	39,164,694	RGD:6480464	CTD
G	Rarg	retinoic acid receptor, gamma		increases expression	ISO	7	140,991,447	141,014,108	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		decreases phosphorylation	ISO	15	53,828,881	53,962,099	RGD:6480464	CTD
G	Rb1	retinoblastoma 1		increases phosphorylation	ISO	15	53,828,881	53,962,099	RGD:6480464	CTD
G	RGD1565616	RGD1565616		increases expression	ISO	3	118,334,338	118,467,517	RGD:6480464	CTD
G	Rora	RAR-related orphan receptor A		multiple interactions	ISO	8	73,052,282	73,817,764	RGD:6480464	CTD
G	Rora	RAR-related orphan receptor A		decreases expression	ISO	8	73,052,282	73,817,764	RGD:6480464	CTD
G	Rps6kb1	ribosomal protein S6 kinase, polypeptide 1		multiple interactions	EXP	10	76,657,024	76,698,088	RGD:6480464	CTD
G	Rps7	ribosomal protein S7		multiple interactions	EXP	6	46,511,961	46,516,825	RGD:6480464	CTD
G	Rps7	ribosomal protein S7		affects expression	EXP	6	46,511,961	46,516,825	RGD:6480464	CTD
G	S100a11	S100 calcium binding protein A11		increases expression	ISO	2	186,620,360	186,621,911	RGD:6480464	CTD
G	Sar1a	SAR1 homolog A (S. cerevisiae)		affects expression	EXP	20	29,048,217	29,060,624	RGD:6480464	CTD
G	Sar1a	SAR1 homolog A (S. cerevisiae)		multiple interactions	EXP	20	29,048,217	29,060,624	RGD:6480464	CTD
G	Sdc3	syndecan 3		decreases expression	ISO	5	149,486,028	149,518,849	RGD:6480464	CTD
G	Selenbp1	selenium binding protein 1		increases expression	ISO	2	189,840,450	189,881,332	RGD:6480464	CTD
G	Serpinb6	serpin peptidase inhibitor, clade B (ovalbumin), member 6		decreases expression	ISO	17	37,316,389	37,335,124	RGD:6480464	CTD
G	Serpine1	serpin peptidase inhibitor, clade E (nexin, plasminogen activator inhibitor type 1), member 1		multiple interactions	ISO	12	20,931,996	20,942,374	RGD:6480464	CTD
G	Shbg	sex hormone binding globulin		multiple interactions	ISO	10	56,432,474	56,435,654	RGD:6480464	CTD
G	Shbg	sex hormone binding globulin		multiple interactions	EXP	10	56,432,474	56,435,654	RGD:6480464	CTD
G	Slc2a1	solute carrier family 2 (facilitated glucose transporter), member 1		increases expression	ISO	5	139,690,801	139,719,021	RGD:6480464	CTD
G	Slc45a3	solute carrier family 45, member 3		increases expression	ISO	13	44,840,555	44,861,173	RGD:6480464	CTD
G	Slc45a3	solute carrier family 45, member 3		multiple interactions	ISO	13	44,840,555	44,861,173	RGD:6480464	CTD
G	Smad3	SMAD family member 3		increases expression	ISO	8	67,803,909	67,952,056	RGD:6480464	CTD
G	Smad4	SMAD family member 4		decreases expression	ISO	18	70,432,705	70,461,541	RGD:6480464	CTD
G	Smarca2	SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 2		multiple interactions	ISO	1	230,015,057	230,183,451	RGD:6480464	CTD
G	Smarca4	SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 4		multiple interactions	ISO	8	20,720,915	20,812,157	RGD:6480464	CTD
G	Sms	spermine synthase		increases expression	ISO	X	58,816,210	58,870,980	RGD:6480464	CTD
G	Snai1	snail homolog 1 (Drosophila)		increases expression	ISO	3	158,676,980	158,681,471	RGD:6480464	CTD
G	Snai2	snail homolog 2 (Drosophila)		increases expression	ISO				RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		decreases activity	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	EXP	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Sod2	superoxide dismutase 2, mitochondrial		multiple interactions	ISO	1	41,862,997	41,870,327	RGD:6480464	CTD
G	Spa17	sperm autoantigenic protein 17		increases expression	ISO	8	38,843,007	38,852,080	RGD:6480464	CTD
G	Spp1	secreted phosphoprotein 1		increases expression	ISO				RGD:6480464	CTD
G	Spp1	secreted phosphoprotein 1		increases expression	ISO				RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		multiple interactions	ISO	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		multiple interactions	ISO	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		increases activity	ISO	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Src	v-src sarcoma (Schmidt-Ruppin A-2) viral oncogene homolog (avian)		multiple interactions	EXP	3	148,157,256	148,170,524	RGD:6480464	CTD
G	Srd5a1	steroid-5-alpha-reductase, alpha polypeptide 1 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 1)		affects expression	EXP	17	3,845,190	3,879,165	RGD:6480464	CTD
G	Srd5a2	steroid-5-alpha-reductase, alpha polypeptide 2 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 2)		multiple interactions	ISO	6	21,453,521	21,489,408	RGD:6480464	CTD
G	Srd5a2	steroid-5-alpha-reductase, alpha polypeptide 2 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 2)		increases expression	ISO	6	21,453,521	21,489,408	RGD:6480464	CTD
G	Srd5a2	steroid-5-alpha-reductase, alpha polypeptide 2 (3-oxo-5 alpha-steroid delta 4-dehydrogenase alpha 2)		increases expression	EXP	6	21,453,521	21,489,408	RGD:6480464	CTD
G	Srebf1	sterol regulatory element binding transcription factor 1		increases expression	ISO	10	46,461,684	46,483,646	RGD:6480464	CTD
G	Srebf2	sterol regulatory element binding transcription factor 2		increases expression	ISO	7	120,522,511	120,580,212	RGD:6480464	CTD
G	Srebf2	sterol regulatory element binding transcription factor 2		increases expression	ISO	7	120,522,511	120,580,212	RGD:6480464	CTD
G	Ssrp1	structure specific recognition protein 1		increases expression	ISO	3	68,272,947	68,282,596	RGD:6480464	CTD
G	Star	steroidogenic acute regulatory protein		decreases expression	ISO	16	70,642,580	70,647,203	RGD:6480464	CTD
G	Stk39	serine threonine kinase 39		increases expression	ISO	3	50,249,626	50,517,085	RGD:6480464	CTD
G	Stk39	serine threonine kinase 39		multiple interactions	ISO	3	50,249,626	50,517,085	RGD:6480464	CTD
G	Stx2	syntaxin 2		decreases expression	ISO	12	28,751,591	28,773,351	RGD:6480464	CTD
G	Tgfb1	transforming growth factor, beta 1		increases expression	ISO	1	80,894,705	80,911,020	RGD:6480464	CTD
G	Thbs1	thrombospondin 1		increases expression	ISO				RGD:6480464	CTD
G	Thoc4	THO complex 4		increases expression	ISO	10	109,984,500	109,988,263	RGD:6480464	CTD
G	Tlr4	toll-like receptor 4		multiple interactions	ISO	5	83,564,100	83,577,735	RGD:6480464	CTD
G	Tmprss2	transmembrane protease, serine 2		multiple interactions	ISO	11	37,577,051	37,617,258	RGD:6480464	CTD
G	Tmprss2	transmembrane protease, serine 2		decreases expression	ISO	11	37,577,051	37,617,258	RGD:6480464	CTD
G	Tmprss2	transmembrane protease, serine 2		increases expression	ISO	11	37,577,051	37,617,258	RGD:6480464	CTD
G	Tmsb4x	thymosin beta 4, X-linked		multiple interactions	ISO				RGD:6480464	CTD
G	Tmsb4x	thymosin beta 4, X-linked		decreases expression	ISO				RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		increases response to substance	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnf	tumor necrosis factor		multiple interactions	ISO	20	3,661,000	3,663,618	RGD:6480464	CTD
G	Tnfrsf11b	tumor necrosis factor receptor superfamily, member 11b		decreases expression	ISO	7	90,606,424	90,634,431	RGD:6480464	CTD
G	Tnfrsf11b	tumor necrosis factor receptor superfamily, member 11b		multiple interactions	ISO	7	90,606,424	90,634,431	RGD:6480464	CTD
G	Tob1	transducer of ErbB-2.1		decreases expression	ISO	10	82,852,405	82,854,443	RGD:6480464	CTD
G	Top2b	topoisomerase (DNA) II beta		multiple interactions	ISO				RGD:6480464	CTD
G	Tpo	thyroid peroxidase		increases expression	ISO	6	47,954,848	48,025,740	RGD:6480464	CTD
G	Trap1	TNF receptor-associated protein 1		increases expression	ISO	10	11,728,524	11,762,571	RGD:6480464	CTD
G	Triobp	TRIO and F-actin binding protein		increases expression	ISO	7	116,917,008	116,969,695	RGD:6480464	CTD
G	Tsc2	tuberous sclerosis 2		multiple interactions	EXP	10	13,848,210	13,883,189	RGD:6480464	CTD
G	Tsg101	tumor susceptibility gene 101		decreases expression	ISO	1	97,445,040	97,475,141	RGD:6480464	CTD
G	Tubb4a	tubulin, beta 4A class IVa		increases expression	ISO				RGD:6480464	CTD
G	Ufm1	ubiquitin-fold modifier 1		increases expression	ISO	2	143,057,364	143,064,329	RGD:6480464	CTD
G	Ugt2b15	UDP glucuronosyltransferase 2 family, polypeptide B15		increases expression	ISO	14	22,346,334	22,366,860	RGD:6480464	CTD
G	Ugt2b15	UDP glucuronosyltransferase 2 family, polypeptide B15		increases glucuronidation	ISO	14	22,346,334	22,366,860	RGD:6480464	CTD
G	Ugt2b15	UDP glucuronosyltransferase 2 family, polypeptide B15		multiple interactions	ISO	14	22,346,334	22,366,860	RGD:6480464	CTD
G	Ugt2b17	UDP glucuronosyltransferase 2 family, polypeptide B17		increases metabolic processing	ISO	14	22,639,182	22,650,931	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		increases glucuronidation	ISO	14	22,454,256	22,493,510	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		multiple interactions	ISO	14	22,454,256	22,493,510	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		increases expression	ISO	14	22,454,256	22,493,510	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		increases glucuronidation	ISO	14	22,454,256	22,493,510	RGD:6480464	CTD
G	Ugt2b35	UDP glucuronosyltransferase 2 family, polypeptide B35		increases glucuronidation	ISO	14	22,454,256	22,493,510	RGD:6480464	CTD
G	Vasp	vasodilator-stimulated phosphoprotein		multiple interactions	ISO	1	78,621,494	78,636,762	RGD:6480464	CTD
G	Vcam1	vascular cell adhesion molecule 1		multiple interactions	ISO	2	212,277,654	212,297,376	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		multiple interactions	EXP	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Vegfa	vascular endothelial growth factor A		increases expression	ISO	9	10,520,730	10,536,071	RGD:6480464	CTD
G	Wbscr28	Williams-Beuren syndrome chromosome region 28		decreases expression	ISO	12	22,858,647	22,863,206	RGD:6480464	CTD
G	Ywhah	tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, eta polypeptide		increases expression	ISO	14	83,448,395	83,457,778	RGD:6480464	CTD
G	Zbtb26	zinc finger and BTB domain containing 26		increases expression	ISO	3	17,194,711	17,204,723	RGD:6480464	CTD
G	Zfhx3	zinc finger homeobox 3		decreases expression	ISO	19	38,547,428	38,783,613	RGD:6480464	CTD

Term paths to the root

Path 1
Term	Annotations
CHEBI ontology	492507
role	482196
biological role	480389
molecular messenger	58033
hormone	42084
steroid hormone	34097
androgen	5254
17beta-hydroxy-5alpha-androstan-3-one	567
Path 2
Term	Annotations
CHEBI ontology	492507
subatomic particle	491470
composite particle	491470
hadron	491470
baryon	491470
nucleon	491470
atomic nucleus	491470
atom	491470
main group element atom	461139
p-block element atom	458635
carbon group element atom	410624
carbon atom	407181
organic molecular entity	407174
organic group	167657
organic divalent group	166492
organodiyl group	166492
carbonyl group	166182
carbonyl compound	166182
ketone	31427
oxo steroid	13479
3-oxo steroid	11984
17beta-hydroxy-5alpha-androstan-3-one	567